Benzenoids
Filtered Search Results
4-Methoxybenzylchloride, 98%, stabilized
CAS: 824-94-2 Molecular Formula: C8H9ClO Molecular Weight (g/mol): 156.61 MDL Number: MFCD00000915 InChI Key: MOHYOXXOKFQHDC-UHFFFAOYSA-N Synonym: 4-methoxybenzyl chloride,4-methoxybenzylchloride,1-chloromethyl-4-methoxybenzene,p-methoxybenzyl chloride,p-anisyl chloride,alpha-chloro-4-methoxytoluene,p-chloromethyl anisole,benzene, 1-chloromethyl-4-methoxy,4-chloromethyl anisole,anisole, p-chloromethyl PubChem CID: 69993 IUPAC Name: 1-(chloromethyl)-4-methoxybenzene SMILES: COC1=CC=C(C=C1)CCl
| PubChem CID | 69993 |
|---|---|
| CAS | 824-94-2 |
| Molecular Weight (g/mol) | 156.61 |
| MDL Number | MFCD00000915 |
| SMILES | COC1=CC=C(C=C1)CCl |
| Synonym | 4-methoxybenzyl chloride,4-methoxybenzylchloride,1-chloromethyl-4-methoxybenzene,p-methoxybenzyl chloride,p-anisyl chloride,alpha-chloro-4-methoxytoluene,p-chloromethyl anisole,benzene, 1-chloromethyl-4-methoxy,4-chloromethyl anisole,anisole, p-chloromethyl |
| IUPAC Name | 1-(chloromethyl)-4-methoxybenzene |
| InChI Key | MOHYOXXOKFQHDC-UHFFFAOYSA-N |
| Molecular Formula | C8H9ClO |
DL-Isoproterenol hydrochloride, 98%
CAS: 51-30-9 Molecular Formula: C11H18ClNO3 Molecular Weight (g/mol): 247.72 MDL Number: MFCD00012603,MFCD00064548 InChI Key: IROWCYIEJAOFOW-UHFFFAOYNA-N Synonym: isoprenaline hydrochloride,isoproterenol hydrochloride,isuprel,euspiran,isoprenaline hcl,isoproterenol hcl,aerolone,aerotrol,izadrin,vapo-iso PubChem CID: 5807 IUPAC Name: hydrogen 4-{1-hydroxy-2-[(propan-2-yl)amino]ethyl}benzene-1,2-diol chloride SMILES: [H+].[Cl-].CC(C)NCC(O)C1=CC=C(O)C(O)=C1
| PubChem CID | 5807 |
|---|---|
| CAS | 51-30-9 |
| Molecular Weight (g/mol) | 247.72 |
| MDL Number | MFCD00012603,MFCD00064548 |
| SMILES | [H+].[Cl-].CC(C)NCC(O)C1=CC=C(O)C(O)=C1 |
| Synonym | isoprenaline hydrochloride,isoproterenol hydrochloride,isuprel,euspiran,isoprenaline hcl,isoproterenol hcl,aerolone,aerotrol,izadrin,vapo-iso |
| IUPAC Name | hydrogen 4-{1-hydroxy-2-[(propan-2-yl)amino]ethyl}benzene-1,2-diol chloride |
| InChI Key | IROWCYIEJAOFOW-UHFFFAOYNA-N |
| Molecular Formula | C11H18ClNO3 |
3-Fluorobenzyl alcohol, 98%
CAS: 456-47-3 Molecular Formula: C7H7FO Molecular Weight (g/mol): 126.13 MDL Number: MFCD00004631 InChI Key: QDHRSLFSDGCJFX-UHFFFAOYSA-N Synonym: 3-fluorobenzyl alcohol,3-fluorophenyl methanol,m-fluorobenzyl alcohol,benzenemethanol, 3-fluoro,3-fluorobenzylalcohol,3-fluorobenzylic alcohol,benzyl alcohol, m-fluoro,3-fluorophenyl methan-1-ol,3-florobenzyl alcohol,pubchem3486 PubChem CID: 68008 IUPAC Name: (3-fluorophenyl)methanol SMILES: C1=CC(=CC(=C1)F)CO
| PubChem CID | 68008 |
|---|---|
| CAS | 456-47-3 |
| Molecular Weight (g/mol) | 126.13 |
| MDL Number | MFCD00004631 |
| SMILES | C1=CC(=CC(=C1)F)CO |
| Synonym | 3-fluorobenzyl alcohol,3-fluorophenyl methanol,m-fluorobenzyl alcohol,benzenemethanol, 3-fluoro,3-fluorobenzylalcohol,3-fluorobenzylic alcohol,benzyl alcohol, m-fluoro,3-fluorophenyl methan-1-ol,3-florobenzyl alcohol,pubchem3486 |
| IUPAC Name | (3-fluorophenyl)methanol |
| InChI Key | QDHRSLFSDGCJFX-UHFFFAOYSA-N |
| Molecular Formula | C7H7FO |
4-Hydroxybenzoic acid, 99%
CAS: 99-96-7 Molecular Formula: C7H6O3 Molecular Weight (g/mol): 138.12 MDL Number: MFCD00002547 InChI Key: FJKROLUGYXJWQN-UHFFFAOYSA-N Synonym: p-hydroxybenzoic acid,4-carboxyphenol,benzoic acid, 4-hydroxy,p-salicylic acid,benzoic acid, p-hydroxy,para-hydroxybenzoic acid,4-hydroxybenzoesaeure,p-carboxyphenol,4-hydroxy benzoic acid,p-oxybenzoesaure german PubChem CID: 135 ChEBI: CHEBI:30763 IUPAC Name: 4-hydroxybenzoic acid SMILES: OC(=O)C1=CC=C(O)C=C1
| PubChem CID | 135 |
|---|---|
| CAS | 99-96-7 |
| Molecular Weight (g/mol) | 138.12 |
| ChEBI | CHEBI:30763 |
| MDL Number | MFCD00002547 |
| SMILES | OC(=O)C1=CC=C(O)C=C1 |
| Synonym | p-hydroxybenzoic acid,4-carboxyphenol,benzoic acid, 4-hydroxy,p-salicylic acid,benzoic acid, p-hydroxy,para-hydroxybenzoic acid,4-hydroxybenzoesaeure,p-carboxyphenol,4-hydroxy benzoic acid,p-oxybenzoesaure german |
| IUPAC Name | 4-hydroxybenzoic acid |
| InChI Key | FJKROLUGYXJWQN-UHFFFAOYSA-N |
| Molecular Formula | C7H6O3 |
Thermo Scientific Chemicals 5-Sulfosalicylic acid dihydrate, 99+%
CAS: 5965-83-3 | C9H14O6S | 250.27 g/mol
| Molecular Weight (g/mol) | 250.27 |
|---|---|
| CAS Min % | 99.0 |
| InChI Key | NFYHZVWMQHQKRU-UHFFFAOYSA-N |
| PubChem CID | 2723734 |
| Name Note | p.a. |
| Percent Purity | 99+% |
| Fieser | 01,1118 |
| Infrared Spectrum | Authentic |
| Formula Weight | 254.22 |
| Melting Point | 106.0°C to 110.0°C |
| CAS Max % | 100.0 |
| Color | White |
| Physical Form | Crystalline Powder |
| Chemical Name or Material | 5-Sulfosalicylic acid dihydrate |
| SMILES | C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O |
| Merck Index | 15, 9094 |
| Assay Percent Range | 99+% |
| CAS | 97-05-2 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| MDL Number | MFCD00007508,MFCD00149540 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. |
| Solubility Information | Solubility in water: 127g/L (20°C). Other solubilities: soluble in alcohol and ether |
| Packaging | Plastic bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | 2-hydroxy-5-sulfobenzoic acid dihydrate,5-sulfosalicylic acid dihydrate,sulfosalicylic acid dihydrate,benzoic acid, 2-hydroxy-5-sulfo-, dihydrate,unii-09ngq462s6,2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate,5-sulfosalicylsyre,5-sulfosalicylsaeure,salicylic acid, 5-sulfo-, dihydrate,acmc-1aymd |
| Beilstein | 11, 411 |
| Molecular Formula | C9H14O6S |
Diphenyl sulfone, 99+%
CAS: 127-63-9 Molecular Formula: C12H10O2S Molecular Weight (g/mol): 218.27 MDL Number: MFCD00007548 InChI Key: KZTYYGOKRVBIMI-UHFFFAOYSA-N Synonym: diphenyl sulfone,phenyl sulfone,sulfonyldibenzene,diphenylsulfone,sulfobenzide,diphenyl sulphone,benzene, 1,1'-sulfonylbis,sulfone, diphenyl,1,1'-sulfonyldibenzene,phenyl sulphone PubChem CID: 31386 ChEBI: CHEBI:78360 IUPAC Name: benzenesulfonylbenzene SMILES: O=S(=O)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 31386 |
|---|---|
| CAS | 127-63-9 |
| Molecular Weight (g/mol) | 218.27 |
| ChEBI | CHEBI:78360 |
| MDL Number | MFCD00007548 |
| SMILES | O=S(=O)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenyl sulfone,phenyl sulfone,sulfonyldibenzene,diphenylsulfone,sulfobenzide,diphenyl sulphone,benzene, 1,1'-sulfonylbis,sulfone, diphenyl,1,1'-sulfonyldibenzene,phenyl sulphone |
| IUPAC Name | benzenesulfonylbenzene |
| InChI Key | KZTYYGOKRVBIMI-UHFFFAOYSA-N |
| Molecular Formula | C12H10O2S |
2,5-Di-tert-butylhydroquinone, 98+%
CAS: 88-58-4 Molecular Formula: C14H22O2 Molecular Weight (g/mol): 222.33 MDL Number: MFCD00008825 InChI Key: JZODKRWQWUWGCD-UHFFFAOYSA-N Synonym: 2,5-di-tert-butylhydroquinone,2,5-di-tert-butylbenzene-1,4-diol,dibug,dtbhq,dybug,santovar o,di-t-butylhydroquinone,2,5-di-tert-butylquinol,nonflex alba,2,5-di-t-butylhydroquinone PubChem CID: 2374 ChEBI: CHEBI:41094 IUPAC Name: 2,5-ditert-butylbenzene-1,4-diol SMILES: CC(C)(C)C1=CC(O)=C(C=C1O)C(C)(C)C
| PubChem CID | 2374 |
|---|---|
| CAS | 88-58-4 |
| Molecular Weight (g/mol) | 222.33 |
| ChEBI | CHEBI:41094 |
| MDL Number | MFCD00008825 |
| SMILES | CC(C)(C)C1=CC(O)=C(C=C1O)C(C)(C)C |
| Synonym | 2,5-di-tert-butylhydroquinone,2,5-di-tert-butylbenzene-1,4-diol,dibug,dtbhq,dybug,santovar o,di-t-butylhydroquinone,2,5-di-tert-butylquinol,nonflex alba,2,5-di-t-butylhydroquinone |
| IUPAC Name | 2,5-ditert-butylbenzene-1,4-diol |
| InChI Key | JZODKRWQWUWGCD-UHFFFAOYSA-N |
| Molecular Formula | C14H22O2 |
4-Chlorobenzotrifluoride, 98+%
CAS: 98-56-6 Molecular Formula: C7H4ClF3 Molecular Weight (g/mol): 180.554 MDL Number: MFCD00000627 InChI Key: QULYNCCPRWKEMF-UHFFFAOYSA-N Synonym: 4-chlorobenzotrifluoride,p-chlorobenzotrifluoride,1-chloro-4-trifluoromethyl benzene,benzene, 1-chloro-4-trifluoromethyl,4-chloro-alpha,alpha,alpha-trifluorotoluene,para-chlorobenzotrifluoride,p-chlorophenyl trifluoromethane,p-chloro-a,a,a-trifluorotoluene,pcbtf,p-chlorotrifluoromethylbenzene PubChem CID: 7394 IUPAC Name: 1-chloro-4-(trifluoromethyl)benzene SMILES: C1=CC(=CC=C1C(F)(F)F)Cl
| PubChem CID | 7394 |
|---|---|
| CAS | 98-56-6 |
| Molecular Weight (g/mol) | 180.554 |
| MDL Number | MFCD00000627 |
| SMILES | C1=CC(=CC=C1C(F)(F)F)Cl |
| Synonym | 4-chlorobenzotrifluoride,p-chlorobenzotrifluoride,1-chloro-4-trifluoromethyl benzene,benzene, 1-chloro-4-trifluoromethyl,4-chloro-alpha,alpha,alpha-trifluorotoluene,para-chlorobenzotrifluoride,p-chlorophenyl trifluoromethane,p-chloro-a,a,a-trifluorotoluene,pcbtf,p-chlorotrifluoromethylbenzene |
| IUPAC Name | 1-chloro-4-(trifluoromethyl)benzene |
| InChI Key | QULYNCCPRWKEMF-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClF3 |
Anisole, 99%
CAS: 100-66-3 Molecular Formula: C7H8O Molecular Weight (g/mol): 108.14 MDL Number: MFCD00008354 InChI Key: RDOXTESZEPMUJZ-UHFFFAOYSA-N Synonym: methoxybenzene,methyl phenyl ether,benzene, methoxy,anisol,phenyl methyl ether,phenoxymethane,anizol,phenol methyl ether,methoxy-benzene PubChem CID: 7519 ChEBI: CHEBI:16579 IUPAC Name: anisole SMILES: COC1=CC=CC=C1
| PubChem CID | 7519 |
|---|---|
| CAS | 100-66-3 |
| Molecular Weight (g/mol) | 108.14 |
| ChEBI | CHEBI:16579 |
| MDL Number | MFCD00008354 |
| SMILES | COC1=CC=CC=C1 |
| Synonym | methoxybenzene,methyl phenyl ether,benzene, methoxy,anisol,phenyl methyl ether,phenoxymethane,anizol,phenol methyl ether,methoxy-benzene |
| IUPAC Name | anisole |
| InChI Key | RDOXTESZEPMUJZ-UHFFFAOYSA-N |
| Molecular Formula | C7H8O |
3-Hydroxybenzylamine, 96%, Thermo Scientific Chemicals
CAS: 73604-31-6 Molecular Formula: C7H9NO Molecular Weight (g/mol): 123.16 MDL Number: MFCD00798977 InChI Key: JNZYADHPGVZMQK-UHFFFAOYSA-N Synonym: 3-aminomethyl phenol,3-hydroxybenzylamine,phenol, 3-aminomethyl,3-hydroxybenzylamine, 3-hydroxyphenyl methylamine,3-aminomethyl-phenol,3-hydroxy-benzylamine,3-hydroxyphenyl methylamine PubChem CID: 735894 IUPAC Name: 3-(aminomethyl)phenol SMILES: NCC1=CC(O)=CC=C1
| PubChem CID | 735894 |
|---|---|
| CAS | 73604-31-6 |
| Molecular Weight (g/mol) | 123.16 |
| MDL Number | MFCD00798977 |
| SMILES | NCC1=CC(O)=CC=C1 |
| Synonym | 3-aminomethyl phenol,3-hydroxybenzylamine,phenol, 3-aminomethyl,3-hydroxybenzylamine, 3-hydroxyphenyl methylamine,3-aminomethyl-phenol,3-hydroxy-benzylamine,3-hydroxyphenyl methylamine |
| IUPAC Name | 3-(aminomethyl)phenol |
| InChI Key | JNZYADHPGVZMQK-UHFFFAOYSA-N |
| Molecular Formula | C7H9NO |
4-tert-Butylphenol, 99%
CAS: 98-54-4 Molecular Formula: C10H14O MDL Number: MFCD00002367 InChI Key: QHPQWRBYOIRBIT-UHFFFAOYSA-N Synonym: 4-tert-butyl phenol,butylphen,p-tert-butylphenol,ptbp,4-1,1-dimethylethyl phenol,4-t-butylphenol,p-t-butyl phenol,phenol, 4-1,1-dimethylethyl,p-t-butylphenol,p-terc.butylfenol PubChem CID: 7393 ChEBI: CHEBI:34444 IUPAC Name: 4-tert-butylphenol
| PubChem CID | 7393 |
|---|---|
| CAS | 98-54-4 |
| ChEBI | CHEBI:34444 |
| MDL Number | MFCD00002367 |
| Synonym | 4-tert-butyl phenol,butylphen,p-tert-butylphenol,ptbp,4-1,1-dimethylethyl phenol,4-t-butylphenol,p-t-butyl phenol,phenol, 4-1,1-dimethylethyl,p-t-butylphenol,p-terc.butylfenol |
| IUPAC Name | 4-tert-butylphenol |
| InChI Key | QHPQWRBYOIRBIT-UHFFFAOYSA-N |
| Molecular Formula | C10H14O |
Sulfamethazine sodium salt, MP Biomedicals™
CAS: 1981-58-4 Molecular Formula: C12H13N4NaO2S Molecular Weight (g/mol): 300.312 InChI Key: NGIVTUVVBWOTNT-UHFFFAOYSA-N Synonym: sulfamethazine sodium salt,sulfamethazine sodium,sulfadimidine sodium,sodium sulfamethazine,sodium sulfametazine,sodium sulfamethamide,sodium sulfamezathine,bovibol,vesadin,sodium sulfamethiazine PubChem CID: 13456556 IUPAC Name: sodium;(4-aminophenyl)sulfonyl-(4,6-dimethylpyrimidin-2-yl)azanide SMILES: CC1=CC(=NC(=N1)[N-]S(=O)(=O)C2=CC=C(C=C2)N)C.[Na+]
| PubChem CID | 13456556 |
|---|---|
| CAS | 1981-58-4 |
| Molecular Weight (g/mol) | 300.312 |
| SMILES | CC1=CC(=NC(=N1)[N-]S(=O)(=O)C2=CC=C(C=C2)N)C.[Na+] |
| Synonym | sulfamethazine sodium salt,sulfamethazine sodium,sulfadimidine sodium,sodium sulfamethazine,sodium sulfametazine,sodium sulfamethamide,sodium sulfamezathine,bovibol,vesadin,sodium sulfamethiazine |
| IUPAC Name | sodium;(4-aminophenyl)sulfonyl-(4,6-dimethylpyrimidin-2-yl)azanide |
| InChI Key | NGIVTUVVBWOTNT-UHFFFAOYSA-N |
| Molecular Formula | C12H13N4NaO2S |
4-Nitrobenzoic acid, 99+%
CAS: 62-23-7 Molecular Formula: C7H5NO4 Molecular Weight (g/mol): 167.12 MDL Number: MFCD00007352 InChI Key: OTLNPYWUJOZPPA-UHFFFAOYSA-N Synonym: 4-nitrobenzoic acid,p-nitrobenzoic acid,benzoic acid, 4-nitro,nitrodracylic acid,4-nitrodracylic acid,1-carboxy-4-nitrobenzene,benzoic acid, p-nitro,p-nitrobenzoicacid,p-nitrobenzenecarboxylic acid,kyselina p-nitrobenzoova PubChem CID: 6108 ChEBI: CHEBI:262350 SMILES: C1=CC(=CC=C1C(=O)O)[N+](=O)[O-]
| PubChem CID | 6108 |
|---|---|
| CAS | 62-23-7 |
| Molecular Weight (g/mol) | 167.12 |
| ChEBI | CHEBI:262350 |
| MDL Number | MFCD00007352 |
| SMILES | C1=CC(=CC=C1C(=O)O)[N+](=O)[O-] |
| Synonym | 4-nitrobenzoic acid,p-nitrobenzoic acid,benzoic acid, 4-nitro,nitrodracylic acid,4-nitrodracylic acid,1-carboxy-4-nitrobenzene,benzoic acid, p-nitro,p-nitrobenzoicacid,p-nitrobenzenecarboxylic acid,kyselina p-nitrobenzoova |
| InChI Key | OTLNPYWUJOZPPA-UHFFFAOYSA-N |
| Molecular Formula | C7H5NO4 |
9,10-Dihydroanthracene 98.0+%, TCI America™
CAS: 613-31-0 Molecular Formula: C14H12 Molecular Weight (g/mol): 180.25 MDL Number: MFCD00001239 InChI Key: WPDAVTSOEQEGMS-UHFFFAOYSA-N Synonym: anthracene, 9,10-dihydro,anthracene, dihydro,9,10-dihydro-anthracene,unii-z142c238gb,anthracene,10-dihydro,acmc-1bh69,9,10-dihydroanthracen-9-yl,9,10-dihydroanthracene PubChem CID: 11940 IUPAC Name: 9,10-dihydroanthracene SMILES: C1C2=CC=CC=C2CC3=CC=CC=C31
| PubChem CID | 11940 |
|---|---|
| CAS | 613-31-0 |
| Molecular Weight (g/mol) | 180.25 |
| MDL Number | MFCD00001239 |
| SMILES | C1C2=CC=CC=C2CC3=CC=CC=C31 |
| Synonym | anthracene, 9,10-dihydro,anthracene, dihydro,9,10-dihydro-anthracene,unii-z142c238gb,anthracene,10-dihydro,acmc-1bh69,9,10-dihydroanthracen-9-yl,9,10-dihydroanthracene |
| IUPAC Name | 9,10-dihydroanthracene |
| InChI Key | WPDAVTSOEQEGMS-UHFFFAOYSA-N |
| Molecular Formula | C14H12 |
4-Nitrophenyl acetate, 97%
CAS: 830-03-5 Molecular Formula: C8H7NO4 Molecular Weight (g/mol): 181.15 MDL Number: MFCD00007326 InChI Key: QAUUDNIGJSLPSX-UHFFFAOYSA-N Synonym: p-nitrophenyl acetate,p-acetoxynitrobenzene,acetic acid, 4-nitrophenyl ester,p-nitrophenol acetate,acetic acid p-nitrophenyl ester,acetic acid, p-nitrophenyl ester,p-nitrophenyl acetate van,4-nitrophenyl acetate,unii-i902j0qh9s,acetic acid 4-nitrophenyl ester PubChem CID: 13243 ChEBI: CHEBI:82635 SMILES: CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O
| PubChem CID | 13243 |
|---|---|
| CAS | 830-03-5 |
| Molecular Weight (g/mol) | 181.15 |
| ChEBI | CHEBI:82635 |
| MDL Number | MFCD00007326 |
| SMILES | CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O |
| Synonym | p-nitrophenyl acetate,p-acetoxynitrobenzene,acetic acid, 4-nitrophenyl ester,p-nitrophenol acetate,acetic acid p-nitrophenyl ester,acetic acid, p-nitrophenyl ester,p-nitrophenyl acetate van,4-nitrophenyl acetate,unii-i902j0qh9s,acetic acid 4-nitrophenyl ester |
| InChI Key | QAUUDNIGJSLPSX-UHFFFAOYSA-N |
| Molecular Formula | C8H7NO4 |