Boronic acid derivatives
eMolecules 768-35-4 | (3-Fluorophenyl)boronic acid | Ambeed | MFCD00236042 | 139.920 | C6H6BFO2 | 98.000 | OB(O)c1cccc(F)c1 | 25g | 552623003
(3-Fluorophenyl)boronic acid | Ambeed | 768-35-4 | MFCD00236042 | 139.920 | C6H6BFO2 | 98.000 | OB(O)c1cccc(F)c1 | 25g | 552623003
eMolecules 883231-25-2 | (2-((tert-Butoxycarbonyl)amino)pyrimidin-5-yl)boronic acid | Synthonix - Stock | MFCD16251533 | 239.040 | C9H14BN3O4 | 95.000 | CC(C)(C)OC(=O)Nc1ncc(cn1)B(O)O | 1g | 507875991
(2-((tert-Butoxycarbonyl)amino)pyrimidin-5-yl)boronic acid | Synthonix - Stock | 883231-25-2 | MFCD16251533 | 239.040 | C9H14BN3O4 | 95.000 | CC(C)(C)OC(=O)Nc1ncc(cn1)B(O)O | 1g | 507875991
eMolecules 819058-34-9 | (4-AMINO-3-FLUOROPHENYL)BORONIC ACID PINACOL ESTER | AstaTech | MFCD09033884 | 237.080 | C12H17BFNO2 | 95.000 | CC1(C)OB(OC1(C)C)c1ccc(N)c(F)c1 | 1g | 233630497
(4-AMINO-3-FLUOROPHENYL)BORONIC ACID PINACOL ESTER | AstaTech | 819058-34-9 | MFCD09033884 | 237.080 | C12H17BFNO2 | 95.000 | CC1(C)OB(OC1(C)C)c1ccc(N)c(F)c1 | 1g | 233630497
eMolecules 768-35-4 | 3-Fluorophenylboronic acid | AA Blocks LLC | MFCD00236042 | 139.920 | C6H6BFO2 | 0.000 | OB(O)c1cccc(F)c1 | 500g | 846251725
3-Fluorophenylboronic acid | AA Blocks LLC | 768-35-4 | MFCD00236042 | 139.920 | C6H6BFO2 | 0.000 | OB(O)c1cccc(F)c1 | 500g | 846251725
eMolecules 5720-06-9 | 2-Methoxyphenylboronic acid | Medchem Express | MFCD00236047 | 151.960 | C7H9BO3 | 98.000 | COc1ccccc1B(O)O | 10g | 801133404
2-Methoxyphenylboronic acid | Medchem Express | 5720-06-9 | MFCD00236047 | 151.960 | C7H9BO3 | 98.000 | COc1ccccc1B(O)O | 10g | 801133404
eMolecules 5720-06-9 | 2-Methoxyphenylboronic acid | Medchem Express | MFCD00236047 | 151.960 | C7H9BO3 | 98.000 | COc1ccccc1B(O)O | 25g | 801133406
2-Methoxyphenylboronic acid | Medchem Express | 5720-06-9 | MFCD00236047 | 151.960 | C7H9BO3 | 98.000 | COc1ccccc1B(O)O | 25g | 801133406
eMolecules 5720-07-0 | 4-Methoxyphenylboronic acid | Ambeed | MFCD00039139 | 151.960 | C7H9BO3 | 98.000 | COc1ccc(cc1)B(O)O | 5g | 525199826
4-Methoxyphenylboronic acid | Ambeed | 5720-07-0 | MFCD00039139 | 151.960 | C7H9BO3 | 98.000 | COc1ccc(cc1)B(O)O | 5g | 525199826
eMolecules 411235-57-9 | Cyclopropyl boronic acid | Oakwood Chemicals | MFCD04038750 | 85.900 | C3H7BO2 | 95.000 | OB(O)C1CC1 | 100g | 491485052
Cyclopropyl boronic acid | Oakwood Chemicals | 411235-57-9 | MFCD04038750 | 85.900 | C3H7BO2 | 95.000 | OB(O)C1CC1 | 100g | 491485052
Aobchem 2 6-Dichloro-4-fluorophenylboronic acid | ≥97% | CAS 1451392-99-6 | C6H4BCl2FO2 | 1g
2 6-Dichloro-4-fluorophenylboronic acid | ≥97% | CAS 1451392-99-6 | C6H4BCl2FO2 | 1g
Aobchem 2 6-Dimethyl-4-fluorophenylboronic acid pinacol ester | ≥97% | CAS 2121512-41-0 | C14H20BFO2 | 250mg
2 6-Dimethyl-4-fluorophenylboronic acid pinacol ester | ≥97% | CAS 2121512-41-0 | C14H20BFO2 | 250mg
Medchemexpress LLC 2-Nitrophenylboronic acid | 5570-19-4 | 166.93 | 100 G
2-Nitrophenylboronic acid is a chemical compound commonly used as a laboratory chemical and in the manufacture of various substances. It has a molecular formula of C6H6BNO4 and a molecular weight of 166.93.
- High purity: 99.99%
- Appearance: White to light yellow solid
- Suitable for laboratory use
- Stable under recommended storage conditions
- Long shelf life for powder at -20°C (3 years) or 4°C (2 years)
- Storage in solvent for 6 months at -80°C or 1 month at -20°C
Aobchem 3-Fluoro-2-ethoxyphenylboronic acid | ≥97% | CAS 1010097-71-8 | C8H10BFO3 | 1g
3-Fluoro-2-ethoxyphenylboronic acid | ≥97% | CAS 1010097-71-8 | C8H10BFO3 | 1g