Diphenylethers
eMolecules 1213269-26-1 | 4-(3-Aminophenoxy)-5-chloro-N-(2-methoxy-4-(4-methylpiperazin-1-yl)phenyl)pyrimidin-2-amine | 250mg
ChemScene | 22-Dimethylchroman-6-sulfonyl chloride | 100mg | 654747279 | CS-0199305 | 131880-55-2 | MFCD03407324 | 260.730 | C11H13ClO3S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Sigma Aldrich Fine Chemicals Biosciences 4-Phenoxyphenol 99% | 831-82-3 | MFCD00002331 | 5G
4-Phenoxyphenol 99% | Purity: 99% | Mol Wt: 186.21 | 831-82-3 | MFCD00002331 | 5G
=O | 1g | 495881165](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502167742.JPG-250.jpg)
eMolecules 1818885-57-2 | 2-(2-(2-(2-(4-Nitrophenoxy)ethoxy)ethoxy)ethoxy)ethanamine | Synthonix - Stock | MFCD30491824 | 314.338 | C14H22N2O6 | 95.000 | NCCOCCOCCOCCOc1ccc(cc1)[N+]([O-])=O | 1g | 495881165
2-(2-(2-(2-(4-Nitrophenoxy)ethoxy)ethoxy)ethoxy)ethanamine | Synthonix - Stock | 1818885-57-2 | MFCD30491824 | 314.338 | C14H22N2O6 | 95.000 | NCCOCCOCCOCCOc1ccc(cc1)[N+]([O-])=O | 1g | 495881165
Chemscene ChemScene | 2-Phenoxybenzeneboronic acid | 10G | CS-W014952 | 0.98 | 108238-09-1| MFCD01001592 | 214.029
ChemScene | 2-Phenoxybenzeneboronic acid | 10G | CS-W014952 | 0.98 | 108238-09-1| MFCD01001592 | 214.029
Sigma Aldrich Fine Chemicals Biosciences 4-(4-Formylphenoxy)benzaldehyde 96% | 2215-76-1 | MFCD08276812 | 1G
4-(4-Formylphenoxy)benzaldehyde 96% | Purity: 96% | Mol Wt: 226.23 | 2215-76-1 | MFCD08276812 | 1G
=O | 1g | 495881164](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502167741.JPG-250.jpg)
eMolecules 168784-48-3 | 2-(2-(2-(2-(4-Nitrophenoxy)ethoxy)ethoxy)ethoxy)ethyl 4-methylbenzenesulfonate | Synthonix - Stock | MFCD30491823 | 469.510 | C21H27NO9S | 95.000 | Cc1ccc(cc1)S(=O)(=O)OCCOCCOCCOCCOc1ccc(cc1)[N+]([O-])=O | 1g | 495881164
2-(2-(2-(2-(4-Nitrophenoxy)ethoxy)ethoxy)ethoxy)ethyl 4-methylbenzenesulfonate | Synthonix - Stock | 168784-48-3 | MFCD30491823 | 469.510 | C21H27NO9S | 95.000 | Cc1ccc(cc1)S(=O)(=O)OCCOCCOCCOCCOc1ccc(cc1)[N+]([O-])=O | 1g | 495881164
eMolecules 30118-32-2 | N-(4-Phenoxyphenyl)methanesulfonamide | Combi-Blocks, Inc. | MFCD01243799 | 263.310 | C13H13NO3S | 98.000 | CS(=O)(=O)Nc1ccc(Oc2ccccc2)cc1 | 1g | 569297154
N-(4-Phenoxyphenyl)methanesulfonamide | Combi-Blocks, Inc. | 30118-32-2 | MFCD01243799 | 263.310 | C13H13NO3S | 98.000 | CS(=O)(=O)Nc1ccc(Oc2ccccc2)cc1 | 1g | 569297154
eMolecules 2215-78-3 | (4-Phenoxyphenyl)methanol | ChemScene | MFCD01463970 | 200.237 | C13H12O2 | 98.000 | OCc1ccc(Oc2ccccc2)cc1 | 1g | 582648129
(4-Phenoxyphenyl)methanol | ChemScene | 2215-78-3 | MFCD01463970 | 200.237 | C13H12O2 | 98.000 | OCc1ccc(Oc2ccccc2)cc1 | 1g | 582648129
eMolecules 113187-84-1 | METHYL 4-(2-AMINOPHENOXY)BENZOATE | AstaTech | MFCD08688148 | 243.262 | C14H13NO3 | 95.000 | COC(=O)c1ccc(Oc2ccccc2N)cc1 | 1g | 441563978
METHYL 4-(2-AMINOPHENOXY)BENZOATE | AstaTech | 113187-84-1 | MFCD08688148 | 243.262 | C14H13NO3 | 95.000 | COC(=O)c1ccc(Oc2ccccc2N)cc1 | 1g | 441563978
eMolecules 86607-76-3 | 1-Bromo-2-(4-nitrophenoxy)benzene | MFCD02106046 | 1g
Combi-Blocks | 1-Bromo-2-(4-nitrophenoxy)benzene | 1g | 232301515 | AN-3456 | 98.000 | 86607-76-3 | MFCD02106046 | 294.104 | C12H8BrNO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 227275-23-2 | METHYL 3-(2-AMINOPHENOXY)BENZOATE | AstaTech | MFCD08688146 | 243.262 | C14H13NO3 | 95.000 | COC(=O)c1cccc(Oc2ccccc2N)c1 | 1g | 416218268
METHYL 3-(2-AMINOPHENOXY)BENZOATE | AstaTech | 227275-23-2 | MFCD08688146 | 243.262 | C14H13NO3 | 95.000 | COC(=O)c1cccc(Oc2ccccc2N)c1 | 1g | 416218268
ALADDIN SCIENTIFIC CORPORATION 1a1-Diphenyl-2-picrylhydrazyl , 100mg
22-Diphenyl-1-picrylhydrazyl is used as a sensitive colorimetric free radical scavenger It serves as a general antioxidant detector It is utilized to monitor chemical reactions involving radicals as well as a standard of the position and intensity of electron paramagnetic resonance signals Further it is employed in the quantitative determination of aliphatic and aromatic thiols by indirect spectroscopy and for photometric determination of tocopherol