Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Ticaracillin disodium salt, 50mg/mL in distilled water, sterile-filtered, Thermo Scientific™
CAS: 4697-14-7 Molecular Formula: C15H14N2Na2O6S2 Molecular Weight (g/mol): 428.38 MDL Number: MFCD07787410,MFCD07787410 InChI Key: ZBBCUBMBMZNEME-QBGWIPKPSA-L Synonym: ticarcillin disodium,ticillin,ticarcillin disodium usan:usp,n-2-carboxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo 3.2.0 hept-6-yl-3-thiophenemalonamic acid disodium salt,3-thiophenemalonamic acid, n-2-carboxy-3,3-dimethyl-7-oxo-4-thia-1-azabicylo 3.2.0 hept-6-yl-, disodium salt,4-thia-1-azabicyclo 3.2.0 heptane-2-carboxylic acid, 6-carboxy-3-thienylacetyl amino-3,3-dimethyl-7-oxo-, disodium salt, 2s-2alpha,5alpha,6beta s*,disodium 2s,5r,6r-3,3-dimethyl-6-3-oxido-3-oxo-2-thiophen-3-ylpropanoyl amino-7-oxo-4-thia-1-azabicyclo 3.2.0 heptane-2-carboxylate PubChem CID: 656842 IUPAC Name: disodium (2S,5R,6R)-6-[(2R)-2-carboxylato-2-(thiophen-3-yl)acetamido]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate SMILES: [Na+].[Na+].CC1(C)S[C@@H]2[C@H](NC(=O)[C@H](C([O-])=O)C3=CSC=C3)C(=O)N2[C@H]1C([O-])=O
| PubChem CID | 656842 |
|---|---|
| CAS | 4697-14-7 |
| Molecular Weight (g/mol) | 428.38 |
| MDL Number | MFCD07787410,MFCD07787410 |
| SMILES | [Na+].[Na+].CC1(C)S[C@@H]2[C@H](NC(=O)[C@H](C([O-])=O)C3=CSC=C3)C(=O)N2[C@H]1C([O-])=O |
| Synonym | ticarcillin disodium,ticillin,ticarcillin disodium usan:usp,n-2-carboxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo 3.2.0 hept-6-yl-3-thiophenemalonamic acid disodium salt,3-thiophenemalonamic acid, n-2-carboxy-3,3-dimethyl-7-oxo-4-thia-1-azabicylo 3.2.0 hept-6-yl-, disodium salt,4-thia-1-azabicyclo 3.2.0 heptane-2-carboxylic acid, 6-carboxy-3-thienylacetyl amino-3,3-dimethyl-7-oxo-, disodium salt, 2s-2alpha,5alpha,6beta s*,disodium 2s,5r,6r-3,3-dimethyl-6-3-oxido-3-oxo-2-thiophen-3-ylpropanoyl amino-7-oxo-4-thia-1-azabicyclo 3.2.0 heptane-2-carboxylate |
| IUPAC Name | disodium (2S,5R,6R)-6-[(2R)-2-carboxylato-2-(thiophen-3-yl)acetamido]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| InChI Key | ZBBCUBMBMZNEME-QBGWIPKPSA-L |
| Molecular Formula | C15H14N2Na2O6S2 |
Lutetium pieces, distilled dendritic, 99.9% (REO)
CAS: 7439-94-3 Molecular Formula: Lu Molecular Weight (g/mol): 174.97 MDL Number: MFCD00011098 InChI Key: OHSVLFRHMCKCQY-UHFFFAOYSA-N Synonym: lutecium,unii-5h0doz21uj,5h0doz21uj,foil,foil, 0.127mm 0.005in thick reo,cassiopium,lutecio,cassiopeium,atom,pieces PubChem CID: 23929 ChEBI: CHEBI:33382 IUPAC Name: lutetium SMILES: [Lu]
| PubChem CID | 23929 |
|---|---|
| CAS | 7439-94-3 |
| Molecular Weight (g/mol) | 174.97 |
| ChEBI | CHEBI:33382 |
| MDL Number | MFCD00011098 |
| SMILES | [Lu] |
| Synonym | lutecium,unii-5h0doz21uj,5h0doz21uj,foil,foil, 0.127mm 0.005in thick reo,cassiopium,lutecio,cassiopeium,atom,pieces |
| IUPAC Name | lutetium |
| InChI Key | OHSVLFRHMCKCQY-UHFFFAOYSA-N |
| Molecular Formula | Lu |
Terbium pieces, distilled dendritic, 99.9% (REO)
CAS: 7440-27-9 Molecular Formula: Tb Molecular Weight (g/mol): 158.93 MDL Number: MFCD00011256 InChI Key: GZCRRIHWUXGPOV-UHFFFAOYSA-N Synonym: unii-06ssf7p179,ingot,foil,terbio,atom,chips,pieces,powder,acmc-20ajly,pieces, distilled dendritic PubChem CID: 23958 ChEBI: CHEBI:33376 IUPAC Name: terbium SMILES: [Tb]
| PubChem CID | 23958 |
|---|---|
| CAS | 7440-27-9 |
| Molecular Weight (g/mol) | 158.93 |
| ChEBI | CHEBI:33376 |
| MDL Number | MFCD00011256 |
| SMILES | [Tb] |
| Synonym | unii-06ssf7p179,ingot,foil,terbio,atom,chips,pieces,powder,acmc-20ajly,pieces, distilled dendritic |
| IUPAC Name | terbium |
| InChI Key | GZCRRIHWUXGPOV-UHFFFAOYSA-N |
| Molecular Formula | Tb |
Dysprosium pieces, distilled dendritic, 99.9% (REO)
CAS: 7429-91-6 Molecular Formula: Dy Molecular Weight (g/mol): 162.50 MDL Number: MFCD00010982 InChI Key: KBQHZAAAGSGFKK-UHFFFAOYSA-N Synonym: ingot reo,disprosio,atom,ion,ingot,pieces,powder,foil, 3n,chips, 3n,ingot, 3n PubChem CID: 23912 ChEBI: CHEBI:33377 IUPAC Name: dysprosium SMILES: [Dy]
| PubChem CID | 23912 |
|---|---|
| CAS | 7429-91-6 |
| Molecular Weight (g/mol) | 162.50 |
| ChEBI | CHEBI:33377 |
| MDL Number | MFCD00010982 |
| SMILES | [Dy] |
| Synonym | ingot reo,disprosio,atom,ion,ingot,pieces,powder,foil, 3n,chips, 3n,ingot, 3n |
| IUPAC Name | dysprosium |
| InChI Key | KBQHZAAAGSGFKK-UHFFFAOYSA-N |
| Molecular Formula | Dy |
Holmium pieces, distilled dendritic, 99.9% (REO)
CAS: 7440-60-0 Molecular Formula: Ho Molecular Weight (g/mol): 164.93 MDL Number: MFCD00011049 InChI Key: KJZYNXUDTRRSPN-UHFFFAOYSA-N Synonym: atom,unii-w1xx32sqn1,w1xx32sqn1,foil,holmio,chips,ingot,pieces,powder,acmc-1c9ym PubChem CID: 23988 ChEBI: CHEBI:49648 IUPAC Name: holmium SMILES: [Ho]
| PubChem CID | 23988 |
|---|---|
| CAS | 7440-60-0 |
| Molecular Weight (g/mol) | 164.93 |
| ChEBI | CHEBI:49648 |
| MDL Number | MFCD00011049 |
| SMILES | [Ho] |
| Synonym | atom,unii-w1xx32sqn1,w1xx32sqn1,foil,holmio,chips,ingot,pieces,powder,acmc-1c9ym |
| IUPAC Name | holmium |
| InChI Key | KJZYNXUDTRRSPN-UHFFFAOYSA-N |
| Molecular Formula | Ho |
Potassium hydroxide, pure, 8N solution in water
CAS: 1310-58-3 Molecular Formula: HKO Molecular Weight (g/mol): 56.11 MDL Number: MFCD00003553 InChI Key: KWYUFKZDYYNOTN-UHFFFAOYSA-M Synonym: potassium hydroxide,caustic potash,potash lye,potassium hydrate,hydroxyde de potassium,potassa,potasse caustique,potassium hydroxide k oh,potassium hydroxide solution,caswell no. 693 PubChem CID: 14797 ChEBI: CHEBI:32035 SMILES: [OH-].[K+]
| PubChem CID | 14797 |
|---|---|
| CAS | 1310-58-3 |
| Molecular Weight (g/mol) | 56.11 |
| ChEBI | CHEBI:32035 |
| MDL Number | MFCD00003553 |
| SMILES | [OH-].[K+] |
| Synonym | potassium hydroxide,caustic potash,potash lye,potassium hydrate,hydroxyde de potassium,potassa,potasse caustique,potassium hydroxide k oh,potassium hydroxide solution,caswell no. 693 |
| InChI Key | KWYUFKZDYYNOTN-UHFFFAOYSA-M |
| Molecular Formula | HKO |
Scandium pieces, distilled dendritic, 99.9% (REO)
CAS: 7440-20-2 Molecular Formula: Sc Molecular Weight (g/mol): 44.96 MDL Number: MFCD00016323 InChI Key: SIXSYDAISGFNSX-UHFFFAOYSA-N Synonym: unii-yuj4u1ew7r,yuj4u1ew7r,escandio,skandium,atom,powder,ingot,nitrate solution,standard for aas,scandium, lump, vacuum remelted PubChem CID: 23952 ChEBI: CHEBI:33330 IUPAC Name: scandium SMILES: [Sc]
| PubChem CID | 23952 |
|---|---|
| CAS | 7440-20-2 |
| Molecular Weight (g/mol) | 44.96 |
| ChEBI | CHEBI:33330 |
| MDL Number | MFCD00016323 |
| SMILES | [Sc] |
| Synonym | unii-yuj4u1ew7r,yuj4u1ew7r,escandio,skandium,atom,powder,ingot,nitrate solution,standard for aas,scandium, lump, vacuum remelted |
| IUPAC Name | scandium |
| InChI Key | SIXSYDAISGFNSX-UHFFFAOYSA-N |
| Molecular Formula | Sc |
Ammonium sulfide, 20% solution in water
CAS: 12135-76-1 Molecular Formula: H8N2S Molecular Weight (g/mol): 68.14 MDL Number: MFCD00010892 InChI Key: UXXGWUQNRMPNKH-UHFFFAOYSA-N IUPAC Name: diamine sulfane SMILES: N.N.S
| CAS | 12135-76-1 |
|---|---|
| Molecular Weight (g/mol) | 68.14 |
| MDL Number | MFCD00010892 |
| SMILES | N.N.S |
| IUPAC Name | diamine sulfane |
| InChI Key | UXXGWUQNRMPNKH-UHFFFAOYSA-N |
| Molecular Formula | H8N2S |
Erbium pieces, distilled dendritic, 99.9% (REO), Thermo Scientific Chemicals
CAS: 7440-52-0 Molecular Formula: Er Molecular Weight (g/mol): 167.26 MDL Number: MFCD00010987 InChI Key: UYAHIZSMUZPPFV-UHFFFAOYSA-N Synonym: unii-77b218d3ye,foil,iii ion,erbio,pieces,powder,chips,ingot,er3,pieces, distilled dendritic PubChem CID: 23980 ChEBI: CHEBI:33379 IUPAC Name: erbium SMILES: [Er]
| PubChem CID | 23980 |
|---|---|
| CAS | 7440-52-0 |
| Molecular Weight (g/mol) | 167.26 |
| ChEBI | CHEBI:33379 |
| MDL Number | MFCD00010987 |
| SMILES | [Er] |
| Synonym | unii-77b218d3ye,foil,iii ion,erbio,pieces,powder,chips,ingot,er3,pieces, distilled dendritic |
| IUPAC Name | erbium |
| InChI Key | UYAHIZSMUZPPFV-UHFFFAOYSA-N |
| Molecular Formula | Er |
Strontium, distilled dendritic pieces, 99.95% (metals basis)
CAS: 7440-24-6 Molecular Formula: Sr Molecular Weight (g/mol): 87.62 MDL Number: MFCD00134060 InChI Key: CIOAGBVUUVVLOB-UHFFFAOYSA-N Synonym: strontium, elemental,unii-yzs2rpe8le,yzs2rpe8le,estroncio,granules, 19mm 0.76in & down metals basis,strontium, distilled dendritic pieces,atom,pieces,strontium, chunks,pieces, dendritic PubChem CID: 5359327 ChEBI: CHEBI:33324 IUPAC Name: strontium SMILES: [Sr]
| PubChem CID | 5359327 |
|---|---|
| CAS | 7440-24-6 |
| Molecular Weight (g/mol) | 87.62 |
| ChEBI | CHEBI:33324 |
| MDL Number | MFCD00134060 |
| SMILES | [Sr] |
| Synonym | strontium, elemental,unii-yzs2rpe8le,yzs2rpe8le,estroncio,granules, 19mm 0.76in & down metals basis,strontium, distilled dendritic pieces,atom,pieces,strontium, chunks,pieces, dendritic |
| IUPAC Name | strontium |
| InChI Key | CIOAGBVUUVVLOB-UHFFFAOYSA-N |
| Molecular Formula | Sr |
| Linear Formula | K2HPO4 |
|---|---|
| Molecular Weight (g/mol) | 174.18 |
| ChEBI | CHEBI:32031 |
| Chemical Name or Material | Potassium phosphate, dibasic |
| SMILES | OP(=O)([O-])[O-].[K+].[K+] |
| Merck Index | 15, 7779 |
| InChI Key | ZPWVASYFFYYZEW-UHFFFAOYSA-L |
| Density | 1.1300g/mL |
| Appearance | Clear colorless solution |
| PubChem CID | 24450 |
| Concentration or Composition (by Analyte or Components) | 1.0M, exact strength on the certificate of analysis |
| CAS | 7732-18-5 |
| MDL Number | MFCD00011383 |
| Packaging | Glass bottle |
| Synonym | dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate |
| IUPAC Name | dipotassium;hydrogen phosphate |
| Molecular Formula | HK2O4P |
| EINECS Number | 231-834-5 |
| Formula Weight | 174.18 |
| Specific Gravity | 1.13 |
Copper(II)-ethylenediamine complex, 1M solution in water
CAS: 14552-35-3 | C4H18CuN4O2 | 217.76 g/mol
| Linear Formula | Cu(H2NCH2CH2NH2)2(OH)2 |
|---|---|
| Molecular Weight (g/mol) | 217.76 |
| Chemical Name or Material | Copper(II)-ethylenediamine complex |
| Density | 1.1000g/mL |
| Name Note | 1M Solution in Water |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00274628 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. |
| Packaging | Glass bottle |
| Solubility Information | Solubility in water: soluble |
| Flash Point | >110°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | Bis(ethylenediamine)copper(II)hydroxide |
| TSCA | TSCA |
| Molecular Formula | C4H18CuN4O2 |
| EINECS Number | 238-597-7 |
| Formula Weight | 217.76 |
| Specific Gravity | 1.1 |
Hydrogen peroxide, for analysis, 35 wt.% solution in water, stabilized
CAS: 7722-84-1 Molecular Formula: H2O2 Molecular Weight (g/mol): 34 MDL Number: MFCD00011333 InChI Key: MHAJPDPJQMAIIY-UHFFFAOYSA-N Synonym: oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone PubChem CID: 784 ChEBI: CHEBI:16240 IUPAC Name: hydrogen peroxide SMILES: OO
| PubChem CID | 784 |
|---|---|
| CAS | 7722-84-1 |
| Molecular Weight (g/mol) | 34 |
| ChEBI | CHEBI:16240 |
| MDL Number | MFCD00011333 |
| SMILES | OO |
| Synonym | oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone |
| IUPAC Name | hydrogen peroxide |
| InChI Key | MHAJPDPJQMAIIY-UHFFFAOYSA-N |
| Molecular Formula | H2O2 |
Mercury, Triple Distilled, Avantor ANALYZED™ A.C.S. Reagent, Avantor™
CAS: 7439-97-6 Molecular Formula: Hg Molecular Weight (g/mol): 200.59 MDL Number: MFCD00011035 InChI Key: QSHDDOUJBYECFT-UHFFFAOYSA-N Synonym: hydrargyrum,quicksilver,metallic,liquid silver,mercurio,quecksilber,mercure,quick silver,colloidal,mercury, metallic PubChem CID: 23931 ChEBI: CHEBI:16170 IUPAC Name: mercury SMILES: [Hg]
| PubChem CID | 23931 |
|---|---|
| CAS | 7439-97-6 |
| Molecular Weight (g/mol) | 200.59 |
| ChEBI | CHEBI:16170 |
| MDL Number | MFCD00011035 |
| SMILES | [Hg] |
| Synonym | hydrargyrum,quicksilver,metallic,liquid silver,mercurio,quecksilber,mercure,quick silver,colloidal,mercury, metallic |
| IUPAC Name | mercury |
| InChI Key | QSHDDOUJBYECFT-UHFFFAOYSA-N |
| Molecular Formula | Hg |
| Linear Formula | OsO4 |
|---|---|
| Molecular Weight (g/mol) | 254.23 |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Density | 1.0400g/mL |
| PubChem CID | 30318 |
| Fieser | 01,759; 02,301; 04,361; 05,141; 06,424; 10,290; 12,358; 13,186; 14,235; 15,240; 16,249; 17,236 |
| RTECS Number | RN1140000 |
| Formula Weight | 254.2 |
| Boiling Point | 100.0°C |
| Color | Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Osmium tetroxide |
| SMILES | O=[Os](=O)(=O)=O |
| Merck Index | 15, 6990 |
| Concentration or Composition (by Analyte or Components) | 3.92 to 4.08% |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Immediately call a POISON CENTER or doctor/physician. IF INHALED: Remove to fresh air a |
| MDL Number | MFCD00011150 |
| Health Hazard 2 | GHS H Statement Causes serious eye damage. Fatal in contact with skin. Harmful if swallowed. Causes skin irritation. Harmful if inhaled. May cause allergy or asthma symptoms or breathing difficulties if inhaled. |
| Packaging | Glass bottle |
| Solubility Information | Solubility in water: soluble |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| TSCA | TSCA |
| IUPAC Name | tetraoxoosmium |
| Molecular Formula | O4Os |
| EINECS Number | 244-058-7 |
| Specific Gravity | 1.04 |