Tetralins
eMolecules 351038-62-5 | 5,6,7,8-Tetrahydro-1,7-naphthyridine dihydrochloride | MFCD09056821 | 1g
ChemScene | ethyl 4-chloro-15-dimethyl-6-oxo-16-dihydropyridine-3-carboxylate | 100mg | 572281946 | CS-0061583 | 853109-70-3 | MFCD09031523 | 229.660 | C10H12ClNO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Medchemexpress LLC Menadione bisulfite sodium | 130-37-0 | 99.93% | 500 MG
Menadione bisulfite sodium is an agent that induces acute oxidative stress and acts as a plant-defense activator against various pathogens. It impacts photosynthetic activity by increasing reactive oxygen species and decreasing antioxidant defenses. This compound also enhances resistance to diseases like phoma stem canker and downy mildew.
- Induces acute oxidative stress
- Activates plant defense mechanisms against pathogens
- Increases reactive oxygen species
- Decreases global and specific antioxidant defenses
- Enhances resistance to phoma stem canker disease
- Induces resistance against downy mildew in pearl millet
- Primes specific components of plant innate-defense repertoire
- Up-regulates gene expression for GRX480 protein
eMolecules 153559-49-0 | Bexarotene | MFCD00932428 | 1g
Medchem Express | Cantrixil | 5mg | 771358282 | HY-114250 | 2135511-22-5 | 408.450 | C24H24O6
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 530-93-8 | 1,2,3,4-Tetrahydro-2-naphthalenone | AA Blocks LLC | MFCD00001727 | 146.189 | C10H10O | 0.000 | O=C1CCc2ccccc2C1 | 1g | 410206506
1,2,3,4-Tetrahydro-2-naphthalenone | AA Blocks LLC | 530-93-8 | MFCD00001727 | 146.189 | C10H10O | 0.000 | O=C1CCc2ccccc2C1 | 1g | 410206506
eMolecules 530-93-8 | 1,2,3,4-Tetrahydro-2-naphthalenone | AA Blocks LLC | MFCD00001727 | 146.189 | C10H10O | 0.000 | O=C1CCc2ccccc2C1 | 5g | 410206507
1,2,3,4-Tetrahydro-2-naphthalenone | AA Blocks LLC | 530-93-8 | MFCD00001727 | 146.189 | C10H10O | 0.000 | O=C1CCc2ccccc2C1 | 5g | 410206507
Medchemexpress LLC 6-Bromo-2-tetralone | 4133-35-1 | 99.6% | 225.08 | 10 G
6-Bromo-2-tetralone is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
- Can be used as a biochemical reagent
- Functions as a biological material
- Serves as an organic compound
- Suitable for life science research
Medchemexpress LLC 7-Fluoro-2-tetralone | 29419-15-6 | 95.0% | 164.18 | 5 G
7-Fluoro-2-tetralone is a chemical compound that serves as a versatile drug intermediate for the synthesis of various active compounds.
- Drug intermediate for synthesis of active compounds.
Medchemexpress LLC 7-Bromo-1-tetralone | 32281-97-3 | 99.97% | 225.08 | 10 G
7-Bromo-1-tetralone is a biochemical reagent used as a biological material or organic compound for life science related research. It serves as a synthetic intermediate in pharmaceutical synthesis.
- Used as a biochemical reagent
- Suitable for life science related research
- Intermediate for pharmaceutical synthesis
eMolecules 42972-13-4 | 1,4-DIOXO-1,2,3,4-TETRAHYDROPHTHALAZINE-6-CARBOXYLIC ACID | 1g
Medchem Express | BI-6015 | 5mg | 694124842 | HY-108469 | 93987-29-2 | MFCD04406654 | 331.350 | C15H13N3O4S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 1373232-27-9 | (1S)-6-FLUORO-1,2,3,4-TETRAHYDRONAPHTHALEN-1-AMINE HCL | AstaTech | MFCD22056324 | 201.670 | C10H13ClFN | 95.000 | Cl.N[C@H]1CCCc2cc(F)ccc12 | 1g | 290669445](https://assets.fishersci.com/TFS-Assets/CCG/product-images/VN00128114-290669445.PNG-250.jpg)
eMolecules 1373232-27-9 | (1S)-6-FLUORO-1,2,3,4-TETRAHYDRONAPHTHALEN-1-AMINE HCL | AstaTech | MFCD22056324 | 201.670 | C10H13ClFN | 95.000 | Cl.N[C@H]1CCCc2cc(F)ccc12 | 1g | 290669445
(1S)-6-FLUORO-1,2,3,4-TETRAHYDRONAPHTHALEN-1-AMINE HCL | AstaTech | 1373232-27-9 | MFCD22056324 | 201.670 | C10H13ClFN | 95.000 | Cl.N[C@H]1CCCc2cc(F)ccc12 | 1g | 290669445
eMolecules 1187830-51-8 | 5,6,7,8-Tetrahydro-1,6-naphthyridine hydrochloride | Combi-Blocks | MFCD11846187 | 170.640 | C8H11ClN2 | 95.000 | Cl.C1Cc2ncccc2CN1 | 1g | 342866649
5,6,7,8-Tetrahydro-1,6-naphthyridine hydrochloride | Combi-Blocks | 1187830-51-8 | MFCD11846187 | 170.640 | C8H11ClN2 | 95.000 | Cl.C1Cc2ncccc2CN1 | 1g | 342866649
eMolecules 942487-16-3 | Medchem Express | PF-03814735 | 5mg | 446264335 | HY-14574 | 474.488 | C23H25F3N6O2
Medchem Express | PF-03814735 | 5mg | 446264335 | HY-14574 | 942487-16-3 | 474.488 | C23H25F3N6O2
eMolecules 215453-84-2 | 4-(4-Bromophenoxy)tetrahydro-2H-pyran | Combi-Blocks | MFCD11855868 | 257.127 | C11H13BrO2 | 98.000 | Brc1ccc(OC2CCOCC2)cc1 | 1g | 117530436
4-(4-Bromophenoxy)tetrahydro-2H-pyran | Combi-Blocks | 215453-84-2 | MFCD11855868 | 257.127 | C11H13BrO2 | 98.000 | Brc1ccc(OC2CCOCC2)cc1 | 1g | 117530436
eMolecules 132095-53-5 | 5-BROMO-2-TETRALONE | AstaTech | MFCD04038485 | 225.085 | C10H9BrO | 95.000 | Brc1cccc2CC(=O)CCc12 | 1g | 434268910
5-BROMO-2-TETRALONE | AstaTech | 132095-53-5 | MFCD04038485 | 225.085 | C10H9BrO | 95.000 | Brc1cccc2CC(=O)CCc12 | 1g | 434268910