tert-Butyl Methyl Ether
Cayman Chemical Estron 3-methyl ether 500mg
A synthetic estrogen; stimulates proliferation of estrogen-dependent MCF-7 breast cancer cells in vitro from 0.16-20 μM; lacks ER binding activity (IC50s = >100 μM for ERα and ERβ); has been used in the synthesis of various estrogen receptor modulators
Sigma Aldrich Fine Chemicals Biosciences tert-Butyl methyl ether HP1L
tert-Butyl methyl ether is a gasoline additive. Its oxidative degradation by propane-oxidizing bacterial strains has been tested. Kinetics of its heat-assisted persulfate oxidation has been investigated at various pH temperature oxidant concentration and ionic strength levels. Its biodegradation followed a pseudo-first-order decay model and its pseudo-first-order rate constants were evaluated. MTBE can be synthesized by acid catalyzed reaction between methanol and isobutene. A study suggests that the addition of MTBE increases the number of active sites during polymerization of propene by stopped-flow method.
![eMolecules 27904-92-3 | TERT-BUTYL N-[(PHENYLCARBAMOYL)METHYL]CARBAMATE | AstaTech | MFCD10043451 | 250.298 | C13H18N2O3 | 95.000 | CC(C)(C)OC(=O)NCC(=O)Nc1ccccc1 | 0.1g | 696740607](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502461933.JPG-250.jpg)
eMolecules 27904-92-3 | TERT-BUTYL N-[(PHENYLCARBAMOYL)METHYL]CARBAMATE | AstaTech | MFCD10043451 | 250.298 | C13H18N2O3 | 95.000 | CC(C)(C)OC(=O)NCC(=O)Nc1ccccc1 | 0.1g | 696740607
TERT-BUTYL N-[(PHENYLCARBAMOYL)METHYL]CARBAMATE | AstaTech | 27904-92-3 | MFCD10043451 | 250.298 | C13H18N2O3 | 95.000 | CC(C)(C)OC(=O)NCC(=O)Nc1ccccc1 | 0.1g | 696740607
eMolecules 637-92-3 | TERT-BUTYL ETHYL ETHER | AstaTech | MFCD00009225 | 102.177 | C6H14O | 97.000 | CCOC(C)(C)C | 5g | 410723668
TERT-BUTYL ETHYL ETHER | AstaTech | 637-92-3 | MFCD00009225 | 102.177 | C6H14O | 97.000 | CCOC(C)(C)C | 5g | 410723668
Cambridge Isotope Laboratories Bisphenol F diglycidyl ether (BFDGE) (unlabeled) 100 ug/mL in acetonitrile 1 2 mL
Bisphenol F diglycidyl ether (BFDGE) (unlabeled) 100 ug/mL in acetonitrile 1 2 mL
![eMolecules 1251010-99-7 | TERT-BUTYL 1,8-DIOXA-4,11-DIAZASPIRO[5.6]DODECANE-11-CARBOXYLATE | AstaTech | MFCD14581088 | 272.345 | C13H24N2O4 | 95.000 | CC(C)(C)OC(=O)N1CCOCC2(CNCCO2)C1 | 0.1g | 742306085](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502479284.JPG-250.jpg)
eMolecules 1251010-99-7 | TERT-BUTYL 1,8-DIOXA-4,11-DIAZASPIRO[5.6]DODECANE-11-CARBOXYLATE | AstaTech | MFCD14581088 | 272.345 | C13H24N2O4 | 95.000 | CC(C)(C)OC(=O)N1CCOCC2(CNCCO2)C1 | 0.1g | 742306085
TERT-BUTYL 1,8-DIOXA-4,11-DIAZASPIRO[5.6]DODECANE-11-CARBOXYLATE | AstaTech | 1251010-99-7 | MFCD14581088 | 272.345 | C13H24N2O4 | 95.000 | CC(C)(C)OC(=O)N1CCOCC2(CNCCO2)C1 | 0.1g | 742306085
Sigma Aldrich Fine Chemicals Biosciences tert-Butyl methyl ether reagent grade, 98% | 1634-04-4 | MFCD00008812 | 1L
tert-Butyl methyl ether reagent grade, 98% | Purity: 98% | Mol Wt: 88.15 | 1634-04-4 | MFCD00008812 | 1L
Sigma Aldrich Fine Chemicals Biosciences tert-Butyl methyl ether reagent grade, >=98% | 1634-04-4 | MFCD00008812 | 1L
tert-Butyl methyl ether reagent grade, >=98% | Purity: >=98% | Mol Wt: 88.15 | 1634-04-4 | MFCD00008812 | 1L
Sigma Aldrich Fine Chemicals Biosciences tert-Butyl methyl ether | 1634-04-4 | MFCD00008812 | 2.5 L
tert-Butyl methyl ether | Purity: ≥99.0% | Mol Wt: 88.15 | 1634-04-4 | MFCD00008812 | 2.5 L
Cayman Chemical Estron 3-methyl ether 1g
A synthetic estrogen; stimulates proliferation of estrogen-dependent MCF-7 breast cancer cells in vitro from 0.16-20 μM; lacks ER binding activity (IC50s = >100 μM for ERα and ERβ); has been used in the synthesis of various estrogen receptor modulators
Sigma Aldrich Fine Chemicals Biosciences tert-Butyl methyl ether ACS reagent, >=99.0% | 1634-04-4 | MFCD00008812 | 1L
tert-Butyl methyl ether ACS reagent, >=99.0% | Purity: >=99.0% | Mol Wt: 88.15 | 1634-04-4 | MFCD00008812 | 1L