Isothiocyanates
Sigma Aldrich Fine Chemicals Biosciences 3-(Methylthio)propyl isothiocyanate >=98%, FG | 505-79-3 | MFCD00209521 | 100G
3-(Methylthio)propyl isothiocyanate >=98%, FG | Purity: >=98% | Mol Wt: 147.26 | 505-79-3 | MFCD00209521 | 100G
Sigma Aldrich Fine Chemicals Biosciences 3-(Methylthio)propyl isothiocyanate >=98%, FG | 505-79-3 | MFCD00209521 | 1KG
3-(Methylthio)propyl isothiocyanate >=98%, FG | Purity: >=98% | Mol Wt: 147.26 | 505-79-3 | MFCD00209521 | 1KG
Sigma Aldrich Fine Chemicals Biosciences 3-(Methylthio)propyl isothiocyanate >=98%, FG | 505-79-3 | MFCD00209521 | 25G
3-(Methylthio)propyl isothiocyanate >=98%, FG | Purity: >=98% | Mol Wt: 147.26 | 505-79-3 | MFCD00209521 | 25G
Sigma Aldrich Fine Chemicals Biosciences Phenyl isothiocyanate for
Phenyl isothiocyanate is an aromatic isothiocyanate. It participates in dehydration reactions of alcohols. It is widely used for synthesis of various biologically important heterocyclic compounds.
eMolecules 3326-32-7 | Fluorescein isothiocyanate isomer I | Chem-Impex | MFCD00005063 | 389.380 | C21H11NO5S | 96.000 | Oc1ccc2c(Oc3cc(O)ccc3C22OC(=O)c3cc(ccc23)N=C=S)c1 | 250mg | 112440714
Fluorescein isothiocyanate isomer I | Chem-Impex | 3326-32-7 | MFCD00005063 | 389.380 | C21H11NO5S | 96.000 | Oc1ccc2c(Oc3cc(O)ccc3C22OC(=O)c3cc(ccc23)N=C=S)c1 | 250mg | 112440714
Aobchem 1-Bromo-4-(cyclopropylmethyl)-2-fluorobenzene | ≥95% | CAS 1369919-18-5 | C10H10BrF | 1g
1-Bromo-4-(cyclopropylmethyl)-2-fluorobenzene | ≥95% | CAS 1369919-18-5 | C10H10BrF | 1g
Aobchem 2-Naphthyl isothiocyanate | 95% | CAS 1636-33-5 | C11H7NS | 5g
2-Naphthyl isothiocyanate | 95% | CAS 1636-33-5 | C11H7NS | 5g
Medchemexpress LLC 2-Butylbenzo d isoth 50g
2-Butylbenzo[d]isothiazol-3(2H)-one is a bioactive compound with potent antibacterial and antifungal activity 2-Butylbenzo[d]isothiazol-3(2H)-one is often used as a pesticide ingredient in agriculture to protect crops from diseases 2-Butylbenzo[d]isothiazol-3(2H)-one is also used in coatings to prevent the growth of mold and algae 2-Butylbenzo[d]isothiazol-3(2H)-one is also used as a preservative in personal care products to extend the shelf life of the product[1]
Aobchem 1-(3-Bromo-4-ethoxyphenyl)ethanone | ≥95% | CAS 35310-76-0 | C10H11BrO2 | 10g
1-(3-Bromo-4-ethoxyphenyl)ethanone | ≥95% | CAS 35310-76-0 | C10H11BrO2 | 10g
Aobchem -Cyclopentyl-3-methylbenzenemethanol | ≥95% | CAS 1182828-21-2 | C13H18O | 250mg
-Cyclopentyl-3-methylbenzenemethanol | ≥95% | CAS 1182828-21-2 | C13H18O | 250mg
eMolecules 951753-87-0 | 5-Isothiocyanato-3-(trifluoromethyl)pyridine-2-carbonitrile | Accela ChemBio (ASD) | MFCD18382742 | 229.180 | C8H2F3N3S | 95.000 | FC(F)(F)c1cc(cnc1C#N)N=C=S | 5g | 528950568
5-Isothiocyanato-3-(trifluoromethyl)pyridine-2-carbonitrile | Accela ChemBio (ASD) | 951753-87-0 | MFCD18382742 | 229.180 | C8H2F3N3S | 95.000 | FC(F)(F)c1cc(cnc1C#N)N=C=S | 5g | 528950568
Aobchem 3-Bromo-5-(cyclopropylmethyl)-4-methylpyridine | ≥97% | CAS 2586126-87-4 | C10H12BrN | 250mg
3-Bromo-5-(cyclopropylmethyl)-4-methylpyridine | ≥97% | CAS 2586126-87-4 | C10H12BrN | 250mg
Aobchem 3-Isothiocyanato-1-methyl-6-(trifluoromethyl)-1H-indazole | 95% | C10H6F3N3S | 1g
3-Isothiocyanato-1-methyl-6-(trifluoromethyl)-1H-indazole | 95% | C10H6F3N3S | 1g
Aobchem 1-(2-Ethoxyphenyl)-4-methylcyclohexanol | 95% | CAS 1496254-02-4 | C15H22O2 | 500mg
1-(2-Ethoxyphenyl)-4-methylcyclohexanol | 95% | CAS 1496254-02-4 | C15H22O2 | 500mg