Diphenylethers
=O)cc1 | 1g | 415099675](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502178075.JPG-250.jpg)
eMolecules 22479-78-3 | 4-(4-Nitrophenoxy)phenol | Chem-Impex | MFCD00225451 | 231.207 | C12H9NO4 | 99.000 | Oc1ccc(Oc2ccc(cc2)[N+]([O-])=O)cc1 | 1g | 415099675
4-(4-Nitrophenoxy)phenol | Chem-Impex | 22479-78-3 | MFCD00225451 | 231.207 | C12H9NO4 | 99.000 | Oc1ccc(Oc2ccc(cc2)[N+]([O-])=O)cc1 | 1g | 415099675
eMolecules 221006-66-2 | Ambeed | (3-Phenoxyphenyl)boronic acid | 250mg | 600846899 | A744885 | MFCD07780272 | 214.03 | C12H11BO3
Ambeed | 1-Methoxy-4-nitronaphthalene | 1g | 587278778 | A393374 | 4900-63-4 | MFCD00003926 | 203.197 | C11H9NO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 116753-49-2 | 3-(3-Fluorophenoxy)propylamine | Combi-Blocks | MFCD09741966 | 169.199 | C9H12FNO | 95.000 | NCCCOc1cccc(F)c1 | 1g | 232335911
3-(3-Fluorophenoxy)propylamine | Combi-Blocks | 116753-49-2 | MFCD09741966 | 169.199 | C9H12FNO | 95.000 | NCCCOc1cccc(F)c1 | 1g | 232335911
eMolecules 587-11-1 | 2-(4-Fluorophenoxy)-2-methylpropanoic acid | MFCD00093187 | 1g
Combi-Blocks, Inc. | 2-(4-Fluorophenoxy)-2-methylpropanoic acid | 1g | 603149994 | ST-3953 | 95.000 | 587-11-1 | MFCD00093187 | 198.193 | C10H11FO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 118468-17-0 | 3-Phenoxyphenethylamine | MFCD06212625 | 5g
Ambeed | Potassium trifluoro[3-(methoxycarbonyl)phenyl]boranuide | 1g | 731677098 | A783956 | 1242733-94-3 | 242.050 | C8H7BF3KO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 66000-40-6 | Medchem Express | BW 755C | 5mg | 791206330 | HY-119671 | MFCD01038078 | 229.206 | C10H10F3N3
Medchem Express | BW 755C | 5mg | 791206330 | HY-119671 | 66000-40-6 | MFCD01038078 | 229.206 | C10H10F3N3
Cambridge Isotope Laboratories Phenylbutazone (diphenyl-D10 98%) 1 mg
Phenylbutazone (diphenyl-D10 98%) 1 mg
eMolecules 2-Chloro-4-fluoro-5-iodophenol | 148254-33-5 | MFCD22628048 | 1g
Apollo Scientific | 2-Chloro-4-fluoro-5-iodophenol | 1g | 562425697 | PC500243 | | 148254-33-5 | MFCD22628048 | 272.440 | C6H3ClFIO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
=O | 1g | 117533505](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502190452.JPG-250.jpg)
eMolecules 1038700-63-8 | N-Methyl-2-(2-nitrophenoxy)ethanamine | Combi-Blocks | MFCD11053870 | 196.206 | C9H12N2O3 | 98.000 | CNCCOc1ccccc1[N+]([O-])=O | 1g | 117533505
N-Methyl-2-(2-nitrophenoxy)ethanamine | Combi-Blocks | 1038700-63-8 | MFCD11053870 | 196.206 | C9H12N2O3 | 98.000 | CNCCOc1ccccc1[N+]([O-])=O | 1g | 117533505
eMolecules 165250-87-3 | 4-(3-AMINOPHENOXY)BENZOIC ACID | AstaTech | MFCD16620220 | 229.235 | C13H11NO3 | 95.000 | Nc1cccc(Oc2ccc(cc2)C(O)=O)c1 | 1g | 416217801
4-(3-AMINOPHENOXY)BENZOIC ACID | AstaTech | 165250-87-3 | MFCD16620220 | 229.235 | C13H11NO3 | 95.000 | Nc1cccc(Oc2ccc(cc2)C(O)=O)c1 | 1g | 416217801
eMolecules 1002557-25-6 | 2-(4-FLUOROPHENOXY)BENZYLAMINE HCL | AstaTech | MFCD03840020 | 253.700 | C13H13ClFNO | 95.000 | Cl.NCc1ccccc1Oc1ccc(F)cc1 | 1g | 112530811
2-(4-FLUOROPHENOXY)BENZYLAMINE HCL | AstaTech | 1002557-25-6 | MFCD03840020 | 253.700 | C13H13ClFNO | 95.000 | Cl.NCc1ccccc1Oc1ccc(F)cc1 | 1g | 112530811
eMolecules 1464091-46-0 | TERT-BUTYL 3-(3-NITROPHENOXY)PIPERIDINE-1-CARBOXYLATE | MFCD09953095 | 1g
Ambeed | 2-Bromo-6-nitrobenzaldehyde | 100mg | 521438257 | A354082 | 20357-21-5 | MFCD09040530 | 230.017 | C7H4BrNO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Chem-Impex International, Inc. 4,4'-Oxybis(benzoic acid) | MFCD00013988 | 25G
4,4'-Oxybis(benzoic acid), MFCD00013988, 25G
eMolecules 62373-80-2 | 3-(4-Methoxyphenoxy)benzaldehyde | Oakwood Chemical | MFCD00003358 | 228.247 | C14H12O3 | 97.000 | COc1ccc(Oc2cccc(C=O)c2)cc1 | 1g | 537722172
3-(4-Methoxyphenoxy)benzaldehyde | Oakwood Chemical | 62373-80-2 | MFCD00003358 | 228.247 | C14H12O3 | 97.000 | COc1ccc(Oc2cccc(C=O)c2)cc1 | 1g | 537722172
eMolecules 101-84-8 | Diphenyl ether | Oakwood Chemicals | MFCD00003034 | 170.211 | C12H10O | 99.000 | O(c1ccccc1)c1ccccc1 | 18kg | 480150166
Diphenyl ether | Oakwood Chemicals | 101-84-8 | MFCD00003034 | 170.211 | C12H10O | 99.000 | O(c1ccccc1)c1ccccc1 | 18kg | 480150166