Dihydrofurans
Sigma Aldrich Fine Chemicals Biosciences Aflatoxin B1 from Aspergillus flavus from Aspergillus flavus | 1162-65-8 | MFCD00869647 | 50MG
Aflatoxin B1 from Aspergillus flavus from Aspergillus flavus | Purity: >=98.0% (HPLC) | Mol Wt: 312.27 | 1162-65-8 | MFCD00869647 | 50MG
Sigma Aldrich Fine Chemicals Biosciences Aflatoxin B1 from Aspergillus Flavus | 1162-65-8 | MFCD00869647 | 5mg
Aflatoxin B1 from Aspergillus Flavus | Purity: 98% | Mol Wt: 312.27 | 1162-65-8 | MFCD00869647 | 5mg
Medchemexpress LLC Dihydrofuran-3(2H)-one | 22929-52-8 | 99.99% | 86.09 | 10 G
Dihydrofuran-3(2H)-one (3-Oxotetrahydrofuran) is a cyclic ketone primarily used as a building block for the synthesis of biologically active compounds. It is also utilized in the synthesis of cyclic ketone inhibitors that inhibit the serine protease plasmin.
- Cyclic ketone structure
- Building block for biologically active compounds
- Inhibits serine protease plasmin
- For research use only
eMolecules 108-30-5 | Succinic anhydride | Ambeed | MFCD00005525 | 100.073 | C4H4O3 | 97.000 | O=C1CCC(=O)O1 | 25g | 587278512
Succinic anhydride | Ambeed | 108-30-5 | MFCD00005525 | 100.073 | C4H4O3 | 97.000 | O=C1CCC(=O)O1 | 25g | 587278512
Medchemexpress LLC Dihydrofuran-3(2H)-one (3-Oxotetrahydrofuran) | 22929-52-8 | 99.99% | 86.09 | 100 G
Dihydrofuran-3(2H)-one (3-Oxotetrahydrofuran) is a cyclic ketone that can be used to synthesize cyclic ketone inhibitors that inhibit the serine protease plasmin. It is also a building block for the synthesis of biologically active compounds.
- Used to synthesize cyclic ketone inhibitors
- Inhibits the serine protease plasmin
- Building block for biologically active compounds
- For research use only
eMolecules 212127-80-5 | 2,5-Dihydrofuran-3-boronic acid pinacol ester | Combi-Blocks | MFCD16996209 | 196.050 | C10H17BO3 | 98.000 | CC1(C)OB(OC1(C)C)C1=CCOC1 | 5g | 374521069
2,5-Dihydrofuran-3-boronic acid pinacol ester | Combi-Blocks | 212127-80-5 | MFCD16996209 | 196.050 | C10H17BO3 | 98.000 | CC1(C)OB(OC1(C)C)C1=CCOC1 | 5g | 374521069
Sigma Aldrich Fine Chemicals Biosciences Aflatoxin B1 from Aspergillus flavus from Aspergillus flavus | 1162-65-8 | MFCD00869647 | 1MG
Aflatoxin B1 from Aspergillus flavus from Aspergillus flavus | Purity: >=98.0% (HPLC) | Mol Wt: 312.27 | 1162-65-8 | MFCD00869647 | 1MG
Chemscene ChemScene | 2-(2,5-Dihydrofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | 250MG | CS-0052307 | 0.97 | 212127-80-5| MFCD16996209 | 196.05
ChemScene | 2-(2,5-Dihydrofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | 250MG | CS-0052307 | 0.97 | 212127-80-5| MFCD16996209 | 196.05
American Radiolabeled Chemicals Inc ALFATOXIN B1 1ME
Aflatoxin B1 1mg as solid, M.W. 312.3, Solvent: Solid, CAS# 1162-65-8
Medchemexpress LLC Dihydrofuran-3(2H)-one | 22929-52-8 | 99.99% | 86.09 | 500 G
Dihydrofuran-3(2H)-one (3-Oxotetrahydrofuran) is a cyclic ketone that can be used to synthesize cyclic ketone inhibitors that inhibit the serine protease plasmin. It serves as a building block for the synthesis of biologically active compounds and is intended for research use only.
- Cyclic ketone structure.
- Can be used to synthesize cyclic ketone inhibitors.
- Inhibits serine protease plasmin.
- Building block for synthesizing biologically active compounds.
- Suitable for research use.