Hydrazines and derivatives
Medchemexpress LLC p-Tolualdehyde | 104-87-0 | 120.15 | 100 G
p-Tolualdehyde is an active small molecule used as a drug intermediate, suitable for research purposes only. It plays a role in the synthesis of isoxazole derivatives, which are crucial for developing multidrug resistance (MDR) reversal agents. This compound also serves as a model for forming the fluorescent compound DPSH-To with fluorescent probe DPSH, enabling aldehyde compound determination.
- Used as a drug intermediate
- Essential for research applications
- Synthesizes isoxazole derivatives
- Contributes to the development of multidrug resistance (MDR) reversal agents
- Serves as a model compound for aldehyde compound determination
Aobchem [6-(4-Morpholinyl)-3-pyridinyl]phenylmethanone | 95% | CAS 1355207-85-0 | C16H16N2O2 | 1g
[6-(4-Morpholinyl)-3-pyridinyl]phenylmethanone | 95% | CAS 1355207-85-0 | C16H16N2O2 | 1g
Aobchem 2-(4-Ethylphenyl)-1 3 4-oxadiazole | ≥97% | CAS 1143581-11-6 | C10H10N2O | 5g
2-(4-Ethylphenyl)-1 3 4-oxadiazole | ≥97% | CAS 1143581-11-6 | C10H10N2O | 5g
Aobchem [6-(4-Morpholinyl)-3-pyridinyl]phenylmethanone | 95% | CAS 1355207-85-0 | C16H16N2O2 | 250mg
[6-(4-Morpholinyl)-3-pyridinyl]phenylmethanone | 95% | CAS 1355207-85-0 | C16H16N2O2 | 250mg
![Aobchem 1-[4-(4-Morpholinyl)phenyl]-1-propanone | ≥95% | CAS 78987-46-9 | C13H17NO2 | 250mg](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000974460.png-250.jpg)
Aobchem 1-[4-(4-Morpholinyl)phenyl]-1-propanone | ≥95% | CAS 78987-46-9 | C13H17NO2 | 250mg
1-[4-(4-Morpholinyl)phenyl]-1-propanone | ≥95% | CAS 78987-46-9 | C13H17NO2 | 250mg
Aobchem 5-Methyl-6-(4-morpholinyl)pyridine-3-boronic acid pinacol ester | ≥97% | CAS 1073372-03-8 | C16H25BN2O3 | 1g
5-Methyl-6-(4-morpholinyl)pyridine-3-boronic acid pinacol ester | ≥97% | CAS 1073372-03-8 | C16H25BN2O3 | 1g
Aobchem 5-Methyl-6-(4-morpholinyl)pyridine-3-boronic acid pinacol ester | 97% | CAS 1073372-03-8 | C16H25BN2O3 | 250mg
5-Methyl-6-(4-morpholinyl)pyridine-3-boronic acid pinacol ester | 97% | CAS 1073372-03-8 | C16H25BN2O3 | 250mg
Medchemexpress LLC Thiosemicarbazide | 79-19-6 | MFCD00007620 | >=98.0% | 91.14 g/mol | CH5N3S | 1mL
Thiosemicarbazide is a vitamin B6 antagonist with anti-acne activity Thiosemicarbazide is also a well-known source in the synthesis of heterocycles and its derivatives have potential anticancer activity Thiosemicarbazide (TSC HL1) reacts with metal salts urea (U) to prepare Co(II) and Cu(I) metal complexes Thiosemicarbazide is also used in the fields of media communications and optical storage and in the spectrophotometric detection of metals[1][2][3][1][2][3]
eMolecules 105316-06-1 | 4-(4-Morpholinyl-3-trifluoromethylaniline | Oakwood Chemical | MFCD06090415 | 246.233 | C11H13F3N2O | 97.000 | Nc1ccc(N2CCOCC2)c(c1)C(F)(F)F | 250mg | 537689503
4-(4-Morpholinyl-3-trifluoromethylaniline | Oakwood Chemical | 105316-06-1 | MFCD06090415 | 246.233 | C11H13F3N2O | 97.000 | Nc1ccc(N2CCOCC2)c(c1)C(F)(F)F | 250mg | 537689503
Aobchem -Ethenyl-4-(4-morpholinyl)benzenemethanol | 95% | CAS 2228396-13-0 | C13H17NO2 | 500mg
-Ethenyl-4-(4-morpholinyl)benzenemethanol | 95% | CAS 2228396-13-0 | C13H17NO2 | 500mg
Aobchem -Ethyl-4-(4-morpholinyl)benzenemethanol | 95% | CAS 494862-42-9 | C13H19NO2 | 1g
-Ethyl-4-(4-morpholinyl)benzenemethanol | 95% | CAS 494862-42-9 | C13H19NO2 | 1g
Aobchem 2-Methyl-1-[4-(4-morpholinyl)phenyl]-1-propanone | 95% | CAS 216989-48-9 | C14H19NO2 | 500mg
2-Methyl-1-[4-(4-morpholinyl)phenyl]-1-propanone | 95% | CAS 216989-48-9 | C14H19NO2 | 500mg
Aobchem 1-(P-Aminophenyl)adamantane | ≥95% | CAS 1459-48-9 | C16H21N | 500mg
1-(P-Aminophenyl)adamantane | ≥95% | CAS 1459-48-9 | C16H21N | 500mg