Diethyl Ether
eMolecules 1383980-52-6 | Bis-aminooxy-PEG7 | Broadpharm | MFCD30723215 | 400.469 | C16H36N2O9 | 98.000 | NOCCOCCOCCOCCOCCOCCOCCOCCON | 100mg | 343283593
Bis-aminooxy-PEG7 | Broadpharm | 1383980-52-6 | MFCD30723215 | 400.469 | C16H36N2O9 | 98.000 | NOCCOCCOCCOCCOCCOCCOCCOCCON | 100mg | 343283593
eMolecules 134179-40-1 | Ambeed | 2233-Tetramethyl-471013-tetraoxa-3-silapentadecan-15-ol | 250mg | 633665535 | A984366 | MFCD25424114 | 308.49 | C14H32O5Si
Ambeed | 4-Methylpicolinonitrile | 10g | 552688763 | A276079 | 1620-76-4 | MFCD00128868 | 118.139 | C7H6N2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 14228-73-0 | Ambeed | 14-Bis((oxiran-2-ylmethoxy)methyl)cyclohexane | 25g | 787726887 | A400289 | MFCD00040698 | 256.342 | C14H24O4
ChemScene | 5-(Difluoromethyl)thiophene-2-carboxylic acid | 100mg | 654763276 | CS-0212762 | 189330-23-2 | MFCD20658307 | 178.150 | C6H4F2O2S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Sigma Aldrich Fine Chemicals Biosciences Diethyl ether contains 1 ppm BHT as inhibitor, anhydrous, >=99.7% | 60-29-7 | MFCD00011646 | 18L
Diethyl ether contains 1 ppm BHT as inhibitor, anhydrous, >=99.7% | Purity: >=99.7% | Mol Wt: 74.12 | 60-29-7 | MFCD00011646 | 18L
eMolecules 856414-68-1 | Ambeed | Ethyl 3-Oxo-3-(4-tetrahydropyranyl)propanoate | 250mg | 627733694 | A506453 | MFCD04115573 | 200.234 | C10H16O4
Ambeed | Ethyl 3-Oxo-3-(4-tetrahydropyranyl)propanoate | 250mg | 627733694 | A506453 | 856414-68-1 | MFCD04115573 | 200.234 | C10H16O4
eMolecules Tri(Boc-NH-PEG5-amide)-amine | Broadpharm |1320.621 | C60H117N7O24 | 98.000 | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCC(=O)NCCN(CCNC(=O)CCOCCOCCOCCOCCOCCNC(=O)OC(C)(C)C)CCNC(=O)CCOCCOCCOCCOCCOCCNC(=O)OC(C)(C)C | 50mg | 303671183
Tri(Boc-NH-PEG5-amide)-amine | Broadpharm |1320.621 | C60H117N7O24 | 98.000 | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCC(=O)NCCN(CCNC(=O)CCOCCOCCOCCOCCOCCNC(=O)OC(C)(C)C)CCNC(=O)CCOCCOCCOCCOCCOCCNC(=O)OC(C)(C)C | 50mg | 303671183
eMolecules 6342-56-9 | Methylglyoxal 1,1-dimethyl acetal | Ambeed | MFCD00008758 | 118.132 | C5H10O3 | 98.000 | COC(OC)C(C)=O | 25g | 525140761
Methylglyoxal 1,1-dimethyl acetal | Ambeed | 6342-56-9 | MFCD00008758 | 118.132 | C5H10O3 | 98.000 | COC(OC)C(C)=O | 25g | 525140761
![eMolecules 13349-82-1 | 1-[2-(2-Hydroxyethoxy)ethyl]piperazine | Ambeed | MFCD00074931 | 174.244 | C8H18N2O2 | 95.000 | OCCOCCN1CCNCC1 | 25g | 552558844](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502429335.PNG-250.jpg)
eMolecules 13349-82-1 | 1-[2-(2-Hydroxyethoxy)ethyl]piperazine | Ambeed | MFCD00074931 | 174.244 | C8H18N2O2 | 95.000 | OCCOCCN1CCNCC1 | 25g | 552558844
1-[2-(2-Hydroxyethoxy)ethyl]piperazine | Ambeed | 13349-82-1 | MFCD00074931 | 174.244 | C8H18N2O2 | 95.000 | OCCOCCN1CCNCC1 | 25g | 552558844
eMolecules 1428902-86-6 | Ambeed | 1-((2R3R4R5R)-4-((tert-Butyldimethylsilyl)oxy)-5-(((tert-butyldimethylsilyl)oxy)methyl)-3-methoxytetrahydrofuran-2-yl)-4-(1H-124-triazol-1-yl)pyrimidin-2(1H)-one | 100mg | 650568633 | A1487896 | 537.808 | C24H43N5O5Si2
Medchem Express | Hinokiflavone | 1mg | 527573675 | HY-N2360 | 19202-36-9 | MFCD00017455 | 538.464 | C30H18O10
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
AdipoGen Pyrogallol
Chemical. CAS 87-66-1. Formula C6H6O3. MW 126.11. The Polyphenol pyrogallol is a powerful naturally occuring reducing agent. Due to its oxygen radical generating property, pyrogallol is commonly used as a photographic developing agent, in hair dying industry, as an antiseptic and to calculate the amount of oxygen in the air. Pyrogallol is a potent superoxide anion O2•- generator. Pyrogallol causes oxidative damage and induces mutagenesis, carcinogenesis and hepatotoxicity. It impairs immune responses, inhibits phagocytosis and suppresses the proliferation due to its strong free radical generating potential. As a superoxide generator it is commonly used to investigate the role of free radicals in the biological system. It is a potent inducer of Nrf2-mediated gene expression. Pyrogallol possesses anti-bacterial, anti-fungal, anti-psoriatic anti-cancer, anti-inflammatory and neuroprotective properties.
eMolecules 53185-52-7 | 3-Methoxy-N,N-dimethyl-propionamide | Ambeed | MFCD18970488 | 131.175 | C6H13NO2 | 98.000 | COCCC(=O)N(C)C | 25g | 603089144
3-Methoxy-N,N-dimethyl-propionamide | Ambeed | 53185-52-7 | MFCD18970488 | 131.175 | C6H13NO2 | 98.000 | COCCC(=O)N(C)C | 25g | 603089144
Diethyl ether, ACS Reagent, contains BHT as inhibitor, anhydrous, ≥99.0%, Solstice
CAS: 60-29-7 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00011646 InChI Key: RTZKZFJDLAIYFH-UHFFFAOYSA-N Synonym: diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether PubChem CID: 3283 ChEBI: CHEBI:35702 IUPAC Name: ethoxyethane SMILES: CCOCC