Boronic acid derivatives
Aobchem 4-Bromo-2-nitrophenylboronic acid | 97% | CAS 860034-11-3 | C6H5BBrNO4 | 250mg
4-Bromo-2-nitrophenylboronic acid | 97% | CAS 860034-11-3 | C6H5BBrNO4 | 250mg
Aobchem 6-(2 2 2-Trifluoroethoxy)-2-pyridinecarboxaldehyde | 95% | CAS 1785612-51-2 | C8H6F3NO2 | 500mg
6-(2 2 2-Trifluoroethoxy)-2-pyridinecarboxaldehyde | 95% | CAS 1785612-51-2 | C8H6F3NO2 | 500mg
Aobchem 4 5-Dimethyl-3-fluorophenylboronic acid pinacol ester | 97% | C14H20BFO2 | 250mg
4 5-Dimethyl-3-fluorophenylboronic acid pinacol ester | 97% | C14H20BFO2 | 250mg
Aobchem 4-Chloro-3-nitrophenylboronic acid | 97% | CAS 151169-67-4 | C6H5BClNO4 | 500g
4-Chloro-3-nitrophenylboronic acid | 97% | CAS 151169-67-4 | C6H5BClNO4 | 500g
Aobchem 6-(2 2 2-Trifluoroethoxy)-2-pyridinecarbonitrile | ≥97% | CAS 1256786-21-6 | C8H5F3N2O | 250mg
6-(2 2 2-Trifluoroethoxy)-2-pyridinecarbonitrile | ≥97% | CAS 1256786-21-6 | C8H5F3N2O | 250mg
Aobchem 2-Bromo-7-ethoxynaphthalene | 97% | CAS 627527-21-3 | C12H11BrO | 5g
2-Bromo-7-ethoxynaphthalene | 97% | CAS 627527-21-3 | C12H11BrO | 5g
Aobchem 3 6-Dichloro-2-fluorophenylboronic acid pinacol ester | 97% | C12H14BCl2FO2 | 500mg
3 6-Dichloro-2-fluorophenylboronic acid pinacol ester | 97% | C12H14BCl2FO2 | 500mg
Aobchem 3-Bromo-4-carboxyphenylboronic acid | 97% | CAS 3066919-53-4 | C7H6BBrO4 | 5g
3-Bromo-4-carboxyphenylboronic acid | 97% | CAS 3066919-53-4 | C7H6BBrO4 | 5g
eMolecules 5720-07-0 | 4-Methoxyphenylboronic acid | Ambeed | MFCD00039139 | 151.960 | C7H9BO3 | 98.000 | COc1ccc(cc1)B(O)O | 5g | 525199826
4-Methoxyphenylboronic acid | Ambeed | 5720-07-0 | MFCD00039139 | 151.960 | C7H9BO3 | 98.000 | COc1ccc(cc1)B(O)O | 5g | 525199826
eMolecules 72824-04-5 | Allylboronic acid pinacol ester | Ambeed | MFCD00013347 | 168.040 | C9H17BO2 | 97.000 | CC1(C)OB(CC=C)OC1(C)C | 1g | 552538916
Allylboronic acid pinacol ester | Ambeed | 72824-04-5 | MFCD00013347 | 168.040 | C9H17BO2 | 97.000 | CC1(C)OB(CC=C)OC1(C)C | 1g | 552538916
eMolecules 850568-02-4 | 2-Aminomethyl-4-fluorophenylboronic acid hydrochloride | Combi-Blocks | MFCD04973742 | 205.420 | C7H10BClFNO2 | 97.000 | Cl.NCc1cc(F)ccc1B(O)O | 1g | 117521804
2-Aminomethyl-4-fluorophenylboronic acid hydrochloride | Combi-Blocks | 850568-02-4 | MFCD04973742 | 205.420 | C7H10BClFNO2 | 97.000 | Cl.NCc1cc(F)ccc1B(O)O | 1g | 117521804
Aobchem 2-Cyano-5-fluorophenylboronic acid | ≥95% | CAS 1375109-01-5 | C7H5BFNO2 | 250mg
2-Cyano-5-fluorophenylboronic acid | ≥95% | CAS 1375109-01-5 | C7H5BFNO2 | 250mg
Medchemexpress LLC Boronic acid, B-(phenyl-2,3,4,5,6-d5) | 215527-70-1 | MFCD02093711 | 100.0% | 126.96 | C6H2D5BO2 | 100 G
Phenyl-boronic acid-d5 is the deuterium-labeled analogue of phenylboronic acid used as a research reagent and tracer in chemical and biochemical studies. It is provided as a high-purity isotopologue for analytical and synthetic applications, with specified storage conditions to preserve isotopic integrity.
- Deuterium-labeled phenylboronic acid (d5) suitable for tracer and analytical studies.
- High purity by HPLC for reliable analytical results.
- Defined molecular formula and molecular weight for precise characterization.
- Recommended storage under nitrogen at 4°C; in solvent store at -80°C (6 months) or -20°C (1 month).
- Useful as a reagent in synthesis and isotopic labeling experiments.
eMolecules 137401-45-7 | 2-((tert-Butoxycarbonyl)amino)-3-ethoxy-3-oxopropanoic acid | ChemScene | MFCD09835539 | 247.247 | C10H17NO6 | 97.000 | CCOC(=O)C(NC(=O)OC(C)(C)C)C(O)=O | 10g | 572245530
2-((tert-Butoxycarbonyl)amino)-3-ethoxy-3-oxopropanoic acid | ChemScene | 137401-45-7 | MFCD09835539 | 247.247 | C10H17NO6 | 97.000 | CCOC(=O)C(NC(=O)OC(C)(C)C)C(O)=O | 10g | 572245530
Aobchem 3-Ethylphenylboronic acid | ≥95% | CAS 90555-65-0 | C8H11BO2 | 5g
3-Ethylphenylboronic acid | ≥95% | CAS 90555-65-0 | C8H11BO2 | 5g