Pyrroles
Aobchem (2-Bromo-4-fluoro-3-iodophenyl)(methyl)sulfane | 97% | CAS 2709971-04-8 | C7H5BrFIS | 5g
(2-Bromo-4-fluoro-3-iodophenyl)(methyl)sulfane | 97% | CAS 2709971-04-8 | C7H5BrFIS | 5g
Aobchem (3-Bromo-2-fluoro-6-iodophenyl)(methyl)sulfane | 97% | CAS 1936135-89-5 | C7H5BrFIS | 1g
(3-Bromo-2-fluoro-6-iodophenyl)(methyl)sulfane | 97% | CAS 1936135-89-5 | C7H5BrFIS | 1g
Aobchem (4-Chlorophenyl)(3-iodophenyl)methanol | 95% | CAS 1249291-61-9 | C13H10ClIO | 5g
(4-Chlorophenyl)(3-iodophenyl)methanol | 95% | CAS 1249291-61-9 | C13H10ClIO | 5g
Aobchem (3-Iodophenyl)(2-methoxyphenyl)methanol | 95% | CAS 1711414-72-0 | C14H13IO2 | 1g
(3-Iodophenyl)(2-methoxyphenyl)methanol | 95% | CAS 1711414-72-0 | C14H13IO2 | 1g
Aobchem O-3-iodophenyl N N-diethylcarbamate | 97% | CAS 863870-73-9 | C11H14INO2 | 5g
O-3-iodophenyl N N-diethylcarbamate | 97% | CAS 863870-73-9 | C11H14INO2 | 5g
Medchemexpress LLC 4-(4-Aminophenyl)morpholin-3-one | 438056-69-0 | 100.0% | C10H12N2O2 | 1 G
4-(4-Aminophenyl)morpholin-3-one is a solid drug intermediate used for the synthesis of various active compounds. It is intended for research purposes only and not for human use. This product has not been fully validated for medical applications.
- Solid, white to light brown appearance
- Stable under recommended storage conditions
- Store powder at -20°C for 3 years or 4°C for 2 years
- Store in solvent at -80°C for 6 months or -20°C for 1 month
- Shipment at room temperature if less than 2 weeks
Aobchem 2-(2 5-Dimethyl-1H-pyrrol-1-yl)-5-(4 4 5 5-tetramethyl-1 3 2-dioxaborolan-2-yl)pyridine | ≥97% | CAS 885226-07-3 | C17H23BN2O2 | 500mg
2-(2 5-Dimethyl-1H-pyrrol-1-yl)-5-(4 4 5 5-tetramethyl-1 3 2-dioxaborolan-2-yl)pyridine | ≥97% | CAS 885226-07-3 | C17H23BN2O2 | 500mg
Aobchem 2-(4-Iodophenyl)pyridine | 95% | CAS 871012-88-3 | C11H8IN | 250mg
2-(4-Iodophenyl)pyridine | 95% | CAS 871012-88-3 | C11H8IN | 250mg
Aobchem 2-(1H-Pyrrol-1-yl)pyridine | ≥97% | CAS 50966-74-0 | C9H8N2 | 250mg
2-(1H-Pyrrol-1-yl)pyridine | ≥97% | CAS 50966-74-0 | C9H8N2 | 250mg
Aobchem 1-(3 5-Difluoro-4-iodophenyl)ethanone | 97% | CAS 2383213-34-9 | C8H5F2IO | 1g
1-(3 5-Difluoro-4-iodophenyl)ethanone | 97% | CAS 2383213-34-9 | C8H5F2IO | 1g
Aobchem Cyclopropyl(4-iodophenyl)methanone | 95% | CAS 1152686-61-7 | C10H9IO | 1g
Cyclopropyl(4-iodophenyl)methanone | 95% | CAS 1152686-61-7 | C10H9IO | 1g
Aobchem (3-Bromo-5-chloro-4-iodophenyl)(methyl)sulfane | 95% | CAS 2709327-50-2 | C7H5BrClIS | 250mg
(3-Bromo-5-chloro-4-iodophenyl)(methyl)sulfane | 95% | CAS 2709327-50-2 | C7H5BrClIS | 250mg
![eMolecules 913742-54-8 | (2S,4R)-4-Boc-amino pyrrolidine-2-carboxylic acid methyl ester hydrochloride | Combi-Blocks280.750 | C11H21ClN2O4 | 95.000 | Cl.COC(=O)[C@@H]1C[C@H](CN1)NC(=O)OC(C)(C)C | 1g | 457921308](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502190211.JPG-250.jpg)
eMolecules 913742-54-8 | (2S,4R)-4-Boc-amino pyrrolidine-2-carboxylic acid methyl ester hydrochloride | Combi-Blocks280.750 | C11H21ClN2O4 | 95.000 | Cl.COC(=O)[C@@H]1C[C@H](CN1)NC(=O)OC(C)(C)C | 1g | 457921308
(2S,4R)-4-Boc-amino pyrrolidine-2-carboxylic acid methyl ester hydrochloride | Combi-Blocks | 913742-54-8280.750 | C11H21ClN2O4 | 95.000 | Cl.COC(=O)[C@@H]1C[C@H](CN1)NC(=O)OC(C)(C)C | 1g | 457921308
eMolecules 1214363-79-7 | ChemScene | Ethyl 6-chloro-3-fluoropicolinate | 250mg | 632303160 | CS-0160553 | MFCD14698362 | 203.6 | C8H7ClFNO2
Ambeed | (R)-NN-Dimethylpyrrolidin-3-amine | 250mg | 552512576 | A100212 | 132958-72-6 | MFCD00191347 | 114.192 | C6H14N2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 89353-42-4 | 3-Pyrrol-1-yl-phenylamine | Oakwood Chemical | MFCD03407309 | 158.204 | C10H10N2 | 98.000 | Nc1cccc(c1)-n1cccc1 | 100mg | 537678823
3-Pyrrol-1-yl-phenylamine | Oakwood Chemical | 89353-42-4 | MFCD03407309 | 158.204 | C10H10N2 | 98.000 | Nc1cccc(c1)-n1cccc1 | 100mg | 537678823