Carboxylic acids and derivatives
Filtered Search Results
1-Naphthylacetic acid, 95%
CAS: 86-87-3 Molecular Formula: C12H10O2 Molecular Weight (g/mol): 186.21 MDL Number: MFCD00004046 InChI Key: PRPINYUDVPFIRX-UHFFFAOYSA-N Synonym: 1-naphthylacetic acid,1-naphthaleneacetic acid,2-naphthalen-1-yl acetic acid,naphthalene-1-acetic acid,transplantone,phyomone,planofix,1-naphthalene acetic acid,fruitone n,stop-drop PubChem CID: 6862 ChEBI: CHEBI:32918 IUPAC Name: 2-naphthalen-1-ylacetic acid SMILES: OC(=O)CC1=C2C=CC=CC2=CC=C1
| PubChem CID | 6862 |
|---|---|
| CAS | 86-87-3 |
| Molecular Weight (g/mol) | 186.21 |
| ChEBI | CHEBI:32918 |
| MDL Number | MFCD00004046 |
| SMILES | OC(=O)CC1=C2C=CC=CC2=CC=C1 |
| Synonym | 1-naphthylacetic acid,1-naphthaleneacetic acid,2-naphthalen-1-yl acetic acid,naphthalene-1-acetic acid,transplantone,phyomone,planofix,1-naphthalene acetic acid,fruitone n,stop-drop |
| IUPAC Name | 2-naphthalen-1-ylacetic acid |
| InChI Key | PRPINYUDVPFIRX-UHFFFAOYSA-N |
| Molecular Formula | C12H10O2 |
3,3-Dimethylbutyric acid, 98%
CAS: 1070-83-3 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00002715 InChI Key: MLMQPDHYNJCQAO-UHFFFAOYSA-N Synonym: 3,3-dimethylbutyric acid,tert-butylacetic acid,t-butylacetic acid,butanoic acid, 3,3-dimethyl,3,3-dimethyl-butanoic acid,unii-q80k0tzq55,butyric acid, 3,3-dimethyl,3,3-dimethyl-butyric acid,3,3-dimethyl-n-butyric acid,tert-butyric acid PubChem CID: 14057 ChEBI: CHEBI:38647 IUPAC Name: 3,3-dimethylbutanoic acid SMILES: CC(C)(C)CC(=O)O
| PubChem CID | 14057 |
|---|---|
| CAS | 1070-83-3 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:38647 |
| MDL Number | MFCD00002715 |
| SMILES | CC(C)(C)CC(=O)O |
| Synonym | 3,3-dimethylbutyric acid,tert-butylacetic acid,t-butylacetic acid,butanoic acid, 3,3-dimethyl,3,3-dimethyl-butanoic acid,unii-q80k0tzq55,butyric acid, 3,3-dimethyl,3,3-dimethyl-butyric acid,3,3-dimethyl-n-butyric acid,tert-butyric acid |
| IUPAC Name | 3,3-dimethylbutanoic acid |
| InChI Key | MLMQPDHYNJCQAO-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Cesium acetate, 97%, pure
CAS: 3396-11-0 Molecular Formula: C2H3CsO2 Molecular Weight (g/mol): 191.96 MDL Number: MFCD00013056 InChI Key: ZOAIGCHJWKDIPJ-UHFFFAOYSA-M Synonym: cesium acetate,acetic acid, cesium salt,caesium acetate,acetic acid, cesium salt 1:1,acetic acid, cesiumsalt,acetic acid cesium salt,caesium 1+ ion acetate,cesiumacetate,acetic acid cesium,caesium 1+ acetate ion PubChem CID: 5152919 IUPAC Name: cesium;acetate SMILES: CC(=O)[O-].[Cs+]
| PubChem CID | 5152919 |
|---|---|
| CAS | 3396-11-0 |
| Molecular Weight (g/mol) | 191.96 |
| MDL Number | MFCD00013056 |
| SMILES | CC(=O)[O-].[Cs+] |
| Synonym | cesium acetate,acetic acid, cesium salt,caesium acetate,acetic acid, cesium salt 1:1,acetic acid, cesiumsalt,acetic acid cesium salt,caesium 1+ ion acetate,cesiumacetate,acetic acid cesium,caesium 1+ acetate ion |
| IUPAC Name | cesium;acetate |
| InChI Key | ZOAIGCHJWKDIPJ-UHFFFAOYSA-M |
| Molecular Formula | C2H3CsO2 |
TraceCERT™ Extractables And Leachables Screening Standard for LC, Certified Reference Material, MilliporeSigma™ Supelco™
This certified reference material (CRM) is produced and certified in accordance with ISO/IEC 17025 and ISO 17034. This CRM is traceable to the SI through a primary reference material from a NMI. Certified content incl. uncertainty and expiry date are stated on the enclosed certificate.
| Health Hazard 1 | H225 - H302 + H312 + H332 - H319 |
|---|---|
| UN Number | UN 1648 3/PGII |
| Grade | Trace CERT |
| Recommended Storage | -20°C |
| Shelf Life | Limited shelf life, expiry date on the label |
2-Furoic acid hydrazide, 98%
CAS: 3326-71-4 MDL Number: MFCD00003235 InChI Key: SKTSVWWOAIAIKI-UHFFFAOYSA-N Synonym: 2-furoic acid hydrazide,2-furoic hydrazide,2-furohydrazide,furoylhydrazide,2-furancarbohydrazide,2-furoylhydrazide,furoic acid, hydrazide,2-furoic acid, hydrazide,2-furoylhydrazine,2-furylcarbonylhydrazide PubChem CID: 18731 IUPAC Name: furan-2-carbohydrazide SMILES: C1=COC(=C1)C(=O)NN
| PubChem CID | 18731 |
|---|---|
| CAS | 3326-71-4 |
| MDL Number | MFCD00003235 |
| SMILES | C1=COC(=C1)C(=O)NN |
| Synonym | 2-furoic acid hydrazide,2-furoic hydrazide,2-furohydrazide,furoylhydrazide,2-furancarbohydrazide,2-furoylhydrazide,furoic acid, hydrazide,2-furoic acid, hydrazide,2-furoylhydrazine,2-furylcarbonylhydrazide |
| IUPAC Name | furan-2-carbohydrazide |
| InChI Key | SKTSVWWOAIAIKI-UHFFFAOYSA-N |
(Ethylenedinitrilo)Tetraacetic Acid, Disodium Salt, Dihydrate, AR, For ACS analysis, Macron Fine Chemicals™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Ethyl 2-cyano-2-methylpropionate, 97%
CAS: 1572-98-1 Molecular Formula: C7H11NO2 Molecular Weight (g/mol): 141.17 MDL Number: MFCD00034667 InChI Key: FYGRPGOHQCPZCV-UHFFFAOYSA-N PubChem CID: 344887 IUPAC Name: ethyl 2-cyano-2-methylpropanoate SMILES: CCOC(=O)C(C)(C)C#N
| PubChem CID | 344887 |
|---|---|
| CAS | 1572-98-1 |
| Molecular Weight (g/mol) | 141.17 |
| MDL Number | MFCD00034667 |
| SMILES | CCOC(=O)C(C)(C)C#N |
| IUPAC Name | ethyl 2-cyano-2-methylpropanoate |
| InChI Key | FYGRPGOHQCPZCV-UHFFFAOYSA-N |
| Molecular Formula | C7H11NO2 |
Ethyl tetradecanoate, 98%
CAS: 124-06-1 Molecular Formula: C16H32O2 Molecular Weight (g/mol): 256.43 MDL Number: MFCD00008984 InChI Key: MMKRHZKQPFCLLS-UHFFFAOYSA-N Synonym: ethyl myristate,tetradecanoic acid, ethyl ester,myristic acid ethyl ester,myristic acid, ethyl ester,ethylmyristate,ethyl n-tetradecanoate,ethyl myristate natural,fema no. 2445,tetradecanoic acid ethyl ester,ethyl ester tetradecanoic acid PubChem CID: 31283 ChEBI: CHEBI:84849 IUPAC Name: ethyl tetradecanoate SMILES: CCCCCCCCCCCCCC(=O)OCC
| PubChem CID | 31283 |
|---|---|
| CAS | 124-06-1 |
| Molecular Weight (g/mol) | 256.43 |
| ChEBI | CHEBI:84849 |
| MDL Number | MFCD00008984 |
| SMILES | CCCCCCCCCCCCCC(=O)OCC |
| Synonym | ethyl myristate,tetradecanoic acid, ethyl ester,myristic acid ethyl ester,myristic acid, ethyl ester,ethylmyristate,ethyl n-tetradecanoate,ethyl myristate natural,fema no. 2445,tetradecanoic acid ethyl ester,ethyl ester tetradecanoic acid |
| IUPAC Name | ethyl tetradecanoate |
| InChI Key | MMKRHZKQPFCLLS-UHFFFAOYSA-N |
| Molecular Formula | C16H32O2 |
N-Acetylethylenediamine, tech. 90%
CAS: 1001-53-2 Molecular Formula: C4H10N2O Molecular Weight (g/mol): 102.137 MDL Number: MFCD00008163 InChI Key: DAKZISABEDGGSV-UHFFFAOYSA-N Synonym: n-2-aminoethyl acetamide,n-acetylethylenediamine,acetamide, n-2-aminoethyl,n-2-amino-ethyl-acetamide,unii-fql33v3kzd,fql33v3kzd,acetylethylenediamine,2-acetamidoethylamine,acetylethylene diamine,n-acetylethylendiamine PubChem CID: 66082 IUPAC Name: N-(2-aminoethyl)acetamide SMILES: CC(=O)NCCN
| PubChem CID | 66082 |
|---|---|
| CAS | 1001-53-2 |
| Molecular Weight (g/mol) | 102.137 |
| MDL Number | MFCD00008163 |
| SMILES | CC(=O)NCCN |
| Synonym | n-2-aminoethyl acetamide,n-acetylethylenediamine,acetamide, n-2-aminoethyl,n-2-amino-ethyl-acetamide,unii-fql33v3kzd,fql33v3kzd,acetylethylenediamine,2-acetamidoethylamine,acetylethylene diamine,n-acetylethylendiamine |
| IUPAC Name | N-(2-aminoethyl)acetamide |
| InChI Key | DAKZISABEDGGSV-UHFFFAOYSA-N |
| Molecular Formula | C4H10N2O |
3-(1-Naphthyl)propionic acid, 96%
CAS: 3243-42-3 Molecular Formula: C13H12O2 Molecular Weight (g/mol): 200.24 MDL Number: MFCD00033058 InChI Key: PRLKVVMRQFFIOQ-UHFFFAOYSA-N Synonym: 3-1-naphthyl propionic acid,3-naphthalen-1-yl propanoic acid,1-naphthalenepropanoic acid,1-naphthalenepropionic acid,3-1-naphthyl-propionic acid,3-1-naphthyl propanoic acid,3-naphth-1-yl propanoic acid,3-naphthalen-1-yl-propionic acid,1-naphthalenepropanoicacid,3-naphthylpropanoic acid PubChem CID: 95254 IUPAC Name: 3-naphthalen-1-ylpropanoic acid SMILES: OC(=O)CCC1=C2C=CC=CC2=CC=C1
| PubChem CID | 95254 |
|---|---|
| CAS | 3243-42-3 |
| Molecular Weight (g/mol) | 200.24 |
| MDL Number | MFCD00033058 |
| SMILES | OC(=O)CCC1=C2C=CC=CC2=CC=C1 |
| Synonym | 3-1-naphthyl propionic acid,3-naphthalen-1-yl propanoic acid,1-naphthalenepropanoic acid,1-naphthalenepropionic acid,3-1-naphthyl-propionic acid,3-1-naphthyl propanoic acid,3-naphth-1-yl propanoic acid,3-naphthalen-1-yl-propionic acid,1-naphthalenepropanoicacid,3-naphthylpropanoic acid |
| IUPAC Name | 3-naphthalen-1-ylpropanoic acid |
| InChI Key | PRLKVVMRQFFIOQ-UHFFFAOYSA-N |
| Molecular Formula | C13H12O2 |
Isopropyl Acetate, Certified Reference Material, MilliporeSigma™ Supelco™
Pharmaceutical secondary standards for applications in quality control. Provides pharma laboratories and manufacturers with a convenient, cost-effective alternative to the preparation of in-house working standards.
| Boiling Point | 85°C to 91°C (literature) |
|---|---|
| Linear Formula | CH3COOCH(CH3)2 |
| Grade | Certified Reference Material |
| Vapor Pressure | 47 mmHg (20°C) |
| Vapor Density | 3.5 (vs air) |
| CAS | 108-21-4 |
| MDL Number | MFCD00008877 |
| Flash Point | 4°C (Not applicable) |
| Health Hazard 1 | H225 - H319 - H336 |
| Refractive Index | n20/D 1.377 (literature) |
| Synonym | Isopropyl Acetate; Acetic Acid Isopropyl Ester |
| Molecular Formula | C5H10O2 |
| Formula Weight | 102.13 |
| Melting Point | -73°C (literature) |
1,2,3,5-Tetra-O-benzoyl-2-C-methyl-beta-D-ribofuranose, 98%, Thermo Scientific Chemicals
CAS: 15397-15-6 Molecular Formula: C34H28O9 Molecular Weight (g/mol): 580.589 MDL Number: MFCD07369658 InChI Key: QJZSLTLDMBDKOU-VBHQRPIPSA-N Synonym: 1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-b-d-ribofuranose,2s,3r,4r,5r-5-benzoyloxy methyl-3-methyltetrahydrofuran-2,3,4-triyl tribenzoate,2s,3r,4r,5r-2,4-bis benzoyloxy-5-benzoyloxy methyl-3-methyloxolan-3-yl benzoate,1,2,3,5-tetra-o-benzoyl-2'-c-methyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d ribofuranose,2-c-methyl-beta-d-ribofuranose 1,2,3,5-tetrabenzoate,2-c-methyl-1,2,3,5-tetra-o-benzoyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d-ribofura PubChem CID: 10875560 IUPAC Name: [(2R,3R,4R,5S)-3,4,5-tribenzoyloxy-4-methyloxolan-2-yl]methyl benzoate SMILES: CC1(C(C(OC1OC(=O)C2=CC=CC=C2)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5
| PubChem CID | 10875560 |
|---|---|
| CAS | 15397-15-6 |
| Molecular Weight (g/mol) | 580.589 |
| MDL Number | MFCD07369658 |
| SMILES | CC1(C(C(OC1OC(=O)C2=CC=CC=C2)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |
| Synonym | 1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-b-d-ribofuranose,2s,3r,4r,5r-5-benzoyloxy methyl-3-methyltetrahydrofuran-2,3,4-triyl tribenzoate,2s,3r,4r,5r-2,4-bis benzoyloxy-5-benzoyloxy methyl-3-methyloxolan-3-yl benzoate,1,2,3,5-tetra-o-benzoyl-2'-c-methyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d ribofuranose,2-c-methyl-beta-d-ribofuranose 1,2,3,5-tetrabenzoate,2-c-methyl-1,2,3,5-tetra-o-benzoyl-beta-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-d-ribofuranose,1,2,3,5-tetra-o-benzoyl-2-c-methyl-beta-d-ribofura |
| IUPAC Name | [(2R,3R,4R,5S)-3,4,5-tribenzoyloxy-4-methyloxolan-2-yl]methyl benzoate |
| InChI Key | QJZSLTLDMBDKOU-VBHQRPIPSA-N |
| Molecular Formula | C34H28O9 |
3-(4-Fluorophenyl)propionic acid, 97%
CAS: 459-31-4 Molecular Formula: C9H9FO2 Molecular Weight (g/mol): 168.167 MDL Number: MFCD00060327 InChI Key: ZMKXWDPUXLPHCA-UHFFFAOYSA-N Synonym: 3-4-fluorophenyl propionic acid,3-4-fluorophenyl propanoic acid,benzenepropanoic acid, 4-fluoro,3-4-fluoro-phenyl-propionic acid,3-4-fluorophenyl propionicacid,3-4'-fluorophenyl propanoic acid,acmc-1aehu,4-fluorohydrocinnamic acid,4-fluorophenylpropionic acid,4-fluorobenzenepropanoic acid PubChem CID: 136302 IUPAC Name: 3-(4-fluorophenyl)propanoic acid SMILES: C1=CC(=CC=C1CCC(=O)O)F
| PubChem CID | 136302 |
|---|---|
| CAS | 459-31-4 |
| Molecular Weight (g/mol) | 168.167 |
| MDL Number | MFCD00060327 |
| SMILES | C1=CC(=CC=C1CCC(=O)O)F |
| Synonym | 3-4-fluorophenyl propionic acid,3-4-fluorophenyl propanoic acid,benzenepropanoic acid, 4-fluoro,3-4-fluoro-phenyl-propionic acid,3-4-fluorophenyl propionicacid,3-4'-fluorophenyl propanoic acid,acmc-1aehu,4-fluorohydrocinnamic acid,4-fluorophenylpropionic acid,4-fluorobenzenepropanoic acid |
| IUPAC Name | 3-(4-fluorophenyl)propanoic acid |
| InChI Key | ZMKXWDPUXLPHCA-UHFFFAOYSA-N |
| Molecular Formula | C9H9FO2 |
Methyl 2,6-dichlorophenylacetate, 99%
CAS: 54551-83-6 Molecular Formula: C9H8Cl2O2 Molecular Weight (g/mol): 219.07 MDL Number: MFCD00191640 InChI Key: FCWRUYPZZJPCCG-UHFFFAOYSA-N Synonym: methyl 2,6-dichlorophenylacetate,methyl 2-2,6-dichlorophenyl acetate,2,6-dichlorophenylacetic acid methyl ester,benzeneacetic acid,2,6-dichloro-, methyl ester,benzeneacetic acid, 2,6-dichloro-, methyl ester,acmc-209lhf,methyl2,6-dichlorophenylacetate,guanfacine methyl ester impurity,methyl 2,6-dichlorophenyl acetate,2,6-dichloro-phenylacetic acid methyl ester PubChem CID: 2734107 IUPAC Name: methyl 2-(2,6-dichlorophenyl)acetate SMILES: COC(=O)CC1=C(C=CC=C1Cl)Cl
| PubChem CID | 2734107 |
|---|---|
| CAS | 54551-83-6 |
| Molecular Weight (g/mol) | 219.07 |
| MDL Number | MFCD00191640 |
| SMILES | COC(=O)CC1=C(C=CC=C1Cl)Cl |
| Synonym | methyl 2,6-dichlorophenylacetate,methyl 2-2,6-dichlorophenyl acetate,2,6-dichlorophenylacetic acid methyl ester,benzeneacetic acid,2,6-dichloro-, methyl ester,benzeneacetic acid, 2,6-dichloro-, methyl ester,acmc-209lhf,methyl2,6-dichlorophenylacetate,guanfacine methyl ester impurity,methyl 2,6-dichlorophenyl acetate,2,6-dichloro-phenylacetic acid methyl ester |
| IUPAC Name | methyl 2-(2,6-dichlorophenyl)acetate |
| InChI Key | FCWRUYPZZJPCCG-UHFFFAOYSA-N |
| Molecular Formula | C9H8Cl2O2 |
2-Keto-D-gluconic acid, hemicalcium salt monohydrate, >98%, MP Biomedicals™
CAS: 3470-37-9 Molecular Formula: C12H20CaO14 Molecular Weight (g/mol): 428.356 MDL Number: MFCD00149104 InChI Key: QACANIDDQFGAJU-JQTJLMCZSA-N Synonym: calcium 2-keto-d-gluconate PubChem CID: 131852723 IUPAC Name: calcium;(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid SMILES: C(C(C(C(C(=O)C(=O)O)O)O)O)O.C(C(C(C(C(=O)C(=O)O)O)O)O)O.[Ca]
| PubChem CID | 131852723 |
|---|---|
| CAS | 3470-37-9 |
| Molecular Weight (g/mol) | 428.356 |
| MDL Number | MFCD00149104 |
| SMILES | C(C(C(C(C(=O)C(=O)O)O)O)O)O.C(C(C(C(C(=O)C(=O)O)O)O)O)O.[Ca] |
| Synonym | calcium 2-keto-d-gluconate |
| IUPAC Name | calcium;(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid |
| InChI Key | QACANIDDQFGAJU-JQTJLMCZSA-N |
| Molecular Formula | C12H20CaO14 |