Diphenylethers
eMolecules 36881-42-2 | 1-(Bromomethyl)-4-phenoxybenzene | Combi-Blocks | MFCD04038693 | 263.134 | C13H11BrO | 97.000 | BrCc1ccc(Oc2ccccc2)cc1 | 1g | 117562705
1-(Bromomethyl)-4-phenoxybenzene | Combi-Blocks | 36881-42-2 | MFCD04038693 | 263.134 | C13H11BrO | 97.000 | BrCc1ccc(Oc2ccccc2)cc1 | 1g | 117562705
eMolecules 330792-70-6 | Ambeed | 3-Amino-5-(4-phenoxyphenyl)pyrazole-4-carbonitrile | 5g | 570996070 | A464244 | MFCD20270361 | 276.299 | C16H12N4O
Ambeed | Methyl 4-methylbenzenesulfonate | 500g | 525099967 | A182547 | 80-48-8 | MFCD00008417 | 186.230 | C8H10O3S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 67-36-7 | Ambeed | 4-Phenoxybenzaldehyde | 10g | 490559754 | A396423 | MFCD00003383 | 198.221 | C13H10O2
Ambeed | 4-Phenoxybenzaldehyde | 10g | 490559754 | A396423 | 67-36-7 | MFCD00003383 | 198.221 | C13H10O2
Cambridge Isotope Laboratories Polybrominated Diphenyl Ether Performance Standard Stock (10X) Solution (13C12 99%) 1 2 mL
Polybrominated Diphenyl Ether Performance Standard Stock (10X) Solution (13C12 99%) 1 2 mL
eMolecules 79124-75-7 | 3-(4-Methylphenoxy)-benzaldehyde | Oakwood Chemical | MFCD00003360 | 212.248 | C14H12O2 | 97.000 | Cc1ccc(Oc2cccc(C=O)c2)cc1 | 1g | 537709807
3-(4-Methylphenoxy)-benzaldehyde | Oakwood Chemical | 79124-75-7 | MFCD00003360 | 212.248 | C14H12O2 | 97.000 | Cc1ccc(Oc2cccc(C=O)c2)cc1 | 1g | 537709807
=O)cc1 | 1g | 415099675](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502178075.JPG-250.jpg)
eMolecules 22479-78-3 | 4-(4-Nitrophenoxy)phenol | Chem-Impex | MFCD00225451 | 231.207 | C12H9NO4 | 99.000 | Oc1ccc(Oc2ccc(cc2)[N+]([O-])=O)cc1 | 1g | 415099675
4-(4-Nitrophenoxy)phenol | Chem-Impex | 22479-78-3 | MFCD00225451 | 231.207 | C12H9NO4 | 99.000 | Oc1ccc(Oc2ccc(cc2)[N+]([O-])=O)cc1 | 1g | 415099675
eMolecules 118468-17-0 | 3-Phenoxyphenethylamine | MFCD06212625 | 5g
Ambeed | Potassium trifluoro[3-(methoxycarbonyl)phenyl]boranuide | 1g | 731677098 | A783956 | 1242733-94-3 | 242.050 | C8H7BF3KO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 2-Chloro-4-fluoro-5-iodophenol | 148254-33-5 | MFCD22628048 | 1g
Apollo Scientific | 2-Chloro-4-fluoro-5-iodophenol | 1g | 562425697 | PC500243 | | 148254-33-5 | MFCD22628048 | 272.440 | C6H3ClFIO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Aobchem Potassium (4-formylphenyl)trifluoroborate | ≥97% | CAS 374564-36-0 | C7H5BF3KO | 10g
Potassium (4-formylphenyl)trifluoroborate | ≥97% | CAS 374564-36-0 | C7H5BF3KO | 10g