Bromobenzenes
- (5)
- (1)
- (1)
- (9)
- (13)
- (1)
- (3)
- (17)
- (3)
- (4)
- (3)
- (1)
- (2)
- (2)
- (7)
- (4)
- (14)
- (3)
Filtered Search Results
Sigma Aldrich 4-methylpyridine-3-boronic acid
MilliporeSigma Sigma Organics products encompass a wide range of quality reagents, solvents, catalysts, and building blocks for organic synthesis. From benchtop discovery to process development and scale-up, Sigma Organics solutions are built to meet the needs of synthetic chemists.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
2-Bromophenylboronic acid, 97%
CAS: 244205-40-1 Molecular Formula: C6H6BBrO2 Molecular Weight (g/mol): 200.83 MDL Number: MFCD01114672 InChI Key: PLVCYMZAEQRYHJ-UHFFFAOYSA-N Synonym: 2-bromophenyl boronic acid,o-bromophenylboronic acid,2-bromobenzeneboronic acid,2-bromophenylboronicacid,boronic acid, 2-bromophenyl,bromobenzeneboronic acid,pubchem13095,2-bromo phenyl boronic acid,2-bromo-phenyl boronic acid PubChem CID: 2773294 IUPAC Name: (2-bromophenyl)boronic acid SMILES: OB(O)C1=CC=CC=C1Br
| PubChem CID | 2773294 |
|---|---|
| CAS | 244205-40-1 |
| Molecular Weight (g/mol) | 200.83 |
| MDL Number | MFCD01114672 |
| SMILES | OB(O)C1=CC=CC=C1Br |
| Synonym | 2-bromophenyl boronic acid,o-bromophenylboronic acid,2-bromobenzeneboronic acid,2-bromophenylboronicacid,boronic acid, 2-bromophenyl,bromobenzeneboronic acid,pubchem13095,2-bromo phenyl boronic acid,2-bromo-phenyl boronic acid |
| IUPAC Name | (2-bromophenyl)boronic acid |
| InChI Key | PLVCYMZAEQRYHJ-UHFFFAOYSA-N |
| Molecular Formula | C6H6BBrO2 |
2-Bromophenylboronic Acid (contains varying amounts of Anhydride), TCI America™
CAS: 244205-40-1 Molecular Formula: C6H6BBrO2 Molecular Weight (g/mol): 200.83 MDL Number: MFCD01114672 InChI Key: PLVCYMZAEQRYHJ-UHFFFAOYSA-N Synonym: 2-bromophenyl boronic acid,o-bromophenylboronic acid,2-bromobenzeneboronic acid,2-bromophenylboronicacid,boronic acid, 2-bromophenyl,bromobenzeneboronic acid,pubchem13095,2-bromo phenyl boronic acid,2-bromo-phenyl boronic acid PubChem CID: 2773294 IUPAC Name: (2-bromophenyl)boronic acid SMILES: OB(O)C1=CC=CC=C1Br
| PubChem CID | 2773294 |
|---|---|
| CAS | 244205-40-1 |
| Molecular Weight (g/mol) | 200.83 |
| MDL Number | MFCD01114672 |
| SMILES | OB(O)C1=CC=CC=C1Br |
| Synonym | 2-bromophenyl boronic acid,o-bromophenylboronic acid,2-bromobenzeneboronic acid,2-bromophenylboronicacid,boronic acid, 2-bromophenyl,bromobenzeneboronic acid,pubchem13095,2-bromo phenyl boronic acid,2-bromo-phenyl boronic acid |
| IUPAC Name | (2-bromophenyl)boronic acid |
| InChI Key | PLVCYMZAEQRYHJ-UHFFFAOYSA-N |
| Molecular Formula | C6H6BBrO2 |
4-Bromophenylboronic Acid (contains varying amounts of Anhydride), TCI America™
CAS: 5467-74-3 Molecular Formula: C6H6BBrO2 Molecular Weight (g/mol): 200.83 MDL Number: MFCD00002104 InChI Key: QBLFZIBJXUQVRF-UHFFFAOYSA-N Synonym: 4-bromophenyl boronic acid,4-bromobenzeneboronic acid,4-bromophenylboric acid,p-bromophenylboronic acid,p-bromophenylboric acid,p-bromobenzeneboronic acid,boronic acid, 4-bromophenyl,benzeneboronic acid, p-bromo,p-bromophenyl boronic acid,4-bromo phenyl boronic acid PubChem CID: 79599 IUPAC Name: (4-bromophenyl)boronic acid SMILES: OB(O)C1=CC=C(Br)C=C1
| PubChem CID | 79599 |
|---|---|
| CAS | 5467-74-3 |
| Molecular Weight (g/mol) | 200.83 |
| MDL Number | MFCD00002104 |
| SMILES | OB(O)C1=CC=C(Br)C=C1 |
| Synonym | 4-bromophenyl boronic acid,4-bromobenzeneboronic acid,4-bromophenylboric acid,p-bromophenylboronic acid,p-bromophenylboric acid,p-bromobenzeneboronic acid,boronic acid, 4-bromophenyl,benzeneboronic acid, p-bromo,p-bromophenyl boronic acid,4-bromo phenyl boronic acid |
| IUPAC Name | (4-bromophenyl)boronic acid |
| InChI Key | QBLFZIBJXUQVRF-UHFFFAOYSA-N |
| Molecular Formula | C6H6BBrO2 |
| PubChem CID | 2734689 |
|---|---|
| CAS | 117695-55-3 |
| Molecular Weight (g/mol) | 279.722 |
| MDL Number | MFCD01075725 |
| Physical Form | Crystalline Powder |
| SMILES | B(C1=CC(=CC(=C1)Br)Br)(O)O |
| TSCA | No |
| IUPAC Name | (3,5-dibromophenyl)boronic acid |
| InChI Key | WQBLCGDZYFKINX-UHFFFAOYSA-N |
| Molecular Formula | C6H5BBr2O2 |
| Formula Weight | 279.72 |
2-Bromobenzeneboronic acid, 98%
CAS: 244205-40-1 Molecular Formula: C6H6BBrO2 Molecular Weight (g/mol): 200.83 MDL Number: MFCD01114672 InChI Key: PLVCYMZAEQRYHJ-UHFFFAOYSA-N Synonym: 2-bromophenyl boronic acid,o-bromophenylboronic acid,2-bromobenzeneboronic acid,2-bromophenylboronicacid,boronic acid, 2-bromophenyl,bromobenzeneboronic acid,pubchem13095,2-bromo phenyl boronic acid,2-bromo-phenyl boronic acid PubChem CID: 2773294 IUPAC Name: (2-bromophenyl)boronic acid SMILES: OB(O)C1=CC=CC=C1Br
| PubChem CID | 2773294 |
|---|---|
| CAS | 244205-40-1 |
| Molecular Weight (g/mol) | 200.83 |
| MDL Number | MFCD01114672 |
| SMILES | OB(O)C1=CC=CC=C1Br |
| Synonym | 2-bromophenyl boronic acid,o-bromophenylboronic acid,2-bromobenzeneboronic acid,2-bromophenylboronicacid,boronic acid, 2-bromophenyl,bromobenzeneboronic acid,pubchem13095,2-bromo phenyl boronic acid,2-bromo-phenyl boronic acid |
| IUPAC Name | (2-bromophenyl)boronic acid |
| InChI Key | PLVCYMZAEQRYHJ-UHFFFAOYSA-N |
| Molecular Formula | C6H6BBrO2 |
4-Bromobenzeneboronic acid, 97+%
CAS: 5467-74-3 Molecular Formula: C6H6BBrO2 Molecular Weight (g/mol): 200.83 MDL Number: MFCD00002104 InChI Key: QBLFZIBJXUQVRF-UHFFFAOYSA-N Synonym: 4-bromophenyl boronic acid,4-bromobenzeneboronic acid,4-bromophenylboric acid,p-bromophenylboronic acid,p-bromophenylboric acid,p-bromobenzeneboronic acid,boronic acid, 4-bromophenyl,benzeneboronic acid, p-bromo,p-bromophenyl boronic acid,4-bromo phenyl boronic acid PubChem CID: 79599 IUPAC Name: (4-bromophenyl)boronic acid SMILES: OB(O)C1=CC=C(Br)C=C1
| PubChem CID | 79599 |
|---|---|
| CAS | 5467-74-3 |
| Molecular Weight (g/mol) | 200.83 |
| MDL Number | MFCD00002104 |
| SMILES | OB(O)C1=CC=C(Br)C=C1 |
| Synonym | 4-bromophenyl boronic acid,4-bromobenzeneboronic acid,4-bromophenylboric acid,p-bromophenylboronic acid,p-bromophenylboric acid,p-bromobenzeneboronic acid,boronic acid, 4-bromophenyl,benzeneboronic acid, p-bromo,p-bromophenyl boronic acid,4-bromo phenyl boronic acid |
| IUPAC Name | (4-bromophenyl)boronic acid |
| InChI Key | QBLFZIBJXUQVRF-UHFFFAOYSA-N |
| Molecular Formula | C6H6BBrO2 |
3-Bromophenylboronic Acid (contains varying amounts of Anhydride), TCI America™
CAS: 89598-96-9 Molecular Formula: C6H6BBrO2 Molecular Weight (g/mol): 200.83 MDL Number: MFCD00239386 InChI Key: AFSSVCNPDKKSRR-UHFFFAOYSA-N Synonym: 3-bromophenyl boronic acid,3-bromobenzeneboronic acid,3-bromophenylboronicacid,boronic acid, 3-bromophenyl,pubchem1758,3-bromo-phenylboronic acid,acmc-209r1w,3-bromo-benzeneboronic acid,3-bromobenzene boronic acid PubChem CID: 2734318 IUPAC Name: (3-bromophenyl)boronic acid SMILES: OB(O)C1=CC=CC(Br)=C1
| PubChem CID | 2734318 |
|---|---|
| CAS | 89598-96-9 |
| Molecular Weight (g/mol) | 200.83 |
| MDL Number | MFCD00239386 |
| SMILES | OB(O)C1=CC=CC(Br)=C1 |
| Synonym | 3-bromophenyl boronic acid,3-bromobenzeneboronic acid,3-bromophenylboronicacid,boronic acid, 3-bromophenyl,pubchem1758,3-bromo-phenylboronic acid,acmc-209r1w,3-bromo-benzeneboronic acid,3-bromobenzene boronic acid |
| IUPAC Name | (3-bromophenyl)boronic acid |
| InChI Key | AFSSVCNPDKKSRR-UHFFFAOYSA-N |
| Molecular Formula | C6H6BBrO2 |
| PubChem CID | 2734318 |
|---|---|
| CAS | 89598-96-9 |
| Molecular Weight (g/mol) | 200.826 |
| MDL Number | MFCD00239386 |
| Color | White-Yellow |
| Physical Form | Crystalline Powder |
| SMILES | B(C1=CC(=CC=C1)Br)(O)O |
| Synonym | 3-bromophenyl boronic acid,3-bromobenzeneboronic acid,3-bromophenylboronicacid,boronic acid, 3-bromophenyl,pubchem1758 |
| IUPAC Name | (3-bromophenyl)boronic acid |
| InChI Key | AFSSVCNPDKKSRR-UHFFFAOYSA-N |
| Molecular Formula | C6H6BBrO2 |
| Formula Weight | 200.83 |
| Melting Point | 168°C |
3-Bromobenzeneboronic acid, 98+%
CAS: 89598-96-9 Molecular Formula: C6H6BBrO2 Molecular Weight (g/mol): 200.83 MDL Number: MFCD00239386 InChI Key: AFSSVCNPDKKSRR-UHFFFAOYSA-N Synonym: 3-bromophenyl boronic acid,3-bromobenzeneboronic acid,3-bromophenylboronicacid,boronic acid, 3-bromophenyl,pubchem1758,3-bromo-phenylboronic acid,acmc-209r1w,3-bromo-benzeneboronic acid,3-bromobenzene boronic acid PubChem CID: 2734318 IUPAC Name: (3-bromophenyl)boronic acid SMILES: OB(O)C1=CC=CC(Br)=C1
| PubChem CID | 2734318 |
|---|---|
| CAS | 89598-96-9 |
| Molecular Weight (g/mol) | 200.83 |
| MDL Number | MFCD00239386 |
| SMILES | OB(O)C1=CC=CC(Br)=C1 |
| Synonym | 3-bromophenyl boronic acid,3-bromobenzeneboronic acid,3-bromophenylboronicacid,boronic acid, 3-bromophenyl,pubchem1758,3-bromo-phenylboronic acid,acmc-209r1w,3-bromo-benzeneboronic acid,3-bromobenzene boronic acid |
| IUPAC Name | (3-bromophenyl)boronic acid |
| InChI Key | AFSSVCNPDKKSRR-UHFFFAOYSA-N |
| Molecular Formula | C6H6BBrO2 |
3,5-Dibromobenzeneboronic acid, 97%
CAS: 117695-55-3 Molecular Formula: C6H5BBr2O2 Molecular Weight (g/mol): 279.722 MDL Number: MFCD01075725 InChI Key: WQBLCGDZYFKINX-UHFFFAOYSA-N Synonym: 3,5-dibromobenzeneboronic acid,3,5-dibromophenyl boronic acid,boronic acid, 3,5-dibromophenyl,pubchem14108,acmc-2099ur,amtb596,3,5-dibromobenzeneboronicacid,ksc493i3d,3,5-dibromobenzene boronic acid PubChem CID: 2734689 IUPAC Name: (3,5-dibromophenyl)boronic acid SMILES: B(C1=CC(=CC(=C1)Br)Br)(O)O
| PubChem CID | 2734689 |
|---|---|
| CAS | 117695-55-3 |
| Molecular Weight (g/mol) | 279.722 |
| MDL Number | MFCD01075725 |
| SMILES | B(C1=CC(=CC(=C1)Br)Br)(O)O |
| Synonym | 3,5-dibromobenzeneboronic acid,3,5-dibromophenyl boronic acid,boronic acid, 3,5-dibromophenyl,pubchem14108,acmc-2099ur,amtb596,3,5-dibromobenzeneboronicacid,ksc493i3d,3,5-dibromobenzene boronic acid |
| IUPAC Name | (3,5-dibromophenyl)boronic acid |
| InChI Key | WQBLCGDZYFKINX-UHFFFAOYSA-N |
| Molecular Formula | C6H5BBr2O2 |
4-Bromophenylboronic acid, 98%
CAS: 5467-74-3 Molecular Formula: C6H6BBrO2 Molecular Weight (g/mol): 200.83 MDL Number: MFCD00002104 InChI Key: QBLFZIBJXUQVRF-UHFFFAOYSA-N Synonym: 4-bromophenyl boronic acid,4-bromobenzeneboronic acid,4-bromophenylboric acid,p-bromophenylboronic acid,p-bromophenylboric acid,p-bromobenzeneboronic acid,boronic acid, 4-bromophenyl,benzeneboronic acid, p-bromo,p-bromophenyl boronic acid,4-bromo phenyl boronic acid PubChem CID: 79599 IUPAC Name: (4-bromophenyl)boronic acid SMILES: OB(O)C1=CC=C(Br)C=C1
| PubChem CID | 79599 |
|---|---|
| CAS | 5467-74-3 |
| Molecular Weight (g/mol) | 200.83 |
| MDL Number | MFCD00002104 |
| SMILES | OB(O)C1=CC=C(Br)C=C1 |
| Synonym | 4-bromophenyl boronic acid,4-bromobenzeneboronic acid,4-bromophenylboric acid,p-bromophenylboronic acid,p-bromophenylboric acid,p-bromobenzeneboronic acid,boronic acid, 4-bromophenyl,benzeneboronic acid, p-bromo,p-bromophenyl boronic acid,4-bromo phenyl boronic acid |
| IUPAC Name | (4-bromophenyl)boronic acid |
| InChI Key | QBLFZIBJXUQVRF-UHFFFAOYSA-N |
| Molecular Formula | C6H6BBrO2 |
3-Bromophenylboronic acid, 97%
CAS: 89598-96-9 Molecular Formula: C6H6BBrO2 Molecular Weight (g/mol): 200.83 MDL Number: MFCD00239386 InChI Key: AFSSVCNPDKKSRR-UHFFFAOYSA-N Synonym: 3-bromophenyl boronic acid,3-bromobenzeneboronic acid,3-bromophenylboronicacid,boronic acid, 3-bromophenyl,pubchem1758,3-bromo-phenylboronic acid,acmc-209r1w,3-bromo-benzeneboronic acid,3-bromobenzene boronic acid PubChem CID: 2734318 IUPAC Name: (3-bromophenyl)boronic acid SMILES: OB(O)C1=CC=CC(Br)=C1
| PubChem CID | 2734318 |
|---|---|
| CAS | 89598-96-9 |
| Molecular Weight (g/mol) | 200.83 |
| MDL Number | MFCD00239386 |
| SMILES | OB(O)C1=CC=CC(Br)=C1 |
| Synonym | 3-bromophenyl boronic acid,3-bromobenzeneboronic acid,3-bromophenylboronicacid,boronic acid, 3-bromophenyl,pubchem1758,3-bromo-phenylboronic acid,acmc-209r1w,3-bromo-benzeneboronic acid,3-bromobenzene boronic acid |
| IUPAC Name | (3-bromophenyl)boronic acid |
| InChI Key | AFSSVCNPDKKSRR-UHFFFAOYSA-N |
| Molecular Formula | C6H6BBrO2 |
| PubChem CID | 79599 |
|---|---|
| CAS | 5467-74-3 |
| MDL Number | MFCD00002104 |
| Physical Form | Crystalline Powder |
| SMILES | B(C1=CC=C(C=C1)Br)(O)O |
| Synonym | 4-bromophenyl boronic acid,4-bromobenzeneboronic acid,4-bromophenylboric acid,p-bromophenylboronic acid,p-bromophenylboric acid |
| TSCA | No |
| RTECS Number | CY8650000 |
| IUPAC Name | (4-bromophenyl)boronic acid |
| InChI Key | QBLFZIBJXUQVRF-UHFFFAOYSA-N |
| Molecular Formula | C6H6BBrO2 |
| Formula Weight | 200.83 |
| Melting Point | 292°C |
4-Bromobenzenediazonium Tetrafluoroborate 97.0+%, TCI America™
CAS: 673-40-5 Molecular Formula: C6H4BBrF4N2 Molecular Weight (g/mol): 270.82 MDL Number: MFCD00011894 InChI Key: FXTCQUCYDJZGGU-UHFFFAOYSA-N Synonym: 4-bromobenzenediazonium tetrafluoroborate,acmc-209nyn,4-bromobenzene-1-diazonium; tetrafluoroboranuide,boron +3 cation; 4-bromobenzenediazonium; tetrafluoride PubChem CID: 2734810 IUPAC Name: 4-bromobenzene-1-diazonium; tetrafluoroboranuide SMILES: F[B-](F)(F)F.BrC1=CC=C(C=C1)[N+]#N
| PubChem CID | 2734810 |
|---|---|
| CAS | 673-40-5 |
| Molecular Weight (g/mol) | 270.82 |
| MDL Number | MFCD00011894 |
| SMILES | F[B-](F)(F)F.BrC1=CC=C(C=C1)[N+]#N |
| Synonym | 4-bromobenzenediazonium tetrafluoroborate,acmc-209nyn,4-bromobenzene-1-diazonium; tetrafluoroboranuide,boron +3 cation; 4-bromobenzenediazonium; tetrafluoride |
| IUPAC Name | 4-bromobenzene-1-diazonium; tetrafluoroboranuide |
| InChI Key | FXTCQUCYDJZGGU-UHFFFAOYSA-N |
| Molecular Formula | C6H4BBrF4N2 |