Organic Acids
eMolecules 25354-95-4 | 2-butyldodecanoic acid | Synthonix | MFCD00506175 | 256.430 | C16H32O2 | 97.000 | CCCCCCCCCCC(CCCC)C(O)=O | 250mg | 784552938
2-butyldodecanoic acid | Synthonix | 25354-95-4 | MFCD00506175 | 256.430 | C16H32O2 | 97.000 | CCCCCCCCCCC(CCCC)C(O)=O | 250mg | 784552938
eMolecules 140-77-2 | 3-Cylcopentylpropanoic acid | Ambeed | MFCD00001392 | 142.198 | C8H14O2 | 98.000 | OC(=O)CCC1CCCC1 | 5g | 552737380
3-Cylcopentylpropanoic acid | Ambeed | 140-77-2 | MFCD00001392 | 142.198 | C8H14O2 | 98.000 | OC(=O)CCC1CCCC1 | 5g | 552737380
eMolecules 112-85-6 | Docosanoic acid | Ambeed | MFCD00002807 | 340.592 | C22H44O2 | 85.000 | CCCCCCCCCCCCCCCCCCCCCC(O)=O | 10g | 490564785
Docosanoic acid | Ambeed | 112-85-6 | MFCD00002807 | 340.592 | C22H44O2 | 85.000 | CCCCCCCCCCCCCCCCCCCCCC(O)=O | 10g | 490564785
eMolecules 124-04-9 | Adipic acid | Ambeed | MFCD00004420 | 146.142 | C6H10O4 | 95.000 | OC(=O)CCCCC(O)=O | 25g | 633419238
Adipic acid | Ambeed | 124-04-9 | MFCD00004420 | 146.142 | C6H10O4 | 95.000 | OC(=O)CCCCC(O)=O | 25g | 633419238
eMolecules 60142-89-4 | Boc-7-aminoheptanoic acid | Ambeed | MFCD00063356 | 245.319 | C12H23NO4 | 97.000 | CC(C)(C)OC(=O)NCCCCCCC(O)=O | 250mg | 552682009
Boc-7-aminoheptanoic acid | Ambeed | 60142-89-4 | MFCD00063356 | 245.319 | C12H23NO4 | 97.000 | CC(C)(C)OC(=O)NCCCCCCC(O)=O | 250mg | 552682009
eMolecules 147664-83-3 | Medchem Express | Citric acid-d4 | 5mg | 771359086 | HY-N1428S | MFCD00209702 | 196.147 | C6H8O7
Medchem Express | AZD4573 | 5mg | 446260119 | HY-112088 | 2057509-72-3 | 429.950 | C22H28ClN5O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Aobchem 3-(Methoxymethyl)benzoic acid | ≥95% | CAS 32194-76-6 | C9H10O3 | 25g
3-(Methoxymethyl)benzoic acid | ≥95% | CAS 32194-76-6 | C9H10O3 | 25g
Aobchem 3-(Benzylthio)benzoic acid | ≥95% | CAS 60739-40-4 | C14H12O2S | 5g
3-(Benzylthio)benzoic acid | ≥95% | CAS 60739-40-4 | C14H12O2S | 5g
Aobchem Benzoic acid 4-(2 2-difluoroethoxy)- | ≥95% | CAS 921623-04-3 | C9H8F2O3 | 500mg
Benzoic acid 4-(2 2-difluoroethoxy)- | ≥95% | CAS 921623-04-3 | C9H8F2O3 | 500mg
Aobchem 4-(1-Phenylethoxy)benzoic acid | ≥95% | CAS 149609-89-2 | C15H14O3 | 250mg
4-(1-Phenylethoxy)benzoic acid | ≥95% | CAS 149609-89-2 | C15H14O3 | 250mg
Apexbio Technology LLC 2-OH-6-OME BENZOIC ACID-200mg
2-Hydroxy-6-methoxybenzoic acid (CAS No 3147-64-6) is a chemical compound studied in the biomedical research category due to its potential therapeutic properties Originating from naturally occurring phenolic acids it acts primarily through modulating oxidative stress and inflammatory pathways potentially targeting cellular signaling mechanisms involved in these processes In vitro this compound exhibits bioactivity in the nanomolar to low micromolar range making it a candidate for studies of antioxidative and anti-inflammatory effects It finds typical applications in both cell models and animal studies providing insights into its efficacy and safety profiles Additionally 2-Hydroxy-6-methoxybenzoic acid is used in drug screening programs to evaluate its potential as a therapeutic agent for related conditions Experimental concentrations typically depend on the specific research design allowing flexibility in the exploration of its pharmacological effects
Aobchem Benzoic acid 4-(methylsulfonyl)- ethyl ester | ≥95% | CAS 6274-54-0 | C10H12O4S | 5g
Benzoic acid 4-(methylsulfonyl)- ethyl ester | ≥95% | CAS 6274-54-0 | C10H12O4S | 5g
Aobchem 2-(Ethoxycarbonyl)benzoic acid | ≥95% | CAS 2306-33-4 | C10H10O4 | 250mg
2-(Ethoxycarbonyl)benzoic acid | ≥95% | CAS 2306-33-4 | C10H10O4 | 250mg