Isothiocyanates
SIGMA ALDRICH FINE CHEMICALS BIOSCIENCES TETRAMETHYLRHODAMINE ISOTHIOCY
NC3521761 TETRAMETHYLRHODAMINE ISOTHIOCY
Aobchem 8-(3-Ethoxyphenyl)-1 4-dioxaspiro[4 5]decan-8-ol | 97% | CAS 1508547-91-8 | C16H22O4 | 500mg
8-(3-Ethoxyphenyl)-1 4-dioxaspiro[4 5]decan-8-ol | 97% | CAS 1508547-91-8 | C16H22O4 | 500mg
Aobchem 1-Bromo-3-(cyclopropylmethyl)-5-fluorobenzene | 95% | CAS 1369880-62-5 | C10H10BrF | 500mg
1-Bromo-3-(cyclopropylmethyl)-5-fluorobenzene | 95% | CAS 1369880-62-5 | C10H10BrF | 500mg
Aobchem Cyclopentyl(2-methoxyphenyl)methanone | 95% | CAS 7063-68-5 | C13H16O2 | 250mg
Cyclopentyl(2-methoxyphenyl)methanone | 95% | CAS 7063-68-5 | C13H16O2 | 250mg
Aobchem 2-(2-Ethoxycarbonylphenyl)-5 5-dimethyl-1 3 2-dioxaborinane | 95% | CAS 346656-34-6 | C14H19BO4 | 1g
2-(2-Ethoxycarbonylphenyl)-5 5-dimethyl-1 3 2-dioxaborinane | 95% | CAS 346656-34-6 | C14H19BO4 | 1g
Aobchem 3-Bromo-1-(cyclopropylmethyl)-2(1H)-pyridinone | ≥95% | CAS 1602551-71-2 | C9H10BrNO | 1g
3-Bromo-1-(cyclopropylmethyl)-2(1H)-pyridinone | ≥95% | CAS 1602551-71-2 | C9H10BrNO | 1g
Medchemexpress LLC JTT 551 | 776309-04-7 | 99.7% | 605.85 | 1 ML
JTT 551 is a selective protein tyrosine phosphatase 1B (PTP1B) inhibitor, with Ki values of 0.22 μM for PTP1B and 9.3 μM for TCPTP (T-cell protein tyrosine phosphatase). It can be used in the research of type 2 diabetes mellitus. JTT 551 enhances insulin-induced deoxyglucose uptake in a dose-dependent manner and dose-dependently decreases blood glucose levels in db/db mice. It also significantly reduces triglyceride levels.
- Selective PTP1B inhibitor
- Enhances insulin-induced deoxyglucose uptake
- Decreases blood glucose levels
- Reduces triglyceride levels
Aobchem (2-Ethoxyphenyl)(methyl)sulfane | ≥95% | CAS 38125-62-1 | C9H12OS | 250mg
(2-Ethoxyphenyl)(methyl)sulfane | ≥95% | CAS 38125-62-1 | C9H12OS | 250mg
Aobchem 2-Bromo-N-(cyclopropylmethyl)benzamide | ≥95% | CAS 306745-66-4 | C11H12BrNO | 1g
2-Bromo-N-(cyclopropylmethyl)benzamide | ≥95% | CAS 306745-66-4 | C11H12BrNO | 1g
eMolecules 3326-32-7 | Fluorescein isothiocyanate isomer I | Ochem Incorporation | MFCD00005063 | 389.380 | C21H11NO5S | 96.000 | Oc1ccc2c(Oc3cc(O)ccc3C22OC(=O)c3cc(ccc23)N=C=S)c1 | 5g | 773137908
Fluorescein isothiocyanate isomer I | Ochem Incorporation | 3326-32-7 | MFCD00005063 | 389.380 | C21H11NO5S | 96.000 | Oc1ccc2c(Oc3cc(O)ccc3C22OC(=O)c3cc(ccc23)N=C=S)c1 | 5g | 773137908
Aobchem 1-Bromo-2-(cyclopropylmethyl)benzene | ≥95% | CAS 1889435-75-9 | C10H11Br | 1g
1-Bromo-2-(cyclopropylmethyl)benzene | ≥95% | CAS 1889435-75-9 | C10H11Br | 1g
Aobchem N-cyclopentyl-4-fluorobenzamide | ≥95% | CAS 300829-28-1 | C12H14FNO | 500mg
N-cyclopentyl-4-fluorobenzamide | ≥95% | CAS 300829-28-1 | C12H14FNO | 500mg
Aobchem -Cyclopentyl-3-methylbenzenemethanol | ≥95% | CAS 1182828-21-2 | C13H18O | 500mg
-Cyclopentyl-3-methylbenzenemethanol | ≥95% | CAS 1182828-21-2 | C13H18O | 500mg
eMolecules 951753-87-0 | 5-Isothiocyanato-3-(trifluoromethyl)picolinonitrile | Ambeed | MFCD18382742 | 229.180 | C8H2F3N3S | 98.000 | FC(F)(F)c1cc(cnc1C#N)N=C=S | 1g | 589945754
5-Isothiocyanato-3-(trifluoromethyl)picolinonitrile | Ambeed | 951753-87-0 | MFCD18382742 | 229.180 | C8H2F3N3S | 98.000 | FC(F)(F)c1cc(cnc1C#N)N=C=S | 1g | 589945754
Apexbio Technology LLC Tempo 2564-83-2 100mg
Tempo (CAS 2564-83-2) is a stable nitroxide radical widely employed in biomedical research for its redox-active properties It facilitates the dismutation of superoxide radicals thereby modulating mitochondrial reactive oxygen species (ROS) levels and influencing cellular oxidative stress responses Tempo also serves as an oxidation catalyst particularly in the transformation of primary alcohols to aldehydes Studies indicate that Tempo exerts both antioxidant and mutagenic effects inducing DNA strand breaks and displaying cytotoxic and mutagenic activities in in vitro models such as murine lymphoma cells It is utilized for investigating oxidative stress redox regulation and chemical mutagenesis