Cyclohexylamines
amido}(mesitylene)ruthenium(II), min. 90% RuCl[(R,R)-Tsdpen(mesitylene) | 174813-82-2 | | 1g](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502169486.JPG-250.jpg)
eMolecules Chloro{[(1R,2R)-(-)-2-amino-1,2-diphenylethyl](4-toluenesulfonyl)amido}(mesitylene)ruthenium(II), min. 90% RuCl[(R,R)-Tsdpen(mesitylene) | 174813-82-2 | | 1g
Strem Chemicals | Chloro{[(1R,2R)-(-)-2-amino-1,2-diphenylethyl](4-toluenesulfonyl)amido}(mesitylene)ruthenium(II), min. 90% RuCl[(R,R)-Tsdpen(mesitylene) | 1g | 321338519 | 44-0154 | 90.000 | 174813-82-2 | | 622.190 | C30H33ClN2O2RuS
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 488703-60-2 | (1S,2S)-2-(TERT-BUTOXYCARBONYLAMINO) CYCLOHEXANECARBOXYLIC ACID | AstaTech | MFCD04974226 | 243.303 | C12H21NO4 | 95.000 | CC(C)(C)OC(=O)N[C@H]1CCCC[C@@H]1C(O)=O | 1g | 273176290](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502171688.JPG-250.jpg)
eMolecules 488703-60-2 | (1S,2S)-2-(TERT-BUTOXYCARBONYLAMINO) CYCLOHEXANECARBOXYLIC ACID | AstaTech | MFCD04974226 | 243.303 | C12H21NO4 | 95.000 | CC(C)(C)OC(=O)N[C@H]1CCCC[C@@H]1C(O)=O | 1g | 273176290
(1S,2S)-2-(TERT-BUTOXYCARBONYLAMINO) CYCLOHEXANECARBOXYLIC ACID | AstaTech | 488703-60-2 | MFCD04974226 | 243.303 | C12H21NO4 | 95.000 | CC(C)(C)OC(=O)N[C@H]1CCCC[C@@H]1C(O)=O | 1g | 273176290
Chemscene ChemScene | (1R,2R)-N1,N2-Dimethylcyclohexane-1,2-diamine dihydrochloride | 5G | CS-0028239 | 0.97 | 70708-33-7| MFCD09749879 | 215.16
ChemScene | (1R,2R)-N1,N2-Dimethylcyclohexane-1,2-diamine dihydrochloride | 5G | CS-0028239 | 0.97 | 70708-33-7| MFCD09749879 | 215.16
Accela Chembio Inc (1s | 2s)-(-)-1 | 2-diaminocyclohexane D-tartrate | 25g | 67333-70-4 | MFCD00191980 | 95+% | Shelf Life: 1800 Days | Moisture Sensitive
(1s | 2s)-(-)-1 | 2-diaminocyclohexane D-tartrate | 25g | 67333-70-4 | MFCD00191980 | 95+% | Shelf Life: 1800 Days | Moisture Sensitive