Benzene and substituted derivatives
Filtered Search Results
eMolecules 2,4,6-Tribromobenzene-1,3,5-triol | 3354-82-3 | MFCD01706660 | 1g
Ambeed | 2,4,6-Tribromobenzene-1,3,5-triol | 1g | 600847489 | A771030 | | 3354-82-3 | MFCD01706660 | 362.799 | C6H3Br3O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
3-Fluorobenzylamine 98.0+%, TCI America™
CAS: 100-82-3 Molecular Formula: C7H8FN Molecular Weight (g/mol): 125.146 InChI Key: QVSVMNXRLWSNGS-UHFFFAOYSA-N Synonym: 3-fluorobenzylamine,3-fluorophenyl methanamine,m-fluorobenzylamine,benzenemethanamine, 3-fluoro,1-3-fluorophenyl methanamine,3-fluoro-benzylamine,benzylamine, m-fluoro,3-fluorophenyl methylamine,m-fluorobenzyl amine,3-fluorobenzyl amine PubChem CID: 66853 IUPAC Name: (3-fluorophenyl)methanamine SMILES: C1=CC(=CC(=C1)F)CN
| PubChem CID | 66853 |
|---|---|
| CAS | 100-82-3 |
| Molecular Weight (g/mol) | 125.146 |
| SMILES | C1=CC(=CC(=C1)F)CN |
| Synonym | 3-fluorobenzylamine,3-fluorophenyl methanamine,m-fluorobenzylamine,benzenemethanamine, 3-fluoro,1-3-fluorophenyl methanamine,3-fluoro-benzylamine,benzylamine, m-fluoro,3-fluorophenyl methylamine,m-fluorobenzyl amine,3-fluorobenzyl amine |
| IUPAC Name | (3-fluorophenyl)methanamine |
| InChI Key | QVSVMNXRLWSNGS-UHFFFAOYSA-N |
| Molecular Formula | C7H8FN |
4-Phenoxyphenol 99.0+%, TCI America™
CAS: 831-82-3 Molecular Formula: C12H10O2 Molecular Weight (g/mol): 186.21 MDL Number: MFCD00002331 InChI Key: ZSBDGXGICLIJGD-UHFFFAOYSA-N Synonym: p-phenoxyphenol,4-hydroxydiphenyl ether,phenol, 4-phenoxy,p-hydroxydiphenyl ether,phenol, p-phenoxy,hydroquinone monophenyl ether,unii-d83r742gjr,4-phenyloxy phenol,4-phenoxy phenol,4-phenoxy-phenol PubChem CID: 13254 ChEBI: CHEBI:39264 IUPAC Name: 4-phenoxyphenol SMILES: C1=CC=C(C=C1)OC2=CC=C(C=C2)O
| PubChem CID | 13254 |
|---|---|
| CAS | 831-82-3 |
| Molecular Weight (g/mol) | 186.21 |
| ChEBI | CHEBI:39264 |
| MDL Number | MFCD00002331 |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)O |
| Synonym | p-phenoxyphenol,4-hydroxydiphenyl ether,phenol, 4-phenoxy,p-hydroxydiphenyl ether,phenol, p-phenoxy,hydroquinone monophenyl ether,unii-d83r742gjr,4-phenyloxy phenol,4-phenoxy phenol,4-phenoxy-phenol |
| IUPAC Name | 4-phenoxyphenol |
| InChI Key | ZSBDGXGICLIJGD-UHFFFAOYSA-N |
| Molecular Formula | C12H10O2 |
2,5-Dibromoterephthalic Acid 98.0+%, TCI America™
CAS: 13731-82-3 Molecular Formula: C8H4Br2O4 Molecular Weight (g/mol): 323.92 MDL Number: MFCD00204593 InChI Key: VUTICWRXMKBOSF-UHFFFAOYSA-N Synonym: 2,5-dibromoterephtalic acid,2,5-dibromobenzene-1,4-dicarboxylic acid,1,4-benzenedicarboxylic acid, 2,5-dibromo,pubchem14888,1, 2,5-dibromo,maybridge1_002153,2,5-dibromoterephtalicacid,2,5-dibromoterephthalicacid,acmc-1cb24,ksc174o0t PubChem CID: 83690 IUPAC Name: 2,5-dibromobenzene-1,4-dicarboxylic acid SMILES: OC(=O)C1=CC(Br)=C(C=C1Br)C(O)=O
| PubChem CID | 83690 |
|---|---|
| CAS | 13731-82-3 |
| Molecular Weight (g/mol) | 323.92 |
| MDL Number | MFCD00204593 |
| SMILES | OC(=O)C1=CC(Br)=C(C=C1Br)C(O)=O |
| Synonym | 2,5-dibromoterephtalic acid,2,5-dibromobenzene-1,4-dicarboxylic acid,1,4-benzenedicarboxylic acid, 2,5-dibromo,pubchem14888,1, 2,5-dibromo,maybridge1_002153,2,5-dibromoterephtalicacid,2,5-dibromoterephthalicacid,acmc-1cb24,ksc174o0t |
| IUPAC Name | 2,5-dibromobenzene-1,4-dicarboxylic acid |
| InChI Key | VUTICWRXMKBOSF-UHFFFAOYSA-N |
| Molecular Formula | C8H4Br2O4 |
4-Bromo-2-fluorobenzyl Chloride 98.0+%, TCI America™
CAS: 85510-82-3 Molecular Formula: C7H5BrClF Molecular Weight (g/mol): 223.47 MDL Number: MFCD02094036 InChI Key: UDKQGFMDBMYVHI-UHFFFAOYSA-N Synonym: 4-bromo-2-fluorobenzyl chloride,4-bromo-1-chloromethyl-2-fluorobenzene,4-bromo-2-fluorobenzylchloride,4-bromo-1-chloromethyl-2-fluoro-benzene,acmc-209q6a,2-fluoro-4-bromo-chloromethylbenzene PubChem CID: 2773361 IUPAC Name: 4-bromo-1-(chloromethyl)-2-fluorobenzene SMILES: FC1=CC(Br)=CC=C1CCl
| PubChem CID | 2773361 |
|---|---|
| CAS | 85510-82-3 |
| Molecular Weight (g/mol) | 223.47 |
| MDL Number | MFCD02094036 |
| SMILES | FC1=CC(Br)=CC=C1CCl |
| Synonym | 4-bromo-2-fluorobenzyl chloride,4-bromo-1-chloromethyl-2-fluorobenzene,4-bromo-2-fluorobenzylchloride,4-bromo-1-chloromethyl-2-fluoro-benzene,acmc-209q6a,2-fluoro-4-bromo-chloromethylbenzene |
| IUPAC Name | 4-bromo-1-(chloromethyl)-2-fluorobenzene |
| InChI Key | UDKQGFMDBMYVHI-UHFFFAOYSA-N |
| Molecular Formula | C7H5BrClF |
4-Hydroxy-3-nitrobenzoic Acid 98.0+%, TCI America™
CAS: 616-82-0 Molecular Formula: C7H5NO5 Molecular Weight (g/mol): 183.12 MDL Number: MFCD00007119 InChI Key: QRYSWXFQLFLJTC-UHFFFAOYSA-N Synonym: 4-hydroxy-3-nitrobenzoic acid,3-nitro-4-hydroxybenzoic acid,benzoic acid, 4-hydroxy-3-nitro,3-nitro-4-hydrobenzoic acid,4-hydroxy-3-nitro-benzoic acid,nhb,pubchem18981,acmc-1auqv,3,4-nitrohydroxybenzoic acid,ksc489q0p PubChem CID: 12033 IUPAC Name: 4-hydroxy-3-nitrobenzoic acid SMILES: OC(=O)C1=CC=C(O)C(=C1)[N+]([O-])=O
| PubChem CID | 12033 |
|---|---|
| CAS | 616-82-0 |
| Molecular Weight (g/mol) | 183.12 |
| MDL Number | MFCD00007119 |
| SMILES | OC(=O)C1=CC=C(O)C(=C1)[N+]([O-])=O |
| Synonym | 4-hydroxy-3-nitrobenzoic acid,3-nitro-4-hydroxybenzoic acid,benzoic acid, 4-hydroxy-3-nitro,3-nitro-4-hydrobenzoic acid,4-hydroxy-3-nitro-benzoic acid,nhb,pubchem18981,acmc-1auqv,3,4-nitrohydroxybenzoic acid,ksc489q0p |
| IUPAC Name | 4-hydroxy-3-nitrobenzoic acid |
| InChI Key | QRYSWXFQLFLJTC-UHFFFAOYSA-N |
| Molecular Formula | C7H5NO5 |
1,2,3,5-Tetrafluorobenzene 98.0+%, TCI America™
CAS: 2367-82-0 Molecular Formula: C6H2F4 Molecular Weight (g/mol): 150.076 MDL Number: MFCD00000302 InChI Key: UHHYOKRQTQBKSB-UHFFFAOYSA-N Synonym: benzene, 1,2,3,5-tetrafluoro,unii-bv201pz5tv,bv201pz5tv,1,2,3,5 tetrafluorobenzene,pubchem1062,acmc-1carr,intermediates-zcf02631,1,2,4,6-tetrafluorobenzene,1,3,4,5-tetrafluorobenzene,1,2,3,5,-tetrafluorobenzene PubChem CID: 16910 IUPAC Name: 1,2,3,5-tetrafluorobenzene SMILES: C1=C(C=C(C(=C1F)F)F)F
| PubChem CID | 16910 |
|---|---|
| CAS | 2367-82-0 |
| Molecular Weight (g/mol) | 150.076 |
| MDL Number | MFCD00000302 |
| SMILES | C1=C(C=C(C(=C1F)F)F)F |
| Synonym | benzene, 1,2,3,5-tetrafluoro,unii-bv201pz5tv,bv201pz5tv,1,2,3,5 tetrafluorobenzene,pubchem1062,acmc-1carr,intermediates-zcf02631,1,2,4,6-tetrafluorobenzene,1,3,4,5-tetrafluorobenzene,1,2,3,5,-tetrafluorobenzene |
| IUPAC Name | 1,2,3,5-tetrafluorobenzene |
| InChI Key | UHHYOKRQTQBKSB-UHFFFAOYSA-N |
| Molecular Formula | C6H2F4 |
3,4,5-Trimethoxyphenylacetic Acid 98.0+%, TCI America™
CAS: 951-82-6 Molecular Formula: C11H14O5 Molecular Weight (g/mol): 226.228 MDL Number: MFCD00004336 InChI Key: DDSJXCGGOXKGSJ-UHFFFAOYSA-N Synonym: 3,4,5-trimethoxyphenylacetic acid,2-3,4,5-trimethoxyphenyl acetic acid,3,4,5-trimethoxyphenyl acetic acid,benzeneacetic acid, 3,4,5-trimethoxy,3,4,5-trimethoxyphenylaceticacid,pubchem14015,acmc-209rv8,ksc487g4j,3,4,5-trimethoxybenzeneacetic acid,benzeneacetic acid,4,5-trimethoxy PubChem CID: 70372 IUPAC Name: 2-(3,4,5-trimethoxyphenyl)acetic acid SMILES: COC1=CC(=CC(=C1OC)OC)CC(=O)O
| PubChem CID | 70372 |
|---|---|
| CAS | 951-82-6 |
| Molecular Weight (g/mol) | 226.228 |
| MDL Number | MFCD00004336 |
| SMILES | COC1=CC(=CC(=C1OC)OC)CC(=O)O |
| Synonym | 3,4,5-trimethoxyphenylacetic acid,2-3,4,5-trimethoxyphenyl acetic acid,3,4,5-trimethoxyphenyl acetic acid,benzeneacetic acid, 3,4,5-trimethoxy,3,4,5-trimethoxyphenylaceticacid,pubchem14015,acmc-209rv8,ksc487g4j,3,4,5-trimethoxybenzeneacetic acid,benzeneacetic acid,4,5-trimethoxy |
| IUPAC Name | 2-(3,4,5-trimethoxyphenyl)acetic acid |
| InChI Key | DDSJXCGGOXKGSJ-UHFFFAOYSA-N |
| Molecular Formula | C11H14O5 |
3-Hydroxyphenylurea 97.0+%, TCI America™
CAS: 701-82-6 Molecular Formula: C7H8N2O2 Molecular Weight (g/mol): 152.153 MDL Number: MFCD00007945 InChI Key: IPRCBIWIPMJXIK-UHFFFAOYSA-N Synonym: 1-3-hydroxyphenyl urea,m-hydroxyphenylurea,3-ureidophenol,urea, 3-hydroxyphenyl,3-hydroxyphenyl urea,urea, m-hydroxyphenyl,urea, n-3-hydroxyphenyl,n-carbamyl-m-aminophenol,n-3-hydroxyphenyl urea,urea,n-3-hydroxyphenyl PubChem CID: 12796 IUPAC Name: (3-hydroxyphenyl)urea SMILES: C1=CC(=CC(=C1)O)NC(=O)N
| PubChem CID | 12796 |
|---|---|
| CAS | 701-82-6 |
| Molecular Weight (g/mol) | 152.153 |
| MDL Number | MFCD00007945 |
| SMILES | C1=CC(=CC(=C1)O)NC(=O)N |
| Synonym | 1-3-hydroxyphenyl urea,m-hydroxyphenylurea,3-ureidophenol,urea, 3-hydroxyphenyl,3-hydroxyphenyl urea,urea, m-hydroxyphenyl,urea, n-3-hydroxyphenyl,n-carbamyl-m-aminophenol,n-3-hydroxyphenyl urea,urea,n-3-hydroxyphenyl |
| IUPAC Name | (3-hydroxyphenyl)urea |
| InChI Key | IPRCBIWIPMJXIK-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2O2 |
2,3,5-Triiodobenzoic Acid 98.0+%, TCI America™
CAS: 88-82-4 Molecular Formula: C7H3I3O2 Molecular Weight (g/mol): 499.81 MDL Number: MFCD00002420 InChI Key: ZMZGFLUUZLELNE-UHFFFAOYSA-N Synonym: floraltone,tiba,triiodobenzoic acid,johnkolor,benzoic acid, 2,3,5-triiodo,2,3,5-tiba,caswell no. 890a,triiodobenzoic acid van,regin 8,kyselina 2,3,5-trijodbenzoova PubChem CID: 6948 ChEBI: CHEBI:73175 IUPAC Name: 2,3,5-triiodobenzoic acid SMILES: OC(=O)C1=CC(I)=CC(I)=C1I
| PubChem CID | 6948 |
|---|---|
| CAS | 88-82-4 |
| Molecular Weight (g/mol) | 499.81 |
| ChEBI | CHEBI:73175 |
| MDL Number | MFCD00002420 |
| SMILES | OC(=O)C1=CC(I)=CC(I)=C1I |
| Synonym | floraltone,tiba,triiodobenzoic acid,johnkolor,benzoic acid, 2,3,5-triiodo,2,3,5-tiba,caswell no. 890a,triiodobenzoic acid van,regin 8,kyselina 2,3,5-trijodbenzoova |
| IUPAC Name | 2,3,5-triiodobenzoic acid |
| InChI Key | ZMZGFLUUZLELNE-UHFFFAOYSA-N |
| Molecular Formula | C7H3I3O2 |
3-Chloro-4-methylbenzoic Acid 98.0+%, TCI America™
CAS: 5162-82-3 Molecular Formula: C8H7ClO2 Molecular Weight (g/mol): 170.592 MDL Number: MFCD00045841 InChI Key: SDKUOEOJAXGCLU-UHFFFAOYSA-N Synonym: 3-chloro-p-toluic acid,p-toluic acid, 3-chloro,benzoic acid, 3-chloro-4-methyl,3-chloro-4-methyl-benzoic acid,3-chloro-4-methyl benzoic acid,pubchem4569,acmc-1ayqf,4-09-00-01743 beilstein handbook reference,ksc272s4h,3-chloro,4-methylbenzoic acid PubChem CID: 78840 IUPAC Name: 3-chloro-4-methylbenzoic acid SMILES: CC1=C(C=C(C=C1)C(=O)O)Cl
| PubChem CID | 78840 |
|---|---|
| CAS | 5162-82-3 |
| Molecular Weight (g/mol) | 170.592 |
| MDL Number | MFCD00045841 |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)Cl |
| Synonym | 3-chloro-p-toluic acid,p-toluic acid, 3-chloro,benzoic acid, 3-chloro-4-methyl,3-chloro-4-methyl-benzoic acid,3-chloro-4-methyl benzoic acid,pubchem4569,acmc-1ayqf,4-09-00-01743 beilstein handbook reference,ksc272s4h,3-chloro,4-methylbenzoic acid |
| IUPAC Name | 3-chloro-4-methylbenzoic acid |
| InChI Key | SDKUOEOJAXGCLU-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO2 |
Methyl 3-Methyl-2-nitrobenzoate 98.0+%, TCI America™
CAS: 5471-82-9 Molecular Formula: C9H9NO4 Molecular Weight (g/mol): 195.174 MDL Number: MFCD01003947 InChI Key: NJHDBIXFFZVJGZ-UHFFFAOYSA-N Synonym: methyl3-methyl-2-nitrobenzoate,methyl 3-methyl-2-nitrobenzenecarboxylate,benzoic acid, 3-methyl-2-nitro-, methyl ester,2-nitro-3-methylbenzoic acid, methyl ester,3-methyl-2-nitrobenzoic acid methyl ester,pubchem10932,acmc-1ap0b,ksc495q9t,methyl 2-nitro-3-methylbenzoate,methyl 3-methyl-2-nitro-benzoate PubChem CID: 79621 IUPAC Name: methyl 3-methyl-2-nitrobenzoate SMILES: CC1=CC=CC(=C1[N+](=O)[O-])C(=O)OC
| PubChem CID | 79621 |
|---|---|
| CAS | 5471-82-9 |
| Molecular Weight (g/mol) | 195.174 |
| MDL Number | MFCD01003947 |
| SMILES | CC1=CC=CC(=C1[N+](=O)[O-])C(=O)OC |
| Synonym | methyl3-methyl-2-nitrobenzoate,methyl 3-methyl-2-nitrobenzenecarboxylate,benzoic acid, 3-methyl-2-nitro-, methyl ester,2-nitro-3-methylbenzoic acid, methyl ester,3-methyl-2-nitrobenzoic acid methyl ester,pubchem10932,acmc-1ap0b,ksc495q9t,methyl 2-nitro-3-methylbenzoate,methyl 3-methyl-2-nitro-benzoate |
| IUPAC Name | methyl 3-methyl-2-nitrobenzoate |
| InChI Key | NJHDBIXFFZVJGZ-UHFFFAOYSA-N |
| Molecular Formula | C9H9NO4 |
3,4,5-Trichlorobenzotrifluoride 98.0+%, TCI America™
CAS: 50594-82-6 Molecular Formula: C7H2Cl3F3 Molecular Weight (g/mol): 249.438 InChI Key: FBKFIAIRSQOXJR-UHFFFAOYSA-N Synonym: 1,2,3-trichloro-5-trifluoromethyl benzene,3,4,5-trichlorobenzotrifluoride,3,4,5-trichlorotrifluoromethylbenzene,3,4,5-trichloro-alpha,alpha,alpha-trifluorotoluene,3,4,5-trichloro-a,a,a-trifluorotoluene,benzene, 1,2,3-trichloro-5-trifluoromethyl,pubchem19737,ksc914i9j,3,4,5-trichloro benzotrifluoride PubChem CID: 2733399 IUPAC Name: 1,2,3-trichloro-5-(trifluoromethyl)benzene SMILES: C1=C(C=C(C(=C1Cl)Cl)Cl)C(F)(F)F
| PubChem CID | 2733399 |
|---|---|
| CAS | 50594-82-6 |
| Molecular Weight (g/mol) | 249.438 |
| SMILES | C1=C(C=C(C(=C1Cl)Cl)Cl)C(F)(F)F |
| Synonym | 1,2,3-trichloro-5-trifluoromethyl benzene,3,4,5-trichlorobenzotrifluoride,3,4,5-trichlorotrifluoromethylbenzene,3,4,5-trichloro-alpha,alpha,alpha-trifluorotoluene,3,4,5-trichloro-a,a,a-trifluorotoluene,benzene, 1,2,3-trichloro-5-trifluoromethyl,pubchem19737,ksc914i9j,3,4,5-trichloro benzotrifluoride |
| IUPAC Name | 1,2,3-trichloro-5-(trifluoromethyl)benzene |
| InChI Key | FBKFIAIRSQOXJR-UHFFFAOYSA-N |
| Molecular Formula | C7H2Cl3F3 |
Ethyl 3,5-Dichloro-4-hydroxybenzoate 98.0+%, TCI America™
CAS: 17302-82-8 Molecular Formula: C9H8Cl2O3 Molecular Weight (g/mol): 235.06 MDL Number: MFCD00016420 InChI Key: WMKNGSJJEMFQOT-UHFFFAOYSA-N Synonym: 3,5-dichloro-4-hydroxybenzoic acid ethyl ester,benzoic acid, 3,5-dichloro-4-hydroxy-, ethyl ester,3,5-dichloro-4-hydroxy-benzoic acid ethyl ester,acmc-209e5q,3-10-00-00363 beilstein handbook reference,wln: qr bg fg dvo2,ethyl 3,5-dichloro-4-hydroxy-benzoate,ethyl 3,5-bis chloranyl-4-oxidanyl-benzoate,benzoic acid,5-dichloro-4-hydroxy-, ethyl ester PubChem CID: 28460 IUPAC Name: ethyl 3,5-dichloro-4-hydroxybenzoate SMILES: CCOC(=O)C1=CC(=C(C(=C1)Cl)O)Cl
| PubChem CID | 28460 |
|---|---|
| CAS | 17302-82-8 |
| Molecular Weight (g/mol) | 235.06 |
| MDL Number | MFCD00016420 |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)Cl)O)Cl |
| Synonym | 3,5-dichloro-4-hydroxybenzoic acid ethyl ester,benzoic acid, 3,5-dichloro-4-hydroxy-, ethyl ester,3,5-dichloro-4-hydroxy-benzoic acid ethyl ester,acmc-209e5q,3-10-00-00363 beilstein handbook reference,wln: qr bg fg dvo2,ethyl 3,5-dichloro-4-hydroxy-benzoate,ethyl 3,5-bis chloranyl-4-oxidanyl-benzoate,benzoic acid,5-dichloro-4-hydroxy-, ethyl ester |
| IUPAC Name | ethyl 3,5-dichloro-4-hydroxybenzoate |
| InChI Key | WMKNGSJJEMFQOT-UHFFFAOYSA-N |
| Molecular Formula | C9H8Cl2O3 |
Methyl 3,4-Dihydroxy-2-methylbenzoate 98.0+%, TCI America™
CAS: 740799-82-0 Molecular Formula: C9H10O4 Molecular Weight (g/mol): 182.18 MDL Number: MFCD16250128 InChI Key: ONNFZKHTMFVKNY-UHFFFAOYSA-N Synonym: 3,4-Dihydroxy-2-methylbenzoic Acid Methyl Ester PubChem CID: 59016598 IUPAC Name: methyl 3,4-dihydroxy-2-methylbenzoate SMILES: COC(=O)C1=C(C)C(O)=C(O)C=C1
| PubChem CID | 59016598 |
|---|---|
| CAS | 740799-82-0 |
| Molecular Weight (g/mol) | 182.18 |
| MDL Number | MFCD16250128 |
| SMILES | COC(=O)C1=C(C)C(O)=C(O)C=C1 |
| Synonym | 3,4-Dihydroxy-2-methylbenzoic Acid Methyl Ester |
| IUPAC Name | methyl 3,4-dihydroxy-2-methylbenzoate |
| InChI Key | ONNFZKHTMFVKNY-UHFFFAOYSA-N |
| Molecular Formula | C9H10O4 |