Aminotoluenes
Aobchem 3 5-Difluoro-4-methylaniline | ≥97% | CAS 878285-13-3 | C7H7F2N | 500mg
3 5-Difluoro-4-methylaniline | ≥97% | CAS 878285-13-3 | C7H7F2N | 500mg
Aobchem 2 4-Difluoro-5-methylaniline | ≥97% | CAS 1378579-56-6 | C7H7F2N | 5g
2 4-Difluoro-5-methylaniline | ≥97% | CAS 1378579-56-6 | C7H7F2N | 5g
Aobchem 4 5-Dibromo-2-methylaniline | ≥97% | CAS 102170-00-3 | C7H7Br2N | 25g
4 5-Dibromo-2-methylaniline | ≥97% | CAS 102170-00-3 | C7H7Br2N | 25g
![Alkali Scientific BCIP, P Toluidine Salt [5 Bromo 4 Chloro 3 Indolyl Phospate P Toluidine Salt], 1 Gram](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000661099.jpg-250.jpg)
Alkali Scientific BCIP, P Toluidine Salt [5 Bromo 4 Chloro 3 Indolyl Phospate P Toluidine Salt], 1 Gram
BCIP (5-Bromo 4-Chloro 3-Indolyl Phosphate P-Toluidine Salt) is a chromogenic substrate used for detecting alkaline phosphatase activity in molecular biology applications. This reagent produces a colored product upon cleavage by alkaline phosphatase, which can be used to detect enzyme activity in assays such as Southern blots, Northern blots, and ELISAs. The 1g bottle is sufficient for numerous experiments and is widely used in gene expression studies, immunohistochemistry, and other techniques where enzyme activity needs to be visualized. BCIP is a reliable and effective tool for researchers studying phosphatase activity and enzyme-linked assays, providing clear and visible results in biochemical experiments.
Aobchem 3-Bromo-4-methylaniline | ≥97% | CAS 7745-91-7 | C7H8BrN | 500g
3-Bromo-4-methylaniline | ≥97% | CAS 7745-91-7 | C7H8BrN | 500g
eMolecules 24732-10-3 | 4-Methylaminobenzylamine | AA Blocks LLC | MFCD03410998 | 136.198 | C8H12N2 | 0.000 | CNc1ccc(CN)cc1 | 250mg | 437052643
4-Methylaminobenzylamine | AA Blocks LLC | 24732-10-3 | MFCD03410998 | 136.198 | C8H12N2 | 0.000 | CNc1ccc(CN)cc1 | 250mg | 437052643
eMolecules 857195-15-4 | 3-Methoxy-2-methylaniline hydrochloride | MFCD11042289 | 1g
Ambeed | 3-Methoxy-2-methylaniline hydrochloride | 1g | 600850223 | A950837 | 857195-15-4 | MFCD11042289 | 173.640 | C8H12ClNO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Aobchem 2 4-Diiodo-6-methylaniline | ≥97% | CAS 117832-09-4 | C7H7I2N | 250mg
2 4-Diiodo-6-methylaniline | ≥97% | CAS 117832-09-4 | C7H7I2N | 250mg
Aobchem 2-Fluoro-3-isobutoxy-4-methoxyphenylboronic acid | ≥95% | CAS 1793003-43-6 | C11H16BFO4 | 250mg
2-Fluoro-3-isobutoxy-4-methoxyphenylboronic acid | ≥95% | CAS 1793003-43-6 | C11H16BFO4 | 250mg
Chemscene ChemScene | 2-Iodo-5-methylaniline | 10G | CS-W004939 | 0.98 | 13194-69-9| MFCD00833395 | 233.052
ChemScene | 2-Iodo-5-methylaniline | 10G | CS-W004939 | 0.98 | 13194-69-9| MFCD00833395 | 233.052
eMolecules 832133-11-6 | 2-IODO-6-METHYLANILINE | AstaTech | MFCD18397766 | 233.052 | C7H8IN | 95.000 | Cc1cccc(I)c1N | 1g | 599121167
2-IODO-6-METHYLANILINE | AstaTech | 832133-11-6 | MFCD18397766 | 233.052 | C7H8IN | 95.000 | Cc1cccc(I)c1N | 1g | 599121167
eMolecules 55011-44-4 | O-Tolidine sulfone | Combi-Blocks | MFCD00039157 | 274.340 | C14H14N2O2S | 70.000 | Cc1cc2-c3cc(C)c(N)cc3S(=O)(=O)c2cc1N | 1g | 537623743
O-Tolidine sulfone | Combi-Blocks | 55011-44-4 | MFCD00039157 | 274.340 | C14H14N2O2S | 70.000 | Cc1cc2-c3cc(C)c(N)cc3S(=O)(=O)c2cc1N | 1g | 537623743
Aobchem 3, 5-Dibromo-4-methylaniline, AOBCHEM USA 21264-5G. 13194-73-5. MFCD00151806
3, 5-Dibromo-4-methylaniline, AOBCHEM USA 21264-5G. 13194-73-5. MFCD00151806
eMolecules 29289-13-2 | Ambeed | 2-Iodo-4-methylaniline | 1g | 552550863 | A122989 | MFCD03407391 | 233.052 | C7H8IN
Ambeed | Phenyl(3-(trifluoromethyl)phenyl)methanol | 1g | 527436573 | A523067 | 728-80-3 | MFCD00014397 | 252.236 | C14H11F3O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 613-97-8 | N-Ethyl-N-methylaniline | ChemScene | MFCD00009038 | 135.210 | C9H13N | 97.000 | CCN(C)c1ccccc1 | 1g | 632287818
N-Ethyl-N-methylaniline | ChemScene | 613-97-8 | MFCD00009038 | 135.210 | C9H13N | 97.000 | CCN(C)c1ccccc1 | 1g | 632287818