Pyrans
Aobchem Phenyl(tetrahydro-2H-pyran-4-yl)methanone | ≥95% | CAS 639468-72-7 | C12H14O2 | 500mg
Phenyl(tetrahydro-2H-pyran-4-yl)methanone | ≥95% | CAS 639468-72-7 | C12H14O2 | 500mg
Aobchem 4-Ethyltetrahydro-2H-pyran-4-carbonitrile | ≥95% | CAS 1498218-44-2 | C8H13NO | 250mg
4-Ethyltetrahydro-2H-pyran-4-carbonitrile | ≥95% | CAS 1498218-44-2 | C8H13NO | 250mg
Aobchem 4-(P-tolyl)tetrahydro-2H-pyran-4-ol | ≥95% | CAS 853886-97-2 | C12H16O2 | 250mg
4-(P-tolyl)tetrahydro-2H-pyran-4-ol | ≥95% | CAS 853886-97-2 | C12H16O2 | 250mg
eMolecules 287944-16-5 | 3,6-Dihydro-2H-pyran-4-boronic acid pinacol ester | Combi-Blocks | MFCD11052631 | 210.080 | C11H19BO3 | 95.000 | CC1(C)OB(OC1(C)C)C1=CCOCC1 | 1g | 117545680
3,6-Dihydro-2H-pyran-4-boronic acid pinacol ester | Combi-Blocks | 287944-16-5 | MFCD11052631 | 210.080 | C11H19BO3 | 95.000 | CC1(C)OB(OC1(C)C)C1=CCOCC1 | 1g | 117545680
Medchemexpress LLC Pinoresinol 4-O-β-D-glucopyranoside | 69251-96-3 | 5 MG
Pinoresinol 4-O-β-D-glucopyranoside | 69251-96-3 | 5 MG
Aobchem 4-(Tetrahydro-2H-pyran-4-yl)benzaldehyde | ≥95% | CAS 1276024-97-5 | C12H14O2 | 1g
4-(Tetrahydro-2H-pyran-4-yl)benzaldehyde | ≥95% | CAS 1276024-97-5 | C12H14O2 | 1g
Medchemexpress LLC Tetrahydro-2h-pyran-4-ol-d5 | 1219795-46-6 | 107.16 | 10 MG
Tetrahydro-2H-pyran-4-ol-d5 is a deuterium labeled compound intended for research use only. It serves as a tracer and an internal standard for quantitative analysis using techniques such as NMR, GC-MS, or LC-MS.
- Can be used as a tracer
- Functions as an internal standard for quantitative analysis
- Suitable for NMR, GC-MS, or LC-MS applications
- Deuterium labeling can influence pharmacokinetic and metabolic profiles of drugs