Benzenoids
Filtered Search Results
Pterostilbene 98.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 537-42-8 Molecular Formula: C16H16O3 Molecular Weight (g/mol): 256.301 MDL Number: MFCD00238710 InChI Key: VLEUZFDZJKSGMX-ONEGZZNKSA-N Synonym: 4′C-Hydroxy-3,5-dimethoxy-trans-stilbene, trans-1-(3,5-Dimethoxyphenyl)-2-(4-hydroxyphenyl)ethylene PubChem CID: 5281727 ChEBI: CHEBI:8630 IUPAC Name: 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenol SMILES: COC1=CC(=CC(=C1)C=CC2=CC=C(C=C2)O)OC
| PubChem CID | 5281727 |
|---|---|
| CAS | 537-42-8 |
| Molecular Weight (g/mol) | 256.301 |
| ChEBI | CHEBI:8630 |
| MDL Number | MFCD00238710 |
| SMILES | COC1=CC(=CC(=C1)C=CC2=CC=C(C=C2)O)OC |
| Synonym | 4′C-Hydroxy-3,5-dimethoxy-trans-stilbene, trans-1-(3,5-Dimethoxyphenyl)-2-(4-hydroxyphenyl)ethylene |
| IUPAC Name | 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenol |
| InChI Key | VLEUZFDZJKSGMX-ONEGZZNKSA-N |
| Molecular Formula | C16H16O3 |
Cinnamoyl Chloride 97.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 17082-09-6 Molecular Formula: C9H7ClO Molecular Weight (g/mol): 166.60 MDL Number: MFCD00000732 InChI Key: WOGITNXCNOTRLK-VOTSOKGWSA-N Synonym: cinnamoyl chloride,cinnamic acid chloride,cinnamic chloride,trans-3-phenylacryloyl chloride,2-propenoyl chloride, 3-phenyl,cinnamoylchloride,e-cinnamoyl chloride,trans-cinnamoyl chloride,2e-3-phenylprop-2-enoyl chloride,3-phenyl-2-propenoyl chloride PubChem CID: 5354261 IUPAC Name: (2E)-3-phenylprop-2-enoyl chloride SMILES: ClC(=O)\C=C\C1=CC=CC=C1
| PubChem CID | 5354261 |
|---|---|
| CAS | 17082-09-6 |
| Molecular Weight (g/mol) | 166.60 |
| MDL Number | MFCD00000732 |
| SMILES | ClC(=O)\C=C\C1=CC=CC=C1 |
| Synonym | cinnamoyl chloride,cinnamic acid chloride,cinnamic chloride,trans-3-phenylacryloyl chloride,2-propenoyl chloride, 3-phenyl,cinnamoylchloride,e-cinnamoyl chloride,trans-cinnamoyl chloride,2e-3-phenylprop-2-enoyl chloride,3-phenyl-2-propenoyl chloride |
| IUPAC Name | (2E)-3-phenylprop-2-enoyl chloride |
| InChI Key | WOGITNXCNOTRLK-VOTSOKGWSA-N |
| Molecular Formula | C9H7ClO |
| CAS | 11-8-4940 |
|---|---|
| Molecular Weight (g/mol) | 140.14 |
| Molecular Formula | C7H8O3 |
9-Fluorenone, 99+%
CAS: 486-25-9 InChI Key: YLQWCDOCJODRMT-UHFFFAOYSA-N Synonym: 9-fluorenone,9h-fluoren-9-one,fluorenone,9-oxofluorene,diphenylene ketone,unii-az9t83s2aq,ccris 593,9h-fluorene-9-one,az9t83s2aq,9-fluoreneone PubChem CID: 10241 ChEBI: CHEBI:17922 IUPAC Name: fluoren-9-one SMILES: C1=CC=C2C(=C1)C3=CC=CC=C3C2=O
| PubChem CID | 10241 |
|---|---|
| CAS | 486-25-9 |
| ChEBI | CHEBI:17922 |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C2=O |
| Synonym | 9-fluorenone,9h-fluoren-9-one,fluorenone,9-oxofluorene,diphenylene ketone,unii-az9t83s2aq,ccris 593,9h-fluorene-9-one,az9t83s2aq,9-fluoreneone |
| IUPAC Name | fluoren-9-one |
| InChI Key | YLQWCDOCJODRMT-UHFFFAOYSA-N |
2-Methyl-1,4-naphthoquinone, 98%
CAS: 58-27-5 Molecular Formula: C11H8O2 Molecular Weight (g/mol): 172.18 MDL Number: MFCD00001681 InChI Key: MJVAVZPDRWSRRC-UHFFFAOYSA-N Synonym: menadione,vitamin k3,2-methyl-1,4-naphthoquinone,menaphthone,2-methylnaphthoquinone,thyloquinone,kappaxin,kayquinone,klottone,panosine PubChem CID: 4055 ChEBI: CHEBI:28869 IUPAC Name: 2-methylnaphthalene-1,4-dione SMILES: CC1=CC(=O)C2=CC=CC=C2C1=O
| PubChem CID | 4055 |
|---|---|
| CAS | 58-27-5 |
| Molecular Weight (g/mol) | 172.18 |
| ChEBI | CHEBI:28869 |
| MDL Number | MFCD00001681 |
| SMILES | CC1=CC(=O)C2=CC=CC=C2C1=O |
| Synonym | menadione,vitamin k3,2-methyl-1,4-naphthoquinone,menaphthone,2-methylnaphthoquinone,thyloquinone,kappaxin,kayquinone,klottone,panosine |
| IUPAC Name | 2-methylnaphthalene-1,4-dione |
| InChI Key | MJVAVZPDRWSRRC-UHFFFAOYSA-N |
| Molecular Formula | C11H8O2 |
Ethyl 4-hydroxybenzoate, 99%
CAS: 120-47-8 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00002353 InChI Key: NUVBSKCKDOMJSU-UHFFFAOYSA-N Synonym: ethylparaben,ethyl paraben,ethyl p-hydroxybenzoate,mycocten,ethyl parasept,4-hydroxybenzoic acid ethyl ester,easeptol,ethyl butex,ethyl parahydroxybenzoate,tegosept e PubChem CID: 8434 ChEBI: CHEBI:86616 IUPAC Name: ethyl 4-hydroxybenzoate SMILES: CCOC(=O)C1=CC=C(C=C1)O
| PubChem CID | 8434 |
|---|---|
| CAS | 120-47-8 |
| Molecular Weight (g/mol) | 166.18 |
| ChEBI | CHEBI:86616 |
| MDL Number | MFCD00002353 |
| SMILES | CCOC(=O)C1=CC=C(C=C1)O |
| Synonym | ethylparaben,ethyl paraben,ethyl p-hydroxybenzoate,mycocten,ethyl parasept,4-hydroxybenzoic acid ethyl ester,easeptol,ethyl butex,ethyl parahydroxybenzoate,tegosept e |
| IUPAC Name | ethyl 4-hydroxybenzoate |
| InChI Key | NUVBSKCKDOMJSU-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
2-Chlorophenylacetonitrile, 98+%
CAS: 2856-63-5 Molecular Formula: C8H6ClN Molecular Weight (g/mol): 151.593 MDL Number: MFCD00001898 InChI Key: MRDUURPIPLIGQX-UHFFFAOYSA-N Synonym: 2-chlorobenzyl cyanide,2-chlorophenylacetonitrile,2-2-chlorophenyl acetonitrile,o-chlorobenzyl cyanide,benzeneacetonitrile, 2-chloro,2-chlorobenzeneacetonitrile,2-chlorobenzylcyanide,2-chlorophenyl acetonitrile,o-chlorophenyl acetonitrile,acetonitrile, o-chlorophenyl PubChem CID: 76112 IUPAC Name: 2-(2-chlorophenyl)acetonitrile SMILES: C1=CC=C(C(=C1)CC#N)Cl
| PubChem CID | 76112 |
|---|---|
| CAS | 2856-63-5 |
| Molecular Weight (g/mol) | 151.593 |
| MDL Number | MFCD00001898 |
| SMILES | C1=CC=C(C(=C1)CC#N)Cl |
| Synonym | 2-chlorobenzyl cyanide,2-chlorophenylacetonitrile,2-2-chlorophenyl acetonitrile,o-chlorobenzyl cyanide,benzeneacetonitrile, 2-chloro,2-chlorobenzeneacetonitrile,2-chlorobenzylcyanide,2-chlorophenyl acetonitrile,o-chlorophenyl acetonitrile,acetonitrile, o-chlorophenyl |
| IUPAC Name | 2-(2-chlorophenyl)acetonitrile |
| InChI Key | MRDUURPIPLIGQX-UHFFFAOYSA-N |
| Molecular Formula | C8H6ClN |
4-Chlorobenzyl chloride, 99+%
CAS: 104-83-6 Molecular Formula: C7H6Cl2 Molecular Weight (g/mol): 161.03 MDL Number: MFCD00000914 InChI Key: JQZAEUFPPSRDOP-UHFFFAOYSA-N Synonym: 4-chlorobenzyl chloride,1-chloro-4-chloromethyl benzene,p-chlorobenzyl chloride,benzene, 1-chloro-4-chloromethyl,alpha,4-dichlorotoluene,4-chlorobenzylchloride,4-chlorophenyl methyl chloride,1-chloro-4-chloromethyl-benzene,alpha,p-dichlorotoluene,toluene, p,alpha-dichloro PubChem CID: 7723 IUPAC Name: 1-chloro-4-(chloromethyl)benzene SMILES: C1=CC(=CC=C1CCl)Cl
| PubChem CID | 7723 |
|---|---|
| CAS | 104-83-6 |
| Molecular Weight (g/mol) | 161.03 |
| MDL Number | MFCD00000914 |
| SMILES | C1=CC(=CC=C1CCl)Cl |
| Synonym | 4-chlorobenzyl chloride,1-chloro-4-chloromethyl benzene,p-chlorobenzyl chloride,benzene, 1-chloro-4-chloromethyl,alpha,4-dichlorotoluene,4-chlorobenzylchloride,4-chlorophenyl methyl chloride,1-chloro-4-chloromethyl-benzene,alpha,p-dichlorotoluene,toluene, p,alpha-dichloro |
| IUPAC Name | 1-chloro-4-(chloromethyl)benzene |
| InChI Key | JQZAEUFPPSRDOP-UHFFFAOYSA-N |
| Molecular Formula | C7H6Cl2 |
Tribenzylamine, 99+%
CAS: 620-40-6 Molecular Formula: C21H21N Molecular Weight (g/mol): 287.41 MDL Number: MFCD00004773 InChI Key: MXHTZQSKTCCMFG-UHFFFAOYSA-N Synonym: tribenzylamine,benzenemethanamine, n,n-bis phenylmethyl,unii-hz10o1931j,trisbenzylamine,n,n-dibenzyl-1-phenyl-methanamine,pubchem21076,acmc-1atok,dsstox_cid_27031,dsstox_rid_82052 PubChem CID: 24321 IUPAC Name: N,N-dibenzyl-1-phenylmethanamine SMILES: C(N(CC1=CC=CC=C1)CC1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 24321 |
|---|---|
| CAS | 620-40-6 |
| Molecular Weight (g/mol) | 287.41 |
| MDL Number | MFCD00004773 |
| SMILES | C(N(CC1=CC=CC=C1)CC1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | tribenzylamine,benzenemethanamine, n,n-bis phenylmethyl,unii-hz10o1931j,trisbenzylamine,n,n-dibenzyl-1-phenyl-methanamine,pubchem21076,acmc-1atok,dsstox_cid_27031,dsstox_rid_82052 |
| IUPAC Name | N,N-dibenzyl-1-phenylmethanamine |
| InChI Key | MXHTZQSKTCCMFG-UHFFFAOYSA-N |
| Molecular Formula | C21H21N |
Ethyl 4-nitrobenzoate, 98%
CAS: 99-77-4 Molecular Formula: C9H9NO4 Molecular Weight (g/mol): 195.174 MDL Number: MFCD00007351 InChI Key: PHWSCBWNPZDYRI-UHFFFAOYSA-N Synonym: ethyl p-nitrobenzoate,benzoic acid, 4-nitro-, ethyl ester,4-nitrobenzoic acid ethyl ester,ethyl nitrobenzoate, para ester,p-nitrobenzoic acid, ethyl ester,4-ethoxycarbonyl nitrobenzene,benzoic acid, p-nitro-, ethyl ester,ethyl-p-nitrobenzoate,unii-1och6y8nar,ethyl para-nitrobenzoate PubChem CID: 7457 IUPAC Name: ethyl 4-nitrobenzoate SMILES: CCOC(=O)C1=CC=C(C=C1)[N+](=O)[O-]
| PubChem CID | 7457 |
|---|---|
| CAS | 99-77-4 |
| Molecular Weight (g/mol) | 195.174 |
| MDL Number | MFCD00007351 |
| SMILES | CCOC(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
| Synonym | ethyl p-nitrobenzoate,benzoic acid, 4-nitro-, ethyl ester,4-nitrobenzoic acid ethyl ester,ethyl nitrobenzoate, para ester,p-nitrobenzoic acid, ethyl ester,4-ethoxycarbonyl nitrobenzene,benzoic acid, p-nitro-, ethyl ester,ethyl-p-nitrobenzoate,unii-1och6y8nar,ethyl para-nitrobenzoate |
| IUPAC Name | ethyl 4-nitrobenzoate |
| InChI Key | PHWSCBWNPZDYRI-UHFFFAOYSA-N |
| Molecular Formula | C9H9NO4 |
o-Tolidine dihydrochloride, ACS
CAS: 612-82-8 Molecular Formula: C14H18Cl2N2 Molecular Weight (g/mol): 285.212 MDL Number: MFCD00012960 InChI Key: LUKPNZHXJRJBAN-UHFFFAOYSA-N Synonym: 3,3'-dimethylbenzidine dihydrochloride,o-tolidine dihydrochloride,3,3'-dimethyl-1,1'-biphenyl-4,4'-diamine dihydrochloride,unii-5msk350kd8,dsstox_cid_511,dsstox_rid_75633,dsstox_gsid_20511,tolidine dihydrochloride,1,1'-biphenyl-4,4'-diamine, 3,3'-dimethyl-, dihydrochloride,3,3'-dimethylbenzidine.2hcl PubChem CID: 108938 IUPAC Name: 4-(4-amino-3-methylphenyl)-2-methylaniline;dihydrochloride SMILES: CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N.Cl.Cl
| PubChem CID | 108938 |
|---|---|
| CAS | 612-82-8 |
| Molecular Weight (g/mol) | 285.212 |
| MDL Number | MFCD00012960 |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N.Cl.Cl |
| Synonym | 3,3'-dimethylbenzidine dihydrochloride,o-tolidine dihydrochloride,3,3'-dimethyl-1,1'-biphenyl-4,4'-diamine dihydrochloride,unii-5msk350kd8,dsstox_cid_511,dsstox_rid_75633,dsstox_gsid_20511,tolidine dihydrochloride,1,1'-biphenyl-4,4'-diamine, 3,3'-dimethyl-, dihydrochloride,3,3'-dimethylbenzidine.2hcl |
| IUPAC Name | 4-(4-amino-3-methylphenyl)-2-methylaniline;dihydrochloride |
| InChI Key | LUKPNZHXJRJBAN-UHFFFAOYSA-N |
| Molecular Formula | C14H18Cl2N2 |
Quinhydrone, 98%
CAS: 106-34-3 Molecular Formula: C12H10O4 Molecular Weight (g/mol): 218.21 MDL Number: MFCD00010310 InChI Key: BDJXVNRFAQSMAA-UHFFFAOYSA-N Synonym: quinhydrone,green hydroquinone,p-benzoquinhydrone,chinhydron,chinhydron czech,unii-p4a66lq3qj,hydroquinone, compd. with p-benzoquinone,p-benzoquinone, compd. with hydroquinone,2,5-cyclohexadiene-1,4-dione, compd. with 1,4-benzenediol 1:1,p-benzoquinone-hydroquinone compound 1:1 PubChem CID: 7801 ChEBI: CHEBI:26491 IUPAC Name: benzene-1,4-diol;cyclohexa-2,5-diene-1,4-dione SMILES: OC1=CC=C(O)C=C1.O=C1C=CC(=O)C=C1
| PubChem CID | 7801 |
|---|---|
| CAS | 106-34-3 |
| Molecular Weight (g/mol) | 218.21 |
| ChEBI | CHEBI:26491 |
| MDL Number | MFCD00010310 |
| SMILES | OC1=CC=C(O)C=C1.O=C1C=CC(=O)C=C1 |
| Synonym | quinhydrone,green hydroquinone,p-benzoquinhydrone,chinhydron,chinhydron czech,unii-p4a66lq3qj,hydroquinone, compd. with p-benzoquinone,p-benzoquinone, compd. with hydroquinone,2,5-cyclohexadiene-1,4-dione, compd. with 1,4-benzenediol 1:1,p-benzoquinone-hydroquinone compound 1:1 |
| IUPAC Name | benzene-1,4-diol;cyclohexa-2,5-diene-1,4-dione |
| InChI Key | BDJXVNRFAQSMAA-UHFFFAOYSA-N |
| Molecular Formula | C12H10O4 |
Orcinol Monohydrate, 99%
CAS: 6153-39-5 Molecular Formula: C7H8O2·H2O Molecular Weight (g/mol): 142.15 MDL Number: MFCD00149092 InChI Key: NBKPNAMTHBIMLA-UHFFFAOYSA-N Synonym: 5-methylbenzene-1,3-diol hydrate,orcinol monohydrate,5-methylresorcinol monohydrate,3,5-dihydroxytoluene monohydrate,orcinol hydrate,resorcinol, 5-methyl-, monohydrate,1,3-benzenediol, 5-methyl-, monohydrate,1,3-dihydroxy-5-methylbenzene monohydrate,acmc-209mtl,5-methylresorcinol hydrate PubChem CID: 3083941 IUPAC Name: 5-methylbenzene-1,3-diol;hydrate SMILES: CC1=CC(=CC(=C1)O)O.O
| PubChem CID | 3083941 |
|---|---|
| CAS | 6153-39-5 |
| Molecular Weight (g/mol) | 142.15 |
| MDL Number | MFCD00149092 |
| SMILES | CC1=CC(=CC(=C1)O)O.O |
| Synonym | 5-methylbenzene-1,3-diol hydrate,orcinol monohydrate,5-methylresorcinol monohydrate,3,5-dihydroxytoluene monohydrate,orcinol hydrate,resorcinol, 5-methyl-, monohydrate,1,3-benzenediol, 5-methyl-, monohydrate,1,3-dihydroxy-5-methylbenzene monohydrate,acmc-209mtl,5-methylresorcinol hydrate |
| IUPAC Name | 5-methylbenzene-1,3-diol;hydrate |
| InChI Key | NBKPNAMTHBIMLA-UHFFFAOYSA-N |
| Molecular Formula | C7H8O2·H2O |
2-tert-Butyl-4-methylphenol, 99%
CAS: 2409-55-4 Molecular Formula: C11H16O Molecular Weight (g/mol): 164.248 MDL Number: MFCD00002381 InChI Key: IKEHOXWJQXIQAG-UHFFFAOYSA-N Synonym: 2-tert-butyl-4-methylphenol,2-tert-butyl-p-cresol,2-t-butyl-p-cresol,p-cresol, 2-tert-butyl,o-tert-butyl-p-cresol,2-t-butyl-4-methylphenol,4-methyl-2-tert-butylphenol,2-terc.butyl-p-kresol,phenol, 2-1,1-dimethylethyl-4-methyl,4-methyl-6-t-butylphenol PubChem CID: 17004 IUPAC Name: 2-tert-butyl-4-methylphenol SMILES: CC1=CC(=C(C=C1)O)C(C)(C)C
| PubChem CID | 17004 |
|---|---|
| CAS | 2409-55-4 |
| Molecular Weight (g/mol) | 164.248 |
| MDL Number | MFCD00002381 |
| SMILES | CC1=CC(=C(C=C1)O)C(C)(C)C |
| Synonym | 2-tert-butyl-4-methylphenol,2-tert-butyl-p-cresol,2-t-butyl-p-cresol,p-cresol, 2-tert-butyl,o-tert-butyl-p-cresol,2-t-butyl-4-methylphenol,4-methyl-2-tert-butylphenol,2-terc.butyl-p-kresol,phenol, 2-1,1-dimethylethyl-4-methyl,4-methyl-6-t-butylphenol |
| IUPAC Name | 2-tert-butyl-4-methylphenol |
| InChI Key | IKEHOXWJQXIQAG-UHFFFAOYSA-N |
| Molecular Formula | C11H16O |
3-Bromoanisole, 98+%
CAS: 2398-37-0 Molecular Formula: C7H7BrO Molecular Weight (g/mol): 187.04 MDL Number: MFCD00000081 InChI Key: PLDWAJLZAAHOGG-UHFFFAOYSA-N Synonym: 3-bromoanisole,m-bromoanisole,3-methoxybromobenzene,3-bromo anisole,m-bromomethoxybenzene,benzene, 1-bromo-3-methoxy,anisole, m-bromo,3-methoxy-1-bromobenzene,m-methoxybromobenzene,meta-bromoanisole PubChem CID: 16971 IUPAC Name: 1-bromo-3-methoxybenzene SMILES: COC1=CC=CC(Br)=C1
| PubChem CID | 16971 |
|---|---|
| CAS | 2398-37-0 |
| Molecular Weight (g/mol) | 187.04 |
| MDL Number | MFCD00000081 |
| SMILES | COC1=CC=CC(Br)=C1 |
| Synonym | 3-bromoanisole,m-bromoanisole,3-methoxybromobenzene,3-bromo anisole,m-bromomethoxybenzene,benzene, 1-bromo-3-methoxy,anisole, m-bromo,3-methoxy-1-bromobenzene,m-methoxybromobenzene,meta-bromoanisole |
| IUPAC Name | 1-bromo-3-methoxybenzene |
| InChI Key | PLDWAJLZAAHOGG-UHFFFAOYSA-N |
| Molecular Formula | C7H7BrO |