Organophosphorus compounds
eMolecules 675602-55-8 | METHYL-(1-PYRROLIDIN-1-YLMETHYL-CYCLOHEXYL)-AMINE | AstaTech | MFCD03426434 | 196.338 | C12H24N2 | 97.000 | CNC1(CN2CCCC2)CCCCC1 | 1g | 112530335
METHYL-(1-PYRROLIDIN-1-YLMETHYL-CYCLOHEXYL)-AMINE | AstaTech | 675602-55-8 | MFCD03426434 | 196.338 | C12H24N2 | 97.000 | CNC1(CN2CCCC2)CCCCC1 | 1g | 112530335
eMolecules 120277-47-6 | (4-METHOXYPYRIDIN-3-YL)METHANOL | AstaTech | MFCD11100741 | 139.154 | C7H9NO2 | 95.000 | COc1ccncc1CO | 0.25g | 282984305
(4-METHOXYPYRIDIN-3-YL)METHANOL | AstaTech | 120277-47-6 | MFCD11100741 | 139.154 | C7H9NO2 | 95.000 | COc1ccncc1CO | 0.25g | 282984305
Sigma Aldrich Fine Chemicals Biosciences Tributylhexadecylphosphonium bromide 97% | 14937-45-2 | MFCD00011775 | 5G
Tributylhexadecylphosphonium bromide 97% | Purity: 97% | Mol Wt: 507.65 | 14937-45-2 | MFCD00011775 | 5G
![eMolecules 1208077-74-0 | (1S,4S)-2-Naphthalen-2-ylmethyl-2,5-diaza-bicyclo[2.2.1]heptane di-trifluoro-acetic acid | Oakwood Chemicals466.380 | C20H20F6N2O4 | 97.000 | OC(=O)C(F)(F)F.OC(=O)C(F)(F)F.C(N1CC2CC1CN2)c1ccc2ccccc2c1 | 1g | 480118707](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502151233.JPG-250.jpg)
eMolecules 1208077-74-0 | (1S,4S)-2-Naphthalen-2-ylmethyl-2,5-diaza-bicyclo[2.2.1]heptane di-trifluoro-acetic acid | Oakwood Chemicals466.380 | C20H20F6N2O4 | 97.000 | OC(=O)C(F)(F)F.OC(=O)C(F)(F)F.C(N1CC2CC1CN2)c1ccc2ccccc2c1 | 1g | 480118707
(1S,4S)-2-Naphthalen-2-ylmethyl-2,5-diaza-bicyclo[2.2.1]heptane di-trifluoro-acetic acid | Oakwood Chemicals | 1208077-74-0466.380 | C20H20F6N2O4 | 97.000 | OC(=O)C(F)(F)F.OC(=O)C(F)(F)F.C(N1CC2CC1CN2)c1ccc2ccccc2c1 | 1g | 480118707
Medchemexpress LLC Tetradecyl acetate | 638-59-5 | MFCD00053737 | 98.5% | 256.42 | C16H32O2 | 1 G
Tetradecyl acetate is an analytical standard of myristyl acetate used as an insect sex pheromone in research and pheromone-based pest control studies. It is supplied as a high-purity reference standard for analytical and research applications.
- Analytical standard for research and analysis.
- Used as insect sex pheromone and for mating disruption studies.
- High purity suitable for analytical applications.
- Available in multiple sizes, e.g. 1 G to 100 G.
eMolecules 1864053-40-6 | (4-Methylthiophen-2-yl)methanamine hydrochloride | ChemScene | MFCD27923381 | 163.660 | C6H10ClNS | 97.000 | Cl.Cc1csc(CN)c1 | 100mg | 768994538
(4-Methylthiophen-2-yl)methanamine hydrochloride | ChemScene | 1864053-40-6 | MFCD27923381 | 163.660 | C6H10ClNS | 97.000 | Cl.Cc1csc(CN)c1 | 100mg | 768994538
Strem, An Ascensus Company CAS# 3115-68-2. 100g. Tetra-n-butylphosphonium bromide, 98%. MFCD00011853
CAS# 3115-68-2. 100g. Tetra-n-butylphosphonium bromide, 98%. MFCD00011853. Molecular Weight: 339.35. Molecular Formula: (C4H9)4P+Brae. Color/form: white xtl. Strem# 93-1579. http://www.strem.com/catalog/v/93-1579/
Medchemexpress LLC 5 10 15 20-Tetraphe 5g
(5 10 15 20-Tetraphenylporphinato)manganese(III) chloride (5 10 15 20-Tetraphenyl-21H 23H-porphine Manganese(III) chloride) is an organic compound with catalytic capabilities[1]
Apexbio Technology LLC TETRADECYL-B-D-MALTOSIDE-100mg
Tetradecyl- -D-maltoside (CAS No 18449-82-6) is a nonionic detergent commonly used in biochemical and biophysical research It originates from the family of alkyl glycosides and functions by solubilizing membrane proteins without denaturing them which is crucial for maintaining their native structure and function This compound is often utilized in studies involving lipid rafts and protein isolation targeting cellular membranes to elucidate signaling pathways Its in vitro activity is typically in the nanomolar to low micromolar range depending on the experimental setup Tetradecyl- -D-maltoside is widely employed in various applications including cell models animal studies and drug screening assays Experimental concentrations typically depend on the specific research design ensuring optimal solubilization while preserving protein functionality