Benzenoids
Filtered Search Results
Tris(triphenylphosphine)ruthenium(II) chloride, 98%
CAS: 15529-49-4 Molecular Formula: C54H45Cl2P3Ru Molecular Weight (g/mol): 958.85 MDL Number: MFCD00013077 InChI Key: KSHWMFNJCNGTJO-UHFFFAOYSA-L Synonym: dichlorotris triphenylphosphine ruthenium ii,tris triphenylphosphine ruthenium ii chloride,dichlorotris triphenylphosphino ruthenium ii,tris triphenylphosphine ruthenium ii dichloride,dichlorotris triphenylphosphine ruthenium,ruthenium ii-tris triphenylphosphine dichloride,tris triphenylphosphine dichlororuthenium,ruthenium dichlorotris triphenylphosphine,pubchem12822 PubChem CID: 11007548 IUPAC Name: dichlororuthenium;triphenylphosphane SMILES: [Cl-].[Cl-].[Ru+].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11007548 |
|---|---|
| CAS | 15529-49-4 |
| Molecular Weight (g/mol) | 958.85 |
| MDL Number | MFCD00013077 |
| SMILES | [Cl-].[Cl-].[Ru+].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | dichlorotris triphenylphosphine ruthenium ii,tris triphenylphosphine ruthenium ii chloride,dichlorotris triphenylphosphino ruthenium ii,tris triphenylphosphine ruthenium ii dichloride,dichlorotris triphenylphosphine ruthenium,ruthenium ii-tris triphenylphosphine dichloride,tris triphenylphosphine dichlororuthenium,ruthenium dichlorotris triphenylphosphine,pubchem12822 |
| IUPAC Name | dichlororuthenium;triphenylphosphane |
| InChI Key | KSHWMFNJCNGTJO-UHFFFAOYSA-L |
| Molecular Formula | C54H45Cl2P3Ru |
3,5-Di-tert-butylcatechol, 99%
CAS: 1020-31-1 Molecular Formula: C14H22O2 Molecular Weight (g/mol): 222.328 MDL Number: MFCD00008819 InChI Key: PJZLSMMERMMQBJ-UHFFFAOYSA-N Synonym: 3,5-di-tert-butylcatechol,3,5-di-t-butylcatechol,3,5-di-tert-butylbenzene-1,2-diol,3,5-di-tert-butylpyrocatechol,1,2-benzenediol, 3,5-bis 1,1-dimethylethyl,4,6-di-tert-butylpyrocatechol,unii-1328kn3f8b,1,2-benzenediol, 3,5-di 1,1-dimethylethyl,pyrocatechol, 3,5-di-tert-butyl,3,5-bis tert-butyl benzene-1,2-diol PubChem CID: 66099 IUPAC Name: 3,5-ditert-butylbenzene-1,2-diol SMILES: CC(C)(C)C1=CC(=C(C(=C1)O)O)C(C)(C)C
| PubChem CID | 66099 |
|---|---|
| CAS | 1020-31-1 |
| Molecular Weight (g/mol) | 222.328 |
| MDL Number | MFCD00008819 |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)O)O)C(C)(C)C |
| Synonym | 3,5-di-tert-butylcatechol,3,5-di-t-butylcatechol,3,5-di-tert-butylbenzene-1,2-diol,3,5-di-tert-butylpyrocatechol,1,2-benzenediol, 3,5-bis 1,1-dimethylethyl,4,6-di-tert-butylpyrocatechol,unii-1328kn3f8b,1,2-benzenediol, 3,5-di 1,1-dimethylethyl,pyrocatechol, 3,5-di-tert-butyl,3,5-bis tert-butyl benzene-1,2-diol |
| IUPAC Name | 3,5-ditert-butylbenzene-1,2-diol |
| InChI Key | PJZLSMMERMMQBJ-UHFFFAOYSA-N |
| Molecular Formula | C14H22O2 |
Naphthalene-2-sulfonic acid, 98%
CAS: 120-18-3 Molecular Formula: C10H8O3S Molecular Weight (g/mol): 208.23 MDL Number: MFCD00004089 InChI Key: KVBGVZZKJNLNJU-UHFFFAOYSA-N Synonym: 2-naphthalenesulfonic acid,beta-naphthylsulfonic acid,beta-naphthalenesulfonic acid,naphthalene-2-sulphonic acid,kyselina 2-naftalensulfonova,2-naphthalene sulfonic acid,unii-o9s4k2s25e,2-naphthylsulfonic acid,kyselina 2-naftalensulfonova czech,2-naphthalenesulfonic acid, monohydrate PubChem CID: 8420 ChEBI: CHEBI:44229 IUPAC Name: naphthalene-2-sulfonic acid SMILES: OS(=O)(=O)C1=CC=C2C=CC=CC2=C1
| PubChem CID | 8420 |
|---|---|
| CAS | 120-18-3 |
| Molecular Weight (g/mol) | 208.23 |
| ChEBI | CHEBI:44229 |
| MDL Number | MFCD00004089 |
| SMILES | OS(=O)(=O)C1=CC=C2C=CC=CC2=C1 |
| Synonym | 2-naphthalenesulfonic acid,beta-naphthylsulfonic acid,beta-naphthalenesulfonic acid,naphthalene-2-sulphonic acid,kyselina 2-naftalensulfonova,2-naphthalene sulfonic acid,unii-o9s4k2s25e,2-naphthylsulfonic acid,kyselina 2-naftalensulfonova czech,2-naphthalenesulfonic acid, monohydrate |
| IUPAC Name | naphthalene-2-sulfonic acid |
| InChI Key | KVBGVZZKJNLNJU-UHFFFAOYSA-N |
| Molecular Formula | C10H8O3S |
2,5-Dihydroxybenzoic acid, 99%
CAS: 490-79-9 Molecular Formula: C7H6O4 Molecular Weight (g/mol): 154.12 MDL Number: MFCD00002460 InChI Key: WXTMDXOMEHJXQO-UHFFFAOYSA-N Synonym: gentisic acid,hydroquinonecarboxylic acid,benzoic acid, 2,5-dihydroxy,5-hydroxysalicylic acid,gensigen,gensigon,gentisate,2,5-dioxybenzoic acid,2,5-dhba,gentisinic acid PubChem CID: 3469 ChEBI: CHEBI:17189 IUPAC Name: 2,5-dihydroxybenzoic acid SMILES: C1=CC(=C(C=C1O)C(=O)O)O
| PubChem CID | 3469 |
|---|---|
| CAS | 490-79-9 |
| Molecular Weight (g/mol) | 154.12 |
| ChEBI | CHEBI:17189 |
| MDL Number | MFCD00002460 |
| SMILES | C1=CC(=C(C=C1O)C(=O)O)O |
| Synonym | gentisic acid,hydroquinonecarboxylic acid,benzoic acid, 2,5-dihydroxy,5-hydroxysalicylic acid,gensigen,gensigon,gentisate,2,5-dioxybenzoic acid,2,5-dhba,gentisinic acid |
| IUPAC Name | 2,5-dihydroxybenzoic acid |
| InChI Key | WXTMDXOMEHJXQO-UHFFFAOYSA-N |
| Molecular Formula | C7H6O4 |
trans-Styrylacetic acid, 96%
CAS: 1914-58-5 Molecular Formula: C10H10O2 Molecular Weight (g/mol): 162.19 MDL Number: MFCD00002783 InChI Key: PSCXFXNEYIHJST-QPJJXVBHSA-N Synonym: trans-styrylacetic acid,e-4-phenylbut-3-enoic acid,3e-4-phenylbut-3-enoic acid,4-phenyl-3-butenoic acid,3-butenoic acid, 4-phenyl,3-butenoic acid, 4-phenyl-, 3e,styrylacetic acid,e-4-phenyl-3-butenoic acid,e-styrylacetic acid PubChem CID: 5370625 SMILES: OC(=O)C\C=C\C1=CC=CC=C1
| PubChem CID | 5370625 |
|---|---|
| CAS | 1914-58-5 |
| Molecular Weight (g/mol) | 162.19 |
| MDL Number | MFCD00002783 |
| SMILES | OC(=O)C\C=C\C1=CC=CC=C1 |
| Synonym | trans-styrylacetic acid,e-4-phenylbut-3-enoic acid,3e-4-phenylbut-3-enoic acid,4-phenyl-3-butenoic acid,3-butenoic acid, 4-phenyl,3-butenoic acid, 4-phenyl-, 3e,styrylacetic acid,e-4-phenyl-3-butenoic acid,e-styrylacetic acid |
| InChI Key | PSCXFXNEYIHJST-QPJJXVBHSA-N |
| Molecular Formula | C10H10O2 |
2,6-Diisopropylaniline, 90+%
CAS: 24544-04-5 Molecular Formula: C12H19N Molecular Weight (g/mol): 177.29 MDL Number: MFCD00008887 InChI Key: WKBALTUBRZPIPZ-UHFFFAOYSA-N Synonym: 2,6-diisopropylaniline,benzenamine, 2,6-bis 1-methylethyl,2,6-diisopropyl aniline,aniline, 2,6-diisopropyl,diisopropylaniline,2,6-diisopropylphenylamine,2,6-bis propan-2-yl aniline,2,6-dilsopropylaniline,2,6-di propan-2-yl aniline,2,6-bis 1-methylethyl aniline PubChem CID: 32484 IUPAC Name: 2,6-di(propan-2-yl)aniline SMILES: CC(C)C1=C(C(=CC=C1)C(C)C)N
| PubChem CID | 32484 |
|---|---|
| CAS | 24544-04-5 |
| Molecular Weight (g/mol) | 177.29 |
| MDL Number | MFCD00008887 |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)N |
| Synonym | 2,6-diisopropylaniline,benzenamine, 2,6-bis 1-methylethyl,2,6-diisopropyl aniline,aniline, 2,6-diisopropyl,diisopropylaniline,2,6-diisopropylphenylamine,2,6-bis propan-2-yl aniline,2,6-dilsopropylaniline,2,6-di propan-2-yl aniline,2,6-bis 1-methylethyl aniline |
| IUPAC Name | 2,6-di(propan-2-yl)aniline |
| InChI Key | WKBALTUBRZPIPZ-UHFFFAOYSA-N |
| Molecular Formula | C12H19N |
p-Anisylchlorodiphenylmethane, 97%
CAS: 14470-28-1 Molecular Formula: C20H17ClO Molecular Weight (g/mol): 308.8 MDL Number: MFCD00000814 InChI Key: OBOHMJWDFPBPKD-UHFFFAOYSA-N Synonym: 4-methoxytriphenylchloromethane,4-methoxytrityl chloride,4-methoxytriphenylmethyl chloride,4-monomethoxytrityl chloride,mmtrcl,p-chlorodiphenylmethyl anisole,p-anisylchlorodiphenylmethane,1-chlorodiphenylmethyl-4-methoxybenzene,chloro 4-methoxyphenyl methylene dibenzene,4-methoxytritylchloride PubChem CID: 84462 IUPAC Name: 1-[chloro(diphenyl)methyl]-4-methoxybenzene SMILES: COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)Cl
| PubChem CID | 84462 |
|---|---|
| CAS | 14470-28-1 |
| Molecular Weight (g/mol) | 308.8 |
| MDL Number | MFCD00000814 |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)Cl |
| Synonym | 4-methoxytriphenylchloromethane,4-methoxytrityl chloride,4-methoxytriphenylmethyl chloride,4-monomethoxytrityl chloride,mmtrcl,p-chlorodiphenylmethyl anisole,p-anisylchlorodiphenylmethane,1-chlorodiphenylmethyl-4-methoxybenzene,chloro 4-methoxyphenyl methylene dibenzene,4-methoxytritylchloride |
| IUPAC Name | 1-[chloro(diphenyl)methyl]-4-methoxybenzene |
| InChI Key | OBOHMJWDFPBPKD-UHFFFAOYSA-N |
| Molecular Formula | C20H17ClO |
Anisonitrile, 99%
CAS: 874-90-8 Molecular Formula: C8H7NO Molecular Weight (g/mol): 133.15 MDL Number: MFCD00001818 InChI Key: XDJAAZYHCCRJOK-UHFFFAOYSA-N Synonym: anisonitrile,p-anisonitrile,4-cyanoanisole,benzonitrile, 4-methoxy,p-methoxybenzonitrile,4-anisonitrile,p-anisylnitrile,p-cyanoanisole,p-methoxyphenyl cyanide,4-methoxy benzonitrile PubChem CID: 70129 IUPAC Name: 4-methoxybenzonitrile SMILES: COC1=CC=C(C=C1)C#N
| PubChem CID | 70129 |
|---|---|
| CAS | 874-90-8 |
| Molecular Weight (g/mol) | 133.15 |
| MDL Number | MFCD00001818 |
| SMILES | COC1=CC=C(C=C1)C#N |
| Synonym | anisonitrile,p-anisonitrile,4-cyanoanisole,benzonitrile, 4-methoxy,p-methoxybenzonitrile,4-anisonitrile,p-anisylnitrile,p-cyanoanisole,p-methoxyphenyl cyanide,4-methoxy benzonitrile |
| IUPAC Name | 4-methoxybenzonitrile |
| InChI Key | XDJAAZYHCCRJOK-UHFFFAOYSA-N |
| Molecular Formula | C8H7NO |
3,5-Dimethoxybenzoic acid, 99%
CAS: 1132-21-4 Molecular Formula: C9H10O4 Molecular Weight (g/mol): 182.18 MDL Number: MFCD00002502 InChI Key: IWPZKOJSYQZABD-UHFFFAOYSA-N Synonym: benzoic acid, 3,5-dimethoxy,unii-38my78eckk,3,5-dimethoxy benzoic acid,38my78eckk,pubchem3121,3,5-dimethoxybenzoicacid,acmc-1c4zl,3,5-dimethoxy-benzoic acid,ksc176m0p,benzoicacid, 3,5-dimethoxy PubChem CID: 14332 IUPAC Name: 3,5-dimethoxybenzoic acid SMILES: COC1=CC(=CC(OC)=C1)C(O)=O
| PubChem CID | 14332 |
|---|---|
| CAS | 1132-21-4 |
| Molecular Weight (g/mol) | 182.18 |
| MDL Number | MFCD00002502 |
| SMILES | COC1=CC(=CC(OC)=C1)C(O)=O |
| Synonym | benzoic acid, 3,5-dimethoxy,unii-38my78eckk,3,5-dimethoxy benzoic acid,38my78eckk,pubchem3121,3,5-dimethoxybenzoicacid,acmc-1c4zl,3,5-dimethoxy-benzoic acid,ksc176m0p,benzoicacid, 3,5-dimethoxy |
| IUPAC Name | 3,5-dimethoxybenzoic acid |
| InChI Key | IWPZKOJSYQZABD-UHFFFAOYSA-N |
| Molecular Formula | C9H10O4 |
2-Aminobenzophenone, 98%
CAS: 2835-77-0 Molecular Formula: C13H11NO Molecular Weight (g/mol): 197.24 MDL Number: MFCD00007713 InChI Key: MAOBFOXLCJIFLV-UHFFFAOYSA-N Synonym: 2-aminobenzophenone,2-benzoylaniline,o-benzoylaniline,o-aminobenzophenone,2-aminophenyl phenyl methanone,methanone, 2-aminophenyl phenyl,benzophenone, 2-amino,2-amino-phenyl-phenyl-methanone,2-aminophenyl phenyl ketone,methanone, aminophenyl phenyl PubChem CID: 76080 IUPAC Name: (2-aminophenyl)-phenylmethanone SMILES: NC1=CC=CC=C1C(=O)C1=CC=CC=C1
| PubChem CID | 76080 |
|---|---|
| CAS | 2835-77-0 |
| Molecular Weight (g/mol) | 197.24 |
| MDL Number | MFCD00007713 |
| SMILES | NC1=CC=CC=C1C(=O)C1=CC=CC=C1 |
| Synonym | 2-aminobenzophenone,2-benzoylaniline,o-benzoylaniline,o-aminobenzophenone,2-aminophenyl phenyl methanone,methanone, 2-aminophenyl phenyl,benzophenone, 2-amino,2-amino-phenyl-phenyl-methanone,2-aminophenyl phenyl ketone,methanone, aminophenyl phenyl |
| IUPAC Name | (2-aminophenyl)-phenylmethanone |
| InChI Key | MAOBFOXLCJIFLV-UHFFFAOYSA-N |
| Molecular Formula | C13H11NO |
N-Acetyl-N'-phenylhydrazine, 98%
CAS: 114-83-0 Molecular Formula: C8H10N2O Molecular Weight (g/mol): 150.181 MDL Number: MFCD00008672 InChI Key: UICBCXONCUFSOI-UHFFFAOYSA-N Synonym: 1-acetyl-2-phenylhydrazine,hydracetin,acetylphenylhydrazine,pyrodin,pyrodine,acetic acid, 2-phenylhydrazide,n-acetyl-n'-phenylhydrazine,n'-phenylacethydrazide,acetic acid phenylhydrazone,n 1-acetylphenylhydrazine PubChem CID: 8247 IUPAC Name: N'-phenylacetohydrazide SMILES: CC(=O)NNC1=CC=CC=C1
| PubChem CID | 8247 |
|---|---|
| CAS | 114-83-0 |
| Molecular Weight (g/mol) | 150.181 |
| MDL Number | MFCD00008672 |
| SMILES | CC(=O)NNC1=CC=CC=C1 |
| Synonym | 1-acetyl-2-phenylhydrazine,hydracetin,acetylphenylhydrazine,pyrodin,pyrodine,acetic acid, 2-phenylhydrazide,n-acetyl-n'-phenylhydrazine,n'-phenylacethydrazide,acetic acid phenylhydrazone,n 1-acetylphenylhydrazine |
| IUPAC Name | N'-phenylacetohydrazide |
| InChI Key | UICBCXONCUFSOI-UHFFFAOYSA-N |
| Molecular Formula | C8H10N2O |
p-Xylylene dichloride, 98%
CAS: 623-25-6 Molecular Formula: C8H8Cl2 Molecular Weight (g/mol): 175.052 MDL Number: MFCD00000920 InChI Key: ZZHIDJWUJRKHGX-UHFFFAOYSA-N Synonym: 1,4-bis chloromethyl benzene,alpha,alpha'-dichloro-p-xylene,p-xylylene dichloride,p-xylylene chloride,benzene, 1,4-bis chloromethyl,p-bis chloromethyl benzene,benzene, p-bis chloromethyl,a,a'-dichloro-p-xylene,xylylene dichloride,ccris 1772 PubChem CID: 12171 IUPAC Name: 1,4-bis(chloromethyl)benzene SMILES: C1=CC(=CC=C1CCl)CCl
| PubChem CID | 12171 |
|---|---|
| CAS | 623-25-6 |
| Molecular Weight (g/mol) | 175.052 |
| MDL Number | MFCD00000920 |
| SMILES | C1=CC(=CC=C1CCl)CCl |
| Synonym | 1,4-bis chloromethyl benzene,alpha,alpha'-dichloro-p-xylene,p-xylylene dichloride,p-xylylene chloride,benzene, 1,4-bis chloromethyl,p-bis chloromethyl benzene,benzene, p-bis chloromethyl,a,a'-dichloro-p-xylene,xylylene dichloride,ccris 1772 |
| IUPAC Name | 1,4-bis(chloromethyl)benzene |
| InChI Key | ZZHIDJWUJRKHGX-UHFFFAOYSA-N |
| Molecular Formula | C8H8Cl2 |
Anthranilamide, 99+%
CAS: 88-68-6 Molecular Formula: C7H8N2O Molecular Weight (g/mol): 136.15 MDL Number: MFCD00007981 InChI Key: PXBFMLJZNCDSMP-UHFFFAOYSA-N Synonym: anthranilamide,benzamide, 2-amino,o-aminobenzamide,2-carbamoylaniline,aminobenzamide,anthranilimidic acid,benzamide, o-amino,anthranilic acid amide,anthranilamide van,o-aminobenzamide van PubChem CID: 6942 IUPAC Name: 2-aminobenzamide SMILES: C1=CC=C(C(=C1)C(=O)N)N
| PubChem CID | 6942 |
|---|---|
| CAS | 88-68-6 |
| Molecular Weight (g/mol) | 136.15 |
| MDL Number | MFCD00007981 |
| SMILES | C1=CC=C(C(=C1)C(=O)N)N |
| Synonym | anthranilamide,benzamide, 2-amino,o-aminobenzamide,2-carbamoylaniline,aminobenzamide,anthranilimidic acid,benzamide, o-amino,anthranilic acid amide,anthranilamide van,o-aminobenzamide van |
| IUPAC Name | 2-aminobenzamide |
| InChI Key | PXBFMLJZNCDSMP-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2O |
1,3-Dioxolane, 99%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 646-06-0
| CAS | 646-06-0 |
|---|
Biphenyl-4-carboxylic acid, 98%
CAS: 92-92-2 Molecular Formula: C13H10O2 Molecular Weight (g/mol): 198.221 MDL Number: MFCD00002553 InChI Key: NNJMFJSKMRYHSR-UHFFFAOYSA-N Synonym: 4-biphenylcarboxylic acid,biphenyl-4-carboxylic acid,1,1'-biphenyl-4-carboxylic acid,p-phenylbenzoic acid,4-carboxybiphenyl,para phenyl benzoic acid,4-diphenylcarboxylic acid,diphenyl-4-carboxylic acid,4-carboxy-1,1'-biphenyl PubChem CID: 66724 IUPAC Name: 4-phenylbenzoic acid SMILES: C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O
| PubChem CID | 66724 |
|---|---|
| CAS | 92-92-2 |
| Molecular Weight (g/mol) | 198.221 |
| MDL Number | MFCD00002553 |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O |
| Synonym | 4-biphenylcarboxylic acid,biphenyl-4-carboxylic acid,1,1'-biphenyl-4-carboxylic acid,p-phenylbenzoic acid,4-carboxybiphenyl,para phenyl benzoic acid,4-diphenylcarboxylic acid,diphenyl-4-carboxylic acid,4-carboxy-1,1'-biphenyl |
| IUPAC Name | 4-phenylbenzoic acid |
| InChI Key | NNJMFJSKMRYHSR-UHFFFAOYSA-N |
| Molecular Formula | C13H10O2 |