Pyrazines
eMolecules 632-46-2 | 2,6-Dimethylbenzoic acid | Ambeed | MFCD00002483 | 150.177 | C9H10O2 | 98.000 | Cc1cccc(C)c1C(O)=O | 10g | 552591791
2,6-Dimethylbenzoic acid | Ambeed | 632-46-2 | MFCD00002483 | 150.177 | C9H10O2 | 98.000 | Cc1cccc(C)c1C(O)=O | 10g | 552591791
eMolecules 20651-71-2 | 4-Butylbenzoic acid | Ambeed | MFCD00002571 | 178.231 | C11H14O2 | 98.000 | CCCCc1ccc(cc1)C(O)=O | 5g | 552667452
4-Butylbenzoic acid | Ambeed | 20651-71-2 | MFCD00002571 | 178.231 | C11H14O2 | 98.000 | CCCCc1ccc(cc1)C(O)=O | 5g | 552667452
eMolecules 28562-68-7 | 3-Methyloxetane-3-carboxylic acid | ChemScene | MFCD09842435 | 116.116 | C5H8O3 | 98.000 | CC1(COC1)C(O)=O | 10g | 572235209
3-Methyloxetane-3-carboxylic acid | ChemScene | 28562-68-7 | MFCD09842435 | 116.116 | C5H8O3 | 98.000 | CC1(COC1)C(O)=O | 10g | 572235209
Apexbio Technology LLC 2'-O-Methyl-GTP 50ul (100 mM)
2 -O-Methyl-GTP is a chemically modified nucleotide analog in which a methyl group is introduced at the 2 -hydroxyl position of guanosine triphosphate (GTP) Due to this structural modification it competes directly with standard GTP molecules during RNA polymerization and acts as a chain terminator thereby inhibiting the process of RNA synthesis Researchers utilize 2 -O-Methyl-GTP predominantly in studies investigating RNA polymerase enzymatic fidelity transcription regulation and RNA-mediated mechanisms It serves as a molecular tool in experimental setups aiming to elucidate RNA synthesis pathways probe enzyme active site specificity or suppress targeted RNA transcription reactions in vitro
eMolecules 24484-98-8 | 2,3-Diamino-4-chloropyridine | Combi-Blocks | MFCD13181777 | 143.570 | C5H6ClN3 | 96.000 | Nc1nccc(Cl)c1N | 25g | 335344743
2,3-Diamino-4-chloropyridine | Combi-Blocks | 24484-98-8 | MFCD13181777 | 143.570 | C5H6ClN3 | 96.000 | Nc1nccc(Cl)c1N | 25g | 335344743
eMolecules Ambeed 2-Bromo-5-methoxypyrazine 250mg 525165130 A271798 0 000 143250-10-6 MFCD08235189 189 012 C5H5BrN2O
Ambeed 2-Bromo-5-methoxypyrazine 250mg 525165130 A271798 0 000 143250-10-6 MFCD08235189 189 012 C5H5BrN2O
![eMolecules 6270-63-9 | 2-Hydroxypyrazine | AA Blocks LLC | MFCD11877813 | 96.089 | C4H4N2O | 0.000 | O=c1cncc[nH]1 | 5g | 436001818](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000163920.jpg-250.jpg)
eMolecules 6270-63-9 | 2-Hydroxypyrazine | AA Blocks LLC | MFCD11877813 | 96.089 | C4H4N2O | 0.000 | O=c1cncc[nH]1 | 5g | 436001818
2-Hydroxypyrazine | AA Blocks LLC | 6270-63-9 | MFCD11877813 | 96.089 | C4H4N2O | 0.000 | O=c1cncc[nH]1 | 5g | 436001818
eMolecules 1261725-56-7 | 3-(4-Bromo-2-chlorophenyl)propanoic acid | Ambeed | MFCD18390614 | 263.520 | C9H8BrClO2 | 97.000 | OC(=O)CCc1ccc(Br)cc1Cl | 5g | 525029834
3-(4-Bromo-2-chlorophenyl)propanoic acid | Ambeed | 1261725-56-7 | MFCD18390614 | 263.520 | C9H8BrClO2 | 97.000 | OC(=O)CCc1ccc(Br)cc1Cl | 5g | 525029834
OCC1c2ccccc2-c2ccccc12)C(O)=O | 25g | 490545122](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502697328.jpg-250.jpg)
eMolecules 180675-08-5 | Fmoc-Asp(OMpe)-OH | Ambeed | MFCD10001333 | 439.508 | C25H29NO6 | 97.000 | CCC(C)(CC)OC(=O)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 25g | 490545122
Fmoc-Asp(OMpe)-OH | Ambeed | 180675-08-5 | MFCD10001333 | 439.508 | C25H29NO6 | 97.000 | CCC(C)(CC)OC(=O)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 25g | 490545122
=O)C(O)=O)c[nH]c2[nH]1 | 25mg | 376013141](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502697858.jpg-250.jpg)
eMolecules 137281-23-3 | Pemetrexed | Target Molecule | MFCD19105065 | 427.417 | C20H21N5O6 | 0.000 | Nc1nc(=O)c2c(CCc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)c[nH]c2[nH]1 | 25mg | 376013141
Pemetrexed | Target Molecule | 137281-23-3 | MFCD19105065 | 427.417 | C20H21N5O6 | 0.000 | Nc1nc(=O)c2c(CCc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)c[nH]c2[nH]1 | 25mg | 376013141
=O)C1 | 5g | 423178053](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502697795.jpg-250.jpg)
eMolecules 204688-60-8 | (R)-1-Boc-3-pyrrolidine acetic acid | Synthonix - Stock | MFCD05861546 | 229.276 | C11H19NO4 | 95.000 | CC(C)(C)OC(=O)N1CC[C@@H](CC(O)=O)C1 | 5g | 423178053
(R)-1-Boc-3-pyrrolidine acetic acid | Synthonix - Stock | 204688-60-8 | MFCD05861546 | 229.276 | C11H19NO4 | 95.000 | CC(C)(C)OC(=O)N1CC[C@@H](CC(O)=O)C1 | 5g | 423178053
eMolecules Combi-Blocks Fmoc-Ser(TBDMS)-OH 10g 342864101 QB-7013 97.000 146346-81-8 MFCD02092931 441.599 C24H31NO5Si
Combi-Blocks Fmoc-Ser(TBDMS)-OH 10g 342864101 QB-7013 97.000 146346-81-8 MFCD02092931 441.599 C24H31NO5Si
Medchemexpress LLC 5-Methylpyrazine-2-carboxylic acid | 5521-55-1 | 99.9% | 138.12 | 50 G
5-Methylpyrazine-2-carboxylic acid is a biochemical reagent suitable for life science related research. It can be utilized as a biological material or an organic compound. This product is for research use only.
- High purity chemical
- Multiple pack sizes available
- Detailed documentation provided
- Suitable for various research protocols