Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Platinum tubing, 1.57mm (0.0618in) OD, 1.32mm (0.0528in) ID, 99.9% (metals basis)
CAS: 6-4-7440 Molecular Formula: Pt Molecular Weight (g/mol): 195.08 MDL Number: MFCD00011179 InChI Key: BASFCYQUMIYNBI-UHFFFAOYSA-N Synonym: black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion PubChem CID: 23939 ChEBI: CHEBI:33400 IUPAC Name: platinum SMILES: [Pt]
| PubChem CID | 23939 |
|---|---|
| CAS | 6-4-7440 |
| Molecular Weight (g/mol) | 195.08 |
| ChEBI | CHEBI:33400 |
| MDL Number | MFCD00011179 |
| SMILES | [Pt] |
| Synonym | black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion |
| IUPAC Name | platinum |
| InChI Key | BASFCYQUMIYNBI-UHFFFAOYSA-N |
| Molecular Formula | Pt |
Platinum wire, 0.1016mm (0.004in) dia, For ISA Type R or S Standard Grade Thermocouple
CAS: 6-4-7440 Molecular Formula: Pt Molecular Weight (g/mol): 195.08 MDL Number: MFCD00011179 InChI Key: BASFCYQUMIYNBI-UHFFFAOYSA-N Synonym: black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion PubChem CID: 23939 ChEBI: CHEBI:33400 IUPAC Name: platinum SMILES: [Pt]
| PubChem CID | 23939 |
|---|---|
| CAS | 6-4-7440 |
| Molecular Weight (g/mol) | 195.08 |
| ChEBI | CHEBI:33400 |
| MDL Number | MFCD00011179 |
| SMILES | [Pt] |
| Synonym | black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion |
| IUPAC Name | platinum |
| InChI Key | BASFCYQUMIYNBI-UHFFFAOYSA-N |
| Molecular Formula | Pt |
Sodium sulfate, 99+%, for analysis, powder, anhydrous
CAS: 7757-82-6 Molecular Formula: Na2O4S Molecular Weight (g/mol): 142.04 MDL Number: MFCD00003504 InChI Key: PMZURENOXWZQFD-UHFFFAOYSA-L Synonym: sodium sulfate,disodium sulfate,salt cake,thenardite,sodium sulfate anhydrous,sodium sulphate,sodium sulfate, anhydrous,sulfuric acid disodium salt,disodium sulphate,sodium sulfate 2:1 PubChem CID: 24436 ChEBI: CHEBI:32149 SMILES: [Na+].[Na+].[O-]S([O-])(=O)=O
| PubChem CID | 24436 |
|---|---|
| CAS | 7757-82-6 |
| Molecular Weight (g/mol) | 142.04 |
| ChEBI | CHEBI:32149 |
| MDL Number | MFCD00003504 |
| SMILES | [Na+].[Na+].[O-]S([O-])(=O)=O |
| Synonym | sodium sulfate,disodium sulfate,salt cake,thenardite,sodium sulfate anhydrous,sodium sulphate,sodium sulfate, anhydrous,sulfuric acid disodium salt,disodium sulphate,sodium sulfate 2:1 |
| InChI Key | PMZURENOXWZQFD-UHFFFAOYSA-L |
| Molecular Formula | Na2O4S |
Manganese Sulfate, Monohydrate, Reagent, ACS, 98-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 10034-96-5 Molecular Formula: H2MnO5S Molecular Weight (g/mol): 169.01 MDL Number: MFCD00149159 InChI Key: ISPYRSDWRDQNSW-UHFFFAOYSA-L IUPAC Name: manganese(2+) hydrate sulfate SMILES: O.[Mn++].[O-]S([O-])(=O)=O
| CAS | 10034-96-5 |
|---|---|
| Molecular Weight (g/mol) | 169.01 |
| MDL Number | MFCD00149159 |
| SMILES | O.[Mn++].[O-]S([O-])(=O)=O |
| IUPAC Name | manganese(2+) hydrate sulfate |
| InChI Key | ISPYRSDWRDQNSW-UHFFFAOYSA-L |
| Molecular Formula | H2MnO5S |
Tetra-n-butoxysilane, 97%
CAS: 4766-57-8 Molecular Formula: C16H36O4Si Molecular Weight (g/mol): 320.545 MDL Number: MFCD00009432 InChI Key: UQMOLLPKNHFRAC-UHFFFAOYSA-N Synonym: tetrabutyl orthosilicate,tetrabutoxysilane,tetra-n-butoxysilane,silane, tetrabutoxy,silicon tetrabutoxide,butyl silicate buo 4si,silicic acid h4sio4 , tetrabutyl ester,butyl silicate c4h9o 4si,butyl silicate,tetrabutyl orthosilice PubChem CID: 78500 IUPAC Name: tetrabutyl silicate SMILES: CCCCO[Si](OCCCC)(OCCCC)OCCCC
| PubChem CID | 78500 |
|---|---|
| CAS | 4766-57-8 |
| Molecular Weight (g/mol) | 320.545 |
| MDL Number | MFCD00009432 |
| SMILES | CCCCO[Si](OCCCC)(OCCCC)OCCCC |
| Synonym | tetrabutyl orthosilicate,tetrabutoxysilane,tetra-n-butoxysilane,silane, tetrabutoxy,silicon tetrabutoxide,butyl silicate buo 4si,silicic acid h4sio4 , tetrabutyl ester,butyl silicate c4h9o 4si,butyl silicate,tetrabutyl orthosilice |
| IUPAC Name | tetrabutyl silicate |
| InChI Key | UQMOLLPKNHFRAC-UHFFFAOYSA-N |
| Molecular Formula | C16H36O4Si |
Magnesium silicate, activated, for chromatography, 60-100 mesh
CAS: 1343-88-0 Molecular Formula: MgO3Si Molecular Weight (g/mol): 100.39 MDL Number: MFCD00078249 InChI Key: ZADYMNAVLSWLEQ-UHFFFAOYSA-N Synonym: Activated magnesium silicate
| CAS | 1343-88-0 |
|---|---|
| Molecular Weight (g/mol) | 100.39 |
| MDL Number | MFCD00078249 |
| Synonym | Activated magnesium silicate |
| InChI Key | ZADYMNAVLSWLEQ-UHFFFAOYSA-N |
| Molecular Formula | MgO3Si |
Triisopropylsilylacetylene, 97%
CAS: 89343-06-6 Molecular Formula: C11H22Si Molecular Weight (g/mol): 182.382 MDL Number: MFCD00075452 InChI Key: KZGWPHUWNWRTEP-UHFFFAOYSA-N Synonym: triisopropylsilyl acetylene,ethynyltriisopropylsilane,triisopropylsilylacetylene,ethynyltris propan-2-yl silane,ethynyl-tri propan-2-yl silane,silane, ethynyltris 1-methylethyl,triisopropylsilylacetylen,acmc-209qzk,ethynyltriisopropyl-silane PubChem CID: 2734682 IUPAC Name: ethynyl-tri(propan-2-yl)silane SMILES: CC(C)[Si](C#C)(C(C)C)C(C)C
| PubChem CID | 2734682 |
|---|---|
| CAS | 89343-06-6 |
| Molecular Weight (g/mol) | 182.382 |
| MDL Number | MFCD00075452 |
| SMILES | CC(C)[Si](C#C)(C(C)C)C(C)C |
| Synonym | triisopropylsilyl acetylene,ethynyltriisopropylsilane,triisopropylsilylacetylene,ethynyltris propan-2-yl silane,ethynyl-tri propan-2-yl silane,silane, ethynyltris 1-methylethyl,triisopropylsilylacetylen,acmc-209qzk,ethynyltriisopropyl-silane |
| IUPAC Name | ethynyl-tri(propan-2-yl)silane |
| InChI Key | KZGWPHUWNWRTEP-UHFFFAOYSA-N |
| Molecular Formula | C11H22Si |
Tungsten oxide, 99.99% (metals basis)
CAS: 12037-58-0 Molecular Formula: O2W Molecular Weight (g/mol): 215.84 MDL Number: MFCD00049709 InChI Key: DZKDPOPGYFUOGI-UHFFFAOYSA-N IUPAC Name: dioxotungsten SMILES: O=[W]=O
| CAS | 12037-58-0 |
|---|---|
| Molecular Weight (g/mol) | 215.84 |
| MDL Number | MFCD00049709 |
| SMILES | O=[W]=O |
| IUPAC Name | dioxotungsten |
| InChI Key | DZKDPOPGYFUOGI-UHFFFAOYSA-N |
| Molecular Formula | O2W |
Gadolinium(III) bromide hydrate, REacton™, 99.99% (REO), Thermo Scientific Chemicals
CAS: 30010-20-9 Molecular Formula: Br3Gd Molecular Weight (g/mol): 396.96 MDL Number: MFCD00049741 InChI Key: KGOKDPWKDBWITQ-UHFFFAOYSA-K IUPAC Name: gadolinium(3+) tribromide SMILES: [Br-].[Br-].[Br-].[Gd+3]
| CAS | 30010-20-9 |
|---|---|
| Molecular Weight (g/mol) | 396.96 |
| MDL Number | MFCD00049741 |
| SMILES | [Br-].[Br-].[Br-].[Gd+3] |
| IUPAC Name | gadolinium(3+) tribromide |
| InChI Key | KGOKDPWKDBWITQ-UHFFFAOYSA-K |
| Molecular Formula | Br3Gd |
Platinum wire, 0.0762mm (0.003in) dia, For ISA Type R or S Standard Grade Thermocouple
CAS: 6-4-7440 Molecular Formula: Pt Molecular Weight (g/mol): 195.08 MDL Number: MFCD00011179 InChI Key: BASFCYQUMIYNBI-UHFFFAOYSA-N Synonym: black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion PubChem CID: 23939 ChEBI: CHEBI:33400 IUPAC Name: platinum SMILES: [Pt]
| PubChem CID | 23939 |
|---|---|
| CAS | 6-4-7440 |
| Molecular Weight (g/mol) | 195.08 |
| ChEBI | CHEBI:33400 |
| MDL Number | MFCD00011179 |
| SMILES | [Pt] |
| Synonym | black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion |
| IUPAC Name | platinum |
| InChI Key | BASFCYQUMIYNBI-UHFFFAOYSA-N |
| Molecular Formula | Pt |
Tellurium broken ingot, Puratronic™, 99.9999+% (metals basis), Thermo Scientific Chemicals
CAS: 13494-80-9 Molecular Formula: Te Molecular Weight (g/mol): 127.60 MDL Number: MFCD00134062 InChI Key: PORWMNRCUJJQNO-UHFFFAOYSA-N Synonym: tellurium, elemental,telloy,tellur,aurum paradoxum,element,tellur polish,metallum problematum,tellurium, metallic,unii-nqa0o090zj,and compounds PubChem CID: 6327182 ChEBI: CHEBI:30452 IUPAC Name: tellurium SMILES: [Te]
| PubChem CID | 6327182 |
|---|---|
| CAS | 13494-80-9 |
| Molecular Weight (g/mol) | 127.60 |
| ChEBI | CHEBI:30452 |
| MDL Number | MFCD00134062 |
| SMILES | [Te] |
| Synonym | tellurium, elemental,telloy,tellur,aurum paradoxum,element,tellur polish,metallum problematum,tellurium, metallic,unii-nqa0o090zj,and compounds |
| IUPAC Name | tellurium |
| InChI Key | PORWMNRCUJJQNO-UHFFFAOYSA-N |
| Molecular Formula | Te |
Palladium, 5% on strontium carbonate powder, reduced
CAS: 5-3-7440 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 5-3-7440 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Thermo Scientific™ Sodium D-glycero-D-guloheptonate dihydrate, 98+%
CAS: 13007-85-7 Molecular Formula: C7H13NaO8 Molecular Weight (g/mol): 248.16 InChI Key: FMYOMWCQJXWGEN-WYRLRVFGSA-M Synonym: D-Glucoheptonic acid sodium salt dihydrate; IUPAC Name: sodium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate SMILES: [Na+].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)C([O-])=O
| CAS | 13007-85-7 |
|---|---|
| Molecular Weight (g/mol) | 248.16 |
| SMILES | [Na+].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)C([O-])=O |
| Synonym | D-Glucoheptonic acid sodium salt dihydrate; |
| IUPAC Name | sodium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
| InChI Key | FMYOMWCQJXWGEN-WYRLRVFGSA-M |
| Molecular Formula | C7H13NaO8 |
| Form | Slug |
|---|---|
| Chemical Name or Material | Gold Germanium slug |
| Grade | Premion |
| Density | 0.37 g/cm3 |
| Weight | ≈0.4g/slug |
| Avg. Mol. Wt. or Mol. Wt. Range | Au:Ge; 88:12 wt% |
| Name Note | 3.175mm (0.125 in.) dia. x≈3.175mm (0.125 in.) length |
| Percent Purity | 99.998% |
| MDL Number | MFCD02091706 |
| Solubility Information | Insoluble in water. |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Assay Percent Notes | (metals basis) |
| Odor | Odorless |
Zirconium(IV) fluoride, 98%, Thermo Scientific Chemicals
CAS: 7783-64-4 Molecular Formula: F4Zr MDL Number: MFCD00011307 Synonym: Zirconium tetrafluoride
| CAS | 7783-64-4 |
|---|---|
| MDL Number | MFCD00011307 |
| Synonym | Zirconium tetrafluoride |
| Molecular Formula | F4Zr |