Diphenylethers
Sigma Aldrich Fine Chemicals Biosciences 4-(4-Formylphenoxy)benzaldehyde 96% | 2215-76-1 | MFCD08276812 | 1G
4-(4-Formylphenoxy)benzaldehyde 96% | Purity: 96% | Mol Wt: 226.23 | 2215-76-1 | MFCD08276812 | 1G
=O | 1g | 495881164](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502167741.JPG-250.jpg)
eMolecules 168784-48-3 | 2-(2-(2-(2-(4-Nitrophenoxy)ethoxy)ethoxy)ethoxy)ethyl 4-methylbenzenesulfonate | Synthonix - Stock | MFCD30491823 | 469.510 | C21H27NO9S | 95.000 | Cc1ccc(cc1)S(=O)(=O)OCCOCCOCCOCCOc1ccc(cc1)[N+]([O-])=O | 1g | 495881164
2-(2-(2-(2-(4-Nitrophenoxy)ethoxy)ethoxy)ethoxy)ethyl 4-methylbenzenesulfonate | Synthonix - Stock | 168784-48-3 | MFCD30491823 | 469.510 | C21H27NO9S | 95.000 | Cc1ccc(cc1)S(=O)(=O)OCCOCCOCCOCCOc1ccc(cc1)[N+]([O-])=O | 1g | 495881164
eMolecules 30118-32-2 | N-(4-Phenoxyphenyl)methanesulfonamide | Combi-Blocks, Inc. | MFCD01243799 | 263.310 | C13H13NO3S | 98.000 | CS(=O)(=O)Nc1ccc(Oc2ccccc2)cc1 | 1g | 569297154
N-(4-Phenoxyphenyl)methanesulfonamide | Combi-Blocks, Inc. | 30118-32-2 | MFCD01243799 | 263.310 | C13H13NO3S | 98.000 | CS(=O)(=O)Nc1ccc(Oc2ccccc2)cc1 | 1g | 569297154
eMolecules 2215-78-3 | (4-Phenoxyphenyl)methanol | ChemScene | MFCD01463970 | 200.237 | C13H12O2 | 98.000 | OCc1ccc(Oc2ccccc2)cc1 | 1g | 582648129
(4-Phenoxyphenyl)methanol | ChemScene | 2215-78-3 | MFCD01463970 | 200.237 | C13H12O2 | 98.000 | OCc1ccc(Oc2ccccc2)cc1 | 1g | 582648129
eMolecules 113187-84-1 | METHYL 4-(2-AMINOPHENOXY)BENZOATE | AstaTech | MFCD08688148 | 243.262 | C14H13NO3 | 95.000 | COC(=O)c1ccc(Oc2ccccc2N)cc1 | 1g | 441563978
METHYL 4-(2-AMINOPHENOXY)BENZOATE | AstaTech | 113187-84-1 | MFCD08688148 | 243.262 | C14H13NO3 | 95.000 | COC(=O)c1ccc(Oc2ccccc2N)cc1 | 1g | 441563978
eMolecules 86607-76-3 | 1-Bromo-2-(4-nitrophenoxy)benzene | MFCD02106046 | 1g
Combi-Blocks | 1-Bromo-2-(4-nitrophenoxy)benzene | 1g | 232301515 | AN-3456 | 98.000 | 86607-76-3 | MFCD02106046 | 294.104 | C12H8BrNO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 227275-23-2 | METHYL 3-(2-AMINOPHENOXY)BENZOATE | AstaTech | MFCD08688146 | 243.262 | C14H13NO3 | 95.000 | COC(=O)c1cccc(Oc2ccccc2N)c1 | 1g | 416218268
METHYL 3-(2-AMINOPHENOXY)BENZOATE | AstaTech | 227275-23-2 | MFCD08688146 | 243.262 | C14H13NO3 | 95.000 | COC(=O)c1cccc(Oc2ccccc2N)c1 | 1g | 416218268
eMolecules 474843-41-9 | 3-Amino-5-(4-phenoxyphenyl)thiophene-2-carboxylic acid methyl ester | Oakwood Chemicals | MFCD04116404 | 325.380 | C18H15NO3S | 97.000 | COC(=O)c1sc(cc1N)-c1ccc(Oc2ccccc2)cc1 | 1g | 480116392
3-Amino-5-(4-phenoxyphenyl)thiophene-2-carboxylic acid methyl ester | Oakwood Chemicals | 474843-41-9 | MFCD04116404 | 325.380 | C18H15NO3S | 97.000 | COC(=O)c1sc(cc1N)-c1ccc(Oc2ccccc2)cc1 | 1g | 480116392
=O)cc1[N+]([O-])=O | 1g | 537713226](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502150243.JPG-250.jpg)
eMolecules 3273-78-7 | 4-(4-Amino-3-nitrophenoxy)-2-nitroaniline | Oakwood Chemical | MFCD00050456 | 290.235 | C12H10N4O5 | 94.000 | Nc1ccc(Oc2ccc(N)c(c2)[N+]([O-])=O)cc1[N+]([O-])=O | 1g | 537713226
4-(4-Amino-3-nitrophenoxy)-2-nitroaniline | Oakwood Chemical | 3273-78-7 | MFCD00050456 | 290.235 | C12H10N4O5 | 94.000 | Nc1ccc(Oc2ccc(N)c(c2)[N+]([O-])=O)cc1[N+]([O-])=O | 1g | 537713226
Sigma Aldrich Fine Chemicals Biosciences Diphenyl ether >=99%, FG | 101-84-8 | MFCD00003034 | 1KG
Diphenyl ether >=99%, FG | Purity: >=99% | Mol Wt: 170.21 | 101-84-8 | MFCD00003034 | 1KG
Sigma Aldrich Fine Chemicals Biosciences Diphenyl ether >=99%, FG | 101-84-8 | MFCD00003034 | 10KG
Diphenyl ether >=99%, FG | Purity: >=99% | Mol Wt: 170.21 | 101-84-8 | MFCD00003034 | 10KG
eMolecules 1254332-83-6 | 1-(4-BROMO-2-NITROPHENOXY)PROPAN-2-ONE | MFCD21235579 | 1g
ChemScene | 5-Iodo-2-methylthiazole | 100mg | 717420961 | CS-0528714 | 1412902-50-1 | MFCD22479546 | 225.050 | C4H4INS
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 30202-93-8 | 4-(3-AMINOPHENOXY)BENZONITRILE | AstaTech | MFCD00458959 | 210.236 | C13H10N2O | 95.000 | Nc1cccc(Oc2ccc(cc2)C#N)c1 | 1g | 444379971
4-(3-AMINOPHENOXY)BENZONITRILE | AstaTech | 30202-93-8 | MFCD00458959 | 210.236 | C13H10N2O | 95.000 | Nc1cccc(Oc2ccc(cc2)C#N)c1 | 1g | 444379971
eMolecules 6876-00-2 | Ambeed | 1-Bromo-3-phenoxybenzene | 1g | 490562454 | A456205 | MFCD00474520 | 249.107 | C12H9BrO
Ambeed | 1-Bromo-3-phenoxybenzene | 1g | 490562454 | A456205 | 6876-00-2 | MFCD00474520 | 249.107 | C12H9BrO
Medchemexpress LLC Diphenyl Blue | 72-57-1 | 39.0% | 25 G
Diphenyl Blue (Trypan Blue) is a cell-active dye, most commonly used for the identification of dead cells. It is frequently employed to assess cell membrane integrity and cell viability. This dye stains deactivated cells or those with incomplete cell membranes blue, while normal living cells with intact membranes do not absorb it. Macrophages, however, can phagocytose Diphenyl Blue, allowing its use as a living stain for these cells.
- Cell-active dye
- Most commonly used dye for the identification of dead cells
- Used to test cell membrane integrity and cell viability
- Can be used as a living stain for macrophages