Biphenyls and derivatives
Aobchem 2 3-Difluoro-1-(hexyloxy)-4-iodobenzene | ≥95% | CAS 144292-41-1 | C12H15F2IO | 1g
2 3-Difluoro-1-(hexyloxy)-4-iodobenzene | ≥95% | CAS 144292-41-1 | C12H15F2IO | 1g
eMolecules 579511-01-6 | AstaTech | METHYL 3-HYDROXYBIPHENYL-4-CARBOXYLATE | 0.1g | 722708208 | AC2417 | 97 | MFCD06409247 | 228.247 | C14H12O3
AstaTech | METHYL 3-HYDROXYBIPHENYL-4-CARBOXYLATE | 0.1g | 722708208 | AC2417 | 97.000 | 579511-01-6 | MFCD06409247 | 228.247 | C14H12O3
Medchemexpress LLC HY-111055 5mg Medchemexpress, BIP-135 CAS:941575-71-9 Purity:>98%
Medchemexpress, HY-111055 5mg BIP-135 CAS:941575-71-9 BIP-135 is a potent and selective ATP-competitive GSK-3 inhibitor, with IC50s of 16 nM and 21 nM for GSK-3α and GSK-3β, respectively. BIP 135 exhibits neuroprotective effect. Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.
Aobchem 4-Amino-3-fluorobiphenyl | ≥97% | CAS 76302-56-2 | C12H10FN | 500mg
4-Amino-3-fluorobiphenyl | ≥97% | CAS 76302-56-2 | C12H10FN | 500mg
Aobchem 3-Bromo-4-chloro-1 1 -biphenyl | 95% | CAS 1537919-83-7 | C12H8BrCl | 5g
3-Bromo-4-chloro-1 1 -biphenyl | 95% | CAS 1537919-83-7 | C12H8BrCl | 5g
Aobchem 2-Bromo-6-fluorobiphenyl | ≥95% | CAS 1233402-20-4 | C12H8BrF | 1g
2-Bromo-6-fluorobiphenyl | ≥95% | CAS 1233402-20-4 | C12H8BrF | 1g
Aobchem 4-Bromo-4 -iodobiphenyl | ≥95% | CAS 105946-82-5 | C12H8BrI | 100g
4-Bromo-4 -iodobiphenyl | ≥95% | CAS 105946-82-5 | C12H8BrI | 100g
Aobchem 2-Biphenylboronic acid | ≥97% | CAS 4688-76-0 | C12H11BO2 | 1kg
2-Biphenylboronic acid | ≥97% | CAS 4688-76-0 | C12H11BO2 | 1kg
Aobchem 2-Fluorobiphenyl-3-boronic acid | ≥95% | CAS 1218790-57-8 | C12H10BFO2 | 10g
2-Fluorobiphenyl-3-boronic acid | ≥95% | CAS 1218790-57-8 | C12H10BFO2 | 10g
Aobchem 4-Amino-3-fluorobiphenyl | ≥97% | CAS 76302-56-2 | C12H10FN | 5g
4-Amino-3-fluorobiphenyl | ≥97% | CAS 76302-56-2 | C12H10FN | 5g
Aobchem 2-Bromo-4-chloro-1 1 -biphenyl | ≥95% | CAS 1805001-22-2 | C12H8BrCl | 500mg
2-Bromo-4-chloro-1 1 -biphenyl | ≥95% | CAS 1805001-22-2 | C12H8BrCl | 500mg
eMolecules 63242-14-8 | 4-Benzoyl-4'-bromobiphenyl | Combi-Blocks, Inc. | MFCD00209630 | 337.216 | C19H13BrO | 98.000 | Brc1ccc(cc1)-c1ccc(cc1)C(=O)c1ccccc1 | 1g | 603135771
4-Benzoyl-4'-bromobiphenyl | Combi-Blocks, Inc. | 63242-14-8 | MFCD00209630 | 337.216 | C19H13BrO | 98.000 | Brc1ccc(cc1)-c1ccc(cc1)C(=O)c1ccccc1 | 1g | 603135771
Aobchem 3-Bromo-2-fluoro-1 1 -biphenyl | 97% | CAS 1515573-52-0 | C12H8BrF | 250mg
3-Bromo-2-fluoro-1 1 -biphenyl | 97% | CAS 1515573-52-0 | C12H8BrF | 250mg
Aobchem 3-Bromo-5-fluoro-1 1 -biphenyl | ≥97% | CAS 136649-30-4 | C12H8BrF | 1g
3-Bromo-5-fluoro-1 1 -biphenyl | ≥97% | CAS 136649-30-4 | C12H8BrF | 1g
Chemscene ChemScene | 4-Bromo-4'-hydroxybiphenyl | 500G | CS-W008587 | 0.98 | 29558-77-8| MFCD00059076 | 249.11
ChemScene | 4-Bromo-4'-hydroxybiphenyl | 500G | CS-W008587 | 0.98 | 29558-77-8| MFCD00059076 | 249.11