Carboxylic acids and derivatives
Aobchem 1-(2 3-Dihydro-1H-inden-4-yl)cyclobutanol | 95% | CAS 2299088-55-2 | C13H16O | 1g
1-(2 3-Dihydro-1H-inden-4-yl)cyclobutanol | 95% | CAS 2299088-55-2 | C13H16O | 1g
Aobchem 3-(2 4-Difluoro-3-methoxyphenyl)oxetan-3-ol | 95% | C10H10F2O3 | 250mg
3-(2 4-Difluoro-3-methoxyphenyl)oxetan-3-ol | 95% | C10H10F2O3 | 250mg
Aobchem 1-(2 6-Difluoro-4-methoxyphenyl)-1-butanone | 95% | CAS 1179207-51-2 | C11H12F2O2 | 1g
1-(2 6-Difluoro-4-methoxyphenyl)-1-butanone | 95% | CAS 1179207-51-2 | C11H12F2O2 | 1g
eMolecules 78191-00-1 | N-Methoxy- N-methylacetamide | Chem-Impex | MFCD00060098 | 103.121 | C4H9NO2 | 98.000 | CON(C)C(C)=O | 1kg | 386904118
N-Methoxy- N-methylacetamide | Chem-Impex | 78191-00-1 | MFCD00060098 | 103.121 | C4H9NO2 | 98.000 | CON(C)C(C)=O | 1kg | 386904118
Cambridge Isotope Laboratories N-ISOPROPYLACRYLAMIDE (ISOPROPYL-D7, 98%), 0.5 G
N-ISOPROPYLACRYLAMIDE (ISOPROPYL-D7, 98%), 0.5 G
eMolecules 63959-88-6 | tert-Butyl N-(trifluoroacetyl)glycinate | Synthonix - Stock227.183 | C8H12F3NO3 | 95.000 | CC(C)(C)OC(=O)CNC(=O)C(F)(F)F | 1g | 525910798
tert-Butyl N-(trifluoroacetyl)glycinate | Synthonix - Stock | 63959-88-6227.183 | C8H12F3NO3 | 95.000 | CC(C)(C)OC(=O)CNC(=O)C(F)(F)F | 1g | 525910798
eMolecules 124022-79-3 | N-(6-(2,2,2-TRIFLUOROACETAMIDO)HEXYL)ACRYLAMIDE | AstaTech | MFCD30471334 | 266.264 | C11H17F3N2O2 | 95.000 | FC(F)(F)C(=O)NCCCCCCNC(=O)C=C | 0.25g | 323608497
N-(6-(2,2,2-TRIFLUOROACETAMIDO)HEXYL)ACRYLAMIDE | AstaTech | 124022-79-3 | MFCD30471334 | 266.264 | C11H17F3N2O2 | 95.000 | FC(F)(F)C(=O)NCCCCCCNC(=O)C=C | 0.25g | 323608497
eMolecules 955397-70-3 | TERT-BUTYL 4-(2-AMINOPHENYL)-5,6-DIHYDROPYRIDINE-1(2H)-CARBOXYLATE | AstaTech | MFCD29038830 | 274.364 | C16H22N2O2 | 95.000 | CC(C)(C)OC(=O)N1CCC(=CC1)c1ccccc1N | 0.25g | 416218460
TERT-BUTYL 4-(2-AMINOPHENYL)-5,6-DIHYDROPYRIDINE-1(2H)-CARBOXYLATE | AstaTech | 955397-70-3 | MFCD29038830 | 274.364 | C16H22N2O2 | 95.000 | CC(C)(C)OC(=O)N1CCC(=CC1)c1ccccc1N | 0.25g | 416218460
Chemscene ChemScene | 5-Bromoindolin-2-one | 25G | CS-W002616 | 0.98 | 20870-78-4| MFCD00456998 | 212.046
ChemScene | 5-Bromoindolin-2-one | 25G | CS-W002616 | 0.98 | 20870-78-4| MFCD00456998 | 212.046
Accela Chembio Inc 2-oxindole | 100g | 59-48-3 | MFCD00005711 | 97+% | Shelf Life: 1260 Days | Light Sensitive/nitrogen Or Argon/+4
2-oxindole | 100g | 59-48-3 | MFCD00005711 | 97+% | Shelf Life: 1260 Days | Light Sensitive/nitrogen Or Argon/+4
eMolecules 99365-48-7 | ChemScene | 4-Bromooxindole | 1g | 536847327 | CS-W005098 | 212.046 | C8H6BrNO
ChemScene | 4-Bromooxindole | 1g | 536847327 | CS-W005098 | 99365-48-7 | 212.046 | C8H6BrNO
eMolecules 2306245-86-1 | (3R)-1-(2-chloroethyl)pyrrolidin-3-ol hydrochloride | 1g
ChemScene | 6-Methyl-3H-13-benzothiazol-2-one | 100mg | 569144678 | CS-0061341 | 53827-53-5 | MFCD08689970 | 165.210 | C8H7NOS
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 2576-29-6 | 2-((2-CHLOROETHYL)AMINO)ETHANOL HCL | MFCD28559188 | 1g
Ambeed | 2-Propylpyridine | 1g | 525068236 | A154912 | 622-39-9 | MFCD00006368 | 121.183 | C8H11N
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Enzo Life Sciences SU 9516 (5mg). CAS: 377090-84-1
Cell permeable, potent, selective and ATP-competitive inhibitor of CDK2/cyclin A (IC50=22nM), CDK1/cyclin B (IC50=40nM) and CDK4/cyclin D1 (IC50=200nM). Has no effect on the activity of PKC, p38, PDGFRβ and EGFR (IC50>10µM). Displays anti-proliferative and pro-apoptotic properties in tumor cells. Inhibits proliferation of growth factor-stimulated colon carcinoma cells by binding to CDK2 and thus preventing the phosphorylation of pRb and its dissociation from E2F. Alternative name: 3-[1-(3H-Imidazol-4-yl)-meth-(Z)-ylidene]-5-methoxy-1,3-dihydro-indol-2-one. Purity: ≥95% (HPLC). Solubility: Soluble in DMSO (10mg/ml). Long Term Storage: +4°C.
eMolecules 667-84-5 | Dl-pantothenyl ethyl ether | Combi-Blocks | MFCD03548274 | 233.308 | C11H23NO4 | 97.000 | CCOCCCNC(=O)C(O)C(C)(C)CO | 1g | 205387372
Dl-pantothenyl ethyl ether | Combi-Blocks | 667-84-5 | MFCD03548274 | 233.308 | C11H23NO4 | 97.000 | CCOCCCNC(=O)C(O)C(C)(C)CO | 1g | 205387372