Organoiodides
Medchemexpress LLC AF-353 (Ro-4) | 865305-30-2 | 99.4% | C14H17IN4O2 | 1 ML
AF-353 (Ro-4) is a potent, selective, and orally bioavailable P2X3/P2X2/3 receptor antagonist. It inhibits α,β-meATP-evoked intracellular calcium flux and reduces the purinergic response in both normal and spinal cord-injured rats.
- Potent and selective P2X3/P2X2/3 receptor antagonist
- Orally bioavailable
- Inhibits intracellular calcium flux
- Reduces purinergic response in normal and SCI rats
- Does not compromise oxygen levels or cardiac function
Aobchem 1 5-Dichloro-2 4-difluoro-3-iodobenzene | 97% | CAS 679836-61-4 | C6HCl2F2I | 500mg
1 5-Dichloro-2 4-difluoro-3-iodobenzene | 97% | CAS 679836-61-4 | C6HCl2F2I | 500mg
Aobchem 2-Bromo-1 3-diethoxy-5-fluorobenzene | 95% | CAS 2167638-10-8 | C10H12BrFO2 | 1g
2-Bromo-1 3-diethoxy-5-fluorobenzene | 95% | CAS 2167638-10-8 | C10H12BrFO2 | 1g
Aobchem 2-Bromo-1 3-diethoxy-5-fluorobenzene | 95% | CAS 2167638-10-8 | C10H12BrFO2 | 5g
2-Bromo-1 3-diethoxy-5-fluorobenzene | 95% | CAS 2167638-10-8 | C10H12BrFO2 | 5g
Aobchem 1-Bromo-2 4-diethoxy-3-fluorobenzene | 97% | CAS 2807466-25-5 | C10H12BrFO2 | 5g
1-Bromo-2 4-diethoxy-3-fluorobenzene | 97% | CAS 2807466-25-5 | C10H12BrFO2 | 5g
Aobchem Allyl(4-bromophenyl)sulfane | 97% | CAS 6334-55-0 | C9H9BrS | 10g
Allyl(4-bromophenyl)sulfane | 97% | CAS 6334-55-0 | C9H9BrS | 10g
Aobchem 2 4-Diethoxy-3-methylbenzaldehyde | ≥95% | CAS 162976-08-1 | C12H16O3 | 250mg
2 4-Diethoxy-3-methylbenzaldehyde | ≥95% | CAS 162976-08-1 | C12H16O3 | 250mg
Aobchem Allyl(4-bromophenyl)sulfane | 97% | CAS 6334-55-0 | C9H9BrS | 1g
Allyl(4-bromophenyl)sulfane | 97% | CAS 6334-55-0 | C9H9BrS | 1g
eMolecules 375-48-4 | Perfluorobutyl bromide | Apollo Scientific | MFCD00082622 | 298.934 | C4BrF9 | 97.000 | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)Br | 1g | 573019522
Perfluorobutyl bromide | Apollo Scientific | 375-48-4 | MFCD00082622 | 298.934 | C4BrF9 | 97.000 | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)Br | 1g | 573019522