Carboxylic acids and derivatives
Filtered Search Results
Ethylenediaminetetraacetic acid, iron(III) monosodium salt
CAS: 15708-41-5 Molecular Formula: C10H12FeN2NaO8 Molecular Weight (g/mol): 367.047 MDL Number: MFCD00078215 InChI Key: MKWYFZFMAMBPQK-UHFFFAOYSA-J Synonym: sodium feredetate,edta ferric sodium salt,calmosine,sodium ironedetate,edta iron iii sodium salt,ferisan,sytron,sequestrene nafe,sodium iron edta,ferric sodium edta PubChem CID: 27461 ChEBI: CHEBI:78292 IUPAC Name: sodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+) SMILES: C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Fe+3]
| PubChem CID | 27461 |
|---|---|
| CAS | 15708-41-5 |
| Molecular Weight (g/mol) | 367.047 |
| ChEBI | CHEBI:78292 |
| MDL Number | MFCD00078215 |
| SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Fe+3] |
| Synonym | sodium feredetate,edta ferric sodium salt,calmosine,sodium ironedetate,edta iron iii sodium salt,ferisan,sytron,sequestrene nafe,sodium iron edta,ferric sodium edta |
| IUPAC Name | sodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+) |
| InChI Key | MKWYFZFMAMBPQK-UHFFFAOYSA-J |
| Molecular Formula | C10H12FeN2NaO8 |
Ethylene glycol-O,O'-bis(2-aminoethyl)-N,N,N',N'-tetraacetic acid, 97%
CAS: 67-42-5 Molecular Formula: C14H24N2O10 Molecular Weight (g/mol): 380.35 MDL Number: MFCD00004291 InChI Key: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC Name: 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
| PubChem CID | 6207 |
|---|---|
| CAS | 67-42-5 |
| Molecular Weight (g/mol) | 380.35 |
| ChEBI | CHEBI:30740 |
| MDL Number | MFCD00004291 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Molecular Formula | C14H24N2O10 |
DL-Isocitric acid, trisodium salt hydrate, 95%
CAS: 1637-73-6 Molecular Formula: C6H5Na3O7 Molecular Weight (g/mol): 258.07 MDL Number: MFCD00149284 InChI Key: HWMVXEKEEAIYGB-UHFFFAOYNA-K Synonym: dl-isocitric acid,isocitric acid trisodium salt,sodium isocitrate,dl-isocitric acid trisodium salt hydrate,dl-isocitric acid trisodium salt,trisodium 1-hydroxypropane-1,2,3-tricarboxylate,trisodium isocitrate,tripotassium isocitrate,isocitric acid, dl,dl-isocitric acid, trisodium salt hydrate PubChem CID: 168942 IUPAC Name: trisodium;1-hydroxypropane-1,2,3-tricarboxylate SMILES: [Na+].[Na+].[Na+].OC(C(CC([O-])=O)C([O-])=O)C([O-])=O
| PubChem CID | 168942 |
|---|---|
| CAS | 1637-73-6 |
| Molecular Weight (g/mol) | 258.07 |
| MDL Number | MFCD00149284 |
| SMILES | [Na+].[Na+].[Na+].OC(C(CC([O-])=O)C([O-])=O)C([O-])=O |
| Synonym | dl-isocitric acid,isocitric acid trisodium salt,sodium isocitrate,dl-isocitric acid trisodium salt hydrate,dl-isocitric acid trisodium salt,trisodium 1-hydroxypropane-1,2,3-tricarboxylate,trisodium isocitrate,tripotassium isocitrate,isocitric acid, dl,dl-isocitric acid, trisodium salt hydrate |
| IUPAC Name | trisodium;1-hydroxypropane-1,2,3-tricarboxylate |
| InChI Key | HWMVXEKEEAIYGB-UHFFFAOYNA-K |
| Molecular Formula | C6H5Na3O7 |
Lithium L-lactate, 97%
CAS: 27848-80-2 Molecular Formula: C3H5LiO3 Molecular Weight (g/mol): 96.01 MDL Number: MFCD00065399 InChI Key: GKQWYZBANWAFMQ-DKWTVANSSA-M Synonym: lithium s-2-hydroxypropanoate,l-lactic acid lithium salt,lithium l-lactate,s-2-hydroxypropionic acid lithium salt,sarcolactic acid lithium salt,lithium 1+ l-+-lactate,lithiuml-lactate,lithotab l-lactate,lactic acid lithium salt,c3h5o3.li PubChem CID: 23687877 IUPAC Name: lithium;(2S)-2-hydroxypropanoate SMILES: [Li+].CC(C(=O)[O-])O
| PubChem CID | 23687877 |
|---|---|
| CAS | 27848-80-2 |
| Molecular Weight (g/mol) | 96.01 |
| MDL Number | MFCD00065399 |
| SMILES | [Li+].CC(C(=O)[O-])O |
| Synonym | lithium s-2-hydroxypropanoate,l-lactic acid lithium salt,lithium l-lactate,s-2-hydroxypropionic acid lithium salt,sarcolactic acid lithium salt,lithium 1+ l-+-lactate,lithiuml-lactate,lithotab l-lactate,lactic acid lithium salt,c3h5o3.li |
| IUPAC Name | lithium;(2S)-2-hydroxypropanoate |
| InChI Key | GKQWYZBANWAFMQ-DKWTVANSSA-M |
| Molecular Formula | C3H5LiO3 |
Pentaerythritol triacrylate, stab. with 4-methoxyphenol
CAS: 3524-68-3 Molecular Formula: C14H18O7 Molecular Weight (g/mol): 298.291 MDL Number: MFCD00009607 InChI Key: HVVWZTWDBSEWIH-UHFFFAOYSA-N Synonym: pentaerythritol triacrylate,peta,pentaerythrityl triacrylate,gafgard 233,kayarad pet 30,sartomer sr 444,aronix m 305,setalux uv 2242,light acrylate pe 3a,p 300 acrylate PubChem CID: 19042 IUPAC Name: [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate SMILES: C=CC(=O)OCC(CO)(COC(=O)C=C)COC(=O)C=C
| PubChem CID | 19042 |
|---|---|
| CAS | 3524-68-3 |
| Molecular Weight (g/mol) | 298.291 |
| MDL Number | MFCD00009607 |
| SMILES | C=CC(=O)OCC(CO)(COC(=O)C=C)COC(=O)C=C |
| Synonym | pentaerythritol triacrylate,peta,pentaerythrityl triacrylate,gafgard 233,kayarad pet 30,sartomer sr 444,aronix m 305,setalux uv 2242,light acrylate pe 3a,p 300 acrylate |
| IUPAC Name | [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate |
| InChI Key | HVVWZTWDBSEWIH-UHFFFAOYSA-N |
| Molecular Formula | C14H18O7 |
Sodium formate, ACS, 99.0% min
CAS: 141-53-7 Molecular Formula: CHNaO2 Molecular Weight (g/mol): 68.007 MDL Number: MFCD00013101 InChI Key: HLBBKKJFGFRGMU-UHFFFAOYSA-M Synonym: sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 PubChem CID: 2723810 ChEBI: CHEBI:62965 IUPAC Name: sodium;formate SMILES: C(=O)[O-].[Na+]
| PubChem CID | 2723810 |
|---|---|
| CAS | 141-53-7 |
| Molecular Weight (g/mol) | 68.007 |
| ChEBI | CHEBI:62965 |
| MDL Number | MFCD00013101 |
| SMILES | C(=O)[O-].[Na+] |
| Synonym | sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 |
| IUPAC Name | sodium;formate |
| InChI Key | HLBBKKJFGFRGMU-UHFFFAOYSA-M |
| Molecular Formula | CHNaO2 |
2-Hydroxyethyl methacrylate, 97%, stabilized
CAS: 868-77-9 Molecular Formula: C6H10O3 Molecular Weight (g/mol): 130.14 MDL Number: MFCD00002863 InChI Key: WOBHKFSMXKNTIM-UHFFFAOYSA-N Synonym: 2-hydroxyethyl methacrylate,glycol methacrylate,hydroxyethyl methacrylate,glycol monomethacrylate,hema,ethylene glycol methacrylate,2-methacryloyloxy ethanol,2-hydroxyethylmethacrylate,mhoromer,monomer mg-1 PubChem CID: 13360 ChEBI: CHEBI:34288 IUPAC Name: 2-hydroxyethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCCO
| PubChem CID | 13360 |
|---|---|
| CAS | 868-77-9 |
| Molecular Weight (g/mol) | 130.14 |
| ChEBI | CHEBI:34288 |
| MDL Number | MFCD00002863 |
| SMILES | CC(=C)C(=O)OCCO |
| Synonym | 2-hydroxyethyl methacrylate,glycol methacrylate,hydroxyethyl methacrylate,glycol monomethacrylate,hema,ethylene glycol methacrylate,2-methacryloyloxy ethanol,2-hydroxyethylmethacrylate,mhoromer,monomer mg-1 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate |
| InChI Key | WOBHKFSMXKNTIM-UHFFFAOYSA-N |
| Molecular Formula | C6H10O3 |
N,N-Dimethylformamide, ACS, 99.8+%
CAS: 68-12-2 Molecular Formula: C3H7NO Molecular Weight (g/mol): 73.10 MDL Number: MFCD00003284 InChI Key: ZMXDDKWLCZADIW-UHFFFAOYSA-N Synonym: dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa PubChem CID: 6228 ChEBI: CHEBI:17741 IUPAC Name: N,N-dimethylformamide SMILES: CN(C)C=O
| PubChem CID | 6228 |
|---|---|
| CAS | 68-12-2 |
| Molecular Weight (g/mol) | 73.10 |
| ChEBI | CHEBI:17741 |
| MDL Number | MFCD00003284 |
| SMILES | CN(C)C=O |
| Synonym | dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa |
| IUPAC Name | N,N-dimethylformamide |
| InChI Key | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO |
Methacrylic Acid (stabilized with MEHQ) 99.0+%, TCI America™
CAS: 79-41-4 Molecular Formula: C4H6O2 Molecular Weight (g/mol): 86.09 MDL Number: MFCD00002651 InChI Key: CERQOIWHTDAKMF-UHFFFAOYSA-N Synonym: methacrylic acid,2-methylacrylic acid,2-propenoic acid, 2-methyl,methylacrylic acid,2-methylpropenoic acid,2-methyl-2-propenoic acid,alpha-methacrylic acid,alpha-methylacrylic acid,2-methylenepropionic acid,acrylic acid, 2-methyl PubChem CID: 4093 ChEBI: CHEBI:25219 IUPAC Name: 2-methylprop-2-enoic acid SMILES: CC(=C)C(=O)O
| PubChem CID | 4093 |
|---|---|
| CAS | 79-41-4 |
| Molecular Weight (g/mol) | 86.09 |
| ChEBI | CHEBI:25219 |
| MDL Number | MFCD00002651 |
| SMILES | CC(=C)C(=O)O |
| Synonym | methacrylic acid,2-methylacrylic acid,2-propenoic acid, 2-methyl,methylacrylic acid,2-methylpropenoic acid,2-methyl-2-propenoic acid,alpha-methacrylic acid,alpha-methylacrylic acid,2-methylenepropionic acid,acrylic acid, 2-methyl |
| IUPAC Name | 2-methylprop-2-enoic acid |
| InChI Key | CERQOIWHTDAKMF-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2 |
Trimethylacetic acid, 99%
CAS: 75-98-9 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.133 MDL Number: MFCD00004194 InChI Key: IUGYQRQAERSCNH-UHFFFAOYSA-N Synonym: pivalic acid,trimethylacetic acid,neopentanoic acid,2,2-dimethylpropionic acid,tert-pentanoic acid,propanoic acid, 2,2-dimethyl,versatic 5,kyselina pivalova,acetic acid, trimethyl,alpha,alpha-dimethylpropionic acid PubChem CID: 6417 ChEBI: CHEBI:45133 IUPAC Name: 2,2-dimethylpropanoic acid SMILES: CC(C)(C)C(=O)O
| PubChem CID | 6417 |
|---|---|
| CAS | 75-98-9 |
| Molecular Weight (g/mol) | 102.133 |
| ChEBI | CHEBI:45133 |
| MDL Number | MFCD00004194 |
| SMILES | CC(C)(C)C(=O)O |
| Synonym | pivalic acid,trimethylacetic acid,neopentanoic acid,2,2-dimethylpropionic acid,tert-pentanoic acid,propanoic acid, 2,2-dimethyl,versatic 5,kyselina pivalova,acetic acid, trimethyl,alpha,alpha-dimethylpropionic acid |
| IUPAC Name | 2,2-dimethylpropanoic acid |
| InChI Key | IUGYQRQAERSCNH-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
Thermo Scientific Chemicals Diethylenetriaminepentaacetic acid, pentasodium salt, tech., 40% aqueous solution
CAS: 140-01-2 | C14H18N3Na5O10 | 503.26 g/mol
| Linear Formula | NaOCOCH2N(CH2CH2N(CH2COONa)2)2 |
|---|---|
| Molecular Weight (g/mol) | 503.26 |
| InChI Key | LQPLDXQVILYOOL-UHFFFAOYSA-I |
| Density | 1.2900g/mL |
| PubChem CID | 8779 |
| Name Note | 40% Aqueous Solution |
| Percent Purity | 39 to 41% |
| pH | 11.0 to 12.0 (1% aq. soln.) |
| Formula Weight | 503.26 |
| Melting Point | -40°C |
| Boiling Point | 106°C |
| Physical Form | Solution |
| Chemical Name or Material | Diethylenetriaminepentaacetic acid, pentasodium salt |
| Grade | Technical |
| SMILES | [Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wash face,hands and any exposed skin thoroughly after handling. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Cont |
| MDL Number | MFCD00051016 |
| Health Hazard 2 | GHS H Statement Causes serious eye irritation. |
| Solubility Information | Solubility in water: soluble. Other solubilities: mixible with many organic solvents |
| Packaging | Glass bottle |
| Flash Point | >100°C |
| Health Hazard 1 | GHS Signal Word: Warning |
| Refractive Index | 1.4185 to 1.4205 |
| Synonym | pentasodium dtpa,tetralon b,trilon c,versenex 80,pentasodium pentetate,hamp-ex 80,detarex py,kiresuto p,chelest p,plexene d |
| IUPAC Name | pentasodium;2-[bis[2-[bis(carboxylatomethyl)amino]ethyl]amino]acetate |
| Beilstein | 04, III, 1190 |
| Molecular Formula | C14H18N3Na5O10 |
| EINECS Number | 205-391-3 |
| Specific Gravity | 1.29 |
Ethylenediaminetetraacetic acid disodium salt dihydrate, ACS, 99.0-101.0%
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
alpha-Ketoglutaric acid disodium salt dihydrate, 99%
CAS: 305-72-6 Molecular Formula: C5H4Na2O5 Molecular Weight (g/mol): 190.062 MDL Number: MFCD00150702 InChI Key: YBGBJYVHJTVUSL-UHFFFAOYSA-L Synonym: disodium 2-oxoglutarate,unii-flp7p4rm46,disodium 2-oxopentanedioate,flp7p4rm46,pentanedioic acid, 2-oxo-, disodium salt,2-oxoglutaric acid disodium salt,2-ketoglutaric acid disodium salt,alpha-ketoglutaric acid sodium salt,disodium ? ketoglutarate,disodium oxoglurate PubChem CID: 31040 IUPAC Name: disodium;2-oxopentanedioate SMILES: C(CC(=O)[O-])C(=O)C(=O)[O-].[Na+].[Na+]
| PubChem CID | 31040 |
|---|---|
| CAS | 305-72-6 |
| Molecular Weight (g/mol) | 190.062 |
| MDL Number | MFCD00150702 |
| SMILES | C(CC(=O)[O-])C(=O)C(=O)[O-].[Na+].[Na+] |
| Synonym | disodium 2-oxoglutarate,unii-flp7p4rm46,disodium 2-oxopentanedioate,flp7p4rm46,pentanedioic acid, 2-oxo-, disodium salt,2-oxoglutaric acid disodium salt,2-ketoglutaric acid disodium salt,alpha-ketoglutaric acid sodium salt,disodium ? ketoglutarate,disodium oxoglurate |
| IUPAC Name | disodium;2-oxopentanedioate |
| InChI Key | YBGBJYVHJTVUSL-UHFFFAOYSA-L |
| Molecular Formula | C5H4Na2O5 |
Citric acid monohydrate, 99+%, ACS reagent
CAS: 5949-29-1 Molecular Formula: C6H8O7·H2O Molecular Weight (g/mol): 210.15 InChI Key: YASYEJJMZJALEJ-UHFFFAOYSA-N Synonym: citric acid monohydrate,citric acid hydrate,2-hydroxypropane-1,2,3-tricarboxylic acid hydrate,citric acid, monohydrate,unii-2968phw8qp,1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate,citrate,acidum citricum monohydricum,citric acid monohydrate usp PubChem CID: 22230 ChEBI: CHEBI:31404 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate SMILES: C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O
| PubChem CID | 22230 |
|---|---|
| CAS | 5949-29-1 |
| Molecular Weight (g/mol) | 210.15 |
| ChEBI | CHEBI:31404 |
| SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O |
| Synonym | citric acid monohydrate,citric acid hydrate,2-hydroxypropane-1,2,3-tricarboxylic acid hydrate,citric acid, monohydrate,unii-2968phw8qp,1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate,citrate,acidum citricum monohydricum,citric acid monohydrate usp |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate |
| InChI Key | YASYEJJMZJALEJ-UHFFFAOYSA-N |
| Molecular Formula | C6H8O7·H2O |
EDTA, Disodium Dihydrate, ACS Reagent Grade, Ricca Chemical
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |