Boronic acid derivatives
Aobchem 2-Ethoxy-5-fluorophenylboronic acid pinacol ester | 97% | CAS 1628502-61-3 | C14H20BFO3 | 1g
2-Ethoxy-5-fluorophenylboronic acid pinacol ester | 97% | CAS 1628502-61-3 | C14H20BFO3 | 1g
Aobchem 4-Hydroxy-3-nitrophenylboronic acid pinacol ester | ≥97% | CAS 1072945-08-4 | C12H16BNO5 | 1g
4-Hydroxy-3-nitrophenylboronic acid pinacol ester | ≥97% | CAS 1072945-08-4 | C12H16BNO5 | 1g
Aobchem 2-Bromo-5-carboxyphenylboronic acid | ≥97% | CAS 1448312-00-2 | C7H6BBrO4 | 250mg
2-Bromo-5-carboxyphenylboronic acid | ≥97% | CAS 1448312-00-2 | C7H6BBrO4 | 250mg
Aobchem 2-Bromo-5-carboxyphenylboronic acid | ≥97% | CAS 1448312-00-2 | C7H6BBrO4 | 1g
2-Bromo-5-carboxyphenylboronic acid | ≥97% | CAS 1448312-00-2 | C7H6BBrO4 | 1g
Aobchem 2-Methoxy-1-naphthaleneboronic acid pinacol ester | ≥97% | CAS 269410-05-1 | C17H21BO3 | 1g
2-Methoxy-1-naphthaleneboronic acid pinacol ester | ≥97% | CAS 269410-05-1 | C17H21BO3 | 1g
Aobchem 4-Nitrophenylboronic acid pinacol ester | ≥97% | CAS 171364-83-3 | C12H16BNO4 | 25g
4-Nitrophenylboronic acid pinacol ester | ≥97% | CAS 171364-83-3 | C12H16BNO4 | 25g
Aobchem 2-Methoxy-5-nitrophenylboronic acid pinacol ester | ≥97% | CAS 677746-34-8 | C13H18BNO5 | 500mg
2-Methoxy-5-nitrophenylboronic acid pinacol ester | ≥97% | CAS 677746-34-8 | C13H18BNO5 | 500mg
eMolecules 137401-45-7 | Boc-DL-2-COOH-Gly-OEt | Ambeed | MFCD09835539 | 247.247 | C10H17NO6 | 95.000 | CCOC(=O)C(NC(=O)OC(C)(C)C)C(O)=O | 25g | 490530529
Boc-DL-2-COOH-Gly-OEt | Ambeed | 137401-45-7 | MFCD09835539 | 247.247 | C10H17NO6 | 95.000 | CCOC(=O)C(NC(=O)OC(C)(C)C)C(O)=O | 25g | 490530529
eMolecules 850568-02-4 | 2-Aminomethyl-4-fluorophenylboronic acid hydrochloride | Combi-Blocks | MFCD04973742 | 205.420 | C7H10BClFNO2 | 97.000 | Cl.NCc1cc(F)ccc1B(O)O | 1g | 117521804
2-Aminomethyl-4-fluorophenylboronic acid hydrochloride | Combi-Blocks | 850568-02-4 | MFCD04973742 | 205.420 | C7H10BClFNO2 | 97.000 | Cl.NCc1cc(F)ccc1B(O)O | 1g | 117521804
eMolecules 5720-07-0 | 4-Methoxyphenylboronic acid | Ambeed | MFCD00039139 | 151.960 | C7H9BO3 | 98.000 | COc1ccc(cc1)B(O)O | 5g | 525199826
4-Methoxyphenylboronic acid | Ambeed | 5720-07-0 | MFCD00039139 | 151.960 | C7H9BO3 | 98.000 | COc1ccc(cc1)B(O)O | 5g | 525199826
Chemscene ChemScene | 7-Bromonaphthalen-1-ol | 250MG | CS-0030221 | 0.98 | 91270-69-8| MFCD17012439 | 223.069
ChemScene | 7-Bromonaphthalen-1-ol | 250MG | CS-0030221 | 0.98 | 91270-69-8| MFCD17012439 | 223.069
Medchemexpress LLC N-Boc-diethanolamine | 103898-11-9 | 100.0% | 205.25 | C9H19NO4 | 100 G
N-Boc-diethanolamine is a Boc-protected diethanolamine used as a building block and cleavable linker in organic synthesis and bioconjugation applications. It is supplied for research use at high purity and is suitable for use in linker and small-molecule assembly workflows.
- Boc-protected secondary amine suitable for selective deprotection
- Two hydroxyl handles for conjugation or further functionalization
- Appropriate for use as a cleavable ADC/PROTAC linker component
- High purity for research and synthetic applications
- Available in multiple pack sizes, including a 100 G pack
Aobchem 6-(2 2 2-Trifluoroethoxy)-2-pyridinecarboxaldehyde | 95% | CAS 1785612-51-2 | C8H6F3NO2 | 5g
6-(2 2 2-Trifluoroethoxy)-2-pyridinecarboxaldehyde | 95% | CAS 1785612-51-2 | C8H6F3NO2 | 5g
Aobchem 2-Cyano-5-fluorophenylboronic acid | ≥95% | CAS 1375109-01-5 | C7H5BFNO2 | 250mg
2-Cyano-5-fluorophenylboronic acid | ≥95% | CAS 1375109-01-5 | C7H5BFNO2 | 250mg
Medchemexpress LLC N-Boc-diethanolamine | 25g
N-Boc-diethanolamine is an Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs N-Boc-diethanolamine is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]