Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Niobium(V) oxide, 99.9% (metals basis)
CAS: 1313-96-8 Molecular Formula: Nb2O5 Molecular Weight (g/mol): 265.81 MDL Number: MFCD00011128 InChI Key: ZKATWMILCYLAPD-UHFFFAOYSA-N Synonym: niobium oxide,niobium v oxide,niobium pentoxide,diniobium pentaoxide,niobia,niobium pentaoxide,diniobium pentoxide,niobium 5+ oxide,nobum oxde PubChem CID: 123105 IUPAC Name: dioxoniobiooxy(dioxo)niobium SMILES: O=[Nb](=O)O[Nb](=O)=O
| PubChem CID | 123105 |
|---|---|
| CAS | 1313-96-8 |
| Molecular Weight (g/mol) | 265.81 |
| MDL Number | MFCD00011128 |
| SMILES | O=[Nb](=O)O[Nb](=O)=O |
| Synonym | niobium oxide,niobium v oxide,niobium pentoxide,diniobium pentaoxide,niobia,niobium pentaoxide,diniobium pentoxide,niobium 5+ oxide,nobum oxde |
| IUPAC Name | dioxoniobiooxy(dioxo)niobium |
| InChI Key | ZKATWMILCYLAPD-UHFFFAOYSA-N |
| Molecular Formula | Nb2O5 |
Ruthenium(III) nitrosyl nitrate, in diluted aq. nitric acid solution
CAS: 34513-98-9 Molecular Formula: N4O10Ru Molecular Weight (g/mol): 317.09 MDL Number: MFCD00016313
| CAS | 34513-98-9 |
|---|---|
| Molecular Weight (g/mol) | 317.09 |
| MDL Number | MFCD00016313 |
| Molecular Formula | N4O10Ru |
Tantalum(V) ethoxide, 99+%
CAS: 6074-84-6 Molecular Formula: C10H25O5Ta Molecular Weight (g/mol): 406.25 MDL Number: MFCD00049785 InChI Key: HSXKFDGTKKAEHL-UHFFFAOYSA-N Synonym: tantalum v ethoxide,tantalum 5+ ethanolate,tantalum ethoxide,tantalum 5+ pentaethanolate,ethanol, tantalum 5+ salt,pentaethoxytantalum v,ethanol, tantalum 5+ salt 5:1,tantalum ethylate,pentaethyl tantalate,tantalum pentaethoxide PubChem CID: 160806 SMILES: CCO[Ta](OCC)(OCC)(OCC)OCC
| PubChem CID | 160806 |
|---|---|
| CAS | 6074-84-6 |
| Molecular Weight (g/mol) | 406.25 |
| MDL Number | MFCD00049785 |
| SMILES | CCO[Ta](OCC)(OCC)(OCC)OCC |
| Synonym | tantalum v ethoxide,tantalum 5+ ethanolate,tantalum ethoxide,tantalum 5+ pentaethanolate,ethanol, tantalum 5+ salt,pentaethoxytantalum v,ethanol, tantalum 5+ salt 5:1,tantalum ethylate,pentaethyl tantalate,tantalum pentaethoxide |
| InChI Key | HSXKFDGTKKAEHL-UHFFFAOYSA-N |
| Molecular Formula | C10H25O5Ta |
Chromium(VI) Oxide, For Analysis, EMSURE™, MilliporeSigma™
CAS: 1333-82-0 Molecular Formula: CrO3 Molecular Weight (g/mol): 99.99 MDL Number: MFCD00010952 InChI Key: WGLPBDUCMAPZCE-UHFFFAOYSA-N Synonym: chromium trioxide,chromium vi oxide,monochromium trioxide,chromtrioxid,chromic trioxide,chromsaeureanhydrid,anhydride chromique,chromium 6+ oxide,chromium vi trioxide,chromium oxide PubChem CID: 14915 ChEBI: CHEBI:48240 IUPAC Name: trioxochromium SMILES: O=[Cr](=O)=O
| PubChem CID | 14915 |
|---|---|
| CAS | 1333-82-0 |
| Molecular Weight (g/mol) | 99.99 |
| ChEBI | CHEBI:48240 |
| MDL Number | MFCD00010952 |
| SMILES | O=[Cr](=O)=O |
| Synonym | chromium trioxide,chromium vi oxide,monochromium trioxide,chromtrioxid,chromic trioxide,chromsaeureanhydrid,anhydride chromique,chromium 6+ oxide,chromium vi trioxide,chromium oxide |
| IUPAC Name | trioxochromium |
| InChI Key | WGLPBDUCMAPZCE-UHFFFAOYSA-N |
| Molecular Formula | CrO3 |
Iron(III) chloride hexahydrate, MilliporeSigma™
CAS: 10025-77-1 Molecular Formula: Cl3FeH12O6 Molecular Weight (g/mol): 270.29 MDL Number: MFCD00149712 InChI Key: NQXWGWZJXJUMQB-UHFFFAOYSA-K Synonym: Ferric chloride hexahydrate; Iron trichloride IUPAC Name: iron(3+) hexahydrate trichloride SMILES: O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Fe+3]
| CAS | 10025-77-1 |
|---|---|
| Molecular Weight (g/mol) | 270.29 |
| MDL Number | MFCD00149712 |
| SMILES | O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Fe+3] |
| Synonym | Ferric chloride hexahydrate; Iron trichloride |
| IUPAC Name | iron(3+) hexahydrate trichloride |
| InChI Key | NQXWGWZJXJUMQB-UHFFFAOYSA-K |
| Molecular Formula | Cl3FeH12O6 |
Platinum(IV) bromide, 99.99% (metals basis), Pt 37.1% min, Thermo Scientific Chemicals
CAS: 68938-92-1 Molecular Formula: Br4Pt Molecular Weight (g/mol): 514.70 MDL Number: MFCD00016289 InChI Key: DYFRBYUUSCNRBP-UHFFFAOYSA-J Synonym: platinum tetrabromide,platinum iv bromide,platinum 4+ tetrabromide IUPAC Name: tetrabromoplatinumtetrakis(ylium) SMILES: Br[Pt+4](Br)(Br)Br
| CAS | 68938-92-1 |
|---|---|
| Molecular Weight (g/mol) | 514.70 |
| MDL Number | MFCD00016289 |
| SMILES | Br[Pt+4](Br)(Br)Br |
| Synonym | platinum tetrabromide,platinum iv bromide,platinum 4+ tetrabromide |
| IUPAC Name | tetrabromoplatinumtetrakis(ylium) |
| InChI Key | DYFRBYUUSCNRBP-UHFFFAOYSA-J |
| Molecular Formula | Br4Pt |
Niobium(V) chloride, 99.9% (metals basis)
CAS: 10026-12-7 Molecular Formula: Cl5Nb Molecular Weight (g/mol): 270.156 MDL Number: MFCD00011127 InChI Key: YHBDIEWMOMLKOO-UHFFFAOYSA-I Synonym: niobium v chloride,niobium pentachloride,niobium chloride nbcl5,nbcl5,columbium pentachloride,niobium v chloride, puratronic,niobium v chloride trace metals basis,niobium v chloride-nb 20-200ppm ta puratrem PubChem CID: 24818 IUPAC Name: pentachloroniobium SMILES: Cl[Nb](Cl)(Cl)(Cl)Cl
| PubChem CID | 24818 |
|---|---|
| CAS | 10026-12-7 |
| Molecular Weight (g/mol) | 270.156 |
| MDL Number | MFCD00011127 |
| SMILES | Cl[Nb](Cl)(Cl)(Cl)Cl |
| Synonym | niobium v chloride,niobium pentachloride,niobium chloride nbcl5,nbcl5,columbium pentachloride,niobium v chloride, puratronic,niobium v chloride trace metals basis,niobium v chloride-nb 20-200ppm ta puratrem |
| IUPAC Name | pentachloroniobium |
| InChI Key | YHBDIEWMOMLKOO-UHFFFAOYSA-I |
| Molecular Formula | Cl5Nb |
Platinum(IV) oxide monohydrate, 99.8%, (trace metal basis)
CAS: 12137-21-2 Molecular Formula: H2O3Pt Molecular Weight (g/mol): 245.10 MDL Number: MFCD00066964 InChI Key: SPGAMGILENUIOF-UHFFFAOYSA-N Synonym: dioxoplatinum hydrate,platinum iv oxide monohydrate,platinum dioxide hydrate,platinum iv oxide hydrate,platinoxydhydrat,acmc-1bujp,platinum 1v oxide hydrate,pto2 h2o PubChem CID: 11139377 SMILES: O.O=[Pt]=O
| PubChem CID | 11139377 |
|---|---|
| CAS | 12137-21-2 |
| Molecular Weight (g/mol) | 245.10 |
| MDL Number | MFCD00066964 |
| SMILES | O.O=[Pt]=O |
| Synonym | dioxoplatinum hydrate,platinum iv oxide monohydrate,platinum dioxide hydrate,platinum iv oxide hydrate,platinoxydhydrat,acmc-1bujp,platinum 1v oxide hydrate,pto2 h2o |
| InChI Key | SPGAMGILENUIOF-UHFFFAOYSA-N |
| Molecular Formula | H2O3Pt |
Copper Oxide Wire, ACS Grade, 0.65 x 3mm, For Elementary Analysis, MilliporeSigma™
CAS: 1317-38-0 Molecular Formula: CuO Molecular Weight (g/mol): 79.55 MDL Number: MFCD00010979 InChI Key: KKCXRELNMOYFLS-UHFFFAOYSA-N Synonym: cupric oxide,copper ii oxide,copper oxide,copper monoxide,banacobru ol,chrome brown,copper brown,copper monooxide,black copper oxide PubChem CID: 14829 IUPAC Name: copper(2+) oxidandiide SMILES: [O--].[Cu++]
| PubChem CID | 14829 |
|---|---|
| CAS | 1317-38-0 |
| Molecular Weight (g/mol) | 79.55 |
| MDL Number | MFCD00010979 |
| SMILES | [O--].[Cu++] |
| Synonym | cupric oxide,copper ii oxide,copper oxide,copper monoxide,banacobru ol,chrome brown,copper brown,copper monooxide,black copper oxide |
| IUPAC Name | copper(2+) oxidandiide |
| InChI Key | KKCXRELNMOYFLS-UHFFFAOYSA-N |
| Molecular Formula | CuO |
Tungsten(VI) chloride, 99.9+%, (trace metal basis)
CAS: 13283-01-7 Molecular Formula: Cl6W Molecular Weight (g/mol): 396.57 MDL Number: MFCD00011463 InChI Key: KPGXUAIFQMJJFB-UHFFFAOYSA-H Synonym: tungsten vi chloride,tungsten hexachloride,wolfram hexachloride,wcl6,tungsten chloride wcl6 , oc-6-11,tungsten chloride, oc-6-11,tungsten chloride 8ci,tungsten 6+ hexachloride,wolframhexachlorid,hexachloridotungsten PubChem CID: 83301 ChEBI: CHEBI:37771 IUPAC Name: hexachlorotungsten SMILES: Cl[W](Cl)(Cl)(Cl)(Cl)Cl
| PubChem CID | 83301 |
|---|---|
| CAS | 13283-01-7 |
| Molecular Weight (g/mol) | 396.57 |
| ChEBI | CHEBI:37771 |
| MDL Number | MFCD00011463 |
| SMILES | Cl[W](Cl)(Cl)(Cl)(Cl)Cl |
| Synonym | tungsten vi chloride,tungsten hexachloride,wolfram hexachloride,wcl6,tungsten chloride wcl6 , oc-6-11,tungsten chloride, oc-6-11,tungsten chloride 8ci,tungsten 6+ hexachloride,wolframhexachlorid,hexachloridotungsten |
| IUPAC Name | hexachlorotungsten |
| InChI Key | KPGXUAIFQMJJFB-UHFFFAOYSA-H |
| Molecular Formula | Cl6W |
Zirconium dinitrate oxide hydrate, 99.9% (metals basis), Thermo Scientific Chemicals
CAS: 14985-18-3 Molecular Formula: N2O7Zr Molecular Weight (g/mol): 231.23 MDL Number: MFCD00149896 InChI Key: JWBWFTANBHYHBC-UHFFFAOYSA-N Synonym: zirconium dinitrate oxide hydrate,zirconyl nitrate hydrate,zirconium iv dinitrate oxide hydrate,oxozirconiumbis ylium hydrate dinitrate,zirconium iv oxynitrate hydrate,zirconium dinitrate oxide hydrate, puratronic,zirconium iv oxynitrate hydrate, technical grade,zirconium iv oxynitrate hydrate trace metals basis PubChem CID: 16211674 SMILES: [O-][N+](=O)O[Zr](=O)O[N+]([O-])=O
| PubChem CID | 16211674 |
|---|---|
| CAS | 14985-18-3 |
| Molecular Weight (g/mol) | 231.23 |
| MDL Number | MFCD00149896 |
| SMILES | [O-][N+](=O)O[Zr](=O)O[N+]([O-])=O |
| Synonym | zirconium dinitrate oxide hydrate,zirconyl nitrate hydrate,zirconium iv dinitrate oxide hydrate,oxozirconiumbis ylium hydrate dinitrate,zirconium iv oxynitrate hydrate,zirconium dinitrate oxide hydrate, puratronic,zirconium iv oxynitrate hydrate, technical grade,zirconium iv oxynitrate hydrate trace metals basis |
| InChI Key | JWBWFTANBHYHBC-UHFFFAOYSA-N |
| Molecular Formula | N2O7Zr |
Platinum(IV) chloride, Premion™, 99.99+% (metals basis), Pt 57% min
CAS: 13454-96-1 Molecular Formula: Cl4Pt Molecular Weight (g/mol): 336.88 MDL Number: MFCD00011182 InChI Key: FBEIPJNQGITEBL-UHFFFAOYSA-J Synonym: platinum tetrachloride,platinum iv chloride,platinum iv tetrachloride,platinum chloride ptcl4,platinum chloride ptcl4 , sp-4-1,platinum chloride ptcl4 6ci,7ci,8ci,platinum iv chloride, premion,ptcl4,platinumchloride ptcl4 PubChem CID: 26031 IUPAC Name: tetrachloroplatinum SMILES: Cl[Pt](Cl)(Cl)Cl
| PubChem CID | 26031 |
|---|---|
| CAS | 13454-96-1 |
| Molecular Weight (g/mol) | 336.88 |
| MDL Number | MFCD00011182 |
| SMILES | Cl[Pt](Cl)(Cl)Cl |
| Synonym | platinum tetrachloride,platinum iv chloride,platinum iv tetrachloride,platinum chloride ptcl4,platinum chloride ptcl4 , sp-4-1,platinum chloride ptcl4 6ci,7ci,8ci,platinum iv chloride, premion,ptcl4,platinumchloride ptcl4 |
| IUPAC Name | tetrachloroplatinum |
| InChI Key | FBEIPJNQGITEBL-UHFFFAOYSA-J |
| Molecular Formula | Cl4Pt |
Molybdenum(VI) oxide, Puratronic™, 99.998% (metals basis excluding W), W 300ppm max
CAS: 1313-27-5 Molecular Formula: MoO3 Molecular Weight (g/mol): 143.95 MDL Number: MFCD00003469 InChI Key: JKQOBWVOAYFWKG-UHFFFAOYSA-N Synonym: molybdenum trioxide,molybdenum vi oxide,molybdic anhydride,molybdic trioxide,molybdena,molybdic oxide,molybdenum oxide,molybdic acid anhydride,molybdenum peroxide PubChem CID: 14802 ChEBI: CHEBI:30627 IUPAC Name: trioxomolybdenum SMILES: O=[Mo](=O)=O
| PubChem CID | 14802 |
|---|---|
| CAS | 1313-27-5 |
| Molecular Weight (g/mol) | 143.95 |
| ChEBI | CHEBI:30627 |
| MDL Number | MFCD00003469 |
| SMILES | O=[Mo](=O)=O |
| Synonym | molybdenum trioxide,molybdenum vi oxide,molybdic anhydride,molybdic trioxide,molybdena,molybdic oxide,molybdenum oxide,molybdic acid anhydride,molybdenum peroxide |
| IUPAC Name | trioxomolybdenum |
| InChI Key | JKQOBWVOAYFWKG-UHFFFAOYSA-N |
| Molecular Formula | MoO3 |
Iron(III) hydroxide, gamma-phase
CAS: 20344-49-4 Molecular Formula: FeHO2 Molecular Weight (g/mol): 88.851 MDL Number: MFCD00064782 InChI Key: AEIXRCIKZIZYPM-UHFFFAOYSA-M Synonym: hydroxy oxo iron,goethite,lepidocrocite,iron hydroxide oxide,goethite fe oh o,iron hydroxide oxide fe oh o,iron iii oxide-hydroxide,ferric acid,iron pigment yellow,ferric hydroxide oxide PubChem CID: 91502 IUPAC Name: hydroxy(oxo)iron SMILES: O[Fe]=O
| PubChem CID | 91502 |
|---|---|
| CAS | 20344-49-4 |
| Molecular Weight (g/mol) | 88.851 |
| MDL Number | MFCD00064782 |
| SMILES | O[Fe]=O |
| Synonym | hydroxy oxo iron,goethite,lepidocrocite,iron hydroxide oxide,goethite fe oh o,iron hydroxide oxide fe oh o,iron iii oxide-hydroxide,ferric acid,iron pigment yellow,ferric hydroxide oxide |
| IUPAC Name | hydroxy(oxo)iron |
| InChI Key | AEIXRCIKZIZYPM-UHFFFAOYSA-M |
| Molecular Formula | FeHO2 |
| CAS | 13520-76-8 |
|---|---|
| MDL Number | MFCD00054136 |
| Molecular Formula | WO2Cl2 |