Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Tantalum disilicide
CAS: 12039-79-1 Molecular Formula: Si2Ta Molecular Weight (g/mol): 237.118 MDL Number: MFCD00049564 InChI Key: MANYRMJQFFSZKJ-UHFFFAOYSA-N Synonym: tantalum disilicide,tantalum silicide tasi2,tantalum silicide, tasi2 PubChem CID: 6336888 IUPAC Name: bis($l^{2}-silanylidene)tantalum SMILES: [Si]=[Ta]=[Si]
| PubChem CID | 6336888 |
|---|---|
| CAS | 12039-79-1 |
| Molecular Weight (g/mol) | 237.118 |
| MDL Number | MFCD00049564 |
| SMILES | [Si]=[Ta]=[Si] |
| Synonym | tantalum disilicide,tantalum silicide tasi2,tantalum silicide, tasi2 |
| IUPAC Name | bis($l^{2}-silanylidene)tantalum |
| InChI Key | MANYRMJQFFSZKJ-UHFFFAOYSA-N |
| Molecular Formula | Si2Ta |
Tantalum(V) ethoxide, 99+%
CAS: 6074-84-6 Molecular Formula: C10H25O5Ta Molecular Weight (g/mol): 406.25 MDL Number: MFCD00049785 InChI Key: HSXKFDGTKKAEHL-UHFFFAOYSA-N Synonym: tantalum v ethoxide,tantalum 5+ ethanolate,tantalum ethoxide,tantalum 5+ pentaethanolate,ethanol, tantalum 5+ salt,pentaethoxytantalum v,ethanol, tantalum 5+ salt 5:1,tantalum ethylate,pentaethyl tantalate,tantalum pentaethoxide PubChem CID: 160806 SMILES: CCO[Ta](OCC)(OCC)(OCC)OCC
| PubChem CID | 160806 |
|---|---|
| CAS | 6074-84-6 |
| Molecular Weight (g/mol) | 406.25 |
| MDL Number | MFCD00049785 |
| SMILES | CCO[Ta](OCC)(OCC)(OCC)OCC |
| Synonym | tantalum v ethoxide,tantalum 5+ ethanolate,tantalum ethoxide,tantalum 5+ pentaethanolate,ethanol, tantalum 5+ salt,pentaethoxytantalum v,ethanol, tantalum 5+ salt 5:1,tantalum ethylate,pentaethyl tantalate,tantalum pentaethoxide |
| InChI Key | HSXKFDGTKKAEHL-UHFFFAOYSA-N |
| Molecular Formula | C10H25O5Ta |
Tantalum nitride, 99.5% (metals basis)
CAS: 12033-62-4 Molecular Formula: NTa Molecular Weight (g/mol): 194.955 MDL Number: MFCD00049568 InChI Key: MZLGASXMSKOWSE-UHFFFAOYSA-N Synonym: tantalum nitride,tantalum nitride tan,tantalum mononitride,tantalum nitride trace metals basis 10g PubChem CID: 82832 IUPAC Name: azanylidynetantalum SMILES: N#[Ta]
| PubChem CID | 82832 |
|---|---|
| CAS | 12033-62-4 |
| Molecular Weight (g/mol) | 194.955 |
| MDL Number | MFCD00049568 |
| SMILES | N#[Ta] |
| Synonym | tantalum nitride,tantalum nitride tan,tantalum mononitride,tantalum nitride trace metals basis 10g |
| IUPAC Name | azanylidynetantalum |
| InChI Key | MZLGASXMSKOWSE-UHFFFAOYSA-N |
| Molecular Formula | NTa |
Tantalum carbide, 99.5% (metals basis)
CAS: 12070-06-3 Molecular Formula: CTa Molecular Weight (g/mol): 192.96 MDL Number: MFCD00011255 InChI Key: DUMHRFXBHXIRTD-UHFFFAOYSA-N IUPAC Name: methanidylidynetantalumylium SMILES: [C-]#[Ta+]
| CAS | 12070-06-3 |
|---|---|
| Molecular Weight (g/mol) | 192.96 |
| MDL Number | MFCD00011255 |
| SMILES | [C-]#[Ta+] |
| IUPAC Name | methanidylidynetantalumylium |
| InChI Key | DUMHRFXBHXIRTD-UHFFFAOYSA-N |
| Molecular Formula | CTa |
Tantalum(V) fluoride, 99.9% (metals basis)
CAS: 7783-71-3 Molecular Formula: F5Ta Molecular Weight (g/mol): 275.94 MDL Number: MFCD00042542 InChI Key: YRGLXIVYESZPLQ-UHFFFAOYSA-I Synonym: tantalum pentafluoride,tantalum v fluoride,tantalum fluoride,tantalum fluoride taf5,taf5 PubChem CID: 82218 IUPAC Name: pentafluorotantalum SMILES: F[Ta](F)(F)(F)F
| PubChem CID | 82218 |
|---|---|
| CAS | 7783-71-3 |
| Molecular Weight (g/mol) | 275.94 |
| MDL Number | MFCD00042542 |
| SMILES | F[Ta](F)(F)(F)F |
| Synonym | tantalum pentafluoride,tantalum v fluoride,tantalum fluoride,tantalum fluoride taf5,taf5 |
| IUPAC Name | pentafluorotantalum |
| InChI Key | YRGLXIVYESZPLQ-UHFFFAOYSA-I |
| Molecular Formula | F5Ta |
Tantalum(V) bromide, 99.9% (metals basis)
CAS: 13451-11-1 Molecular Formula: Br5Ta Molecular Weight (g/mol): 580.468 MDL Number: MFCD00049563 InChI Key: GCPVYIPZZUPXPB-UHFFFAOYSA-I Synonym: tantalum pentabromide,tantalum bromide tabr5,tantalum v bromide,tantalum 5+ pentabromide,tabr5 PubChem CID: 83480 IUPAC Name: pentabromotantalum SMILES: Br[Ta](Br)(Br)(Br)Br
| PubChem CID | 83480 |
|---|---|
| CAS | 13451-11-1 |
| Molecular Weight (g/mol) | 580.468 |
| MDL Number | MFCD00049563 |
| SMILES | Br[Ta](Br)(Br)(Br)Br |
| Synonym | tantalum pentabromide,tantalum bromide tabr5,tantalum v bromide,tantalum 5+ pentabromide,tabr5 |
| IUPAC Name | pentabromotantalum |
| InChI Key | GCPVYIPZZUPXPB-UHFFFAOYSA-I |
| Molecular Formula | Br5Ta |
Tantalum(V) oxide, 99.85% (metals basis)
CAS: 1314-61-0 Molecular Formula: O5Ta2 Molecular Weight (g/mol): 441.89 MDL Number: MFCD00011254 InChI Key: PBCFLUZVCVVTBY-UHFFFAOYSA-N IUPAC Name: [(dioxotantalio)oxy]dioxotantalum SMILES: O=[Ta](=O)O[Ta](=O)=O
| CAS | 1314-61-0 |
|---|---|
| Molecular Weight (g/mol) | 441.89 |
| MDL Number | MFCD00011254 |
| SMILES | O=[Ta](=O)O[Ta](=O)=O |
| IUPAC Name | [(dioxotantalio)oxy]dioxotantalum |
| InChI Key | PBCFLUZVCVVTBY-UHFFFAOYSA-N |
| Molecular Formula | O5Ta2 |
Tantalum(V) oxide, 99% (metals basis)
CAS: 1314-61-0 Molecular Formula: O5Ta2 Molecular Weight (g/mol): 441.89 MDL Number: MFCD00011254 InChI Key: PBCFLUZVCVVTBY-UHFFFAOYSA-N Synonym: Tantalum pentoxide IUPAC Name: [(dioxotantalio)oxy]dioxotantalum SMILES: O=[Ta](=O)O[Ta](=O)=O
| CAS | 1314-61-0 |
|---|---|
| Molecular Weight (g/mol) | 441.89 |
| MDL Number | MFCD00011254 |
| SMILES | O=[Ta](=O)O[Ta](=O)=O |
| Synonym | Tantalum pentoxide |
| IUPAC Name | [(dioxotantalio)oxy]dioxotantalum |
| InChI Key | PBCFLUZVCVVTBY-UHFFFAOYSA-N |
| Molecular Formula | O5Ta2 |
Tantalum(V) chloride, 99.8% (metals basis)
CAS: 7721-01-9 Molecular Formula: Cl5Ta Molecular Weight (g/mol): 358.20 MDL Number: MFCD00011253 InChI Key: OEIMLTQPLAGXMX-UHFFFAOYSA-I Synonym: Tantalum pentachloride IUPAC Name: tantalum(5+) pentachloride SMILES: [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Ta+5]
| CAS | 7721-01-9 |
|---|---|
| Molecular Weight (g/mol) | 358.20 |
| MDL Number | MFCD00011253 |
| SMILES | [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Ta+5] |
| Synonym | Tantalum pentachloride |
| IUPAC Name | tantalum(5+) pentachloride |
| InChI Key | OEIMLTQPLAGXMX-UHFFFAOYSA-I |
| Molecular Formula | Cl5Ta |
Lithium tantalum oxide, 99.9% (metals basis)
CAS: 12031-66-2 Molecular Formula: LiO3Ta Molecular Weight (g/mol): 235.88 MDL Number: MFCD00016174 InChI Key: JNQQEOHHHGGZCY-UHFFFAOYSA-N Synonym: lithium tantalate,lithium oxido dioxo tantalum,lithium 1+ tantalumoylolate PubChem CID: 5148101 IUPAC Name: lithium;oxido(dioxo)tantalum SMILES: [Li+].[O--].[O--].[O--].[Ta+5]
| PubChem CID | 5148101 |
|---|---|
| CAS | 12031-66-2 |
| Molecular Weight (g/mol) | 235.88 |
| MDL Number | MFCD00016174 |
| SMILES | [Li+].[O--].[O--].[O--].[Ta+5] |
| Synonym | lithium tantalate,lithium oxido dioxo tantalum,lithium 1+ tantalumoylolate |
| IUPAC Name | lithium;oxido(dioxo)tantalum |
| InChI Key | JNQQEOHHHGGZCY-UHFFFAOYSA-N |
| Molecular Formula | LiO3Ta |
Tantalum(V) chloride, 99.99%, (trace metal basis)
CAS: 7721-01-9 Molecular Formula: Cl5Ta Molecular Weight (g/mol): 358.20 MDL Number: MFCD00011253 InChI Key: OEIMLTQPLAGXMX-UHFFFAOYSA-I IUPAC Name: tantalum(5+) pentachloride SMILES: [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Ta+5]
| CAS | 7721-01-9 |
|---|---|
| Molecular Weight (g/mol) | 358.20 |
| MDL Number | MFCD00011253 |
| SMILES | [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Ta+5] |
| IUPAC Name | tantalum(5+) pentachloride |
| InChI Key | OEIMLTQPLAGXMX-UHFFFAOYSA-I |
| Molecular Formula | Cl5Ta |
Tantalum powder, APS ^=2 micron, 99.9% (metals basis)
CAS: 7440-25-7 Molecular Formula: Ta Molecular Weight (g/mol): 180.95 MDL Number: MFCD00011252 InChI Key: GUVRBAGPIYLISA-UHFFFAOYSA-N Synonym: tantalum, elemental,hydride,tantalum-181,tantalum, metal and oxide dust,tantal,tantalum, metal,powder,foil,wire,rod PubChem CID: 23956 ChEBI: CHEBI:33348 IUPAC Name: tantalum SMILES: [Ta]
| PubChem CID | 23956 |
|---|---|
| CAS | 7440-25-7 |
| Molecular Weight (g/mol) | 180.95 |
| ChEBI | CHEBI:33348 |
| MDL Number | MFCD00011252 |
| SMILES | [Ta] |
| Synonym | tantalum, elemental,hydride,tantalum-181,tantalum, metal and oxide dust,tantal,tantalum, metal,powder,foil,wire,rod |
| IUPAC Name | tantalum |
| InChI Key | GUVRBAGPIYLISA-UHFFFAOYSA-N |
| Molecular Formula | Ta |
Tantalum(V) oxide, 99.99%, (trace metal basis)
CAS: 1314-61-0 Molecular Formula: O5Ta2 Molecular Weight (g/mol): 441.89 MDL Number: MFCD00011254 InChI Key: PBCFLUZVCVVTBY-UHFFFAOYSA-N IUPAC Name: [(dioxotantalio)oxy]dioxotantalum SMILES: O=[Ta](=O)O[Ta](=O)=O
| CAS | 1314-61-0 |
|---|---|
| Molecular Weight (g/mol) | 441.89 |
| MDL Number | MFCD00011254 |
| SMILES | O=[Ta](=O)O[Ta](=O)=O |
| IUPAC Name | [(dioxotantalio)oxy]dioxotantalum |
| InChI Key | PBCFLUZVCVVTBY-UHFFFAOYSA-N |
| Molecular Formula | O5Ta2 |
Tantalum foil, 0.025mm (0.001in) thick, hard, 99.95% (metals basis)
CAS: 7440-25-7 Molecular Formula: Ta Molecular Weight (g/mol): 180.95 MDL Number: MFCD00011252 InChI Key: GUVRBAGPIYLISA-UHFFFAOYSA-N Synonym: tantalum, elemental,hydride,tantalum-181,tantalum, metal and oxide dust,tantal,tantalum, metal,powder,foil,wire,rod PubChem CID: 23956 ChEBI: CHEBI:33348 IUPAC Name: tantalum SMILES: [Ta]
| PubChem CID | 23956 |
|---|---|
| CAS | 7440-25-7 |
| Molecular Weight (g/mol) | 180.95 |
| ChEBI | CHEBI:33348 |
| MDL Number | MFCD00011252 |
| SMILES | [Ta] |
| Synonym | tantalum, elemental,hydride,tantalum-181,tantalum, metal and oxide dust,tantal,tantalum, metal,powder,foil,wire,rod |
| IUPAC Name | tantalum |
| InChI Key | GUVRBAGPIYLISA-UHFFFAOYSA-N |
| Molecular Formula | Ta |
Tantalum(V) chloride, Puratronic™, 99.99% (metals basis)
CAS: 7721-01-9 Molecular Formula: Cl5Ta Molecular Weight (g/mol): 358.20 MDL Number: MFCD00011253 InChI Key: OEIMLTQPLAGXMX-UHFFFAOYSA-I IUPAC Name: tantalum(5+) pentachloride SMILES: [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Ta+5]
| CAS | 7721-01-9 |
|---|---|
| Molecular Weight (g/mol) | 358.20 |
| MDL Number | MFCD00011253 |
| SMILES | [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Ta+5] |
| IUPAC Name | tantalum(5+) pentachloride |
| InChI Key | OEIMLTQPLAGXMX-UHFFFAOYSA-I |
| Molecular Formula | Cl5Ta |