Organic sodium salts
AdipoGen TrisDEAcyclopropenylium DICY
Chemical. CAS 1415962-26-3. Formula C17H30N6. MW 318.46. Synthetic Ionic liquid. The properties of these ionic liquids include almost zero vapour pressure, low flammability and ease of recycling. They are frequently considered as potential green alternatives to classical organic solvents. Additionally, most classes can be readily tuned to provide unique solvent environments in which to carry out reactions, extractions and other processes. There are a large number of applications.
eMolecules 865-47-4 | Potassium tert-butoxide | Oakwood Chemical | MFCD00012162 | 112.213 | C4H9KO | 99.000 | [K+].CC(C)(C)[O-] | 50g | 537698668
Potassium tert-butoxide | Oakwood Chemical | 865-47-4 | MFCD00012162 | 112.213 | C4H9KO | 99.000 | [K+].CC(C)(C)[O-] | 50g | 537698668
![eMolecules 865-47-4 | Potassium tert-butoxide 20% solution in tetrahydrofuran | Oakwood Chemical | MFCD00012162 | 112.213 | C4H9KO | 0.000 | [K+].CC(C)(C)[O-] | 25g | 537708080](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000488339.jpg-250.jpg)
eMolecules 865-47-4 | Potassium tert-butoxide 20% solution in tetrahydrofuran | Oakwood Chemical | MFCD00012162 | 112.213 | C4H9KO | 0.000 | [K+].CC(C)(C)[O-] | 25g | 537708080
Potassium tert-butoxide 20% solution in tetrahydrofuran | Oakwood Chemical | 865-47-4 | MFCD00012162 | 112.213 | C4H9KO | 0.000 | [K+].CC(C)(C)[O-] | 25g | 537708080
![eMolecules 63451-29-6 | Ferrozine mono-sodium salt hydrate | Combi-Blocks | MFCD00150794 | 510.470 | C20H15N4NaO7S2 | 95.000 | O.[Na+].OS(=O)(=O)c1ccc(cc1)-c1nnc(nc1-c1ccc(cc1)S([O-])(=O)=O)-c1ccccn1 | 1g | 388720031](https://assets.fishersci.com/TFS-Assets/CCG/product-images/VN00128114-388720031.PNG-250.jpg)
eMolecules 63451-29-6 | Ferrozine mono-sodium salt hydrate | Combi-Blocks | MFCD00150794 | 510.470 | C20H15N4NaO7S2 | 95.000 | O.[Na+].OS(=O)(=O)c1ccc(cc1)-c1nnc(nc1-c1ccc(cc1)S([O-])(=O)=O)-c1ccccn1 | 1g | 388720031
Ferrozine mono-sodium salt hydrate | Combi-Blocks | 63451-29-6 | MFCD00150794 | 510.470 | C20H15N4NaO7S2 | 95.000 | O.[Na+].OS(=O)(=O)c1ccc(cc1)-c1nnc(nc1-c1ccc(cc1)S([O-])(=O)=O)-c1ccccn1 | 1g | 388720031
Chem-Impex International, Inc. Sodium tert-butoxide | MFCD00040575 | 25G
Sodium tert-butoxide, MFCD00040575, 25G
Chem-Impex International, Inc. Sodium tert-butoxide | MFCD00040575 | 100G
Sodium tert-butoxide, MFCD00040575, 100G
Sigma Aldrich Fine Chemicals Biosciences rac-Glycerol 1-phosphate sodium salt hydrate >=95.0% (TLC) | 17603-42-8 (anhydrous) | MFCD00152510 | 1G
rac-Glycerol 1-phosphate sodium salt hydrate >=95.0% (TLC) | Purity: >=95.0% (TLC); 95-102% anhydrous basis (corrected for sodium, T) | 17603-42-8 (anhydrous) | MFCD00152510 | 1G
Sigma Aldrich Fine Chemicals Biosciences Heparin sodium salt from porcine intestinal mucosa | 9041-08-1 | MFCD00081689 | 10vl
Heparin sodium salt from porcine intestinal mucosa | 9041-08-1 | MFCD00081689 | 10vl
Sigma Aldrich Fine Chemicals Biosciences MES hemisodium salt >=98% (titration) | 117961-21-4 | MFCD00079460 | 25G
MES hemisodium salt >=98% (titration) | Purity: >=98% (titration) | Mol Wt: 206.73 | 117961-21-4 | MFCD00079460 | 25G
![eMolecules 29548-72-9 | Fluoromalonaldehyde, sodium salt | Apollo Scientific | MFCD20265627 | 112.035 | C3H2FNaO2 | 95.000 | [Na+].[O-]\C=C(/F)C=O | 1g | 562430526](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502154002.JPG-250.jpg)
eMolecules 29548-72-9 | Fluoromalonaldehyde, sodium salt | Apollo Scientific | MFCD20265627 | 112.035 | C3H2FNaO2 | 95.000 | [Na+].[O-]\C=C(/F)C=O | 1g | 562430526
Fluoromalonaldehyde, sodium salt | Apollo Scientific | 29548-72-9 | MFCD20265627 | 112.035 | C3H2FNaO2 | 95.000 | [Na+].[O-]\C=C(/F)C=O | 1g | 562430526
![eMolecules 20277-69-4 | Methanesulfinic acid, sodium salt | Oakwood Chemicals | MFCD00040392 | 102.080 | CH3NaO2S | 90.000 | [Na+].CS([O-])=O | 25g | 480099554](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000161054.jpg-250.jpg)
eMolecules 20277-69-4 | Methanesulfinic acid, sodium salt | Oakwood Chemicals | MFCD00040392 | 102.080 | CH3NaO2S | 90.000 | [Na+].CS([O-])=O | 25g | 480099554
Methanesulfinic acid, sodium salt | Oakwood Chemicals | 20277-69-4 | MFCD00040392 | 102.080 | CH3NaO2S | 90.000 | [Na+].CS([O-])=O | 25g | 480099554
![eMolecules 1907-33-1 | Lithium tert-butoxide | Oakwood Chemical | MFCD00050479 | 80.060 | C4H9LiO | 0.000 | [Li+].CC(C)(C)[O-] | 1g | 703157387](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000224033.jpg-250.jpg)
eMolecules 1907-33-1 | Lithium tert-butoxide | Oakwood Chemical | MFCD00050479 | 80.060 | C4H9LiO | 0.000 | [Li+].CC(C)(C)[O-] | 1g | 703157387
Lithium tert-butoxide | Oakwood Chemical | 1907-33-1 | MFCD00050479 | 80.060 | C4H9LiO | 0.000 | [Li+].CC(C)(C)[O-] | 1g | 703157387
![eMolecules 865-48-5 | Sodium tert-butoxide solution 2M in THF | Oakwood Chemicals | MFCD00040575 | 96.105 | C4H9NaO | 0.000 | [Na+].CC(C)(C)[O-] | 5g | 480149015](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000170084.jpg-250.jpg)
eMolecules 865-48-5 | Sodium tert-butoxide solution 2M in THF | Oakwood Chemicals | MFCD00040575 | 96.105 | C4H9NaO | 0.000 | [Na+].CC(C)(C)[O-] | 5g | 480149015
Sodium tert-butoxide solution 2M in THF | Oakwood Chemicals | 865-48-5 | MFCD00040575 | 96.105 | C4H9NaO | 0.000 | [Na+].CC(C)(C)[O-] | 5g | 480149015