tert-Butyl Methyl Ether
Cayman Chemical Estron 3-methyl ether 5g
A synthetic estrogen; stimulates proliferation of estrogen-dependent MCF-7 breast cancer cells in vitro from 0.16-20 μM; lacks ER binding activity (IC50s = >100 μM for ERα and ERβ); has been used in the synthesis of various estrogen receptor modulators
eMolecules 1628679-52-6 | PEG2-MeN-Boc | ChemScene219.281 | C10H21NO4 | 97.000 | CN(CCOCCO)C(=O)OC(C)(C)C | 100mg | 686213862
PEG2-MeN-Boc | ChemScene | 1628679-52-6219.281 | C10H21NO4 | 97.000 | CN(CCOCCO)C(=O)OC(C)(C)C | 100mg | 686213862
eMolecules 637-92-3 | TERT-BUTYL ETHYL ETHER | AstaTech | MFCD00009225 | 102.177 | C6H14O | 97.000 | CCOC(C)(C)C | 5g | 410723668
TERT-BUTYL ETHYL ETHER | AstaTech | 637-92-3 | MFCD00009225 | 102.177 | C6H14O | 97.000 | CCOC(C)(C)C | 5g | 410723668
Aobchem Tert-butyl(2-fluorophenoxy)dimethylsilane | ≥97% | CAS 103438-89-7 | C12H19FOSi | 250mg
Tert-butyl(2-fluorophenoxy)dimethylsilane | ≥97% | CAS 103438-89-7 | C12H19FOSi | 250mg
Aobchem Tert-butyl(2-fluorophenoxy)dimethylsilane | ≥97% | CAS 103438-89-7 | C12H19FOSi | 5g
Tert-butyl(2-fluorophenoxy)dimethylsilane | ≥97% | CAS 103438-89-7 | C12H19FOSi | 5g
Sigma Aldrich Fine Chemicals Biosciences tert Butyl methyl ether su
tert-Butyl methyl ether (methyl tert-butyl ether MTBE) is a gasoline additive. Its oxidative degradation by propane-oxidizing bacterial strains has been tested. Kinetic studies of its heat-assisted persulfate oxidation at various pH temperature oxidant concentration and ionic strength levels suggests that reaction exhibits a pseudo-first-order decay model.
Cayman Chemical Estron 3-methyl ether 500mg
A synthetic estrogen; stimulates proliferation of estrogen-dependent MCF-7 breast cancer cells in vitro from 0.16-20 μM; lacks ER binding activity (IC50s = >100 μM for ERα and ERβ); has been used in the synthesis of various estrogen receptor modulators
![eMolecules 215917-99-0 | (R)-4-Boc-(3-Hydroxymethyl)morpholine | Ambeed | MFCD06799477 | 217.265 | C10H19NO4 | 97.000 | CC(C)(C)OC(=O)N1CCOC[C@H]1CO | 250mg | 525170146](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502429026.PNG-250.jpg)
eMolecules 215917-99-0 | (R)-4-Boc-(3-Hydroxymethyl)morpholine | Ambeed | MFCD06799477 | 217.265 | C10H19NO4 | 97.000 | CC(C)(C)OC(=O)N1CCOC[C@H]1CO | 250mg | 525170146
(R)-4-Boc-(3-Hydroxymethyl)morpholine | Ambeed | 215917-99-0 | MFCD06799477 | 217.265 | C10H19NO4 | 97.000 | CC(C)(C)OC(=O)N1CCOC[C@H]1CO | 250mg | 525170146
![eMolecules 1245816-29-8 | tert-butyl 2-oxa-6-azaspiro[3.5]nonane-6-carboxylate | Pharmablock | MFCD12545892 | 227.304 | C12H21NO3 | 97.000 | CC(C)(C)OC(=O)N1CCCC2(COC2)C1 | 25mg | 551136038](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502434596.JPG-250.jpg)
eMolecules 1245816-29-8 | tert-butyl 2-oxa-6-azaspiro[3.5]nonane-6-carboxylate | Pharmablock | MFCD12545892 | 227.304 | C12H21NO3 | 97.000 | CC(C)(C)OC(=O)N1CCCC2(COC2)C1 | 25mg | 551136038
tert-butyl 2-oxa-6-azaspiro[3.5]nonane-6-carboxylate | Pharmablock | 1245816-29-8 | MFCD12545892 | 227.304 | C12H21NO3 | 97.000 | CC(C)(C)OC(=O)N1CCCC2(COC2)C1 | 25mg | 551136038
eMolecules 79533-04-3 | ChemScene | tert-Butyl 4-acetylbenzylcarbamate | 100mg | 801476544 | CS-0434711 | MFCD18381796 | 249.31 | C14H19NO3
ChemScene | tert-Butyl 4-acetylbenzylcarbamate | 100mg | 801476544 | CS-0434711 | 79533-04-3 | MFCD18381796 | 249.310 | C14H19NO3
Cayman Chemical Estron 3-methyl ether 10g
A synthetic estrogen; stimulates proliferation of estrogen-dependent MCF-7 breast cancer cells in vitro from 0.16-20 μM; lacks ER binding activity (IC50s = >100 μM for ERα and ERβ); has been used in the synthesis of various estrogen receptor modulators
Chemscene ChemScene | (S)-tert-Butyl 3-formylpyrrolidine-1-carboxylate | 1G | CS-0079694 | 0.98 | 191348-04-6| MFCD14635729 | 199.25
ChemScene | (S)-tert-Butyl 3-formylpyrrolidine-1-carboxylate | 1G | CS-0079694 | 0.98 | 191348-04-6| MFCD14635729 | 199.25