Benzodioxoles
Accela Chembio Inc 1 | 3-benzodioxole-4-carboxylic Acid | 1g | 5768-39-8 | MFCD01076411 | 97+% | Shelf Life: 1800 Days | Regular
1 | 3-benzodioxole-4-carboxylic Acid | 1g | 5768-39-8 | MFCD01076411 | 97+% | Shelf Life: 1800 Days | Regular
eMolecules 1131594-42-7 | 3-Bromo-4-(piperidin-1-ylmethyl)benzoic acid | MFCD11110908 | 1g
Medchem Express | INT-777 (R-enantiomer) | 2mg | 446266311 | HY-15677A | 1198786-98-9 | MFCD30536210 | 450.660 | C27H46O5
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 5768-39-8 | 1,3-Benzodioxole-4-carboxylic acid | MFCD01076411 | 25g
Combi-Blocks | 1,3-Benzodioxole-4-carboxylic acid | 25g | 350782567 | ST-7533 | 97.000 | 5768-39-8 | MFCD01076411 | 166.132 | C8H6O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Medchemexpress LLC Piperonylic acid | 94-53-1 | 99.9% | 166.13 | 50 G
Piperonylic acid | 94-53-1 | 99.9% | 166.13 | 50 G
![eMolecules 1792-41-2 | AstaTech | 25-DIMETHYL-1H-BENZO[D]IMIDAZOLE | 0.25g | 444386042 | C15122 | 95 | MFCD00125906 | 146.193 | C9H10N2](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502450818.PNG-250.jpg)
eMolecules 1792-41-2 | AstaTech | 25-DIMETHYL-1H-BENZO[D]IMIDAZOLE | 0.25g | 444386042 | C15122 | 95 | MFCD00125906 | 146.193 | C9H10N2
Ambeed | 2-(2-Fluorophenoxy)-4-(1-methyl-1H-pyrazol-5-yl)benzamide | 1mg | 598441890 | A1340414 | 2682114-39-0 | 311.316 | C17H14FN3O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
(NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 1g | 572293904](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000217423.jpg-250.jpg)
eMolecules 1202003-49-3 | (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-6-((tert-butoxycarbonyl)amino)-2-methylhexanoic acid | ChemScene | MFCD17019258 | 482.577 | C27H34N2O6 | 97.000 | CC(C)(C)OC(=O)NCCCC[C@](C)(NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 1g | 572293904
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-6-((tert-butoxycarbonyl)amino)-2-methylhexanoic acid | ChemScene | 1202003-49-3 | MFCD17019258 | 482.577 | C27H34N2O6 | 97.000 | CC(C)(C)OC(=O)NCCCC[C@](C)(NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 1g | 572293904
(C)C)cc1)C(O)=O)C(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 559782989](https://assets.fishersci.com/TFS-Assets/CCG/product-images/default.jpg-250.jpg)
eMolecules 133373-24-7 | (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-3-(4-(tert-butoxy)phenyl)propanoic acid | ChemScene | MFCD02684471 | 473.569 | C29H31NO5 | 97.000 | CN([C@@H](Cc1ccc(OC(C)(C)C)cc1)C(O)=O)C(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 559782989
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-3-(4-(tert-butoxy)phenyl)propanoic acid | ChemScene | 133373-24-7 | MFCD02684471 | 473.569 | C29H31NO5 | 97.000 | CN([C@@H](Cc1ccc(OC(C)(C)C)cc1)C(O)=O)C(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 559782989
OCC1c2ccccc2-c2ccccc12)C(O)=O | 1g | 536810159](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000164570.jpg-250.jpg)
eMolecules 204320-60-5 | (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-methylhexanoic acid | ChemScene | MFCD00270205 | 367.445 | C22H25NO4 | 98.000 | CC(C)CC[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 1g | 536810159
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-methylhexanoic acid | ChemScene | 204320-60-5 | MFCD00270205 | 367.445 | C22H25NO4 | 98.000 | CC(C)CC[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 1g | 536810159
NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 572195551](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000159037.jpg-250.jpg)
eMolecules 1956434-67-5 | (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(oxazol-5-yl)propanoic acid | ChemScene | MFCD28134507 | 378.384 | C21H18N2O5 | 97.000 | OC(=O)[C@H](Cc1cnco1)NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 572195551
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(oxazol-5-yl)propanoic acid | ChemScene | 1956434-67-5 | MFCD28134507 | 378.384 | C21H18N2O5 | 97.000 | OC(=O)[C@H](Cc1cnco1)NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 572195551
OC(C)(C)C)C(O)=O)C(=O)OCC1c2ccccc2-c2ccccc12 | 5g | 837450612](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000159016.jpg-250.jpg)
eMolecules 1793105-27-7 | (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-6-((tert-butoxycarbonyl)amino)hexanoic acid | Combi-Blocks, Inc. | MFCD08702737 | 482.577 | C27H34N2O6 | 97.000 | CN([C@H](CCCCNC(=O)OC(C)(C)C)C(O)=O)C(=O)OCC1c2ccccc2-c2ccccc12 | 5g | 837450612
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-6-((tert-butoxycarbonyl)amino)hexanoic acid | Combi-Blocks, Inc. | 1793105-27-7 | MFCD08702737 | 482.577 | C27H34N2O6 | 97.000 | CN([C@H](CCCCNC(=O)OC(C)(C)C)C(O)=O)C(=O)OCC1c2ccccc2-c2ccccc12 | 5g | 837450612
OCC2c3ccccc3-c3ccccc23)C(O)=O)cc1 | 5g | 851171182](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000162354.jpg-250.jpg)
eMolecules 183070-44-2 | (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-(tert-butoxycarbonyl)phenyl)propanoic acid | Synthonix | MFCD01317016 | 487.552 | C29H29NO6 | 97.000 | CC(C)(C)OC(=O)c1ccc(C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc23)C(O)=O)cc1 | 5g | 851171182
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-(tert-butoxycarbonyl)phenyl)propanoic acid | Synthonix | 183070-44-2 | MFCD01317016 | 487.552 | C29H29NO6 | 97.000 | CC(C)(C)OC(=O)c1ccc(C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc23)C(O)=O)cc1 | 5g | 851171182
cccc12)NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 632283036](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000188207.jpg-250.jpg)
eMolecules 1956434-65-3 | (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(7-fluoro-1H-indol-3-yl)propanoic acid | ChemScene | MFCD26960591 | 444.462 | C26H21FN2O4 | 95.000 | OC(=O)[C@H](Cc1c[nH]c2c(F)cccc12)NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 632283036
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(7-fluoro-1H-indol-3-yl)propanoic acid | ChemScene | 1956434-65-3 | MFCD26960591 | 444.462 | C26H21FN2O4 | 95.000 | OC(=O)[C@H](Cc1c[nH]c2c(F)cccc12)NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 632283036
OCC1c2ccccc2-c2ccccc12)C(O)=O | 1g | 851170978](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000473056.jpg-250.jpg)
eMolecules 204320-60-5 | (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-methylhexanoic acid | Synthonix | MFCD00270205 | 367.445 | C22H25NO4 | 98.000 | CC(C)CC[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 1g | 851170978
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-methylhexanoic acid | Synthonix | 204320-60-5 | MFCD00270205 | 367.445 | C22H25NO4 | 98.000 | CC(C)CC[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 1g | 851170978
OCC1c2ccccc2-c2ccccc12)C(O)=O | 5g | 851170979](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000473057.jpg-250.jpg)
eMolecules 204320-60-5 | (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-methylhexanoic acid | Synthonix | MFCD00270205 | 367.445 | C22H25NO4 | 98.000 | CC(C)CC[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 5g | 851170979
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-methylhexanoic acid | Synthonix | 204320-60-5 | MFCD00270205 | 367.445 | C22H25NO4 | 98.000 | CC(C)CC[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 5g | 851170979
OCC2c3ccccc3-c3ccccc23)C(O)=O)cc1 | 1g | 553201433](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000471498.jpg-250.jpg)
eMolecules 204384-69-0 | (S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-4-(4-(tert-butoxy)phenyl)butanoic acid | Advanced ChemBlocks | MFCD01321420 | 473.569 | C29H31NO5 | 97.000 | CC(C)(C)Oc1ccc(CC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc23)C(O)=O)cc1 | 1g | 553201433
(S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-4-(4-(tert-butoxy)phenyl)butanoic acid | Advanced ChemBlocks | 204384-69-0 | MFCD01321420 | 473.569 | C29H31NO5 | 97.000 | CC(C)(C)Oc1ccc(CC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc23)C(O)=O)cc1 | 1g | 553201433