Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Hafnium(IV) chloride, 98+% (metals basis excluding Zr), Zr <2.7%
CAS: 13499-05-3 Molecular Formula: Cl4Hf Molecular Weight (g/mol): 320.29 MDL Number: MFCD00011034 InChI Key: PDPJQWYGJJBYLF-UHFFFAOYSA-J Synonym: hafnium tetrachloride,hafnium iv chloride,hafnium chloride hfcl4 , t-4,hfcl4,hafnium iv chloride,hafnium tetrachloride,hafnium iv chloride, sublimed grade,hafnium iv chloride, purum at,hafnium iv chloride, purified by sublimation trace metals basis PubChem CID: 37715 IUPAC Name: tetrachlorohafnium SMILES: Cl[Hf](Cl)(Cl)Cl
| PubChem CID | 37715 |
|---|---|
| CAS | 13499-05-3 |
| Molecular Weight (g/mol) | 320.29 |
| MDL Number | MFCD00011034 |
| SMILES | Cl[Hf](Cl)(Cl)Cl |
| Synonym | hafnium tetrachloride,hafnium iv chloride,hafnium chloride hfcl4 , t-4,hfcl4,hafnium iv chloride,hafnium tetrachloride,hafnium iv chloride, sublimed grade,hafnium iv chloride, purum at,hafnium iv chloride, purified by sublimation trace metals basis |
| IUPAC Name | tetrachlorohafnium |
| InChI Key | PDPJQWYGJJBYLF-UHFFFAOYSA-J |
| Molecular Formula | Cl4Hf |
Silver oxide, 99%+, MilliporeSigma™
CAS: 20667-12-3 Molecular Formula: Ag2O Molecular Weight (g/mol): 231.74 MDL Number: MFCD00003404 InChI Key: KHJDQHIZCZTCAE-UHFFFAOYSA-N IUPAC Name: (argentiooxy)silver SMILES: [Ag]O[Ag]
| CAS | 20667-12-3 |
|---|---|
| Molecular Weight (g/mol) | 231.74 |
| MDL Number | MFCD00003404 |
| SMILES | [Ag]O[Ag] |
| IUPAC Name | (argentiooxy)silver |
| InChI Key | KHJDQHIZCZTCAE-UHFFFAOYSA-N |
| Molecular Formula | Ag2O |
Copper(II) trifluoroacetate hydrate
CAS: 123333-88-0 Molecular Formula: C4CuF6O4 Molecular Weight (g/mol): 289.58 MDL Number: MFCD00013200 InChI Key: JIDMEYQIXXJQCC-UHFFFAOYSA-L Synonym: copper ii trifluoroacetate hydrate,289.58 anhydrous,2c2hf3o2.cu.xh2o,2,2,2-trifluoroacetyl oxy cuprio 2,2,2-trifluoroacetate hydrate PubChem CID: 71311159 SMILES: [Cu++].[O-]C(=O)C(F)(F)F.[O-]C(=O)C(F)(F)F
| PubChem CID | 71311159 |
|---|---|
| CAS | 123333-88-0 |
| Molecular Weight (g/mol) | 289.58 |
| MDL Number | MFCD00013200 |
| SMILES | [Cu++].[O-]C(=O)C(F)(F)F.[O-]C(=O)C(F)(F)F |
| Synonym | copper ii trifluoroacetate hydrate,289.58 anhydrous,2c2hf3o2.cu.xh2o,2,2,2-trifluoroacetyl oxy cuprio 2,2,2-trifluoroacetate hydrate |
| InChI Key | JIDMEYQIXXJQCC-UHFFFAOYSA-L |
| Molecular Formula | C4CuF6O4 |
Hexaamminecobalt(III) chloride, 97%
CAS: 10534-89-1 Molecular Formula: [Co(NH3)6]Cl3 MDL Number: MFCD00036304
| CAS | 10534-89-1 |
|---|---|
| MDL Number | MFCD00036304 |
| Molecular Formula | [Co(NH3)6]Cl3 |
Barium zirconium oxide, 99% (metals basis), Thermo Scientific Chemicals
CAS: 12009-21-1 Molecular Formula: BaO3Zr Molecular Weight (g/mol): 276.548 MDL Number: MFCD00014189 InChI Key: DQBAOWPVHRWLJC-UHFFFAOYSA-N Synonym: barium zirconate,barium 2+ oxozirconiumbis olate,ba.o3zr,barium 2+ ;dioxido oxo zirconium,barium zirconate, powder, <10 mum,barium zirconate, nanopowder, <50 nm particle size trace metals basis PubChem CID: 16212444 IUPAC Name: barium(2+);dioxido(oxo)zirconium SMILES: [O-][Zr](=O)[O-].[Ba+2]
| PubChem CID | 16212444 |
|---|---|
| CAS | 12009-21-1 |
| Molecular Weight (g/mol) | 276.548 |
| MDL Number | MFCD00014189 |
| SMILES | [O-][Zr](=O)[O-].[Ba+2] |
| Synonym | barium zirconate,barium 2+ oxozirconiumbis olate,ba.o3zr,barium 2+ ;dioxido oxo zirconium,barium zirconate, powder, <10 mum,barium zirconate, nanopowder, <50 nm particle size trace metals basis |
| IUPAC Name | barium(2+);dioxido(oxo)zirconium |
| InChI Key | DQBAOWPVHRWLJC-UHFFFAOYSA-N |
| Molecular Formula | BaO3Zr |
| CAS | 10361-84-9 |
|---|---|
| MDL Number | MFCD00011221 |
Zirconium(IV) n-propoxide, 70% w/w in n-propanol, Thermo Scientific Chemicals
CAS: 23519-77-9 Molecular Formula: C12H28O4Zr Molecular Weight (g/mol): 327.58 MDL Number: MFCD00015307 InChI Key: XPGAWFIWCWKDDL-UHFFFAOYSA-N Synonym: zirconium iv tetrapropoxide,zirconium iv propoxide,unii-a7z4n4e80x,1-propanol, zirconium 4+ salt,zirconium propoxide,zirconium n-propoxide,1-propanol, zirconium 4+ salt 4:1,zirconium iv propoxide solution,zirconium tetrapropanolate,propyl alcohol, zirconium 4+ salt PubChem CID: 90139 SMILES: CCCO[Zr](OCCC)(OCCC)OCCC
| PubChem CID | 90139 |
|---|---|
| CAS | 23519-77-9 |
| Molecular Weight (g/mol) | 327.58 |
| MDL Number | MFCD00015307 |
| SMILES | CCCO[Zr](OCCC)(OCCC)OCCC |
| Synonym | zirconium iv tetrapropoxide,zirconium iv propoxide,unii-a7z4n4e80x,1-propanol, zirconium 4+ salt,zirconium propoxide,zirconium n-propoxide,1-propanol, zirconium 4+ salt 4:1,zirconium iv propoxide solution,zirconium tetrapropanolate,propyl alcohol, zirconium 4+ salt |
| InChI Key | XPGAWFIWCWKDDL-UHFFFAOYSA-N |
| Molecular Formula | C12H28O4Zr |
Molybdic acid, ACS, MoO{3} 85% min
CAS: 7782-91-4 Molecular Formula: H2MoO4 Molecular Weight (g/mol): 161.96 MDL Number: MFCD00036287 InChI Key: VLAPMBHFAWRUQP-UHFFFAOYSA-L Synonym: molybdic acid,molybdic vi acid,unii-i96n991j1n,dihydroxy dioxo molybdenum,molybdic acid acs,dihydroxy-dioxomolybdenum,molybdate moo42-, dihydrogen, t-4,dihydroxidodioxidomolybdenum,aronis24112,moo2 oh 2 PubChem CID: 82208 ChEBI: CHEBI:25371 IUPAC Name: dihydroxy(dioxo)molybdenum SMILES: O[Mo](O)(=O)=O
| PubChem CID | 82208 |
|---|---|
| CAS | 7782-91-4 |
| Molecular Weight (g/mol) | 161.96 |
| ChEBI | CHEBI:25371 |
| MDL Number | MFCD00036287 |
| SMILES | O[Mo](O)(=O)=O |
| Synonym | molybdic acid,molybdic vi acid,unii-i96n991j1n,dihydroxy dioxo molybdenum,molybdic acid acs,dihydroxy-dioxomolybdenum,molybdate moo42-, dihydrogen, t-4,dihydroxidodioxidomolybdenum,aronis24112,moo2 oh 2 |
| IUPAC Name | dihydroxy(dioxo)molybdenum |
| InChI Key | VLAPMBHFAWRUQP-UHFFFAOYSA-L |
| Molecular Formula | H2MoO4 |
Titanium carbide, 99.5% (metals basis)
CAS: 12070-08-5 Molecular Formula: CTi Molecular Weight (g/mol): 59.88 MDL Number: MFCD00011268 InChI Key: YXIVWSJCLXKLJL-UHFFFAOYSA-N IUPAC Name: methanidylidynetitaniumylium SMILES: [C-]#[Ti+]
| CAS | 12070-08-5 |
|---|---|
| Molecular Weight (g/mol) | 59.88 |
| MDL Number | MFCD00011268 |
| SMILES | [C-]#[Ti+] |
| IUPAC Name | methanidylidynetitaniumylium |
| InChI Key | YXIVWSJCLXKLJL-UHFFFAOYSA-N |
| Molecular Formula | CTi |
Tantalum(V) ethoxide, optical grade, 99.95% (metal basis)
CAS: 6074-84-6 Molecular Formula: C10H25O5Ta Molecular Weight (g/mol): 406.25 MDL Number: MFCD00049785 InChI Key: HSXKFDGTKKAEHL-UHFFFAOYSA-N Synonym: tantalum v ethoxide,tantalum 5+ ethanolate,tantalum ethoxide,tantalum 5+ pentaethanolate,ethanol, tantalum 5+ salt,pentaethoxytantalum v,ethanol, tantalum 5+ salt 5:1,tantalum ethylate,pentaethyl tantalate,tantalum pentaethoxide PubChem CID: 160806 IUPAC Name: ethanolate;tantalum(5+) SMILES: CCO[Ta](OCC)(OCC)(OCC)OCC
| PubChem CID | 160806 |
|---|---|
| CAS | 6074-84-6 |
| Molecular Weight (g/mol) | 406.25 |
| MDL Number | MFCD00049785 |
| SMILES | CCO[Ta](OCC)(OCC)(OCC)OCC |
| Synonym | tantalum v ethoxide,tantalum 5+ ethanolate,tantalum ethoxide,tantalum 5+ pentaethanolate,ethanol, tantalum 5+ salt,pentaethoxytantalum v,ethanol, tantalum 5+ salt 5:1,tantalum ethylate,pentaethyl tantalate,tantalum pentaethoxide |
| IUPAC Name | ethanolate;tantalum(5+) |
| InChI Key | HSXKFDGTKKAEHL-UHFFFAOYSA-N |
| Molecular Formula | C10H25O5Ta |
Scandium(III) perchlorate, 50% w/w aq. soln., Reagent Grade, Thermo Scientific™
CAS: 14066-05-8 Molecular Formula: Cl3O12Sc Molecular Weight (g/mol): 343.294 MDL Number: MFCD00243289 InChI Key: UBVKRMCXDCYZQK-UHFFFAOYSA-K Synonym: scandium perchlorate,scandium 3+ perchlorate,acmc-20ajr3,scandium 3+ ion triperchlorate,trihyperchloric acid scandium salt,scandium iii perchlorate solution,scandium 3+ triperchlorate PubChem CID: 11013318 IUPAC Name: scandium(3+);triperchlorate SMILES: [O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[Sc+3]
| PubChem CID | 11013318 |
|---|---|
| CAS | 14066-05-8 |
| Molecular Weight (g/mol) | 343.294 |
| MDL Number | MFCD00243289 |
| SMILES | [O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[Sc+3] |
| Synonym | scandium perchlorate,scandium 3+ perchlorate,acmc-20ajr3,scandium 3+ ion triperchlorate,trihyperchloric acid scandium salt,scandium iii perchlorate solution,scandium 3+ triperchlorate |
| IUPAC Name | scandium(3+);triperchlorate |
| InChI Key | UBVKRMCXDCYZQK-UHFFFAOYSA-K |
| Molecular Formula | Cl3O12Sc |
Mercury(II) telluride, 99% (metals basis), Thermo Scientific Chemicals
CAS: 12068-90-5 Molecular Formula: HgTe Molecular Weight (g/mol): 328.19 MDL Number: MFCD00016133 InChI Key: VCEXCCILEWFFBG-UHFFFAOYSA-N Synonym: mercury telluride,mercury ii telluride,mercuric telluride,quecksilbertellurid,mercurous telluride,mercury ii telluride trace metals basis 5g PubChem CID: 82914 IUPAC Name: tellanylidenemercury SMILES: [Te]=[Hg]
| PubChem CID | 82914 |
|---|---|
| CAS | 12068-90-5 |
| Molecular Weight (g/mol) | 328.19 |
| MDL Number | MFCD00016133 |
| SMILES | [Te]=[Hg] |
| Synonym | mercury telluride,mercury ii telluride,mercuric telluride,quecksilbertellurid,mercurous telluride,mercury ii telluride trace metals basis 5g |
| IUPAC Name | tellanylidenemercury |
| InChI Key | VCEXCCILEWFFBG-UHFFFAOYSA-N |
| Molecular Formula | HgTe |
Vanadium(V) trichloride oxide, V+5 28.5% min
CAS: 7727-18-6 Molecular Formula: Cl3OV Molecular Weight (g/mol): 173.29 MDL Number: MFCD00011459 InChI Key: WMZFXRASJAIALG-UHFFFAOYSA-K Synonym: vanadyl trichloride,trichlorooxovanadium,vanadium v trichloride oxide,trichlorooxovanadium oxide,vanadium v oxytrichloride,trichlorooxo vanadium,vanadium, trichlorooxo-, t-4,vanadium, trichlorooxo,vanadium oxide trichloride,vanadium trichloride oxide PubChem CID: 24410 IUPAC Name: oxovanadium;trihydrochloride SMILES: [Cl-].[Cl-].[Cl-].O=[V+5]
| PubChem CID | 24410 |
|---|---|
| CAS | 7727-18-6 |
| Molecular Weight (g/mol) | 173.29 |
| MDL Number | MFCD00011459 |
| SMILES | [Cl-].[Cl-].[Cl-].O=[V+5] |
| Synonym | vanadyl trichloride,trichlorooxovanadium,vanadium v trichloride oxide,trichlorooxovanadium oxide,vanadium v oxytrichloride,trichlorooxo vanadium,vanadium, trichlorooxo-, t-4,vanadium, trichlorooxo,vanadium oxide trichloride,vanadium trichloride oxide |
| IUPAC Name | oxovanadium;trihydrochloride |
| InChI Key | WMZFXRASJAIALG-UHFFFAOYSA-K |
| Molecular Formula | Cl3OV |
Iron(II) sulfide, tech.
CAS: 1317-37-9 Molecular Formula: FeS Molecular Weight (g/mol): 87.91 MDL Number: MFCD00011013 InChI Key: GNVXPFBEZCSHQZ-UHFFFAOYSA-N Synonym: ferrous sulfide,iron ii sulfide,iron sulfide,troilite,iron sulfuret,iron sulphide,iron monosulfide,iron protosulfide,ferrous monosulfide PubChem CID: 14828 SMILES: [S--].[Fe++]
| PubChem CID | 14828 |
|---|---|
| CAS | 1317-37-9 |
| Molecular Weight (g/mol) | 87.91 |
| MDL Number | MFCD00011013 |
| SMILES | [S--].[Fe++] |
| Synonym | ferrous sulfide,iron ii sulfide,iron sulfide,troilite,iron sulfuret,iron sulphide,iron monosulfide,iron protosulfide,ferrous monosulfide |
| InChI Key | GNVXPFBEZCSHQZ-UHFFFAOYSA-N |
| Molecular Formula | FeS |
Cobalt(II,III) oxide
CAS: 1308-06-1 Molecular Formula: Co3O4 Molecular Weight (g/mol): 240.80 MDL Number: MFCD00010939 InChI Key: UBEWDCMIDFGDOO-UHFFFAOYSA-N Synonym: oxocobalt; oxo oxocobaltiooxy cobalt,cobalt ii oxide; cobalt iii oxide,cobalt ii,coo.co2o3,aronis24129,cobaltic tetraoxide,,cobalt ii,iii oxide, powder, <10 mum,cobalt ii oxide; oxo oxocobaltio oxy cobalt,cobalt ii,iii oxide metals basis , 2-6 micron powder,oxidanylidenecobalt; oxidanylidene oxidanylidenecobaltiooxy cobalt PubChem CID: 11651651 IUPAC Name: oxocobalt;oxo(oxocobaltiooxy)cobalt SMILES: [O--].[O--].[O--].[O--].[Co++].[Co+3].[Co+3]
| PubChem CID | 11651651 |
|---|---|
| CAS | 1308-06-1 |
| Molecular Weight (g/mol) | 240.80 |
| MDL Number | MFCD00010939 |
| SMILES | [O--].[O--].[O--].[O--].[Co++].[Co+3].[Co+3] |
| Synonym | oxocobalt; oxo oxocobaltiooxy cobalt,cobalt ii oxide; cobalt iii oxide,cobalt ii,coo.co2o3,aronis24129,cobaltic tetraoxide,,cobalt ii,iii oxide, powder, <10 mum,cobalt ii oxide; oxo oxocobaltio oxy cobalt,cobalt ii,iii oxide metals basis , 2-6 micron powder,oxidanylidenecobalt; oxidanylidene oxidanylidenecobaltiooxy cobalt |
| IUPAC Name | oxocobalt;oxo(oxocobaltiooxy)cobalt |
| InChI Key | UBEWDCMIDFGDOO-UHFFFAOYSA-N |
| Molecular Formula | Co3O4 |