Diphenylethers
eMolecules 79124-75-7 | 3-(4-Methylphenoxy)-benzaldehyde | Oakwood Chemical | MFCD00003360 | 212.248 | C14H12O2 | 97.000 | Cc1ccc(Oc2cccc(C=O)c2)cc1 | 1g | 537709807
3-(4-Methylphenoxy)-benzaldehyde | Oakwood Chemical | 79124-75-7 | MFCD00003360 | 212.248 | C14H12O2 | 97.000 | Cc1ccc(Oc2cccc(C=O)c2)cc1 | 1g | 537709807
Chem-Impex International, Inc. 4-Phenoxybenzaldehyde | MFCD00003383 | 1G
4-Phenoxybenzaldehyde, MFCD00003383, 1G
Chem-Impex International, Inc. 4-Phenoxybenzoic acid | 2215-77-2 | MFCD00002539 | 25G
4-Phenoxybenzoic acid, 2215-77-2, MFCD00002539, 25G
![Medchemexpress LLC Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) | 31277-98-2 | MFCD00009880 | ≥98.0% | 903.25 g·mol⁻¹ | C52H48P4Pd | 1 G](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000301988.png-250.jpg)
Medchemexpress LLC Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) | 31277-98-2 | MFCD00009880 | ≥98.0% | 903.25 g·mol⁻¹ | C52H48P4Pd | 1 G
Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) is a zero-valent palladium complex supplied as a light yellow to brown solid. It is used as a preformed Pd(0) source for homogeneous catalysis in cross-coupling and related organic transformations, providing consistent activity without in-situ reduction steps.
- Zero-valent palladium complex for homogeneous catalysis.
- Suitable as a preformed Pd(0) source for cross-coupling reactions.
- High purity (≥98.0%) for reproducible performance.
- Molecular weight 903.25 g·mol⁻¹ and formula C52H48P4Pd.
- Air-sensitive; store at -20 °C under inert atmosphere.
eMolecules 855239-61-1 | 3,3''-DIIODO-5'-(3-IODOPHENYL)-1,1':3',1''-TERPHENYL | AstaTech | MFCD13193234 | 684.097 | C24H15I3 | 95.000 | Ic1cccc(c1)-c1cc(cc(c1)-c1cccc(I)c1)-c1cccc(I)c1 | 0.1g | 722706707
3,3''-DIIODO-5'-(3-IODOPHENYL)-1,1':3',1''-TERPHENYL | AstaTech | 855239-61-1 | MFCD13193234 | 684.097 | C24H15I3 | 95.000 | Ic1cccc(c1)-c1cc(cc(c1)-c1cccc(I)c1)-c1cccc(I)c1 | 0.1g | 722706707
eMolecules 106797-69-7 | 3-(3-phenoxyphenyl)propan-1-ol | MFCD09028720 | 250mg
ChemScene | 3H-123-Triazolo[45-d]pyrimidin-7-amine | 100mg | 602865979 | CS-W008550 | 1123-54-2 | MFCD00778514 | 136.118 | C4H4N6
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 851199-61-6 | 2,4-DIFLUORO-1-(4-IODOPHENOXY)-BENZENE | AstaTech | MFCD18207466 | 332.088 | C12H7F2IO | 95.000 | Fc1ccc(Oc2ccc(I)cc2)c(F)c1 | 0.25g | 448270233
2,4-DIFLUORO-1-(4-IODOPHENOXY)-BENZENE | AstaTech | 851199-61-6 | MFCD18207466 | 332.088 | C12H7F2IO | 95.000 | Fc1ccc(Oc2ccc(I)cc2)c(F)c1 | 0.25g | 448270233
Aobchem N-(4-chloro-2-formylphenyl)-2 2-dimethylpropionamide | ≥97% | CAS 127472-35-9 | C12H14ClNO2 | 1g
N-(4-chloro-2-formylphenyl)-2 2-dimethylpropionamide | ≥97% | CAS 127472-35-9 | C12H14ClNO2 | 1g
![eMolecules 1072944-62-7 | 4-(2-Bromo-4-nitrophenoxy)tetrahydro-2H-pyran | Combi-Blocks | MFCD11504903 | 302.124 | C11H12BrNO4 | 96.000 | [O-][N+](=O)c1ccc(OC2CCOCC2)c(Br)c1 | 1g | 117530276](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502190482.JPG-250.jpg)
eMolecules 1072944-62-7 | 4-(2-Bromo-4-nitrophenoxy)tetrahydro-2H-pyran | Combi-Blocks | MFCD11504903 | 302.124 | C11H12BrNO4 | 96.000 | [O-][N+](=O)c1ccc(OC2CCOCC2)c(Br)c1 | 1g | 117530276
4-(2-Bromo-4-nitrophenoxy)tetrahydro-2H-pyran | Combi-Blocks | 1072944-62-7 | MFCD11504903 | 302.124 | C11H12BrNO4 | 96.000 | [O-][N+](=O)c1ccc(OC2CCOCC2)c(Br)c1 | 1g | 117530276
eMolecules 67-36-7 | Ambeed | 4-Phenoxybenzaldehyde | 10g | 490559754 | A396423 | MFCD00003383 | 198.221 | C13H10O2
Ambeed | 4-Phenoxybenzaldehyde | 10g | 490559754 | A396423 | 67-36-7 | MFCD00003383 | 198.221 | C13H10O2
eMolecules 110231-30-6 | Diphenyl-1-pyrenylphosphine | Ambeed | MFCD00278755 | 386.434 | C28H19P | 95.000 | c1ccc(cc1)P(c1ccccc1)c1ccc2ccc3cccc4ccc1c2c34 | 5g | 517261637
Diphenyl-1-pyrenylphosphine | Ambeed | 110231-30-6 | MFCD00278755 | 386.434 | C28H19P | 95.000 | c1ccc(cc1)P(c1ccccc1)c1ccc2ccc3cccc4ccc1c2c34 | 5g | 517261637