Iodobenzenes
Accela Chembio Inc 4-iodobiphenyl | 100g | 1591-31-7 | MFCD00019028 | 97+% | Shelf Life: 1260 Days | Light Sensitive
4-iodobiphenyl | 100g | 1591-31-7 | MFCD00019028 | 97+% | Shelf Life: 1260 Days | Light Sensitive
eMolecules 591-50-4 | Iodobenzene | Ambeed | MFCD00001029 | 204.010 | C6H5I | 98.000 | Ic1ccccc1 | 10g | 525165610
Iodobenzene | Ambeed | 591-50-4 | MFCD00001029 | 204.010 | C6H5I | 98.000 | Ic1ccccc1 | 10g | 525165610
eMolecules 77770-09-3 | 2-Amino-4-iodoanisole | Ambeed | MFCD03095407 | 249.051 | C7H8INO | 98.000 | COc1ccc(I)cc1N | 250mg | 552665575
2-Amino-4-iodoanisole | Ambeed | 77770-09-3 | MFCD03095407 | 249.051 | C7H8INO | 98.000 | COc1ccc(I)cc1N | 250mg | 552665575
eMolecules 944276-67-9 | 4-Bromo-2-iodobenzonitrile | MFCD09907887 | 1g
Ambeed | 4-Bromo-2-iodobenzonitrile | 1g | 600848508 | A823564 | 944276-67-9 | MFCD09907887 | 307.916 | C7H3BrIN
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 289039-21-0 | 3-Bromo-5-iodobenzonitrile | MFCD00672949 | 1g
Ambeed | 3-Fluoro-5-(4455-tetramethyl-132-dioxaborolan-2-yl)pyridine | 250mg | 586027590 | A140692 | 719268-92-5 | MFCD07780754 | 223.050 | C11H15BFNO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
AURUM PHARMATECH INC 3-BROMO-5-IODOPHENYLACETIC 1G
3-BROMO-5-IODOPHENYLACETIC ACID | 1261601-75-5 | MFCD18391765 | 1G
Matrix Scientific 5-FLUORO-2-IODONITROBENZENE-5G
5-Fluoro-2-iodonitrobenzene, 98%; 5g,C6H3FINO2, MFCD00153169, mw 267.00, [364-77-2]
eMolecules 518070-17-2 | 1-(Difluoromethoxy)-3-iodobenzene | ChemScene | MFCD03094307 | 270.017 | C7H5F2IO | 97.000 | FC(F)Oc1cccc(I)c1 | 1g | 632339806
1-(Difluoromethoxy)-3-iodobenzene | ChemScene | 518070-17-2 | MFCD03094307 | 270.017 | C7H5F2IO | 97.000 | FC(F)Oc1cccc(I)c1 | 1g | 632339806
Chemscene ChemScene | Methyl 4-chloro-2-iodobenzoate | 1G | CS-0041112 | 0.98 | 181765-85-5| MFCD12024993 | 296.49
ChemScene | Methyl 4-chloro-2-iodobenzoate | 1G | CS-0041112 | 0.98 | 181765-85-5| MFCD12024993 | 296.49
eMolecules 408492-28-4 | 3-Iodophenylboronic acid, pinacol ester | Combi-Blocks | MFCD09953498 | 329.970 | C12H16BIO2 | 98.000 | CC1(C)OB(OC1(C)C)c1cccc(I)c1 | 25g | 267168058
3-Iodophenylboronic acid, pinacol ester | Combi-Blocks | 408492-28-4 | MFCD09953498 | 329.970 | C12H16BIO2 | 98.000 | CC1(C)OB(OC1(C)C)c1cccc(I)c1 | 25g | 267168058
eMolecules 155798-08-6 | Medchem Express | 4-IBP | 5mg | 446255023 | HY-100155 | MFCD00673910 | 420.294 | C19H21IN2O
Ambeed | 37-Dibromo-10H-phenothiazine | 250mg | 666598504 | A522338 | 21667-32-3 | MFCD30531816 | 357.060 | C12H7Br2NS
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Medchemexpress LLC Isovanillic acid | 645-08-9 | 5 MG
Isovanillic acid (3-Hydroxy-4-methoxybenzoic acid) is a phenolic acid isolated from *Scrophularia ningpoensis*. It exhibits anti-thrombotic activity and is involved in various biological processes.
- Increases 2-[14C(U)]-deoxy-D-glucose (2-DG) uptake in LHCN-M2 cells, which has potential in research of insulin resistance and type 2 diabetes
- Exhibits uncompetitive inhibitory activity against thrombin
- Inhibits the formation of fibrin clot and blood clot
- Prolongs partial thromboplastin time
- Increases platelet aggregation closure time, showing antithrombotic, anticoagulant, and antiplatelet activities
=O)c1ccccc1 | 1kg | 296390664](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000130750.jpg-250.jpg)
eMolecules 3240-34-4 | Iodobenzene diacetate | Combi-Blocks | MFCD00008692 | 322.098 | C10H11IO4 | 95.000 | CC(=O)O[I](OC(C)=O)c1ccccc1 | 1kg | 296390664
Iodobenzene diacetate | Combi-Blocks | 3240-34-4 | MFCD00008692 | 322.098 | C10H11IO4 | 95.000 | CC(=O)O[I](OC(C)=O)c1ccccc1 | 1kg | 296390664
eMolecules 665033-21-6 | Ambeed | 3-Amino-4-iodobenzonitrile | 1g | 491683725 | A882776 | MFCD18389612 | 244.035 | C7H5IN2
Ambeed | 3-Amino-4-iodobenzonitrile | 1g | 491683725 | A882776 | 665033-21-6 | MFCD18389612 | 244.035 | C7H5IN2
eMolecules 107623-21-2 | 1-(Benzyloxy)-3-iodobenzene | Oakwood Chemicals | MFCD01318100 | 310.134 | C13H11IO | 99.000 | Ic1cccc(OCc2ccccc2)c1 | 25g | 486566526
1-(Benzyloxy)-3-iodobenzene | Oakwood Chemicals | 107623-21-2 | MFCD01318100 | 310.134 | C13H11IO | 99.000 | Ic1cccc(OCc2ccccc2)c1 | 25g | 486566526