Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
1-Trimethylsilylmethanol, 95%
CAS: 3219-63-4 Molecular Formula: C4H12OSi Molecular Weight (g/mol): 104.224 MDL Number: MFCD00004596 InChI Key: ZQKNBDOVPOZPLY-UHFFFAOYSA-N Synonym: trimethylsilyl methanol,1-trimethylsilylmethanol,hydroxymethyltrimethylsilane,methanol, trimethylsilyl,silane, hydroxymethyl trimethyl,hydroxymethyl trimethylsilane,trimethylhydroxymethylsilane,methanol, 1-trimethylsilyl,trimethylsilyl-methanol,acmc-209hrr PubChem CID: 76692 IUPAC Name: trimethylsilylmethanol SMILES: C[Si](C)(C)CO
| PubChem CID | 76692 |
|---|---|
| CAS | 3219-63-4 |
| Molecular Weight (g/mol) | 104.224 |
| MDL Number | MFCD00004596 |
| SMILES | C[Si](C)(C)CO |
| Synonym | trimethylsilyl methanol,1-trimethylsilylmethanol,hydroxymethyltrimethylsilane,methanol, trimethylsilyl,silane, hydroxymethyl trimethyl,hydroxymethyl trimethylsilane,trimethylhydroxymethylsilane,methanol, 1-trimethylsilyl,trimethylsilyl-methanol,acmc-209hrr |
| IUPAC Name | trimethylsilylmethanol |
| InChI Key | ZQKNBDOVPOZPLY-UHFFFAOYSA-N |
| Molecular Formula | C4H12OSi |
1-Phenyl-1-trimethylsiloxyethylene, 95%
CAS: 13735-81-4 Molecular Formula: C11H16OSi Molecular Weight (g/mol): 192.333 MDL Number: MFCD00008582 InChI Key: AFFPCIMDERUIST-UHFFFAOYSA-N Synonym: 1-phenyl-1-trimethylsiloxyethylene,trimethyl 1-phenylvinyl oxy silane,1-phenyl-1-trimethylsilyloxyethylene,1-phenyl-1-trimethylsiloxy ethylene,1-phenyl-1-trimethylsilyloxy ethylene,benzene, 1-trimethylsilyl oxy ethenyl,silane, trimethyl 1-phenylethenyl oxy,acmc-209ccf PubChem CID: 117406 IUPAC Name: trimethyl(1-phenylethenoxy)silane SMILES: C[Si](C)(C)OC(=C)C1=CC=CC=C1
| PubChem CID | 117406 |
|---|---|
| CAS | 13735-81-4 |
| Molecular Weight (g/mol) | 192.333 |
| MDL Number | MFCD00008582 |
| SMILES | C[Si](C)(C)OC(=C)C1=CC=CC=C1 |
| Synonym | 1-phenyl-1-trimethylsiloxyethylene,trimethyl 1-phenylvinyl oxy silane,1-phenyl-1-trimethylsilyloxyethylene,1-phenyl-1-trimethylsiloxy ethylene,1-phenyl-1-trimethylsilyloxy ethylene,benzene, 1-trimethylsilyl oxy ethenyl,silane, trimethyl 1-phenylethenyl oxy,acmc-209ccf |
| IUPAC Name | trimethyl(1-phenylethenoxy)silane |
| InChI Key | AFFPCIMDERUIST-UHFFFAOYSA-N |
| Molecular Formula | C11H16OSi |
Thermo Scientific Chemicals FerroZine™ Iron Reagent, Hydrate, 95+%, Pure
CAS: 1266615-85-3 Molecular Formula: C20H13N4NaO6S2 Molecular Weight (g/mol): 492.46 MDL Number: MFCD00150794 InChI Key: ZGVNYCXXBQPDPQ-UHFFFAOYSA-M Synonym: ferrozine mono-sodium salt hydrate,ferrozine™ iron reagent,c20h13n4o6s2.na.h2o,pdt disulfonate monosodium salt hydrate,3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p inverted exclamation marka-disulfonic acid monosodium salt hydrate,3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p'-disulfonic acid monosodium salt hydrate PubChem CID: 129893581 IUPAC Name: sodium 4-[3-(pyridin-2-yl)-6-(4-sulfophenyl)-1,2,4-triazin-5-yl]benzene-1-sulfonate SMILES: [Na+].OS(=O)(=O)C1=CC=C(C=C1)C1=C(N=C(N=N1)C1=CC=CC=N1)C1=CC=C(C=C1)S([O-])(=O)=O
| PubChem CID | 129893581 |
|---|---|
| CAS | 1266615-85-3 |
| Molecular Weight (g/mol) | 492.46 |
| MDL Number | MFCD00150794 |
| SMILES | [Na+].OS(=O)(=O)C1=CC=C(C=C1)C1=C(N=C(N=N1)C1=CC=CC=N1)C1=CC=C(C=C1)S([O-])(=O)=O |
| Synonym | ferrozine mono-sodium salt hydrate,ferrozine™ iron reagent,c20h13n4o6s2.na.h2o,pdt disulfonate monosodium salt hydrate,3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p inverted exclamation marka-disulfonic acid monosodium salt hydrate,3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p'-disulfonic acid monosodium salt hydrate |
| IUPAC Name | sodium 4-[3-(pyridin-2-yl)-6-(4-sulfophenyl)-1,2,4-triazin-5-yl]benzene-1-sulfonate |
| InChI Key | ZGVNYCXXBQPDPQ-UHFFFAOYSA-M |
| Molecular Formula | C20H13N4NaO6S2 |
3,5-Bis(trifluoromethyl)phenyldimethylchlorosilane, 95%
CAS: 732306-23-9 Molecular Formula: C10H9ClF6Si Molecular Weight (g/mol): 306.707 MDL Number: MFCD01862186 InChI Key: JZWDIKPZWMXPMG-UHFFFAOYSA-N Synonym: 3,5-bis trifluoromethyl phenyldimethylchlorosilane,3,5-bis trifluoromethyl phenyl chloro dimethylsilane,3,5-bis trifluoromethyl phenyl chloro dimethyl silane,3,5-bis trifluoromethyl phenyl-chloro-dimethylsilane,3,5-bis trifluoromethyl phenyl dimethylsilyl chloride,benzene,1-chlorodimethylsilyl-3,5-bis trifluoromethyl PubChem CID: 2783240 IUPAC Name: [3,5-bis(trifluoromethyl)phenyl]-chloro-dimethylsilane SMILES: C[Si](C)(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)Cl
| PubChem CID | 2783240 |
|---|---|
| CAS | 732306-23-9 |
| Molecular Weight (g/mol) | 306.707 |
| MDL Number | MFCD01862186 |
| SMILES | C[Si](C)(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)Cl |
| Synonym | 3,5-bis trifluoromethyl phenyldimethylchlorosilane,3,5-bis trifluoromethyl phenyl chloro dimethylsilane,3,5-bis trifluoromethyl phenyl chloro dimethyl silane,3,5-bis trifluoromethyl phenyl-chloro-dimethylsilane,3,5-bis trifluoromethyl phenyl dimethylsilyl chloride,benzene,1-chlorodimethylsilyl-3,5-bis trifluoromethyl |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-chloro-dimethylsilane |
| InChI Key | JZWDIKPZWMXPMG-UHFFFAOYSA-N |
| Molecular Formula | C10H9ClF6Si |
11-Azidoundecyltriethoxysilane, 95%
CAS: 663171-33-3 Molecular Formula: C17H37N3O3Si Molecular Weight (g/mol): 359.586 MDL Number: MFCD11982879 InChI Key: WCDFLYKXACDAES-UHFFFAOYSA-N Synonym: azidoundecyltriethoxysilane,11-azidoundecyltriethoxysilane,11-azidoundecyl triethoxysilane PubChem CID: 46779111 IUPAC Name: 11-azidoundecyl(triethoxy)silane SMILES: CCO[Si](CCCCCCCCCCCN=[N+]=[N-])(OCC)OCC
| PubChem CID | 46779111 |
|---|---|
| CAS | 663171-33-3 |
| Molecular Weight (g/mol) | 359.586 |
| MDL Number | MFCD11982879 |
| SMILES | CCO[Si](CCCCCCCCCCCN=[N+]=[N-])(OCC)OCC |
| Synonym | azidoundecyltriethoxysilane,11-azidoundecyltriethoxysilane,11-azidoundecyl triethoxysilane |
| IUPAC Name | 11-azidoundecyl(triethoxy)silane |
| InChI Key | WCDFLYKXACDAES-UHFFFAOYSA-N |
| Molecular Formula | C17H37N3O3Si |
3,5-Bis(trifluoromethyl)phenyldimethylsilane, 95%
CAS: 33558-36-0 Molecular Formula: C10H9F6Si Molecular Weight (g/mol): 271.257 MDL Number: MFCD02093948 InChI Key: HJQABLGRCWBCDT-UHFFFAOYSA-N Synonym: 3,5-bis trifluoromethyl phenyl dimethylsilane,3,5-bis trifluoromethyl phenyl-dimethyl-silicon,3,5-bis-trifluoromethyl phenyldimethylsilane,3,5-bis trifluoromethyl phenyl-dimethylsilicon,3,5-bis trifluoromethyl phenyldimethylsilane PubChem CID: 11219490 IUPAC Name: [3,5-bis(trifluoromethyl)phenyl]-dimethylsilicon SMILES: C[Si](C)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F
| PubChem CID | 11219490 |
|---|---|
| CAS | 33558-36-0 |
| Molecular Weight (g/mol) | 271.257 |
| MDL Number | MFCD02093948 |
| SMILES | C[Si](C)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
| Synonym | 3,5-bis trifluoromethyl phenyl dimethylsilane,3,5-bis trifluoromethyl phenyl-dimethyl-silicon,3,5-bis-trifluoromethyl phenyldimethylsilane,3,5-bis trifluoromethyl phenyl-dimethylsilicon,3,5-bis trifluoromethyl phenyldimethylsilane |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-dimethylsilicon |
| InChI Key | HJQABLGRCWBCDT-UHFFFAOYSA-N |
| Molecular Formula | C10H9F6Si |
11-Aminoundecyltriethoxysilane, 90+%
CAS: 116821-45-5 Molecular Formula: C17H39NO3Si Molecular Weight (g/mol): 333.588 MDL Number: MFCD08272792 InChI Key: LPWZCJFZJCOBHO-UHFFFAOYSA-N PubChem CID: 18944844 IUPAC Name: 11-triethoxysilylundecan-1-amine SMILES: CCO[Si](CCCCCCCCCCCN)(OCC)OCC
| PubChem CID | 18944844 |
|---|---|
| CAS | 116821-45-5 |
| Molecular Weight (g/mol) | 333.588 |
| MDL Number | MFCD08272792 |
| SMILES | CCO[Si](CCCCCCCCCCCN)(OCC)OCC |
| IUPAC Name | 11-triethoxysilylundecan-1-amine |
| InChI Key | LPWZCJFZJCOBHO-UHFFFAOYSA-N |
| Molecular Formula | C17H39NO3Si |
10-(Pentafluorophenoxycarbonyl)decyltrimethoxysilane, 95%
CAS: 944721-52-2 Molecular Formula: C20H29F5O5Si Molecular Weight (g/mol): 472.524 MDL Number: MFCD13181915 InChI Key: KSYPNQIBGIOYPZ-UHFFFAOYSA-N Synonym: 11-pentafluorophenylundecanoato trimethoxysilane,10-pentafluorophenoxycarbonyl decyltrimethoxysilane,2,3,4,5,6-pentafluorophenyl 11-trimethoxysilyl undecanoate PubChem CID: 23582157 IUPAC Name: (2,3,4,5,6-pentafluorophenyl) 11-trimethoxysilylundecanoate SMILES: CO[Si](CCCCCCCCCCC(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)(OC)OC
| PubChem CID | 23582157 |
|---|---|
| CAS | 944721-52-2 |
| Molecular Weight (g/mol) | 472.524 |
| MDL Number | MFCD13181915 |
| SMILES | CO[Si](CCCCCCCCCCC(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)(OC)OC |
| Synonym | 11-pentafluorophenylundecanoato trimethoxysilane,10-pentafluorophenoxycarbonyl decyltrimethoxysilane,2,3,4,5,6-pentafluorophenyl 11-trimethoxysilyl undecanoate |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 11-trimethoxysilylundecanoate |
| InChI Key | KSYPNQIBGIOYPZ-UHFFFAOYSA-N |
| Molecular Formula | C20H29F5O5Si |
10-(Pentafluorophenoxycarbonyl)decyltriethoxysilane, 95%
CAS: 1197981-08-0 Molecular Formula: C23H35F5O5Si Molecular Weight (g/mol): 514.605 MDL Number: MFCD13181916 InChI Key: WQFFEEIHQJVCHR-UHFFFAOYSA-N Synonym: 2,3,4,5,6-pentafluorophenyl 11-triethoxysilyl undecanoate,10-pentafluorophenoxycarbonyl decyltriethoxysilane,10-pentafluorophenoxycarbonyl decyl triethoxysilane PubChem CID: 99738205 IUPAC Name: (2,3,4,5,6-pentafluorophenyl) 11-triethoxysilylundecanoate SMILES: CCO[Si](CCCCCCCCCCC(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)(OCC)OCC
| PubChem CID | 99738205 |
|---|---|
| CAS | 1197981-08-0 |
| Molecular Weight (g/mol) | 514.605 |
| MDL Number | MFCD13181916 |
| SMILES | CCO[Si](CCCCCCCCCCC(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)(OCC)OCC |
| Synonym | 2,3,4,5,6-pentafluorophenyl 11-triethoxysilyl undecanoate,10-pentafluorophenoxycarbonyl decyltriethoxysilane,10-pentafluorophenoxycarbonyl decyl triethoxysilane |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 11-triethoxysilylundecanoate |
| InChI Key | WQFFEEIHQJVCHR-UHFFFAOYSA-N |
| Molecular Formula | C23H35F5O5Si |
Silicon(IV) nitride, alpha-phase, ca. 90%
CAS: 12033-89-5 Molecular Formula: N4Si3 Molecular Weight (g/mol): 140.28 MDL Number: MFCD00011230 InChI Key: HQVNEWCFYHHQES-UHFFFAOYSA-N Synonym: silicon nitride,silicon nitride si3n4,unii-qhb8t06idk,qhb8t06idk,silicon iv nitride, alpha phase,trisilicon tetranitride,nierite,nano silicon nitride,silicon iv nitride,silicon nitride, amorphous PubChem CID: 3084099 IUPAC Name: Silicon nitride SMILES: N12[Si]34N5[Si]11N3[Si]25N41
| PubChem CID | 3084099 |
|---|---|
| CAS | 12033-89-5 |
| Molecular Weight (g/mol) | 140.28 |
| MDL Number | MFCD00011230 |
| SMILES | N12[Si]34N5[Si]11N3[Si]25N41 |
| Synonym | silicon nitride,silicon nitride si3n4,unii-qhb8t06idk,qhb8t06idk,silicon iv nitride, alpha phase,trisilicon tetranitride,nierite,nano silicon nitride,silicon iv nitride,silicon nitride, amorphous |
| IUPAC Name | Silicon nitride |
| InChI Key | HQVNEWCFYHHQES-UHFFFAOYSA-N |
| Molecular Formula | N4Si3 |
Potassium thiobenzoate, 95%
CAS: 28170-13-0 Molecular Formula: C7H6KOS Molecular Weight (g/mol): 177.28 MDL Number: MFCD28399074 InChI Key: LSBMSRUYNGEWKI-UHFFFAOYSA-N Synonym: benzenecarbothioic acid potassium PubChem CID: 87087528 IUPAC Name: benzenecarbothioic S-acid;potassium SMILES: [K].SC(=O)C1=CC=CC=C1
| PubChem CID | 87087528 |
|---|---|
| CAS | 28170-13-0 |
| Molecular Weight (g/mol) | 177.28 |
| MDL Number | MFCD28399074 |
| SMILES | [K].SC(=O)C1=CC=CC=C1 |
| Synonym | benzenecarbothioic acid potassium |
| IUPAC Name | benzenecarbothioic S-acid;potassium |
| InChI Key | LSBMSRUYNGEWKI-UHFFFAOYSA-N |
| Molecular Formula | C7H6KOS |
Cobalt(II) hydroxide, 95%, pure
CAS: 21041-93-0 Molecular Formula: CoH2O2 Molecular Weight (g/mol): 92.95 MDL Number: MFCD00016015 InChI Key: ASKVAEGIVYSGNY-UHFFFAOYSA-L Synonym: cobalt hydroxide,cobalt ii hydroxide,cobaltous hydrate,acmc-20aleg,cobalt 2+ dihydroxide,cobalt ii hydroxide metals basis PubChem CID: 10129900 SMILES: [OH-].[OH-].[Co++]
| PubChem CID | 10129900 |
|---|---|
| CAS | 21041-93-0 |
| Molecular Weight (g/mol) | 92.95 |
| MDL Number | MFCD00016015 |
| SMILES | [OH-].[OH-].[Co++] |
| Synonym | cobalt hydroxide,cobalt ii hydroxide,cobaltous hydrate,acmc-20aleg,cobalt 2+ dihydroxide,cobalt ii hydroxide metals basis |
| InChI Key | ASKVAEGIVYSGNY-UHFFFAOYSA-L |
| Molecular Formula | CoH2O2 |
Sodium Cholate, Reagent, 95%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 361-09-1 Molecular Formula: C24H39NaO5 Molecular Weight (g/mol): 430.56 MDL Number: MFCD00150749,MFCD00064138 InChI Key: NRHMKIHPTBHXPF-TUJRSCDTSA-M IUPAC Name: sodium (4R)-4-[(1R,3aS,3bR,4R,5aS,7R,9aS,9bS,11S,11aR)-4,7,11-trihydroxy-9a,11a-dimethyl-hexadecahydro-1H-cyclopenta[a]phenanthren-1-yl]pentanoate SMILES: [Na+].C[C@H](CCC([O-])=O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C
| CAS | 361-09-1 |
|---|---|
| Molecular Weight (g/mol) | 430.56 |
| MDL Number | MFCD00150749,MFCD00064138 |
| SMILES | [Na+].C[C@H](CCC([O-])=O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C |
| IUPAC Name | sodium (4R)-4-[(1R,3aS,3bR,4R,5aS,7R,9aS,9bS,11S,11aR)-4,7,11-trihydroxy-9a,11a-dimethyl-hexadecahydro-1H-cyclopenta[a]phenanthren-1-yl]pentanoate |
| InChI Key | NRHMKIHPTBHXPF-TUJRSCDTSA-M |
| Molecular Formula | C24H39NaO5 |
2-Quinoxaloyl chloride, 95%
CAS: 54745-92-5 Molecular Formula: C9H5ClN2O Molecular Weight (g/mol): 192.6 InChI Key: SOPDQKNXOCUBSR-UHFFFAOYSA-N Synonym: 2-quinoxalinecarbonyl chloride,2-quinoxalinecarbonylchloride,2-quinoxaloyl chloride,2-quinoxaloylchloride,2-quinoxalinylcarbonyl chloride,2-quinoxaline carbonyl chloride,2-quinoxalinecarbonyl chloride 7ci, 9ci PubChem CID: 2734681 IUPAC Name: quinoxaline-2-carbonyl chloride SMILES: C1=CC=C2C(=C1)N=CC(=N2)C(=O)Cl
| PubChem CID | 2734681 |
|---|---|
| CAS | 54745-92-5 |
| Molecular Weight (g/mol) | 192.6 |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)C(=O)Cl |
| Synonym | 2-quinoxalinecarbonyl chloride,2-quinoxalinecarbonylchloride,2-quinoxaloyl chloride,2-quinoxaloylchloride,2-quinoxalinylcarbonyl chloride,2-quinoxaline carbonyl chloride,2-quinoxalinecarbonyl chloride 7ci, 9ci |
| IUPAC Name | quinoxaline-2-carbonyl chloride |
| InChI Key | SOPDQKNXOCUBSR-UHFFFAOYSA-N |
| Molecular Formula | C9H5ClN2O |
Potassium pyrophosphate, 95%
CAS: 7320-34-5 Molecular Formula: K4O7P2 Molecular Weight (g/mol): 330.33 MDL Number: MFCD00011393 InChI Key: RYCLIXPGLDDLTM-UHFFFAOYSA-J Synonym: potassium pyrophosphate,potassium diphosphate,tkpp,tetrapotassium diphosphate,tetrapotassium pyrophosphate,diphosphoric acid, tetrapotassium salt,tetrapotassium diphosphorate,unii-b9w4019h5g,pyrophosphoric acid, tetrapotassium salt,tetrapotassium phosphonato phosphate PubChem CID: 23740 IUPAC Name: tetrapotassium;phosphonato phosphate SMILES: [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O
| PubChem CID | 23740 |
|---|---|
| CAS | 7320-34-5 |
| Molecular Weight (g/mol) | 330.33 |
| MDL Number | MFCD00011393 |
| SMILES | [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O |
| Synonym | potassium pyrophosphate,potassium diphosphate,tkpp,tetrapotassium diphosphate,tetrapotassium pyrophosphate,diphosphoric acid, tetrapotassium salt,tetrapotassium diphosphorate,unii-b9w4019h5g,pyrophosphoric acid, tetrapotassium salt,tetrapotassium phosphonato phosphate |
| IUPAC Name | tetrapotassium;phosphonato phosphate |
| InChI Key | RYCLIXPGLDDLTM-UHFFFAOYSA-J |
| Molecular Formula | K4O7P2 |