Benzenoids
Filtered Search Results
3-Acetamidophenol, 98%
CAS: 621-42-1 Molecular Formula: C8H9NO2 Molecular Weight (g/mol): 151.165 MDL Number: MFCD00002263 InChI Key: QLNWXBAGRTUKKI-UHFFFAOYSA-N Synonym: 3-acetamidophenol,n-3-hydroxyphenyl acetamide,metacetamol,3'-hydroxyacetanilide,m-acetamidophenol,3-hydroxyacetanilide,n-acetyl-m-aminophenol,m-hydroxyacetanilide,3-acetylamino phenol,metalid PubChem CID: 12124 ChEBI: CHEBI:76987 IUPAC Name: N-(3-hydroxyphenyl)acetamide SMILES: CC(=O)NC1=CC(=CC=C1)O
| PubChem CID | 12124 |
|---|---|
| CAS | 621-42-1 |
| Molecular Weight (g/mol) | 151.165 |
| ChEBI | CHEBI:76987 |
| MDL Number | MFCD00002263 |
| SMILES | CC(=O)NC1=CC(=CC=C1)O |
| Synonym | 3-acetamidophenol,n-3-hydroxyphenyl acetamide,metacetamol,3'-hydroxyacetanilide,m-acetamidophenol,3-hydroxyacetanilide,n-acetyl-m-aminophenol,m-hydroxyacetanilide,3-acetylamino phenol,metalid |
| IUPAC Name | N-(3-hydroxyphenyl)acetamide |
| InChI Key | QLNWXBAGRTUKKI-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO2 |
Triphenylphosphine-3,3',3″-trisulfonic acid trisodium salt hydrate, tech. 85%
CAS: 335421-90-4 Molecular Formula: C18H12Na3O9PS3 Molecular Weight (g/mol): 568.41 MDL Number: MFCD00145472 InChI Key: MYAJTCUQMQREFZ-UHFFFAOYSA-K Synonym: sodium 3,3',3-phosphinetriyltribenzenesulfonate,tppts,triphenylphosphine-3,3',3-trisulfonic acid trisodium salt,tris 3-sulfophenyl phosphine trisodium salt,trisodium 3,3',3-phosphinetriyltris benzene-1-sulphonate,trisodium 3-bis 3-sulfonatophenyl phosphanylbenzenesulfonate,tri m-sulfophenyl phosphine, sodium salt,benzenesulfonic acid, 3,3',3-phosphinidynetris-, trisodium salt,triphenylphosphine-3,3 ,3-trisulfonic acid trisodium salt,pubchem16013 PubChem CID: 6099338 IUPAC Name: trisodium;3-bis(3-sulfonatophenyl)phosphanylbenzenesulfonate
| PubChem CID | 6099338 |
|---|---|
| CAS | 335421-90-4 |
| Molecular Weight (g/mol) | 568.41 |
| MDL Number | MFCD00145472 |
| Synonym | sodium 3,3',3-phosphinetriyltribenzenesulfonate,tppts,triphenylphosphine-3,3',3-trisulfonic acid trisodium salt,tris 3-sulfophenyl phosphine trisodium salt,trisodium 3,3',3-phosphinetriyltris benzene-1-sulphonate,trisodium 3-bis 3-sulfonatophenyl phosphanylbenzenesulfonate,tri m-sulfophenyl phosphine, sodium salt,benzenesulfonic acid, 3,3',3-phosphinidynetris-, trisodium salt,triphenylphosphine-3,3 ,3-trisulfonic acid trisodium salt,pubchem16013 |
| IUPAC Name | trisodium;3-bis(3-sulfonatophenyl)phosphanylbenzenesulfonate |
| InChI Key | MYAJTCUQMQREFZ-UHFFFAOYSA-K |
| Molecular Formula | C18H12Na3O9PS3 |
Triphenylphosphine, 98%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 603-35-0
| CAS | 603-35-0 |
|---|
Selectophore™ Sodium tetrakis(4-fluorophenyl)borate dihydrate, ≥97.0%, MilliporeSigma™ Supelco™
MDL Number: MFCD00149598 Synonym: Cesibor; Tetrakis(4-fluorophenyl)boron sodium
| MDL Number | MFCD00149598 |
|---|---|
| Synonym | Cesibor; Tetrakis(4-fluorophenyl)boron sodium |
4,4'-Dichlorobenzophenone, 99%
CAS: 90-98-2 Molecular Formula: C13H8Cl2O Molecular Weight (g/mol): 251.11 MDL Number: MFCD00000623 InChI Key: OKISUZLXOYGIFP-UHFFFAOYSA-N Synonym: 4,4'-dichlorobenzophenone,bis 4-chlorophenyl methanone,methanone, bis 4-chlorophenyl,bis 4-chlorophenyl ketone,dcbp,di p-chlorophenyl ketone,di 4-chlorophenyl ketone,bis p-chlorophenyl ketone,p,p'-dichlorobenzophenone,usaf do-4 PubChem CID: 7034 ChEBI: CHEBI:27519 IUPAC Name: bis(4-chlorophenyl)methanone SMILES: ClC1=CC=C(C=C1)C(=O)C1=CC=C(Cl)C=C1
| PubChem CID | 7034 |
|---|---|
| CAS | 90-98-2 |
| Molecular Weight (g/mol) | 251.11 |
| ChEBI | CHEBI:27519 |
| MDL Number | MFCD00000623 |
| SMILES | ClC1=CC=C(C=C1)C(=O)C1=CC=C(Cl)C=C1 |
| Synonym | 4,4'-dichlorobenzophenone,bis 4-chlorophenyl methanone,methanone, bis 4-chlorophenyl,bis 4-chlorophenyl ketone,dcbp,di p-chlorophenyl ketone,di 4-chlorophenyl ketone,bis p-chlorophenyl ketone,p,p'-dichlorobenzophenone,usaf do-4 |
| IUPAC Name | bis(4-chlorophenyl)methanone |
| InChI Key | OKISUZLXOYGIFP-UHFFFAOYSA-N |
| Molecular Formula | C13H8Cl2O |
Methyl 2-hydroxy-3-methylbenzoate, 97%
CAS: 23287-26-5 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00020051 InChI Key: SUHLUMKZPUMAFP-UHFFFAOYSA-N Synonym: methyl 3-methylsalicylate,methyl o-cresotinate,benzoic acid, 2-hydroxy-3-methyl-, methyl ester,levegal pt,2-hydroxy-3-methylbenzoic acid methyl ester,2,3-cresotic acid, methyl ester,methyl-3-methylsalicylate,methyl 2-hydroxy-3-methyl-benzoate,methyl o-cresotate,3-methylsalicylic acid methyl ester PubChem CID: 31835 IUPAC Name: methyl 2-hydroxy-3-methylbenzoate SMILES: COC(=O)C1=CC=CC(C)=C1O
| PubChem CID | 31835 |
|---|---|
| CAS | 23287-26-5 |
| Molecular Weight (g/mol) | 166.18 |
| MDL Number | MFCD00020051 |
| SMILES | COC(=O)C1=CC=CC(C)=C1O |
| Synonym | methyl 3-methylsalicylate,methyl o-cresotinate,benzoic acid, 2-hydroxy-3-methyl-, methyl ester,levegal pt,2-hydroxy-3-methylbenzoic acid methyl ester,2,3-cresotic acid, methyl ester,methyl-3-methylsalicylate,methyl 2-hydroxy-3-methyl-benzoate,methyl o-cresotate,3-methylsalicylic acid methyl ester |
| IUPAC Name | methyl 2-hydroxy-3-methylbenzoate |
| InChI Key | SUHLUMKZPUMAFP-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
Methyl 3-fluoro-4-methoxybenzoate, 95%, Thermo Scientific™
CAS: 369-30-2 Molecular Formula: C9H9FO3 Molecular Weight (g/mol): 184.17 MDL Number: MFCD00215839 InChI Key: MIKOKYAREMINFF-UHFFFAOYSA-N Synonym: benzoic acid, 3-fluoro-4-methoxy-, methyl ester,methyl 3-fluoro-4-methyloxy benzoate,3-fluoro-4-methoxybenzoic acid methyl ester,pubchem3569,acmc-1ck9v,rarechem al bf 0055,# PubChem CID: 592848 IUPAC Name: methyl 3-fluoro-4-methoxybenzoate SMILES: COC(=O)C1=CC(F)=C(OC)C=C1
| PubChem CID | 592848 |
|---|---|
| CAS | 369-30-2 |
| Molecular Weight (g/mol) | 184.17 |
| MDL Number | MFCD00215839 |
| SMILES | COC(=O)C1=CC(F)=C(OC)C=C1 |
| Synonym | benzoic acid, 3-fluoro-4-methoxy-, methyl ester,methyl 3-fluoro-4-methyloxy benzoate,3-fluoro-4-methoxybenzoic acid methyl ester,pubchem3569,acmc-1ck9v,rarechem al bf 0055,# |
| IUPAC Name | methyl 3-fluoro-4-methoxybenzoate |
| InChI Key | MIKOKYAREMINFF-UHFFFAOYSA-N |
| Molecular Formula | C9H9FO3 |
2,4-Difluoro-5-nitrobenzoic acid, 97%
CAS: 153775-33-8 Molecular Formula: C7H2F2NO4 Molecular Weight (g/mol): 202.09 MDL Number: MFCD04115713 InChI Key: MDFSGDMPHMKKGB-UHFFFAOYSA-M PubChem CID: 2782822 IUPAC Name: 2,4-difluoro-5-nitrobenzoate SMILES: [O-]C(=O)C1=CC(=C(F)C=C1F)[N+]([O-])=O
| PubChem CID | 2782822 |
|---|---|
| CAS | 153775-33-8 |
| Molecular Weight (g/mol) | 202.09 |
| MDL Number | MFCD04115713 |
| SMILES | [O-]C(=O)C1=CC(=C(F)C=C1F)[N+]([O-])=O |
| IUPAC Name | 2,4-difluoro-5-nitrobenzoate |
| InChI Key | MDFSGDMPHMKKGB-UHFFFAOYSA-M |
| Molecular Formula | C7H2F2NO4 |
4-Bromotoluene, 99%
CAS: 106-38-7 Molecular Formula: C7H7Br Molecular Weight (g/mol): 171.04 MDL Number: MFCD00000109 InChI Key: ZBTMRBYMKUEVEU-UHFFFAOYSA-N Synonym: 4-bromotoluene,p-bromotoluene,4-methylbromobenzene,p-tolyl bromide,benzene, 1-bromo-4-methyl,toluene, p-bromo,p-methylphenyl bromide,p-methylbromobenzene,1-methyl-4-bromobenzene,4-bromo-1-methylbenzene PubChem CID: 7805 IUPAC Name: 1-bromo-4-methylbenzene SMILES: CC1=CC=C(Br)C=C1
| PubChem CID | 7805 |
|---|---|
| CAS | 106-38-7 |
| Molecular Weight (g/mol) | 171.04 |
| MDL Number | MFCD00000109 |
| SMILES | CC1=CC=C(Br)C=C1 |
| Synonym | 4-bromotoluene,p-bromotoluene,4-methylbromobenzene,p-tolyl bromide,benzene, 1-bromo-4-methyl,toluene, p-bromo,p-methylphenyl bromide,p-methylbromobenzene,1-methyl-4-bromobenzene,4-bromo-1-methylbenzene |
| IUPAC Name | 1-bromo-4-methylbenzene |
| InChI Key | ZBTMRBYMKUEVEU-UHFFFAOYSA-N |
| Molecular Formula | C7H7Br |
3,3',5,5'-Tetramethylbenzidine soln., Ready-to-Use, precipitating, standard sensitivity, Thermo Scientific Chemicals
CAS: 54827-17-7 Molecular Formula: C16H20N2 Molecular Weight (g/mol): 240.35 MDL Number: MFCD00007748 InChI Key: UAIUNKRWKOVEES-UHFFFAOYSA-N Synonym: 3,3',5,5'-tetramethylbenzidine,3,3',5,5'-tetramethyl-1,1'-biphenyl-4,4'-diamine,3,5,3',5'-tetramethylbenzidine,tmb,3,3',5,5'-tetramethyl benzidine,tmb substrate,bm blue,ccris 4727,tmb plus,tmb, insoluble PubChem CID: 41206 IUPAC Name: 4-(4-amino-3,5-dimethylphenyl)-2,6-dimethylaniline SMILES: CC1=CC(=CC(=C1N)C)C2=CC(=C(C(=C2)C)N)C
| PubChem CID | 41206 |
|---|---|
| CAS | 54827-17-7 |
| Molecular Weight (g/mol) | 240.35 |
| MDL Number | MFCD00007748 |
| SMILES | CC1=CC(=CC(=C1N)C)C2=CC(=C(C(=C2)C)N)C |
| Synonym | 3,3',5,5'-tetramethylbenzidine,3,3',5,5'-tetramethyl-1,1'-biphenyl-4,4'-diamine,3,5,3',5'-tetramethylbenzidine,tmb,3,3',5,5'-tetramethyl benzidine,tmb substrate,bm blue,ccris 4727,tmb plus,tmb, insoluble |
| IUPAC Name | 4-(4-amino-3,5-dimethylphenyl)-2,6-dimethylaniline |
| InChI Key | UAIUNKRWKOVEES-UHFFFAOYSA-N |
| Molecular Formula | C16H20N2 |
3,5-Dihydroxytoluene monohydrate, 97%
CAS: 6153-39-5 Molecular Formula: C7H10O3 Molecular Weight (g/mol): 142.154 MDL Number: MFCD00149092 InChI Key: NBKPNAMTHBIMLA-UHFFFAOYSA-N Synonym: 5-methylbenzene-1,3-diol hydrate,orcinol monohydrate,5-methylresorcinol monohydrate,3,5-dihydroxytoluene monohydrate,orcinol hydrate,resorcinol, 5-methyl-, monohydrate,1,3-benzenediol, 5-methyl-, monohydrate,1,3-dihydroxy-5-methylbenzene monohydrate,acmc-209mtl,5-methylresorcinol hydrate PubChem CID: 3083941 IUPAC Name: 5-methylbenzene-1,3-diol;hydrate SMILES: CC1=CC(=CC(=C1)O)O.O
| PubChem CID | 3083941 |
|---|---|
| CAS | 6153-39-5 |
| Molecular Weight (g/mol) | 142.154 |
| MDL Number | MFCD00149092 |
| SMILES | CC1=CC(=CC(=C1)O)O.O |
| Synonym | 5-methylbenzene-1,3-diol hydrate,orcinol monohydrate,5-methylresorcinol monohydrate,3,5-dihydroxytoluene monohydrate,orcinol hydrate,resorcinol, 5-methyl-, monohydrate,1,3-benzenediol, 5-methyl-, monohydrate,1,3-dihydroxy-5-methylbenzene monohydrate,acmc-209mtl,5-methylresorcinol hydrate |
| IUPAC Name | 5-methylbenzene-1,3-diol;hydrate |
| InChI Key | NBKPNAMTHBIMLA-UHFFFAOYSA-N |
| Molecular Formula | C7H10O3 |
3-Bromobenzhydrazide, 98+%
CAS: 39115-96-3 Molecular Formula: C7H7BrN2O Molecular Weight (g/mol): 215.05 MDL Number: MFCD00007600 InChI Key: BNAQRAZIPAHWAR-UHFFFAOYSA-N Synonym: 3-bromobenzhydrazide,m-bromobenzohydrazide,3-bromobenzoic hydrazide,benzoic acid, 3-bromo-, hydrazide,3-bromobenzoic acid hydrazide,3-bromobenzoylhydrazine,benzoylhydrazine, m-bromo,3-bromo-benzoic acid hydrazide,3-bromobenzenecarbohydrazide,3-bromanylbenzohydrazide PubChem CID: 520941 IUPAC Name: 3-bromobenzohydrazide SMILES: C1=CC(=CC(=C1)Br)C(=O)NN
| PubChem CID | 520941 |
|---|---|
| CAS | 39115-96-3 |
| Molecular Weight (g/mol) | 215.05 |
| MDL Number | MFCD00007600 |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)NN |
| Synonym | 3-bromobenzhydrazide,m-bromobenzohydrazide,3-bromobenzoic hydrazide,benzoic acid, 3-bromo-, hydrazide,3-bromobenzoic acid hydrazide,3-bromobenzoylhydrazine,benzoylhydrazine, m-bromo,3-bromo-benzoic acid hydrazide,3-bromobenzenecarbohydrazide,3-bromanylbenzohydrazide |
| IUPAC Name | 3-bromobenzohydrazide |
| InChI Key | BNAQRAZIPAHWAR-UHFFFAOYSA-N |
| Molecular Formula | C7H7BrN2O |
2-Chloro-6-fluorobenzamide, 98%
CAS: 66073-54-9 Molecular Formula: C7H5ClFNO Molecular Weight (g/mol): 173.571 MDL Number: MFCD00055436 InChI Key: KLOZZZNFJYMTNE-UHFFFAOYSA-N PubChem CID: 98564 IUPAC Name: 2-chloro-6-fluorobenzamide SMILES: C1=CC(=C(C(=C1)Cl)C(=O)N)F
| PubChem CID | 98564 |
|---|---|
| CAS | 66073-54-9 |
| Molecular Weight (g/mol) | 173.571 |
| MDL Number | MFCD00055436 |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)N)F |
| IUPAC Name | 2-chloro-6-fluorobenzamide |
| InChI Key | KLOZZZNFJYMTNE-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClFNO |
3-Bromo-4-fluorobenzylamine hydrochloride, 98%, Thermo Scientific Chemicals
CAS: 202865-68-7 Molecular Formula: C7H8BrClFN Molecular Weight (g/mol): 240.50 MDL Number: MFCD00143094 InChI Key: RSFNYNQGERWCMT-UHFFFAOYSA-N Synonym: 3-bromo-4-fluorobenzylamine hydrochloride,3-bromo-4-fluorophenyl methanamine hydrochloride,3-bromo-4-fluorobenzylamine hcl,1-3-bromo-4-fluorophenyl methanamine hydrochloride,3-bromo-4-fluorophenyl methylamine, chloride,1-3-bromo-4-fluorophenyl methylamine hydrochloride,benzenemethanamine, 3-bromo-4-fluoro-, hydrochloride,pubchem3226,3-bromo-4-fluorobenzylaminehydrochloride,acmc-1bczm PubChem CID: 2724901 IUPAC Name: (3-bromo-4-fluorophenyl)methanamine;hydrochloride SMILES: Cl.NCC1=CC(Br)=C(F)C=C1
| PubChem CID | 2724901 |
|---|---|
| CAS | 202865-68-7 |
| Molecular Weight (g/mol) | 240.50 |
| MDL Number | MFCD00143094 |
| SMILES | Cl.NCC1=CC(Br)=C(F)C=C1 |
| Synonym | 3-bromo-4-fluorobenzylamine hydrochloride,3-bromo-4-fluorophenyl methanamine hydrochloride,3-bromo-4-fluorobenzylamine hcl,1-3-bromo-4-fluorophenyl methanamine hydrochloride,3-bromo-4-fluorophenyl methylamine, chloride,1-3-bromo-4-fluorophenyl methylamine hydrochloride,benzenemethanamine, 3-bromo-4-fluoro-, hydrochloride,pubchem3226,3-bromo-4-fluorobenzylaminehydrochloride,acmc-1bczm |
| IUPAC Name | (3-bromo-4-fluorophenyl)methanamine;hydrochloride |
| InChI Key | RSFNYNQGERWCMT-UHFFFAOYSA-N |
| Molecular Formula | C7H8BrClFN |
3-Fluoro-2-methylaniline, 98+%
CAS: 443-86-7 Molecular Formula: C7H8FN Molecular Weight (g/mol): 125.15 MDL Number: MFCD00007760 InChI Key: SLDLVGFPFFLYBM-UHFFFAOYSA-N Synonym: 3-fluoro-o-toluidine,2-fluoro-6-aminotoluene,2-amino-6-fluorotoluene,6-amino-2-fluorotoluene,3-fluoro-2-methyl-aniline,benzenamine, 3-fluoro-2-methyl,3-fluoro-2-methylphenylamine,2-methyl-3-fluoroaniline,hydrochloride,3-fluor-2-methylanilin PubChem CID: 285553 IUPAC Name: 3-fluoro-2-methylaniline SMILES: CC1=C(N)C=CC=C1F
| PubChem CID | 285553 |
|---|---|
| CAS | 443-86-7 |
| Molecular Weight (g/mol) | 125.15 |
| MDL Number | MFCD00007760 |
| SMILES | CC1=C(N)C=CC=C1F |
| Synonym | 3-fluoro-o-toluidine,2-fluoro-6-aminotoluene,2-amino-6-fluorotoluene,6-amino-2-fluorotoluene,3-fluoro-2-methyl-aniline,benzenamine, 3-fluoro-2-methyl,3-fluoro-2-methylphenylamine,2-methyl-3-fluoroaniline,hydrochloride,3-fluor-2-methylanilin |
| IUPAC Name | 3-fluoro-2-methylaniline |
| InChI Key | SLDLVGFPFFLYBM-UHFFFAOYSA-N |
| Molecular Formula | C7H8FN |