Organophosphorus compounds
eMolecules 16858-01-8 | Tris(2-pyridylmethyl)amine | AA Blocks LLC | MFCD14708176 | 290.370 | C18H18N4 | 0.000 | C(N(Cc1ccccn1)Cc1ccccn1)c1ccccn1 | 1g | 433192296
Tris(2-pyridylmethyl)amine | AA Blocks LLC | 16858-01-8 | MFCD14708176 | 290.370 | C18H18N4 | 0.000 | C(N(Cc1ccccn1)Cc1ccccn1)c1ccccn1 | 1g | 433192296
eMolecules 224311-51-7 | 2-(Di-tert-butylphosphino)biphenyl | AA Blocks LLC | MFCD01862440 | 298.410 | C20H27P | 0.000 | CC(C)(C)P(c1ccccc1-c1ccccc1)C(C)(C)C | 10g | 410163813
2-(Di-tert-butylphosphino)biphenyl | AA Blocks LLC | 224311-51-7 | MFCD01862440 | 298.410 | C20H27P | 0.000 | CC(C)(C)P(c1ccccc1-c1ccccc1)C(C)(C)C | 10g | 410163813
eMolecules 224311-51-7 | 2-(Di-tert-butylphosphino)biphenyl | AA Blocks LLC | MFCD01862440 | 298.410 | C20H27P | 0.000 | CC(C)(C)P(c1ccccc1-c1ccccc1)C(C)(C)C | 100g | 410163815
2-(Di-tert-butylphosphino)biphenyl | AA Blocks LLC | 224311-51-7 | MFCD01862440 | 298.410 | C20H27P | 0.000 | CC(C)(C)P(c1ccccc1-c1ccccc1)C(C)(C)C | 100g | 410163815
eMolecules 1599466-81-5 | XPHOS PD G4 | AstaTech | MFCD28411652 | 860.490 | C47H64NO3PPdS | 95.000 | CS([O-])(=O)=O.CNc1ccccc1-c1ccccc1[Pd+].CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 5g | 449762969
XPHOS PD G4 | AstaTech | 1599466-81-5 | MFCD28411652 | 860.490 | C47H64NO3PPdS | 95.000 | CS([O-])(=O)=O.CNc1ccccc1-c1ccccc1[Pd+].CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 5g | 449762969
eMolecules 1160861-53-9 | 2-(Di-t-butylphosphino)-3,6-dimethoxy-2',4',6'-tri-i-propyl-1,1'-biphenyl | Oakwood Chemical | MFCD13181930 | 484.705 | C31H49O2P | 97.000 | COc1ccc(OC)c(c1P(C(C)(C)C)C(C)(C)C)-c1c(cc(cc1C(C)C)C(C)C)C(C)C | 1g | 791206902
2-(Di-t-butylphosphino)-3,6-dimethoxy-2',4',6'-tri-i-propyl-1,1'-biphenyl | Oakwood Chemical | 1160861-53-9 | MFCD13181930 | 484.705 | C31H49O2P | 97.000 | COc1ccc(OC)c(c1P(C(C)(C)C)C(C)(C)C)-c1c(cc(cc1C(C)C)C(C)C)C(C)C | 1g | 791206902
Strem, An Ascensus Company CAS# 29934-17-6. 1g. trans-Dichlorobis(tricyclohexylphosphine)palladium(II), 99%. MFCD00191830
CAS# 29934-17-6. 1g. trans-Dichlorobis(tricyclohexylphosphine)palladium(II), 99%. MFCD00191830. Molecular Weight: 738.19. Molecular Formula: PdCl2[(C6H11)3P]2. Color/form: light yellow pwdr. Strem# 46-0520. http://www.strem.com/catalog/v/46-0520/
Chemscene ChemScene | Cyjohnphos | 25G | CS-W002849 | 0.98 | 247940-06-3| MFCD01862441 | 350.49
ChemScene | Cyjohnphos | 25G | CS-W002849 | 0.98 | 247940-06-3| MFCD01862441 | 350.49
![eMolecules 1788085-46-0 | Ambeed | rel-(2R3R)-2-[Bis(11-dimethylethyl)phosphinyl]-3-(11-dimethylethyl)-23-dihydro-4-methoxy-13-benzoxaphosphole | 100mg | 602849166 | A1149087 | 384.437 | C20H34O3P2](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502446373.PNG-250.jpg)
eMolecules 1788085-46-0 | Ambeed | rel-(2R3R)-2-[Bis(11-dimethylethyl)phosphinyl]-3-(11-dimethylethyl)-23-dihydro-4-methoxy-13-benzoxaphosphole | 100mg | 602849166 | A1149087 | 384.437 | C20H34O3P2
Medchem Express | Canertinib | 10mg | 459606683 | HY-10367 | 267243-28-7 | MFCD09837878 | 485.940 | C24H25ClFN5O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 787618-22-8 | 2-Dicyclohexylphosphino-2',6'-diisopropoxy-1,1'-biphenyl | Combi-Blocks | MFCD06798294 | 466.646 | C30H43O2P | 98.000 | CC(C)Oc1cccc(OC(C)C)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 5g | 290693811
2-Dicyclohexylphosphino-2',6'-diisopropoxy-1,1'-biphenyl | Combi-Blocks | 787618-22-8 | MFCD06798294 | 466.646 | C30H43O2P | 98.000 | CC(C)Oc1cccc(OC(C)C)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 5g | 290693811
Strem, An Ascensus Company CAS# 33309-88-5. Bis(tricyclohexylphosphine)palladium(0), 98%. MFCD01073796. 250MG.
CAS# 33309-88-5. 250MG. Bis(tricyclohexylphosphine)palladium(0), 98%. MFCD01073796. Molecular Formula: C36H66P2Pd Molecular Weight: 667.28. Color/Form: off-white xtl. Stability: air sensitive, store cold. Strem#: 46-0260 www.strem.com/catalog/v3/46-0260/
Strem, An Ascensus Company CAS# 16605-03-1. 500mg. 3-(Diphenylphosphino)propylamine, min. 97%. MFCD00233832
CAS# 16605-03-1. 500mg. 3-(Diphenylphosphino)propylamine, min. 97%. MFCD00233832. Molecular Weight: 243.28. Molecular Formula: (C6H5)2P(CH2)3NH2. Color/form: colorless to pale yellow liq. Strem# 15-1767. http://www.strem.com/catalog/v/15-1767/
Strem, An Ascensus Company (R)-(+)-5,5'-BIS(DIPHENYLPHOSP
(R)-(+)-5,5'-Bis(diphenylphosphino)-4,4'-bi-1,3-benzodioxole][4-cyano-3-nitrobenzenecarboxylato][1,2,3-n-2-propenyl]iridium(III), min. 97
eMolecules 564483-18-7 | 2-(Dicyclohexylphosphino)-2',4',6'-tri-i-propyl-1,1'-biphenyl | Synthonix - Stock | MFCD04117682 | 476.729 | C33H49P | 95.000 | CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 25g | 448042932
2-(Dicyclohexylphosphino)-2',4',6'-tri-i-propyl-1,1'-biphenyl | Synthonix - Stock | 564483-18-7 | MFCD04117682 | 476.729 | C33H49P | 95.000 | CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 25g | 448042932
eMolecules 22031-12-5 | Ambeed | (2-((Diphenylphosphino)methyl)-2-methylpropane-13-diyl)bis(diphenylphosphine) | 250mg | 571784052 | A873679 | MFCD00014084 | 624.684 | C41H39P3
Ambeed | 3-Oxo-34-dihydro-2H-benzo[b][14]oxazine-5-carboxylic acid | 50mg | 600843497 | A579096 | 483282-25-3 | MFCD11878408 | 193.158 | C9H7NO4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 564483-18-7 | XPhos | ChemScene | MFCD04117682 | 476.729 | C33H49P | 97.000 | CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 10g | 536835403
XPhos | ChemScene | 564483-18-7 | MFCD04117682 | 476.729 | C33H49P | 97.000 | CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 10g | 536835403