Tetralins
eMolecules 675126-08-6 | Medchem Express | Dasotraline (hydrochloride) | 5mg | 446261947 | HY-12850A | MFCD12031361 | 328.66 | C16H16Cl3N
Medchem Express | Dasotraline (hydrochloride) | 5mg | 446261947 | HY-12850A | 675126-08-6 | MFCD12031361 | 328.660 | C16H16Cl3N
Sigma Aldrich Fine Chemicals Biosciences 6-Methoxy-1-tetralone 99% | 1078-19-9 | MFCD00001695 | 100G
6-Methoxy-1-tetralone 99% | Purity: 99% | Mol Wt: 176.21 | 1078-19-9 | MFCD00001695 | 100G
eMolecules 942487-16-3 | Medchem Express | PF-03814735 | 5mg | 446264335 | HY-14574 | 474.488 | C23H25F3N6O2
Medchem Express | PF-03814735 | 5mg | 446264335 | HY-14574 | 942487-16-3 | 474.488 | C23H25F3N6O2
eMolecules 17556-20-6 | 5,7-Dichloro-2-tetralone | ChemScene | MFCD11041201 | 215.070 | C10H8Cl2O | 97.000 | Clc1cc(Cl)c2CCC(=O)Cc2c1 | 100mg | 626491635
5,7-Dichloro-2-tetralone | ChemScene | 17556-20-6 | MFCD11041201 | 215.070 | C10H8Cl2O | 97.000 | Clc1cc(Cl)c2CCC(=O)Cc2c1 | 100mg | 626491635
Medchemexpress LLC HY-14652 10mg Medchemexpress, Tamibarotene CAS:94497-51-5 Purity:>98%
Medchemexpress, HY-14652 10mg Tamibarotene CAS:94497-51-5 Tamibarotene is a retinoic acid receptor α/β (RARα/β) agonist, showing high selectivity over RARγ. Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.
Chem-Impex International, Inc. 6-Amino-1-tetralone | MFCD00099462 | 5G
6-Amino-1-tetralone, MFCD00099462, 5G
eMolecules 10347-81-6 | Medchem Express | Maprotiline (hydrochloride) | 100mg | 446272751 | HY-B0444 | 313.87 | C20H24ClN
Medchem Express | WYE-687 | 5mg | 632433305 | HY-15271 | 1062161-90-3 | MFCD22417086 | 528.617 | C28H32N8O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 215453-84-2 | 4-(4-Bromophenoxy)tetrahydro-2H-pyran | Combi-Blocks | MFCD11855868 | 257.127 | C11H13BrO2 | 98.000 | Brc1ccc(OC2CCOCC2)cc1 | 1g | 117530436
4-(4-Bromophenoxy)tetrahydro-2H-pyran | Combi-Blocks | 215453-84-2 | MFCD11855868 | 257.127 | C11H13BrO2 | 98.000 | Brc1ccc(OC2CCOCC2)cc1 | 1g | 117530436
![eMolecules 1373232-27-9 | (1S)-6-FLUORO-1,2,3,4-TETRAHYDRONAPHTHALEN-1-AMINE HCL | AstaTech | MFCD22056324 | 201.670 | C10H13ClFN | 95.000 | Cl.N[C@H]1CCCc2cc(F)ccc12 | 1g | 290669445](https://assets.fishersci.com/TFS-Assets/CCG/product-images/VN00128114-290669445.PNG-250.jpg)
eMolecules 1373232-27-9 | (1S)-6-FLUORO-1,2,3,4-TETRAHYDRONAPHTHALEN-1-AMINE HCL | AstaTech | MFCD22056324 | 201.670 | C10H13ClFN | 95.000 | Cl.N[C@H]1CCCc2cc(F)ccc12 | 1g | 290669445
(1S)-6-FLUORO-1,2,3,4-TETRAHYDRONAPHTHALEN-1-AMINE HCL | AstaTech | 1373232-27-9 | MFCD22056324 | 201.670 | C10H13ClFN | 95.000 | Cl.N[C@H]1CCCc2cc(F)ccc12 | 1g | 290669445