Carboxylic acids and derivatives
Filtered Search Results
MilliporeSigma™ Dihydrorhodamine 123, Calbiochem™,
CAS: 109244-58-8 Molecular Formula: C21H18N2O3 Molecular Weight (g/mol): 346.39 MDL Number: MFCD04221428 InChI Key: FNEZBBILNYNQGC-UHFFFAOYSA-N Synonym: dihydrorhodamine 123,dihydrorhodamine,methyl 2-3,6-diamino-9h-xanthen-9-yl benzoate,benzoic acid, 2-3,6-diamino-9h-xanthen-9-yl-, methyl ester,dihydrorhodamine-123 PubChem CID: 105032 IUPAC Name: methyl 2-(3,6-diamino-9H-xanthen-9-yl)benzoate SMILES: COC(=O)C1=CC=CC=C1C1C2=CC=C(N)C=C2OC2=CC(N)=CC=C12
| PubChem CID | 105032 |
|---|---|
| CAS | 109244-58-8 |
| Molecular Weight (g/mol) | 346.39 |
| MDL Number | MFCD04221428 |
| SMILES | COC(=O)C1=CC=CC=C1C1C2=CC=C(N)C=C2OC2=CC(N)=CC=C12 |
| Synonym | dihydrorhodamine 123,dihydrorhodamine,methyl 2-3,6-diamino-9h-xanthen-9-yl benzoate,benzoic acid, 2-3,6-diamino-9h-xanthen-9-yl-, methyl ester,dihydrorhodamine-123 |
| IUPAC Name | methyl 2-(3,6-diamino-9H-xanthen-9-yl)benzoate |
| InChI Key | FNEZBBILNYNQGC-UHFFFAOYSA-N |
| Molecular Formula | C21H18N2O3 |
Methyl 4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate, 97%, Thermo Scientific™
CAS: 209912-44-7 Molecular Formula: C11H10N2O3 Molecular Weight (g/mol): 218.212 MDL Number: MFCD08690288 InChI Key: PJYMNVKGDLTDJE-UHFFFAOYSA-N Synonym: methyl 4-3-methyl-1,2,4-oxadiazol-5-yl benzoate,4-3-methyl-1,2,4-oxadiazole-5-yl benzoic acid methyl ester,benzoicacid, 4-3-methyl-1,2,4-oxadiazol-5-yl-, methyl ester PubChem CID: 11096067 IUPAC Name: methyl 4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate SMILES: CC1=NOC(=N1)C2=CC=C(C=C2)C(=O)OC
| PubChem CID | 11096067 |
|---|---|
| CAS | 209912-44-7 |
| Molecular Weight (g/mol) | 218.212 |
| MDL Number | MFCD08690288 |
| SMILES | CC1=NOC(=N1)C2=CC=C(C=C2)C(=O)OC |
| Synonym | methyl 4-3-methyl-1,2,4-oxadiazol-5-yl benzoate,4-3-methyl-1,2,4-oxadiazole-5-yl benzoic acid methyl ester,benzoicacid, 4-3-methyl-1,2,4-oxadiazol-5-yl-, methyl ester |
| IUPAC Name | methyl 4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate |
| InChI Key | PJYMNVKGDLTDJE-UHFFFAOYSA-N |
| Molecular Formula | C11H10N2O3 |
L(-)-Lactic acid, lithium salt, 99%, pure
CAS: 27848-80-2 Molecular Formula: C3H5O3Li Molecular Weight (g/mol): 96.01 MDL Number: MFCD00065512 InChI Key: GKQWYZBANWAFMQ-DKWTVANSSA-M Synonym: lithium s-2-hydroxypropanoate,l-lactic acid lithium salt,lithium l-lactate,s-2-hydroxypropionic acid lithium salt,sarcolactic acid lithium salt,lithium 1+ l-+-lactate,lithiuml-lactate,lithotab l-lactate,lactic acid lithium salt,c3h5o3.li PubChem CID: 23687877 IUPAC Name: lithium;(2S)-2-hydroxypropanoate SMILES: [Li+].CC(C(=O)[O-])O
| PubChem CID | 23687877 |
|---|---|
| CAS | 27848-80-2 |
| Molecular Weight (g/mol) | 96.01 |
| MDL Number | MFCD00065512 |
| SMILES | [Li+].CC(C(=O)[O-])O |
| Synonym | lithium s-2-hydroxypropanoate,l-lactic acid lithium salt,lithium l-lactate,s-2-hydroxypropionic acid lithium salt,sarcolactic acid lithium salt,lithium 1+ l-+-lactate,lithiuml-lactate,lithotab l-lactate,lactic acid lithium salt,c3h5o3.li |
| IUPAC Name | lithium;(2S)-2-hydroxypropanoate |
| InChI Key | GKQWYZBANWAFMQ-DKWTVANSSA-M |
| Molecular Formula | C3H5O3Li |
Trifluoroacetic acid, sodium salt, 97%
CAS: 2923-18-4 Molecular Formula: C2F3NaO2 Molecular Weight (g/mol): 136.01 MDL Number: MFCD00013217 InChI Key: UYCAUPASBSROMS-UHFFFAOYSA-M Synonym: sodium trifluoroacetate,trifluoroacetic acid sodium salt,acetic acid, trifluoro-, sodium salt,sodium perfluoroacetate,trifluoroacetate sodium,sodium 2,2,2-trifluoroacetate,trifluoroacetic acid sodium,trifluoroacetic acid,sodium salt,acetic acid, 2,2,2-trifluoro-, sodium salt 1:1,trifluoroacetic acid, sodium salt PubChem CID: 517019 IUPAC Name: sodium;2,2,2-trifluoroacetate SMILES: [Na+].[O-]C(=O)C(F)(F)F
| PubChem CID | 517019 |
|---|---|
| CAS | 2923-18-4 |
| Molecular Weight (g/mol) | 136.01 |
| MDL Number | MFCD00013217 |
| SMILES | [Na+].[O-]C(=O)C(F)(F)F |
| Synonym | sodium trifluoroacetate,trifluoroacetic acid sodium salt,acetic acid, trifluoro-, sodium salt,sodium perfluoroacetate,trifluoroacetate sodium,sodium 2,2,2-trifluoroacetate,trifluoroacetic acid sodium,trifluoroacetic acid,sodium salt,acetic acid, 2,2,2-trifluoro-, sodium salt 1:1,trifluoroacetic acid, sodium salt |
| IUPAC Name | sodium;2,2,2-trifluoroacetate |
| InChI Key | UYCAUPASBSROMS-UHFFFAOYSA-M |
| Molecular Formula | C2F3NaO2 |
methyl 2-[1-methyl-3-(trifluoromethyl)-1h-pyrazol-5-yl]benzoate, 90%, Thermo Scientific™
CAS: 898289-62-8 Molecular Formula: C13H11F3N2O2 Molecular Weight (g/mol): 284.238 MDL Number: MFCD09879929 InChI Key: VBXXEOGWKRJBBH-UHFFFAOYSA-N Synonym: methyl 2-1-methyl-3-trifluoromethyl-1h-pyrazol-5-yl benzoate,methyl 2-2-methyl-5-trifluoromethyl pyrazol-3-yl benzoate,2-2-methyl-5-trifluoromethyl-3-pyrazolyl benzoic acid methyl ester,5-2-methoxycarbonyl phenyl-1-methyl-3-trifluoromethyl-1h-pyrazole,benzoic acid,2-1-methyl-3-trifluoromethyl-1h-pyrazol-5-yl-, methyl ester PubChem CID: 24229663 IUPAC Name: methyl 2-[2-methyl-5-(trifluoromethyl)pyrazol-3-yl]benzoate SMILES: CN1C(=CC(=N1)C(F)(F)F)C2=CC=CC=C2C(=O)OC
| PubChem CID | 24229663 |
|---|---|
| CAS | 898289-62-8 |
| Molecular Weight (g/mol) | 284.238 |
| MDL Number | MFCD09879929 |
| SMILES | CN1C(=CC(=N1)C(F)(F)F)C2=CC=CC=C2C(=O)OC |
| Synonym | methyl 2-1-methyl-3-trifluoromethyl-1h-pyrazol-5-yl benzoate,methyl 2-2-methyl-5-trifluoromethyl pyrazol-3-yl benzoate,2-2-methyl-5-trifluoromethyl-3-pyrazolyl benzoic acid methyl ester,5-2-methoxycarbonyl phenyl-1-methyl-3-trifluoromethyl-1h-pyrazole,benzoic acid,2-1-methyl-3-trifluoromethyl-1h-pyrazol-5-yl-, methyl ester |
| IUPAC Name | methyl 2-[2-methyl-5-(trifluoromethyl)pyrazol-3-yl]benzoate |
| InChI Key | VBXXEOGWKRJBBH-UHFFFAOYSA-N |
| Molecular Formula | C13H11F3N2O2 |
Methyl methacrylate, 99%, stab.
CAS: 80-62-6 Molecular Formula: C5H8O2 MDL Number: MFCD00008587 InChI Key: VVQNEPGJFQJSBK-UHFFFAOYSA-N Synonym: methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate PubChem CID: 6658 ChEBI: CHEBI:34840 IUPAC Name: methyl 2-methylprop-2-enoate
| PubChem CID | 6658 |
|---|---|
| CAS | 80-62-6 |
| ChEBI | CHEBI:34840 |
| MDL Number | MFCD00008587 |
| Synonym | methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate |
| IUPAC Name | methyl 2-methylprop-2-enoate |
| InChI Key | VVQNEPGJFQJSBK-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
| Optical Rotation | [α]/D -28°C ± 2°C = 0.1 in. H218O |
|---|---|
| Percent Purity | ≥92% (HPLC) |
| Linear Formula | C10D3H14NO6 · xLi+ |
| CAS | 1803252-71-2 (Free Acid) |
| Flash Point | Not applicable |
| Grade | Analytical Standard |
| Recommended Storage | -20°C |
| Shelf Life | Limited shelf life, expiry date on the label |
| Molecular Formula | C10D3H14NO6 · xLi+ |
| Formula Weight | 250.26 (Free Acid Basis) |
2,2,2-Trifluoroethyl methacrylate, 99%, stabilized, Thermo Scientific Chemicals
CAS: 352-87-4 Molecular Formula: C6H7F3O2 Molecular Weight (g/mol): 168.12 MDL Number: MFCD00013576,MFCD00274739 InChI Key: QTKPMCIBUROOGY-UHFFFAOYSA-N Synonym: 2,2,2-trifluoroethyl methacrylate,trifluoroethyl methacrylate,methacrylic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethylmethacrylate,2-propenoic acid, 2-methyl-, 2,2,2-trifluoroethyl ester,2-methyl-acrylic acid 2,2,2-trifluoro-ethyl ester,2-propenoic acid, 2-methyl-, trifluoroethyl ester,2-methyl-2-propenoic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyl m,acmc-1af8z PubChem CID: 9608 IUPAC Name: 2,2,2-trifluoroethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(F)(F)F
| PubChem CID | 9608 |
|---|---|
| CAS | 352-87-4 |
| Molecular Weight (g/mol) | 168.12 |
| MDL Number | MFCD00013576,MFCD00274739 |
| SMILES | CC(=C)C(=O)OCC(F)(F)F |
| Synonym | 2,2,2-trifluoroethyl methacrylate,trifluoroethyl methacrylate,methacrylic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethylmethacrylate,2-propenoic acid, 2-methyl-, 2,2,2-trifluoroethyl ester,2-methyl-acrylic acid 2,2,2-trifluoro-ethyl ester,2-propenoic acid, 2-methyl-, trifluoroethyl ester,2-methyl-2-propenoic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyl m,acmc-1af8z |
| IUPAC Name | 2,2,2-trifluoroethyl 2-methylprop-2-enoate |
| InChI Key | QTKPMCIBUROOGY-UHFFFAOYSA-N |
| Molecular Formula | C6H7F3O2 |
Ethyl cinnamate, 98% trans
CAS: 103-36-6 Molecular Formula: C11H12O2 Molecular Weight (g/mol): 176.21 InChI Key: KBEBGUQPQBELIU-CMDGGOBGSA-N Synonym: ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate PubChem CID: 637758 ChEBI: CHEBI:4895 IUPAC Name: ethyl (E)-3-phenylprop-2-enoate SMILES: CCOC(=O)C=CC1=CC=CC=C1
| PubChem CID | 637758 |
|---|---|
| CAS | 103-36-6 |
| Molecular Weight (g/mol) | 176.21 |
| ChEBI | CHEBI:4895 |
| SMILES | CCOC(=O)C=CC1=CC=CC=C1 |
| Synonym | ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate |
| IUPAC Name | ethyl (E)-3-phenylprop-2-enoate |
| InChI Key | KBEBGUQPQBELIU-CMDGGOBGSA-N |
| Molecular Formula | C11H12O2 |
Tetraacetylethylenediamine, 90%
CAS: 10543-57-4 Molecular Formula: C10H16N2O4 Molecular Weight (g/mol): 228.25 MDL Number: MFCD00014967 InChI Key: BGRWYDHXPHLNKA-UHFFFAOYSA-N Synonym: tetraacetylethylenediamine,n,n,n',n'-tetraacetylethylenediamine,taed,tetracetylethylenediamine,acetamide, n,n'-1,2-ethanediylbis n-acetyl,n,n'-ethylenebis n-acetylacetamide,unii-p411ed0n2b,n,n'-ethane-1,2-diyl bis n-acetylacetamide,n-acetyl-n-2-diacetylamino ethyl acetamide PubChem CID: 66347 IUPAC Name: N-acetyl-N-[2-(diacetylamino)ethyl]acetamide SMILES: CC(=O)N(CCN(C(=O)C)C(=O)C)C(=O)C
| PubChem CID | 66347 |
|---|---|
| CAS | 10543-57-4 |
| Molecular Weight (g/mol) | 228.25 |
| MDL Number | MFCD00014967 |
| SMILES | CC(=O)N(CCN(C(=O)C)C(=O)C)C(=O)C |
| Synonym | tetraacetylethylenediamine,n,n,n',n'-tetraacetylethylenediamine,taed,tetracetylethylenediamine,acetamide, n,n'-1,2-ethanediylbis n-acetyl,n,n'-ethylenebis n-acetylacetamide,unii-p411ed0n2b,n,n'-ethane-1,2-diyl bis n-acetylacetamide,n-acetyl-n-2-diacetylamino ethyl acetamide |
| IUPAC Name | N-acetyl-N-[2-(diacetylamino)ethyl]acetamide |
| InChI Key | BGRWYDHXPHLNKA-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O4 |
Strontium oxalate, 95%, Thermo Scientific Chemicals
CAS: 814-95-9 Molecular Formula: C2O4Sr Molecular Weight (g/mol): 175.638 MDL Number: MFCD00050803 InChI Key: KQAGKTURZUKUCH-UHFFFAOYSA-L Synonym: strontium oxalate,unii-7iaw7e69ni,7iaw7e69ni,strontium oxalate, src2o4,ethanedioic acid, strontium salt 1:1,oxalic acid, monostrontium salt,strontium 2+ ion oxalate,oxalic acid, strontium salt 1:1 8ci PubChem CID: 69947 IUPAC Name: strontium;oxalate SMILES: C(=O)(C(=O)[O-])[O-].[Sr+2]
| PubChem CID | 69947 |
|---|---|
| CAS | 814-95-9 |
| Molecular Weight (g/mol) | 175.638 |
| MDL Number | MFCD00050803 |
| SMILES | C(=O)(C(=O)[O-])[O-].[Sr+2] |
| Synonym | strontium oxalate,unii-7iaw7e69ni,7iaw7e69ni,strontium oxalate, src2o4,ethanedioic acid, strontium salt 1:1,oxalic acid, monostrontium salt,strontium 2+ ion oxalate,oxalic acid, strontium salt 1:1 8ci |
| IUPAC Name | strontium;oxalate |
| InChI Key | KQAGKTURZUKUCH-UHFFFAOYSA-L |
| Molecular Formula | C2O4Sr |
Magnesium lactate trihydrate, 99%
CAS: 18917-96-9 Molecular Formula: C6H16MgO9 Molecular Weight (g/mol): 256.49 MDL Number: MFCD00156534 Synonym: magnesium lactate trihydrate,c6h10mgo6.3h2o,2-hydroxypropanoyl oxy magnesio 2-hydroxypropanoate trihydrate PubChem CID: 91668363 IUPAC Name: magnesium;2-hydroxypropanoate;trihydrate
| PubChem CID | 91668363 |
|---|---|
| CAS | 18917-96-9 |
| Molecular Weight (g/mol) | 256.49 |
| MDL Number | MFCD00156534 |
| Synonym | magnesium lactate trihydrate,c6h10mgo6.3h2o,2-hydroxypropanoyl oxy magnesio 2-hydroxypropanoate trihydrate |
| IUPAC Name | magnesium;2-hydroxypropanoate;trihydrate |
| Molecular Formula | C6H16MgO9 |
Methyl 4-cyanobenzoate, 99%
CAS: 1129-35-7 Molecular Formula: C9H7NO2 Molecular Weight (g/mol): 161.16 MDL Number: MFCD00001823 InChI Key: KKZMIDYKRKGJHG-UHFFFAOYSA-N Synonym: 4-cyanobenzoic acid methyl ester,benzoic acid, 4-cyano-, methyl ester,methyl p-cyanobenzoate,unii-f8fms7o8xg,f8fms7o8xg,benzoic acid, p-cyano-, methyl ester,4-cyano-benzoic acid methyl ester,methyl4-cyanobenzoate,methyl-4-cyanobenzoate,acmc-1bs5i PubChem CID: 70791 IUPAC Name: methyl 4-cyanobenzoate SMILES: COC(=O)C1=CC=C(C=C1)C#N
| PubChem CID | 70791 |
|---|---|
| CAS | 1129-35-7 |
| Molecular Weight (g/mol) | 161.16 |
| MDL Number | MFCD00001823 |
| SMILES | COC(=O)C1=CC=C(C=C1)C#N |
| Synonym | 4-cyanobenzoic acid methyl ester,benzoic acid, 4-cyano-, methyl ester,methyl p-cyanobenzoate,unii-f8fms7o8xg,f8fms7o8xg,benzoic acid, p-cyano-, methyl ester,4-cyano-benzoic acid methyl ester,methyl4-cyanobenzoate,methyl-4-cyanobenzoate,acmc-1bs5i |
| IUPAC Name | methyl 4-cyanobenzoate |
| InChI Key | KKZMIDYKRKGJHG-UHFFFAOYSA-N |
| Molecular Formula | C9H7NO2 |
1,5,5-Trimethylhydantoin, 98%
CAS: 6851-81-6 Molecular Formula: C6H10N2O2 Molecular Weight (g/mol): 142.158 MDL Number: MFCD00040439 InChI Key: ZNYIPTYJBRGSSL-UHFFFAOYSA-N Synonym: 1,5,5-trimethylhydantoin,3,4,4-trimethyl-2,5-dioxoimidazolidine,1,5,5-trimethyl-imidazolidine-2,4-dione,1,5,5-trimethyl-1,3-diazolidine-2,4-dione,hydantoin, 1,5,5-trimethyl,2,4-imidazolidinedione, 1,5,5-trimethyl,1,5,5 trimethylhydantoin,acmc-209o3u,1,5,5-trimethyl-hydantoin,1,5,5-trimethyl hydantoin PubChem CID: 81295 IUPAC Name: 1,5,5-trimethylimidazolidine-2,4-dione SMILES: CC1(C(=O)NC(=O)N1C)C
| PubChem CID | 81295 |
|---|---|
| CAS | 6851-81-6 |
| Molecular Weight (g/mol) | 142.158 |
| MDL Number | MFCD00040439 |
| SMILES | CC1(C(=O)NC(=O)N1C)C |
| Synonym | 1,5,5-trimethylhydantoin,3,4,4-trimethyl-2,5-dioxoimidazolidine,1,5,5-trimethyl-imidazolidine-2,4-dione,1,5,5-trimethyl-1,3-diazolidine-2,4-dione,hydantoin, 1,5,5-trimethyl,2,4-imidazolidinedione, 1,5,5-trimethyl,1,5,5 trimethylhydantoin,acmc-209o3u,1,5,5-trimethyl-hydantoin,1,5,5-trimethyl hydantoin |
| IUPAC Name | 1,5,5-trimethylimidazolidine-2,4-dione |
| InChI Key | ZNYIPTYJBRGSSL-UHFFFAOYSA-N |
| Molecular Formula | C6H10N2O2 |
Mono-methyl phthalate, 98%
CAS: 4376-18-5 Molecular Formula: C9H8O4 Molecular Weight (g/mol): 180.16 MDL Number: MFCD00002466 InChI Key: FNJSWIPFHMKRAT-UHFFFAOYSA-N Synonym: 2-methoxycarbonyl benzoic acid,methyl hydrogen phthalate,monomethyl phthalate,mono-methyl phthalate,phthalic acid monomethyl ester,o-methoxycarbonyl benzoic acid,monomethyl 1,2-benzenedicarboxylate,phthalic acid, monomethyl ester,monomethylphthalate,unii-2stt6d18jr PubChem CID: 20392 IUPAC Name: 2-methoxycarbonylbenzoic acid SMILES: COC(=O)C1=CC=CC=C1C(O)=O
| PubChem CID | 20392 |
|---|---|
| CAS | 4376-18-5 |
| Molecular Weight (g/mol) | 180.16 |
| MDL Number | MFCD00002466 |
| SMILES | COC(=O)C1=CC=CC=C1C(O)=O |
| Synonym | 2-methoxycarbonyl benzoic acid,methyl hydrogen phthalate,monomethyl phthalate,mono-methyl phthalate,phthalic acid monomethyl ester,o-methoxycarbonyl benzoic acid,monomethyl 1,2-benzenedicarboxylate,phthalic acid, monomethyl ester,monomethylphthalate,unii-2stt6d18jr |
| IUPAC Name | 2-methoxycarbonylbenzoic acid |
| InChI Key | FNJSWIPFHMKRAT-UHFFFAOYSA-N |
| Molecular Formula | C9H8O4 |