Benzodioxoles
![eMolecules 100615-14-3 | 1-Cyclohexyl-3H-1,3-benzodiazol-2-one | Combi-Blocks | MFCD02271220 | 216.284 | C13H16N2O | 98.000 | O=c1[nH]c2ccccc2n1C1CCCCC1 | 1g | 205384013](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502187217.JPG-250.jpg)
eMolecules 100615-14-3 | 1-Cyclohexyl-3H-1,3-benzodiazol-2-one | Combi-Blocks | MFCD02271220 | 216.284 | C13H16N2O | 98.000 | O=c1[nH]c2ccccc2n1C1CCCCC1 | 1g | 205384013
1-Cyclohexyl-3H-1,3-benzodiazol-2-one | Combi-Blocks | 100615-14-3 | MFCD02271220 | 216.284 | C13H16N2O | 98.000 | O=c1[nH]c2ccccc2n1C1CCCCC1 | 1g | 205384013
Aobchem 1-(3-Isobutylphenyl)cyclobutanol | 95% | CAS 1600474-73-4 | C14H20O | 1g
1-(3-Isobutylphenyl)cyclobutanol | 95% | CAS 1600474-73-4 | C14H20O | 1g
eMolecules 5538-95-4 | N1-Dodecylpropane-1,3-diamine | Combi-Blocks | MFCD00014828 | 242.451 | C15H34N2 | 98.000 | CCCCCCCCCCCCNCCCN | 5g | 517065569
N1-Dodecylpropane-1,3-diamine | Combi-Blocks | 5538-95-4 | MFCD00014828 | 242.451 | C15H34N2 | 98.000 | CCCCCCCCCCCCNCCCN | 5g | 517065569
Apexbio Technology LLC BENZYLIDENEACETONE-1G
Benzylideneacetone (CAS No 122-57-6) is a compound with significant applications in biomedical research particularly in the study of anti-cancer and anti-inflammatory properties Originating from organic synthesis its mechanism of action often involves the inhibition of NF-kB and other signaling pathways targeting cellular processes like apoptosis and proliferation It exhibits in vitro activity typically within the nanomolar to low micromolar range demonstrating potency in various assays Applications include use in cell models such as human carcinoma cell lines and animal studies to explore therapeutic potentials It is also utilized in drug screening processes for its ability to modulate key biological pathways Experimental concentrations typically depend on the specific research design This compound s versatility makes it a valuable tool in the exploration of novel therapeutic strategies and the understanding of complex biochemical mechanisms
Apexbio Technology LLC PIPERONYLIC-ACID-500MG
Piperonylic acid (CAS No 94-53-1) is a compound frequently used in biomedical research particularly in the study of enzyme inhibition and metabolic pathways Originating from the oxidation of piperonal it acts as an inhibitor of cytochrome P450 enzymes which play a crucial role in drug metabolism and detoxification processes Its in vitro activity is commonly observed in the nanomolar to low micromolar range demonstrating high potency Piperonylic acid is utilized in cellular models to evaluate metabolic interactions and investigate enzyme-mediated drug interactions Additionally it is employed in animal studies to assess its potential therapeutic effects and toxicological profiles In drug screening it serves as a tool to slow down or alter specific pathways providing insight into drug efficacy and safety profiles Experimental concentrations typically depend on the specific research design allowing flexibility in various investigative protocols
Aobchem 4-(3-Isobutylphenyl)tetrahydro-2H-pyran-4-ol | 95% | CAS 1771051-50-3 | C15H22O2 | 250mg
4-(3-Isobutylphenyl)tetrahydro-2H-pyran-4-ol | 95% | CAS 1771051-50-3 | C15H22O2 | 250mg
Aobchem 2-Fluoro-4-(1-oxopropyl)benzonitrile | 95% | CAS 1260650-18-7 | C10H8FNO | 250mg
2-Fluoro-4-(1-oxopropyl)benzonitrile | 95% | CAS 1260650-18-7 | C10H8FNO | 250mg
Aobchem 2-Fluoro-4-(1-oxopropyl)benzonitrile | 95% | CAS 1260650-18-7 | C10H8FNO | 500mg
2-Fluoro-4-(1-oxopropyl)benzonitrile | 95% | CAS 1260650-18-7 | C10H8FNO | 500mg
Aobchem 2-Fluoro-1-(4-isobutylphenyl)ethanone | 95% | CAS 2295152-17-7 | C12H15FO | 500mg
2-Fluoro-1-(4-isobutylphenyl)ethanone | 95% | CAS 2295152-17-7 | C12H15FO | 500mg
Aobchem 1-(1 3-Benzodioxol-5-yl)-2-chloroethanone | 95% | CAS 83070-15-9 | C9H7ClO3 | 250mg
1-(1 3-Benzodioxol-5-yl)-2-chloroethanone | 95% | CAS 83070-15-9 | C9H7ClO3 | 250mg
Aobchem 3-Methyl-5-(1-oxopropyl)benzonitrile | 95% | CAS 1240305-80-9 | C11H11NO | 1g
3-Methyl-5-(1-oxopropyl)benzonitrile | 95% | CAS 1240305-80-9 | C11H11NO | 1g
Aobchem 1-(1 3-Benzodioxol-5-yl)-2-chloroethanone | 95% | CAS 83070-15-9 | C9H7ClO3 | 1g
1-(1 3-Benzodioxol-5-yl)-2-chloroethanone | 95% | CAS 83070-15-9 | C9H7ClO3 | 1g