Carboxylic acids and derivatives
Filtered Search Results
Acetazolamide, USP, 98-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Methyl thiophene-3-carboxylate, 97%, Thermo Scientific Chemicals
CAS: 22913-26-4 Molecular Formula: C6H6O2S Molecular Weight (g/mol): 142.17 MDL Number: MFCD06203810 InChI Key: ZTRAEMILTFNZSM-UHFFFAOYSA-N Synonym: methyl 3-thiophenecarboxylate,3-thiophenecarboxylic acid, methyl ester,thiophene-3-carboxylic acid methyl ester,3-thiophenecarboxylicacid, methyl ester,methyl thiophen-3-carboxylate,methyl-3-thenoate,methyl 3-thenoate,3-methoxycarbonylthiophene,3-methoxy carbonyl-thiophene,methyl 3-thiophenecarboxylate # PubChem CID: 574151 IUPAC Name: methyl thiophene-3-carboxylate SMILES: COC(=O)C1=CSC=C1
| PubChem CID | 574151 |
|---|---|
| CAS | 22913-26-4 |
| Molecular Weight (g/mol) | 142.17 |
| MDL Number | MFCD06203810 |
| SMILES | COC(=O)C1=CSC=C1 |
| Synonym | methyl 3-thiophenecarboxylate,3-thiophenecarboxylic acid, methyl ester,thiophene-3-carboxylic acid methyl ester,3-thiophenecarboxylicacid, methyl ester,methyl thiophen-3-carboxylate,methyl-3-thenoate,methyl 3-thenoate,3-methoxycarbonylthiophene,3-methoxy carbonyl-thiophene,methyl 3-thiophenecarboxylate # |
| IUPAC Name | methyl thiophene-3-carboxylate |
| InChI Key | ZTRAEMILTFNZSM-UHFFFAOYSA-N |
| Molecular Formula | C6H6O2S |
Thermo Scientific Chemicals beta-D-Ribofuranose 1-acetate 2,3,5-tribenzoate, 99%
CAS: 6974-32-9 Molecular Formula: C28H24O9 Molecular Weight (g/mol): 504.48 MDL Number: MFCD00005357 InChI Key: GCZABPLTDYVJMP-CBUXHAPBSA-N Synonym: 1-o-acetyl-2,3,5-tri-o-benzoyl-beta-d-ribofuranose,beta-d-ribofuranose 1-acetate 2,3,5-tribenzoate,2r,3r,4r,5s-5-acetyloxy-3,4-bis benzoyloxy oxolan-2-yl methyl benzoate,1-acetyl-2,3,5-tribenzoyl-beta-d-ribofuranose,1-acetyl-2,3,5-tribenzoy-b-d-ribofuranose,1-o-acetyl-2,3,5,tri-o-benzyl-beta-d-ribofuranose,2r,3r,4r,5s-5-acetyloxy-3,4-dibenzoyloxyoxolan-2-yl methyl benzoate,2s,3r,4r,5r-2-acetoxy-5-benzoyloxymethyl tetrahydrofuran-3,4-diyl dibenzoate,.beta.-d-ribofuranose, 1-acetate 2,3,5-tribenzoate,2s,3r,4r,5r-2-acetoxy-5-benzoyloxy methyl tetrahydrofuran-3,4-diyl dibenzoate PubChem CID: 81455 IUPAC Name: [(2R,3R,4R,5S)-5-acetyloxy-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate SMILES: CC(=O)OC1C(C(C(O1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4
| PubChem CID | 81455 |
|---|---|
| CAS | 6974-32-9 |
| Molecular Weight (g/mol) | 504.48 |
| MDL Number | MFCD00005357 |
| SMILES | CC(=O)OC1C(C(C(O1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
| Synonym | 1-o-acetyl-2,3,5-tri-o-benzoyl-beta-d-ribofuranose,beta-d-ribofuranose 1-acetate 2,3,5-tribenzoate,2r,3r,4r,5s-5-acetyloxy-3,4-bis benzoyloxy oxolan-2-yl methyl benzoate,1-acetyl-2,3,5-tribenzoyl-beta-d-ribofuranose,1-acetyl-2,3,5-tribenzoy-b-d-ribofuranose,1-o-acetyl-2,3,5,tri-o-benzyl-beta-d-ribofuranose,2r,3r,4r,5s-5-acetyloxy-3,4-dibenzoyloxyoxolan-2-yl methyl benzoate,2s,3r,4r,5r-2-acetoxy-5-benzoyloxymethyl tetrahydrofuran-3,4-diyl dibenzoate,.beta.-d-ribofuranose, 1-acetate 2,3,5-tribenzoate,2s,3r,4r,5r-2-acetoxy-5-benzoyloxy methyl tetrahydrofuran-3,4-diyl dibenzoate |
| IUPAC Name | [(2R,3R,4R,5S)-5-acetyloxy-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| InChI Key | GCZABPLTDYVJMP-CBUXHAPBSA-N |
| Molecular Formula | C28H24O9 |
3-Nitrobenzamide, 98%
CAS: 645-09-0 Molecular Formula: C7H6N2O3 Molecular Weight (g/mol): 166.14 MDL Number: MFCD00007984 InChI Key: KWAYEPXDGHYGRW-UHFFFAOYSA-N Synonym: m-nitrobenzamide,benzamide, 3-nitro,benzamide, m-nitro,3-nitro-benzamide,3-nitrophenylcarboxamide,acmc-209nmr,3-nitrobenzamide,dsstox_cid_5732,dsstox_rid_77897,dsstox_gsid_25732 PubChem CID: 12576 IUPAC Name: 3-nitrobenzamide SMILES: C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)N
| PubChem CID | 12576 |
|---|---|
| CAS | 645-09-0 |
| Molecular Weight (g/mol) | 166.14 |
| MDL Number | MFCD00007984 |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)N |
| Synonym | m-nitrobenzamide,benzamide, 3-nitro,benzamide, m-nitro,3-nitro-benzamide,3-nitrophenylcarboxamide,acmc-209nmr,3-nitrobenzamide,dsstox_cid_5732,dsstox_rid_77897,dsstox_gsid_25732 |
| IUPAC Name | 3-nitrobenzamide |
| InChI Key | KWAYEPXDGHYGRW-UHFFFAOYSA-N |
| Molecular Formula | C7H6N2O3 |
Methyl 4-aminobenzoate, 98%
CAS: 619-45-4 Molecular Formula: C8H9NO2 Molecular Weight (g/mol): 151.17 MDL Number: MFCD00007891 InChI Key: LZXXNPOYQCLXRS-UHFFFAOYSA-N Synonym: 4-aminobenzoic acid methyl ester,methyl p-aminobenzoate,benzoic acid, 4-amino-, methyl ester,p-methoxycarbonyl aniline,4-methoxycarbonyl aniline,p-aminobenzoic acid methyl ester,methyl aniline-4-carboxylate,4-carbomethoxyaniline,methyl4-aminobenzoate,benzoic acid, p-amino-, methyl ester PubChem CID: 12082 IUPAC Name: methyl 4-aminobenzoate SMILES: COC(=O)C1=CC=C(C=C1)N
| PubChem CID | 12082 |
|---|---|
| CAS | 619-45-4 |
| Molecular Weight (g/mol) | 151.17 |
| MDL Number | MFCD00007891 |
| SMILES | COC(=O)C1=CC=C(C=C1)N |
| Synonym | 4-aminobenzoic acid methyl ester,methyl p-aminobenzoate,benzoic acid, 4-amino-, methyl ester,p-methoxycarbonyl aniline,4-methoxycarbonyl aniline,p-aminobenzoic acid methyl ester,methyl aniline-4-carboxylate,4-carbomethoxyaniline,methyl4-aminobenzoate,benzoic acid, p-amino-, methyl ester |
| IUPAC Name | methyl 4-aminobenzoate |
| InChI Key | LZXXNPOYQCLXRS-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO2 |
meso-2,3-Dimercaptosuccinic acid, 98%
CAS: 304-55-2 Molecular Formula: C4H6O4S2 Molecular Weight (g/mol): 182.21 MDL Number: MFCD00064799 InChI Key: ACTRVOBWPAIOHC-XIXRPRMCSA-N Synonym: succimer,meso-2,3-dimercaptosuccinic acid,meso-dimercaptosuccinic acid,dmsa,dim-sa,2r,3s-rel-2,3-dimercaptosuccinic acid,succimero,succimerum,chemet,dimercaptosuccinic acid PubChem CID: 2724354 ChEBI: CHEBI:63623 IUPAC Name: (2S,3R)-2,3-bis(sulfanyl)butanedioic acid SMILES: C(C(C(=O)O)S)(C(=O)O)S
| PubChem CID | 2724354 |
|---|---|
| CAS | 304-55-2 |
| Molecular Weight (g/mol) | 182.21 |
| ChEBI | CHEBI:63623 |
| MDL Number | MFCD00064799 |
| SMILES | C(C(C(=O)O)S)(C(=O)O)S |
| Synonym | succimer,meso-2,3-dimercaptosuccinic acid,meso-dimercaptosuccinic acid,dmsa,dim-sa,2r,3s-rel-2,3-dimercaptosuccinic acid,succimero,succimerum,chemet,dimercaptosuccinic acid |
| IUPAC Name | (2S,3R)-2,3-bis(sulfanyl)butanedioic acid |
| InChI Key | ACTRVOBWPAIOHC-XIXRPRMCSA-N |
| Molecular Formula | C4H6O4S2 |
Sodium oxalate, 99.5%, for analysis, Thermo Scientific Chemicals
CAS: 62-76-0 Molecular Formula: C2Na2O4 Molecular Weight (g/mol): 134.00 MDL Number: MFCD00012465 InChI Key: ZNCPFRVNHGOPAG-UHFFFAOYSA-L Synonym: sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt PubChem CID: 6125 IUPAC Name: disodium;oxalate SMILES: [Na+].[Na+].[O-]C(=O)C([O-])=O
| PubChem CID | 6125 |
|---|---|
| CAS | 62-76-0 |
| Molecular Weight (g/mol) | 134.00 |
| MDL Number | MFCD00012465 |
| SMILES | [Na+].[Na+].[O-]C(=O)C([O-])=O |
| Synonym | sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt |
| IUPAC Name | disodium;oxalate |
| InChI Key | ZNCPFRVNHGOPAG-UHFFFAOYSA-L |
| Molecular Formula | C2Na2O4 |
N-(2-Chloroethyl)acetamide, 98%
CAS: 7355-58-0 Molecular Formula: C4H8ClNO Molecular Weight (g/mol): 121.57 MDL Number: MFCD00000965 InChI Key: HSKNJSHFPPHTAQ-UHFFFAOYSA-N Synonym: n-2-chloroethyl acetamide,acetamide, n-2-chloroethyl,n-2-chloro-ethyl-acetamide,n-acetyl-2-chloroethylamine,n 2-chloroethyl acetamide,n-acetyl-ss-chlorathylamin,acmc-1bi05,n-2-chloroethyl-acetamide,4-04-00-00449 beilstein handbook reference PubChem CID: 81815 IUPAC Name: N-(2-chloroethyl)acetamide SMILES: CC(=O)NCCCl
| PubChem CID | 81815 |
|---|---|
| CAS | 7355-58-0 |
| Molecular Weight (g/mol) | 121.57 |
| MDL Number | MFCD00000965 |
| SMILES | CC(=O)NCCCl |
| Synonym | n-2-chloroethyl acetamide,acetamide, n-2-chloroethyl,n-2-chloro-ethyl-acetamide,n-acetyl-2-chloroethylamine,n 2-chloroethyl acetamide,n-acetyl-ss-chlorathylamin,acmc-1bi05,n-2-chloroethyl-acetamide,4-04-00-00449 beilstein handbook reference |
| IUPAC Name | N-(2-chloroethyl)acetamide |
| InChI Key | HSKNJSHFPPHTAQ-UHFFFAOYSA-N |
| Molecular Formula | C4H8ClNO |
2-Sulfobenzoic acid cyclic anhydride, 95%
CAS: 81-08-3 Molecular Formula: C7H4O4S Molecular Weight (g/mol): 184.17 MDL Number: MFCD00005879 InChI Key: NCYNKWQXFADUOZ-UHFFFAOYSA-N Synonym: 2-sulfobenzoic anhydride,2-sulfobenzoic acid cyclic anhydride,sulfobenzoic anhydride,o-sulfobenzoic acid anhydride,3h-2,1-benzoxathiol-3-one, 1,1-dioxide,3h-benzo c 1,2 oxathiol-3-one 1,1-dioxide,unii-0swh68iq5w,o-sulfobenzoic acid, cyclic anhydride,2,1-benzoxathiol-3-one-1,1-dioxide,0swh68iq5w PubChem CID: 65729 IUPAC Name: 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one SMILES: C1=CC=C2C(=C1)C(=O)OS2(=O)=O
| PubChem CID | 65729 |
|---|---|
| CAS | 81-08-3 |
| Molecular Weight (g/mol) | 184.17 |
| MDL Number | MFCD00005879 |
| SMILES | C1=CC=C2C(=C1)C(=O)OS2(=O)=O |
| Synonym | 2-sulfobenzoic anhydride,2-sulfobenzoic acid cyclic anhydride,sulfobenzoic anhydride,o-sulfobenzoic acid anhydride,3h-2,1-benzoxathiol-3-one, 1,1-dioxide,3h-benzo c 1,2 oxathiol-3-one 1,1-dioxide,unii-0swh68iq5w,o-sulfobenzoic acid, cyclic anhydride,2,1-benzoxathiol-3-one-1,1-dioxide,0swh68iq5w |
| IUPAC Name | 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one |
| InChI Key | NCYNKWQXFADUOZ-UHFFFAOYSA-N |
| Molecular Formula | C7H4O4S |
2-Ethylhexyl methacrylate, 99%, stabilized
CAS: 688-84-6 Molecular Formula: C12H22O2 Molecular Weight (g/mol): 198.31 MDL Number: MFCD00009494 InChI Key: WDQMWEYDKDCEHT-UHFFFAOYSA-N Synonym: 2-ethylhexyl methacrylate,2-ethyl-1-hexyl methacrylate,2-ethylhexyl methacryate,2-propenoic acid, 2-methyl-, 2-ethylhexyl ester,methacrylic acid 2-ethylhexyl ester,methacrylic acid, 2-ethylhexyl ester,methacrylate, 2-ethylisohexy,2-ethylhexylmethacrylate,dsstox_cid_7293,dsstox_rid_78391 PubChem CID: 12713 IUPAC Name: 2-ethylhexyl 2-methylprop-2-enoate SMILES: CCCCC(CC)COC(=O)C(=C)C
| PubChem CID | 12713 |
|---|---|
| CAS | 688-84-6 |
| Molecular Weight (g/mol) | 198.31 |
| MDL Number | MFCD00009494 |
| SMILES | CCCCC(CC)COC(=O)C(=C)C |
| Synonym | 2-ethylhexyl methacrylate,2-ethyl-1-hexyl methacrylate,2-ethylhexyl methacryate,2-propenoic acid, 2-methyl-, 2-ethylhexyl ester,methacrylic acid 2-ethylhexyl ester,methacrylic acid, 2-ethylhexyl ester,methacrylate, 2-ethylisohexy,2-ethylhexylmethacrylate,dsstox_cid_7293,dsstox_rid_78391 |
| IUPAC Name | 2-ethylhexyl 2-methylprop-2-enoate |
| InChI Key | WDQMWEYDKDCEHT-UHFFFAOYSA-N |
| Molecular Formula | C12H22O2 |
Methyl 2-methylbutyrate, 98%
CAS: 868-57-5 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009335 InChI Key: OCWLYWIFNDCWRZ-UHFFFAOYNA-N Synonym: methyl 2-methylbutyrate,butanoic acid, 2-methyl-, methyl ester,methyl 2-methyl butyrate,methyl s-2-methylbutanoate,2-methylbutyric acid methyl ester,butyric acid, 2-methyl-, methyl ester,dl-2-methylbutyric acid methyl ester,methyl dl-2-methylbutyrate,methyl alpha-methylbutyrate,methyl alpha-methylbutanoate PubChem CID: 13357 IUPAC Name: methyl 2-methylbutanoate SMILES: CCC(C)C(=O)OC
| PubChem CID | 13357 |
|---|---|
| CAS | 868-57-5 |
| Molecular Weight (g/mol) | 116.16 |
| MDL Number | MFCD00009335 |
| SMILES | CCC(C)C(=O)OC |
| Synonym | methyl 2-methylbutyrate,butanoic acid, 2-methyl-, methyl ester,methyl 2-methyl butyrate,methyl s-2-methylbutanoate,2-methylbutyric acid methyl ester,butyric acid, 2-methyl-, methyl ester,dl-2-methylbutyric acid methyl ester,methyl dl-2-methylbutyrate,methyl alpha-methylbutyrate,methyl alpha-methylbutanoate |
| IUPAC Name | methyl 2-methylbutanoate |
| InChI Key | OCWLYWIFNDCWRZ-UHFFFAOYNA-N |
| Molecular Formula | C6H12O2 |
2,2,2-Trifluoroacetamide, 97%
CAS: 354-38-1 Molecular Formula: C2H2F3NO Molecular Weight (g/mol): 113.04 MDL Number: MFCD00008008 InChI Key: NRKYWOKHZRQRJR-UHFFFAOYSA-N Synonym: trifluoroacetamide,acetamide, 2,2,2-trifluoro,unii-36mu16byfk,n-trifluoroacetamide,2,2,2-trifluoro-acetamide,36mu16byfk,trifluroacetamide,trifluoro-acetamide,snylgqhjptadtaetp@,pubchem12622 PubChem CID: 67717 IUPAC Name: 2,2,2-trifluoroacetamide SMILES: NC(=O)C(F)(F)F
| PubChem CID | 67717 |
|---|---|
| CAS | 354-38-1 |
| Molecular Weight (g/mol) | 113.04 |
| MDL Number | MFCD00008008 |
| SMILES | NC(=O)C(F)(F)F |
| Synonym | trifluoroacetamide,acetamide, 2,2,2-trifluoro,unii-36mu16byfk,n-trifluoroacetamide,2,2,2-trifluoro-acetamide,36mu16byfk,trifluroacetamide,trifluoro-acetamide,snylgqhjptadtaetp@,pubchem12622 |
| IUPAC Name | 2,2,2-trifluoroacetamide |
| InChI Key | NRKYWOKHZRQRJR-UHFFFAOYSA-N |
| Molecular Formula | C2H2F3NO |
Methyl 3-methylphenylacetate, 98%
CAS: 53088-69-0 Molecular Formula: C10H12O2 Molecular Weight (g/mol): 164.20 MDL Number: MFCD00968468 InChI Key: AWTKFTNNPQGGLX-UHFFFAOYSA-N Synonym: methyl 2-m-tolyl acetate,methyl 3-methylphenylacetate,methyl 2-3-methylphenyl acetate,3-methylphenylacetic acid methyl ester,benzeneacetic acid, 3-methyl-, methyl ester,methyl 2-m-tolylacetate,m-tolylacetic acid methyl ester,m-toly-acetic acid methyl ester,m-tolyl-acetic acid methyl ester,methyl 2-3-methylphenyl ethanoate PubChem CID: 5135288 IUPAC Name: methyl 2-(3-methylphenyl)acetate SMILES: COC(=O)CC1=CC=CC(C)=C1
| PubChem CID | 5135288 |
|---|---|
| CAS | 53088-69-0 |
| Molecular Weight (g/mol) | 164.20 |
| MDL Number | MFCD00968468 |
| SMILES | COC(=O)CC1=CC=CC(C)=C1 |
| Synonym | methyl 2-m-tolyl acetate,methyl 3-methylphenylacetate,methyl 2-3-methylphenyl acetate,3-methylphenylacetic acid methyl ester,benzeneacetic acid, 3-methyl-, methyl ester,methyl 2-m-tolylacetate,m-tolylacetic acid methyl ester,m-toly-acetic acid methyl ester,m-tolyl-acetic acid methyl ester,methyl 2-3-methylphenyl ethanoate |
| IUPAC Name | methyl 2-(3-methylphenyl)acetate |
| InChI Key | AWTKFTNNPQGGLX-UHFFFAOYSA-N |
| Molecular Formula | C10H12O2 |
tert-Butyl propiolate, 98%
CAS: 13831-03-3 Molecular Formula: C7H10O2 Molecular Weight (g/mol): 126.16 MDL Number: MFCD00060100 InChI Key: XGTPDIIFEPTULX-UHFFFAOYSA-N Synonym: tert-butyl propiolate,propiolic acid tert-butyl ester,t-butyl propiolate,2-propynoic acid, 1,1-dimethylethyl ester,boc-acetylene,tert-butyl propalate,tert-butyl propargylate,acmc-209chj,tert-butyl propiolate # PubChem CID: 543038 IUPAC Name: tert-butyl prop-2-ynoate SMILES: CC(C)(C)OC(=O)C#C
| PubChem CID | 543038 |
|---|---|
| CAS | 13831-03-3 |
| Molecular Weight (g/mol) | 126.16 |
| MDL Number | MFCD00060100 |
| SMILES | CC(C)(C)OC(=O)C#C |
| Synonym | tert-butyl propiolate,propiolic acid tert-butyl ester,t-butyl propiolate,2-propynoic acid, 1,1-dimethylethyl ester,boc-acetylene,tert-butyl propalate,tert-butyl propargylate,acmc-209chj,tert-butyl propiolate # |
| IUPAC Name | tert-butyl prop-2-ynoate |
| InChI Key | XGTPDIIFEPTULX-UHFFFAOYSA-N |
| Molecular Formula | C7H10O2 |