Pyrans
Aobchem 2-Carboxy-5-chlorophenylboronic acid | ≥97% | CAS 874290-67-2 | C7H6BClO4 | 5g
2-Carboxy-5-chlorophenylboronic acid | ≥97% | CAS 874290-67-2 | C7H6BClO4 | 5g
Aobchem 7-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole | ≥95% | CAS 1158680-89-7 | C12H13BrN2O | 5g
7-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole | ≥95% | CAS 1158680-89-7 | C12H13BrN2O | 5g
Aobchem 5-Carboxy-4-chloro-2-fluorophenylboronic acid | ≥97% | CAS 325786-23-0 | C7H5BClFO4 | 1g
5-Carboxy-4-chloro-2-fluorophenylboronic acid | ≥97% | CAS 325786-23-0 | C7H5BClFO4 | 1g
Aobchem 3-Carboxy-5-methoxyphenylboronic acid | ≥97% | CAS 1050424-08-2 | C8H9BO5 | 500mg
3-Carboxy-5-methoxyphenylboronic acid | ≥97% | CAS 1050424-08-2 | C8H9BO5 | 500mg
Aobchem 3-Carboxy-2-fluorophenylboronic acid pinacol ester | ≥95% | CAS 1373168-89-8 | C13H16BFO4 | 250mg
3-Carboxy-2-fluorophenylboronic acid pinacol ester | ≥95% | CAS 1373168-89-8 | C13H16BFO4 | 250mg
Aobchem 2-Isopropoxypyridine-3-carboxylic acid | ≥97% | CAS 1016690-39-3 | C9H11NO3 | 500mg
2-Isopropoxypyridine-3-carboxylic acid | ≥97% | CAS 1016690-39-3 | C9H11NO3 | 500mg
Aobchem 4-Bromo-3 6-dihydro-2H-pyran | ≥97% | CAS 24265-23-4 | C5H7BrO | 5g
4-Bromo-3 6-dihydro-2H-pyran | ≥97% | CAS 24265-23-4 | C5H7BrO | 5g
Aobchem 5-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole | ≥95% | CAS 478828-53-4 | C12H13BrN2O | 1g
5-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole | ≥95% | CAS 478828-53-4 | C12H13BrN2O | 1g
eMolecules 1131912-76-9 | Tetrahydropyran-4-boronic acid, pinacol ester | Combi-Blocks | MFCD11506065 | 212.100 | C11H21BO3 | 97.000 | CC1(C)OB(OC1(C)C)C1CCOCC1 | 25g | 290688582
Tetrahydropyran-4-boronic acid, pinacol ester | Combi-Blocks | 1131912-76-9 | MFCD11506065 | 212.100 | C11H21BO3 | 97.000 | CC1(C)OB(OC1(C)C)C1CCOCC1 | 25g | 290688582
Medchemexpress LLC 2-(Tetrahydropyran-4-yl)glycine | 53284-84-7 | 97.0% | 159.19 | 5 G
2-(Tetrahydropyran-4-yl)glycine is a Glycine derivative. Amino acids and amino acid derivatives are commercially used as ergogenic supplements. They are known to influence the secretion of anabolic hormones, supply fuel during exercise, improve mental performance during stress-related tasks, and prevent exercise-induced muscle damage, thus recognized as beneficial ergogenic dietary substances.
- Appearance: Solid, white to off-white
- Shipping at room temperature in continental US; may vary elsewhere
- Storage for powder at -20°C for 3 years, 4°C for 2 years
- Storage in solvent at -80°C for 6 months, -20°C for 1 month
eMolecules 212127-81-6 | 2-(5,6-Dihydro-2H-pyran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | Combi-Blocks, Inc. | MFCD22189459 | 210.080 | C11H19BO3 | 96.000 | CC1(C)OB(OC1(C)C)C1=CCCOC1 | 10g | 586073194
2-(5,6-Dihydro-2H-pyran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | Combi-Blocks, Inc. | 212127-81-6 | MFCD22189459 | 210.080 | C11H19BO3 | 96.000 | CC1(C)OB(OC1(C)C)C1=CCCOC1 | 10g | 586073194
eMolecules 25637-16-5 | 4-Bromotetrahydro-2H-pyran | Apollo Scientific US - Building Blocks | MFCD07371501 | 165.030 | C5H9BrO | 97.000 | BrC1CCOCC1 | 5g | 485181052
4-Bromotetrahydro-2H-pyran | Apollo Scientific US - Building Blocks | 25637-16-5 | MFCD07371501 | 165.030 | C5H9BrO | 97.000 | BrC1CCOCC1 | 5g | 485181052
eMolecules 25637-18-7 | 4-Iodotetrahydro-2H-pyran | Ambeed | MFCD06797467 | 212.030 | C5H9IO | 95.000 | IC1CCOCC1 | 1g | 525068853
4-Iodotetrahydro-2H-pyran | Ambeed | 25637-18-7 | MFCD06797467 | 212.030 | C5H9IO | 95.000 | IC1CCOCC1 | 1g | 525068853
Medchemexpress LLC Tetrahydro-4H-pyran-4-one | 29943-42-8 | MFCD00006581 | 100.0% | C5H8O2 | 500 G
Tetrahydro-4H-pyran-4-one is a biochemical reagent suitable for life science-related research as a biological material or organic compound.
- Used in the preparation of 4-methoxytetrahydropyran-4-yl protecting group.
- Employed in the synthesis of symmetric tetra-substituted methanes.
- Functions as a protecting agent for alcohols, particularly in nucleotide synthesis.
- Utilized in a study focusing on the enantioselective alpha-aminoxylation of ketones.
- Undergoes condensation reactions for the preparation of dipeptides and spiroimidazolones.
- Employed in Wittig reactions for the synthesis of penicillins and in a ring of vitamin D3.