Benzodioxoles
Aobchem 2-Ethoxypyridine-4-carboxaldehyde | ≥97% | CAS 1211587-25-5 | C8H9NO2 | 500mg
2-Ethoxypyridine-4-carboxaldehyde | ≥97% | CAS 1211587-25-5 | C8H9NO2 | 500mg
Aobchem (6-Chloro-2H-1 3-benzodioxol-5-yl)boronic acid | ≥95% | CAS 2377608-88-1 | C7H6BClO4 | 250mg
(6-Chloro-2H-1 3-benzodioxol-5-yl)boronic acid | ≥95% | CAS 2377608-88-1 | C7H6BClO4 | 250mg
Aobchem Methyl 4-methyl-3-(1-oxopropyl)benzoate | ≥95% | CAS 1799749-63-5 | C12H14O3 | 250mg
Methyl 4-methyl-3-(1-oxopropyl)benzoate | ≥95% | CAS 1799749-63-5 | C12H14O3 | 250mg
Aobchem 5-(2 2-Dimethyl-1-oxopropyl)-2-thiophenecarbonitrile | 95% | CAS 111504-81-5 | C10H11NOS | 1g
5-(2 2-Dimethyl-1-oxopropyl)-2-thiophenecarbonitrile | 95% | CAS 111504-81-5 | C10H11NOS | 1g
Aobchem 1-(4-Methoxy-1 3-benzodioxol-5-yl)-1-propanone | 95% | CAS 340016-41-3 | C11H12O4 | 1g
1-(4-Methoxy-1 3-benzodioxol-5-yl)-1-propanone | 95% | CAS 340016-41-3 | C11H12O4 | 1g
Aobchem 2-Ethoxypyridine-4-carboxaldehyde | ≥97% | CAS 1211587-25-5 | C8H9NO2 | 250mg
2-Ethoxypyridine-4-carboxaldehyde | ≥97% | CAS 1211587-25-5 | C8H9NO2 | 250mg
Aobchem 4-((4-Isobutylphenyl)sulfonyl)thiomorpholine | 95% | C14H21NO2S2 | 5g
4-((4-Isobutylphenyl)sulfonyl)thiomorpholine | 95% | C14H21NO2S2 | 5g
Aobchem 1-(6-Bromo-1 3-benzodioxol-5-yl)ethanone | 95% | CAS 71095-26-6 | C9H7BrO3 | 5g
1-(6-Bromo-1 3-benzodioxol-5-yl)ethanone | 95% | CAS 71095-26-6 | C9H7BrO3 | 5g
Aobchem 1-(6-Bromo-1 3-benzodioxol-5-yl)ethanone | 95% | CAS 71095-26-6 | C9H7BrO3 | 250mg
1-(6-Bromo-1 3-benzodioxol-5-yl)ethanone | 95% | CAS 71095-26-6 | C9H7BrO3 | 250mg
Aobchem 4-((4-Isobutylphenyl)sulfonyl)thiomorpholine | 95% | C14H21NO2S2 | 1g
4-((4-Isobutylphenyl)sulfonyl)thiomorpholine | 95% | C14H21NO2S2 | 1g
Aobchem (4-Methoxy-1 3-benzodioxol-5-yl)phenylmethanone | ≥95% | CAS 872881-74-8 | C15H12O4 | 250mg
(4-Methoxy-1 3-benzodioxol-5-yl)phenylmethanone | ≥95% | CAS 872881-74-8 | C15H12O4 | 250mg
Aobchem 6-Trimethyl-1 3-benzodioxole-5-methanol | 95% | CAS 1780228-23-0 | C11H14O3 | 500mg
6-Trimethyl-1 3-benzodioxole-5-methanol | 95% | CAS 1780228-23-0 | C11H14O3 | 500mg
Apexbio Technology LLC PIPERONYLIC-ACID-500MG
Piperonylic acid (CAS No 94-53-1) is a compound frequently used in biomedical research particularly in the study of enzyme inhibition and metabolic pathways Originating from the oxidation of piperonal it acts as an inhibitor of cytochrome P450 enzymes which play a crucial role in drug metabolism and detoxification processes Its in vitro activity is commonly observed in the nanomolar to low micromolar range demonstrating high potency Piperonylic acid is utilized in cellular models to evaluate metabolic interactions and investigate enzyme-mediated drug interactions Additionally it is employed in animal studies to assess its potential therapeutic effects and toxicological profiles In drug screening it serves as a tool to slow down or alter specific pathways providing insight into drug efficacy and safety profiles Experimental concentrations typically depend on the specific research design allowing flexibility in various investigative protocols
eMolecules 460751-66-0 | (S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-(5-bromo-1H-indol-3-yl)propanoic acid | ChemScene | MFCD28166519 | 505.368 | C26H21BrN2O4 | 98.000 | OC(=O)[C@H](Cc1c[nH]c2ccc(Br)cc12)NC(=O)OCC1c2ccccc2-c2ccccc12 | 5g | 714306586
(S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-(5-bromo-1H-indol-3-yl)propanoic acid | ChemScene | 460751-66-0 | MFCD28166519 | 505.368 | C26H21BrN2O4 | 98.000 | OC(=O)[C@H](Cc1c[nH]c2ccc(Br)cc12)NC(=O)OCC1c2ccccc2-c2ccccc12 | 5g | 714306586