Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Stainless Steel gauze, 20 mesh woven from 0.102mm (0.004in) dia wire, Type 316
Open area: 84.6%; Width of opening: 0.046 in. | Fe:Cr:Ni:Mo; 67.5:17:13:2.5 wt%
| Form | Wire Cloth |
|---|---|
| MDL Number | MFCD00148499 |
| Solubility Information | Insoluble in water. |
| Health Hazard 1 | H317-H351: May cause an allergic skin reaction. Suspected of causing cancer. |
| Chemical Name or Material | Stainless Steel |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Molecular Formula | Fe:Cr:Ni:Mo; 67.5:17:13:2.5 wt% |
| Appearance | Gauze |
| Mesh Size | 20 Mesh |
Cerium(IV) oxide, 99.5% (REO)
CAS: 1306-38-3 Molecular Formula: CeO2 Molecular Weight (g/mol): 172.114 MDL Number: MFCD00010933 InChI Key: CETPSERCERDGAM-UHFFFAOYSA-N Synonym: ceric oxide,cerium dioxide,cerium iv oxide,ceria,cerium oxide,ceric dioxide,cerium 4+ oxide,needlal,nidoral,opaline PubChem CID: 73963 ChEBI: CHEBI:79089 IUPAC Name: dioxocerium SMILES: O=[Ce]=O
| PubChem CID | 73963 |
|---|---|
| CAS | 1306-38-3 |
| Molecular Weight (g/mol) | 172.114 |
| ChEBI | CHEBI:79089 |
| MDL Number | MFCD00010933 |
| SMILES | O=[Ce]=O |
| Synonym | ceric oxide,cerium dioxide,cerium iv oxide,ceria,cerium oxide,ceric dioxide,cerium 4+ oxide,needlal,nidoral,opaline |
| IUPAC Name | dioxocerium |
| InChI Key | CETPSERCERDGAM-UHFFFAOYSA-N |
| Molecular Formula | CeO2 |
Magnesium bromide hexahydrate, 98+%
CAS: 13446-53-2 Molecular Formula: Br2H12MgO6 Molecular Weight (g/mol): 292.20 MDL Number: MFCD00149780 InChI Key: LGLXXNHIGIJYQQ-UHFFFAOYSA-L Synonym: acmc-1bp1b,magnesium bromide-water 1/2/6,magnesium 2+ ion hexahydrate dibromide,magnesium 2+ hexahydrate dibromide,grignard reagent PubChem CID: 17749097 SMILES: O.O.O.O.O.O.Br[Mg]Br
| PubChem CID | 17749097 |
|---|---|
| CAS | 13446-53-2 |
| Molecular Weight (g/mol) | 292.20 |
| MDL Number | MFCD00149780 |
| SMILES | O.O.O.O.O.O.Br[Mg]Br |
| Synonym | acmc-1bp1b,magnesium bromide-water 1/2/6,magnesium 2+ ion hexahydrate dibromide,magnesium 2+ hexahydrate dibromide,grignard reagent |
| InChI Key | LGLXXNHIGIJYQQ-UHFFFAOYSA-L |
| Molecular Formula | Br2H12MgO6 |
Strontium carbonate, 99.99% (metals basis)
CAS: 1633-05-2 Molecular Formula: CO3Sr Molecular Weight (g/mol): 147.63 MDL Number: MFCD00011250 InChI Key: LEDMRZGFZIAGGB-UHFFFAOYSA-L Synonym: strontium carbonate,strontianite,carbonic acid, strontium salt 1:1,unii-41ypu4mmca,strontium carbonate srco3,ccris 3203,carbonic acid strontium salt 1:1,41ypu4mmca,strontium, reference standard solution,strontiumcarbonate PubChem CID: 15407 SMILES: [Sr++].[O-]C([O-])=O
| PubChem CID | 15407 |
|---|---|
| CAS | 1633-05-2 |
| Molecular Weight (g/mol) | 147.63 |
| MDL Number | MFCD00011250 |
| SMILES | [Sr++].[O-]C([O-])=O |
| Synonym | strontium carbonate,strontianite,carbonic acid, strontium salt 1:1,unii-41ypu4mmca,strontium carbonate srco3,ccris 3203,carbonic acid strontium salt 1:1,41ypu4mmca,strontium, reference standard solution,strontiumcarbonate |
| InChI Key | LEDMRZGFZIAGGB-UHFFFAOYSA-L |
| Molecular Formula | CO3Sr |
Thermo Scientific Chemicals Sodium thiosulfate pentahydrate, 99+%, for biochemistry
CAS: 10102-17-7 Molecular Formula: Na2O3S2·5H2O Molecular Weight (g/mol): 248.18 InChI Key: PODWXQQNRWNDGD-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane;pentahydrate SMILES: O.O.O.O.O.[O-]S(=O)(=S)[O-].[Na+].[Na+]
| PubChem CID | 61475 |
|---|---|
| CAS | 10102-17-7 |
| Molecular Weight (g/mol) | 248.18 |
| ChEBI | CHEBI:32150 |
| SMILES | O.O.O.O.O.[O-]S(=O)(=S)[O-].[Na+].[Na+] |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane;pentahydrate |
| InChI Key | PODWXQQNRWNDGD-UHFFFAOYSA-L |
| Molecular Formula | Na2O3S2·5H2O |
Cobalt(II) fluoride, ultra dry, 99.99% (metals basis)
CAS: 10026-17-2 Molecular Formula: CoF2 Molecular Weight (g/mol): 96.93 MDL Number: MFCD00010941 InChI Key: YCYBZKSMUPTWEE-UHFFFAOYSA-L Synonym: cobalt ii fluoride,cobalt fluoride,cobalt difluoride,cobaltous fluoride,hsdb 236,cobalt fluoride pink,cobalt ii fluoride, powder,cobalt ii fluoride, anhydrous,cobalt ii fluoride, ultra dry PubChem CID: 24820 IUPAC Name: difluorocobalt SMILES: F[Co]F
| PubChem CID | 24820 |
|---|---|
| CAS | 10026-17-2 |
| Molecular Weight (g/mol) | 96.93 |
| MDL Number | MFCD00010941 |
| SMILES | F[Co]F |
| Synonym | cobalt ii fluoride,cobalt fluoride,cobalt difluoride,cobaltous fluoride,hsdb 236,cobalt fluoride pink,cobalt ii fluoride, powder,cobalt ii fluoride, anhydrous,cobalt ii fluoride, ultra dry |
| IUPAC Name | difluorocobalt |
| InChI Key | YCYBZKSMUPTWEE-UHFFFAOYSA-L |
| Molecular Formula | CoF2 |
Potassium thiocyanate, ACS, 98.5% min
CAS: 333-20-0 Molecular Formula: CKNS Molecular Weight (g/mol): 97.176 MDL Number: MFCD00011413 InChI Key: ZNNZYHKDIALBAK-UHFFFAOYSA-M Synonym: potassium thiocyanate,potassium rhodanate,potassium rhodanide,rodanca,potassium sulfocyanate,rhodanide,rhocya,potassium thiocyanide,kscn,thiocyanic acid, potassium salt PubChem CID: 516872 ChEBI: CHEBI:30951 IUPAC Name: potassium;thiocyanate SMILES: C(#N)[S-].[K+]
| PubChem CID | 516872 |
|---|---|
| CAS | 333-20-0 |
| Molecular Weight (g/mol) | 97.176 |
| ChEBI | CHEBI:30951 |
| MDL Number | MFCD00011413 |
| SMILES | C(#N)[S-].[K+] |
| Synonym | potassium thiocyanate,potassium rhodanate,potassium rhodanide,rodanca,potassium sulfocyanate,rhodanide,rhocya,potassium thiocyanide,kscn,thiocyanic acid, potassium salt |
| IUPAC Name | potassium;thiocyanate |
| InChI Key | ZNNZYHKDIALBAK-UHFFFAOYSA-M |
| Molecular Formula | CKNS |
Potassium carbonate, Puratronic™, 99.997% (metals basis)
CAS: 584-08-7 Molecular Formula: CK2O3 Molecular Weight (g/mol): 138.21 MDL Number: MFCD00011382 InChI Key: BWHMMNNQKKPAPP-UHFFFAOYSA-L Synonym: potassium carbonate,dipotassium carbonate,potash,potassium carbonate, anhydrous,carbonic acid, dipotassium salt,carbonate of potash,pearl ash,salt of tartar,kaliumcarbonat,potassiumcarbonate PubChem CID: 11430 SMILES: [K+].[K+].[O-]C([O-])=O
| PubChem CID | 11430 |
|---|---|
| CAS | 584-08-7 |
| Molecular Weight (g/mol) | 138.21 |
| MDL Number | MFCD00011382 |
| SMILES | [K+].[K+].[O-]C([O-])=O |
| Synonym | potassium carbonate,dipotassium carbonate,potash,potassium carbonate, anhydrous,carbonic acid, dipotassium salt,carbonate of potash,pearl ash,salt of tartar,kaliumcarbonat,potassiumcarbonate |
| InChI Key | BWHMMNNQKKPAPP-UHFFFAOYSA-L |
| Molecular Formula | CK2O3 |
Holmium(III) nitrate pentahydrate, REacton™, 99.9% (REO)
CAS: 14483-18-2 Molecular Formula: H10HoN3O14 Molecular Weight (g/mol): 441.017 MDL Number: MFCD00149737 InChI Key: BJUGWWDCFYEYOA-UHFFFAOYSA-N Synonym: holmium nitrate pentahydrate,ho.3no3.5h2o,holmium iii nitrate hydrate,holmium nitrate,holmium nitrate-water 1/3/5,holmium 3+ pentahydrate trinitronate,holmium iii nitrate pentahydrate,holmium 3+ pentahydrate trinitrate,nitric acid,holmium 3+ salt, pentahydrate 8ci,9ci,holmium iii nitrate pentahydrate trace metals basis PubChem CID: 25021754 IUPAC Name: holmium(3+);trinitrate;pentahydrate SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.O.O.[Ho+3]
| PubChem CID | 25021754 |
|---|---|
| CAS | 14483-18-2 |
| Molecular Weight (g/mol) | 441.017 |
| MDL Number | MFCD00149737 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.O.O.[Ho+3] |
| Synonym | holmium nitrate pentahydrate,ho.3no3.5h2o,holmium iii nitrate hydrate,holmium nitrate,holmium nitrate-water 1/3/5,holmium 3+ pentahydrate trinitronate,holmium iii nitrate pentahydrate,holmium 3+ pentahydrate trinitrate,nitric acid,holmium 3+ salt, pentahydrate 8ci,9ci,holmium iii nitrate pentahydrate trace metals basis |
| IUPAC Name | holmium(3+);trinitrate;pentahydrate |
| InChI Key | BJUGWWDCFYEYOA-UHFFFAOYSA-N |
| Molecular Formula | H10HoN3O14 |
Magnesium oxide, ACS, 95.0% min
CAS: 1309-48-4 Molecular Formula: MgO Molecular Weight (g/mol): 40.30 MDL Number: MFCD00011109 InChI Key: CPLXHLVBOLITMK-UHFFFAOYSA-N Synonym: magnesium oxide,magnesia,seawater magnesia,causmag,granmag,maglite,periclase,seasorb,animag PubChem CID: 14792 IUPAC Name: oxomagnesium SMILES: O=[Mg]
| PubChem CID | 14792 |
|---|---|
| CAS | 1309-48-4 |
| Molecular Weight (g/mol) | 40.30 |
| MDL Number | MFCD00011109 |
| SMILES | O=[Mg] |
| Synonym | magnesium oxide,magnesia,seawater magnesia,causmag,granmag,maglite,periclase,seasorb,animag |
| IUPAC Name | oxomagnesium |
| InChI Key | CPLXHLVBOLITMK-UHFFFAOYSA-N |
| Molecular Formula | MgO |
Aluminum silicate
CAS: 12428-46-5 Molecular Formula: Al2H4O9Si2 Molecular Weight (g/mol): 258.16 MDL Number: MFCD00062311 InChI Key: NLYAJNPCOHFWQQ-UHFFFAOYSA-N Synonym: kaolin,china clay,argilla,glomax,porcelain clay,bolus alba,white bole,hydrated aluminum silicate,kaolin clay slurry,alphagloss PubChem CID: 56841936 IUPAC Name: oxo-oxoalumanyloxy-[oxo(oxoalumanyloxy)silyl]oxysilane;dihydrate SMILES: O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O
| PubChem CID | 56841936 |
|---|---|
| CAS | 12428-46-5 |
| Molecular Weight (g/mol) | 258.16 |
| MDL Number | MFCD00062311 |
| SMILES | O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O |
| Synonym | kaolin,china clay,argilla,glomax,porcelain clay,bolus alba,white bole,hydrated aluminum silicate,kaolin clay slurry,alphagloss |
| IUPAC Name | oxo-oxoalumanyloxy-[oxo(oxoalumanyloxy)silyl]oxysilane;dihydrate |
| InChI Key | NLYAJNPCOHFWQQ-UHFFFAOYSA-N |
| Molecular Formula | Al2H4O9Si2 |
Sodium phosphate dibasic dihydrate, 98+%, for analysis
CAS: 10028-24-7 Molecular Formula: H5Na2O6P Molecular Weight (g/mol): 177.99 MDL Number: MFCD00149182 InChI Key: KDQPSPMLNJTZAL-UHFFFAOYSA-L Synonym: disodium hydrogen phosphate dihydrate,disodium phosphate dihydrate,sodium phosphate dibasic dihydrate,di-sodium hydrogen phosphate dihydrate,phosphoric acid, disodium salt, dihydrate,sodium hydrogenphosphate dihydrate,sodium phosphate, dibasic, dihydrate,disodium hydrogenphosphate dihydrate,dinatrii phosphas dihydricus,2na.hpo4.2h2o PubChem CID: 6451167 IUPAC Name: disodium;hydrogen phosphate;dihydrate SMILES: O.O.[Na+].[Na+].OP([O-])([O-])=O
| PubChem CID | 6451167 |
|---|---|
| CAS | 10028-24-7 |
| Molecular Weight (g/mol) | 177.99 |
| MDL Number | MFCD00149182 |
| SMILES | O.O.[Na+].[Na+].OP([O-])([O-])=O |
| Synonym | disodium hydrogen phosphate dihydrate,disodium phosphate dihydrate,sodium phosphate dibasic dihydrate,di-sodium hydrogen phosphate dihydrate,phosphoric acid, disodium salt, dihydrate,sodium hydrogenphosphate dihydrate,sodium phosphate, dibasic, dihydrate,disodium hydrogenphosphate dihydrate,dinatrii phosphas dihydricus,2na.hpo4.2h2o |
| IUPAC Name | disodium;hydrogen phosphate;dihydrate |
| InChI Key | KDQPSPMLNJTZAL-UHFFFAOYSA-L |
| Molecular Formula | H5Na2O6P |
Lanthanum(III) fluoride, anhydrous, 99.9% (REO)
CAS: 13709-38-1 Molecular Formula: F3La Molecular Weight (g/mol): 195.90 MDL Number: MFCD00011073 InChI Key: BYMUNNMMXKDFEZ-UHFFFAOYSA-K IUPAC Name: lanthanum(3+) trifluoride SMILES: [F-].[F-].[F-].[La+3]
| CAS | 13709-38-1 |
|---|---|
| Molecular Weight (g/mol) | 195.90 |
| MDL Number | MFCD00011073 |
| SMILES | [F-].[F-].[F-].[La+3] |
| IUPAC Name | lanthanum(3+) trifluoride |
| InChI Key | BYMUNNMMXKDFEZ-UHFFFAOYSA-K |
| Molecular Formula | F3La |
Manganese(II) chloride, 97%
CAS: 7773-01-5 Molecular Formula: Cl2Mn Molecular Weight (g/mol): 125.84 MDL Number: MFCD00011114 InChI Key: GLFNIEUTAYBVOC-UHFFFAOYSA-L Synonym: manganese chloride,manganese ii chloride,manganese 2+ ion dichloride,manganesechloride,acmc-20akkt,manganous chloride,anhydrous,ksc171o6h,manganous chloride, anhydr,manganese ii chloride anhydrous crystalline PubChem CID: 10313134 ChEBI: CHEBI:63041 SMILES: [Cl-].[Cl-].[Mn++]
| PubChem CID | 10313134 |
|---|---|
| CAS | 7773-01-5 |
| Molecular Weight (g/mol) | 125.84 |
| ChEBI | CHEBI:63041 |
| MDL Number | MFCD00011114 |
| SMILES | [Cl-].[Cl-].[Mn++] |
| Synonym | manganese chloride,manganese ii chloride,manganese 2+ ion dichloride,manganesechloride,acmc-20akkt,manganous chloride,anhydrous,ksc171o6h,manganous chloride, anhydr,manganese ii chloride anhydrous crystalline |
| InChI Key | GLFNIEUTAYBVOC-UHFFFAOYSA-L |
| Molecular Formula | Cl2Mn |
Calcium titanium oxide, 99+% (metals basis)
CAS: 12049-50-2 Molecular Formula: CaO3Ti Molecular Weight (g/mol): 135.94 MDL Number: MFCD00015981 InChI Key: WEUCVIBPSSMHJG-UHFFFAOYSA-N Synonym: calcium titanate,titaniumcalciumoxide,calciumtitaniumtrioxide,ca.o3ti,titanatecalcium 1:1,calcium dioxido oxo titanium,calcium oxotitaniumbis olate,calcium 2+ oxotitaniumbis olate,titanate tio32-,calcium 1:1,calcium titanate, nanopowder, <100 nm particle size bet trace metals basis PubChem CID: 16212381 IUPAC Name: calcium;dioxido(oxo)titanium SMILES: [O--].[O--].[O--].[Ca++].[Ti+4]
| PubChem CID | 16212381 |
|---|---|
| CAS | 12049-50-2 |
| Molecular Weight (g/mol) | 135.94 |
| MDL Number | MFCD00015981 |
| SMILES | [O--].[O--].[O--].[Ca++].[Ti+4] |
| Synonym | calcium titanate,titaniumcalciumoxide,calciumtitaniumtrioxide,ca.o3ti,titanatecalcium 1:1,calcium dioxido oxo titanium,calcium oxotitaniumbis olate,calcium 2+ oxotitaniumbis olate,titanate tio32-,calcium 1:1,calcium titanate, nanopowder, <100 nm particle size bet trace metals basis |
| IUPAC Name | calcium;dioxido(oxo)titanium |
| InChI Key | WEUCVIBPSSMHJG-UHFFFAOYSA-N |
| Molecular Formula | CaO3Ti |