Benzodioxoles
![eMolecules 150613-50-6 | Ambeed | 2-(Chloromethyl)-1H-benzo[d]imidazole-6-carbonitrile | 1g | 570574691 | A217643 | MFCD08234907 | 191.62 | C9H6ClN3](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502452239.PNG-250.jpg)
eMolecules 150613-50-6 | Ambeed | 2-(Chloromethyl)-1H-benzo[d]imidazole-6-carbonitrile | 1g | 570574691 | A217643 | MFCD08234907 | 191.62 | C9H6ClN3
Medchem Express | ERK1|2 inhibitor 1 | 5mg | 532149038 | HY-112287 | 2095719-90-5 | 550.060 | C29H32ClN5O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Medchemexpress LLC 10,11-(METHYLENEDIOXY)-20(S)-C
10,11-(Methylenedioxy)-20(S)-camptothecin | Purity: 97.07% | Mol Wt: 392.36 | 135415-73-5 | 100mg
NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 528984621](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000188514.jpg-250.jpg)
eMolecules 1097192-04-5 | (S)-2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-5-AZIDOPENTANOIC ACID | AstaTech | MFCD11052921 | 380.404 | C20H20N4O4 | 95.000 | OC(=O)[C@H](CCCN=[N+]=[N-])NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 528984621
(S)-2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-5-AZIDOPENTANOIC ACID | AstaTech | 1097192-04-5 | MFCD11052921 | 380.404 | C20H20N4O4 | 95.000 | OC(=O)[C@H](CCCN=[N+]=[N-])NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 528984621
Medchemexpress LLC 3,4-Methylenedioxy PV9 hydrochloride | 24646-40-0 | 99.9% | 353.88 g·mol⁻¹ | C19H28ClNO3 | 5 MG
3,4-Methylenedioxy PV9 hydrochloride is a hydrochloride salt of a PV9 derivative provided as a solid research reagent for in vitro studies and reference standard applications. It is characterized by a defined molecular formula and molecular weight, and is supplied with manufacturer guidance for storage and handling.
- CAS number 24646-40-0.
- Molecular weight 353.88 g·mol⁻¹.
- Chemical formula C19H28ClNO3.
- Form crystalline solid, hydrochloride salt.
- Packaged quantity 5 MG.
- Purity 99.9% (HPLC).
- Storage sealed, away from moisture; in solvent: -80 °C up to 6 months, -20 °C up to 1 month.
eMolecules 58255-18-8 | ChemScene | N-Methyl-1-(thiophen-2-yl)methanamine | 5g | 536860432 | CS-W018825 | MFCD04625435 | 127.21 | C6H9NS
ChemScene | N-Methyl-1-(thiophen-2-yl)methanamine | 5g | 536860432 | CS-W018825 | 58255-18-8 | MFCD04625435 | 127.210 | C6H9NS
Medchemexpress LLC 10,11-(METHYLENEDIOXY)-20 25MG
10,11-(Methylenedioxy)-20(S)-camptothecin | Purity: 97.07% | Mol Wt: 392.36 | 135415-73-5 | 25mg
eMolecules 1065267-14-2 | (3,5-Difluoropyridin-2-yl)methanol | Ambeed | MFCD11520700 | 145.109 | C6H5F2NO | 98.000 | OCc1ncc(F)cc1F | 5g | 572963174
(3,5-Difluoropyridin-2-yl)methanol | Ambeed | 1065267-14-2 | MFCD11520700 | 145.109 | C6H5F2NO | 98.000 | OCc1ncc(F)cc1F | 5g | 572963174
Cambridge Isotope Laboratories N-(3-Amino-3-oxopropyl)-val-FTH (unlabeled) 100 ug/mL in acetonitrile H2O (1 1) 1 2 mL
N-(3-Amino-3-oxopropyl)-val-FTH (unlabeled) 100 ug/mL in acetonitrile H2O (1 1) 1 2 mL
eMolecules 5538-95-4 | N1-Dodecylpropane-1,3-diamine | Combi-Blocks | MFCD00014828 | 242.451 | C15H34N2 | 98.000 | CCCCCCCCCCCCNCCCN | 1g | 517065568
N1-Dodecylpropane-1,3-diamine | Combi-Blocks | 5538-95-4 | MFCD00014828 | 242.451 | C15H34N2 | 98.000 | CCCCCCCCCCCCNCCCN | 1g | 517065568
eMolecules 159751-46-9 | (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-7-(tert-butoxy)-7-oxoheptanoic acid | ChemScene | MFCD08166552 | 453.535 | C26H31NO6 | 96.000 | CC(C)(C)OC(=O)CCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 5g | 801487523
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-7-(tert-butoxy)-7-oxoheptanoic acid | ChemScene | 159751-46-9 | MFCD08166552 | 453.535 | C26H31NO6 | 96.000 | CC(C)(C)OC(=O)CCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 5g | 801487523
![eMolecules 64943-90-4 | 5,6-Methylenedioxy-2-phenylindole | Combi-Blocks | MFCD00798602 | 237.258 | C15H11NO2 | 97.000 | C1Oc2cc3cc([nH]c3cc2O1)-c1ccccc1 | 1g | 517034394](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502185639.JPG-250.jpg)
eMolecules 64943-90-4 | 5,6-Methylenedioxy-2-phenylindole | Combi-Blocks | MFCD00798602 | 237.258 | C15H11NO2 | 97.000 | C1Oc2cc3cc([nH]c3cc2O1)-c1ccccc1 | 1g | 517034394
5,6-Methylenedioxy-2-phenylindole | Combi-Blocks | 64943-90-4 | MFCD00798602 | 237.258 | C15H11NO2 | 97.000 | C1Oc2cc3cc([nH]c3cc2O1)-c1ccccc1 | 1g | 517034394
NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 572190231](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000482318.jpg-250.jpg)
eMolecules 1251904-51-4 | (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)oct-7-enoic acid | ChemScene | MFCD03094929 | 379.456 | C23H25NO4 | 98.000 | OC(=O)[C@H](CCCCC=C)NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 572190231
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)oct-7-enoic acid | ChemScene | 1251904-51-4 | MFCD03094929 | 379.456 | C23H25NO4 | 98.000 | OC(=O)[C@H](CCCCC=C)NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 572190231
eMolecules 1210834-55-1 | ChemScene | (R)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-3-cyclohexylpropanoic acid | 100mg | 746309906 | CS-0454278 | MFCD00156556 | 407.51 | C25H29NO4
ChemScene | 3-Nitro-4-chloropyridine | 100g | 582639407 | CS-W009015 | 13091-23-1 | MFCD02683025 | 158.540 | C5H3ClN2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 20487-40-5 | tert-butyl propanoate | Pharmablock | MFCD00009304 | 130.187 | C7H14O2 | 97.000 | CCC(=O)OC(C)(C)C | 500mg | 728133381
tert-butyl propanoate | Pharmablock | 20487-40-5 | MFCD00009304 | 130.187 | C7H14O2 | 97.000 | CCC(=O)OC(C)(C)C | 500mg | 728133381
eMolecules 56643-83-5 | Ambeed | 14-Bis((1H-imidazol-1-yl)methyl)benzene | 1g | 521475065 | A638374 | MFCD06598031 | 238.294 | C14H14N4
Ambeed | 14-Bis((1H-imidazol-1-yl)methyl)benzene | 1g | 521475065 | A638374 | 56643-83-5 | MFCD06598031 | 238.294 | C14H14N4