Methoxybenzenes
eMolecules 202925-08-4 | 3-Chloro-5-fluoroanisole | Apollo Scientific | MFCD00070770 | 160.570 | C7H6ClFO | 98.000 | COc1cc(F)cc(Cl)c1 | 10g | 562455648
3-Chloro-5-fluoroanisole | Apollo Scientific | 202925-08-4 | MFCD00070770 | 160.570 | C7H6ClFO | 98.000 | COc1cc(F)cc(Cl)c1 | 10g | 562455648
![eMolecules 94800-23-4 | [(2-Methoxyphenyl)amino]acetic acid | Combi-Blocks | MFCD00504580 | 181.191 | C9H11NO3 | 98.000 | COc1ccccc1NCC(O)=O | 1g | 342865543](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502184695.JPG-250.jpg)
eMolecules 94800-23-4 | [(2-Methoxyphenyl)amino]acetic acid | Combi-Blocks | MFCD00504580 | 181.191 | C9H11NO3 | 98.000 | COc1ccccc1NCC(O)=O | 1g | 342865543
[(2-Methoxyphenyl)amino]acetic acid | Combi-Blocks | 94800-23-4 | MFCD00504580 | 181.191 | C9H11NO3 | 98.000 | COc1ccccc1NCC(O)=O | 1g | 342865543
Accela Chembio Inc 9 | 10-bis(4-methoxyphenyl)-2-chloroanthracene | 1g | 110904-87-5 | MFCD00009935 | 95+% | Shelf Life: 1260 Days | Light Sensitive/nitrogen Or Argon
9 | 10-bis(4-methoxyphenyl)-2-chloroanthracene | 1g | 110904-87-5 | MFCD00009935 | 95+% | Shelf Life: 1260 Days | Light Sensitive/nitrogen Or Argon
Accela Chembio Inc 3-bromo-5-fluoroanisole | 25g | 29578-39-0 | MFCD01861129 | 97+% | D: 1.59 | Shelf Life: 1620 Days | Light Sensitive
3-bromo-5-fluoroanisole | 25g | 29578-39-0 | MFCD01861129 | 97+% | D: 1.59 | Shelf Life: 1620 Days | Light Sensitive
eMolecules 621-23-8 | 1,3,5-Trimethoxybenzene | Combi-Blocks | MFCD00008385 | 168.192 | C9H12O3 | 98.000 | COc1cc(OC)cc(OC)c1 | 100g | 117543990
1,3,5-Trimethoxybenzene | Combi-Blocks | 621-23-8 | MFCD00008385 | 168.192 | C9H12O3 | 98.000 | COc1cc(OC)cc(OC)c1 | 100g | 117543990
eMolecules 1229-55-6 | 1-((2-Methoxyphenyl)diazenyl)naphthalen-2-ol | Oakwood Chemical | MFCD00046377 | 278.311 | C17H14N2O2 | 95.000 | COc1ccccc1\N=N\c1c(O)ccc2ccccc12 | 5g | 537719174
1-((2-Methoxyphenyl)diazenyl)naphthalen-2-ol | Oakwood Chemical | 1229-55-6 | MFCD00046377 | 278.311 | C17H14N2O2 | 95.000 | COc1ccccc1\N=N\c1c(O)ccc2ccccc12 | 5g | 537719174
Chemscene ChemScene | 1-Chloro-2-fluoro-4-methoxybenzene | 25G | CS-W010874 | 0.98 | 501-29-1| MFCD00042570 | 160.57
ChemScene | 1-Chloro-2-fluoro-4-methoxybenzene | 25G | CS-W010874 | 0.98 | 501-29-1| MFCD00042570 | 160.57
eMolecules 100-66-3 | Anisole | Oakwood Chemicals | MFCD00008354 | 108.140 | C7H8O | 99.000 | COc1ccccc1 | 5g | 480170476
Anisole | Oakwood Chemicals | 100-66-3 | MFCD00008354 | 108.140 | C7H8O | 99.000 | COc1ccccc1 | 5g | 480170476
eMolecules 100-66-3 | Anisole | Oakwood Chemicals | MFCD00008354 | 108.140 | C7H8O | 99.000 | COc1ccccc1 | 100g | 480170478
Anisole | Oakwood Chemicals | 100-66-3 | MFCD00008354 | 108.140 | C7H8O | 99.000 | COc1ccccc1 | 100g | 480170478
eMolecules 621-23-8 | 1,3,5-Trimethoxybenzene | Accela ChemBio (ASD) | MFCD00008385 | 168.192 | C9H12O3 | 98.000 | COc1cc(OC)cc(OC)c1 | 5g | 375960082
1,3,5-Trimethoxybenzene | Accela ChemBio (ASD) | 621-23-8 | MFCD00008385 | 168.192 | C9H12O3 | 98.000 | COc1cc(OC)cc(OC)c1 | 5g | 375960082
eMolecules 621-23-8 | 1,3,5-Trimethoxybenzene | Oakwood Chemical | MFCD00008385 | 168.192 | C9H12O3 | 98.000 | COc1cc(OC)cc(OC)c1 | 500g | 549157144
1,3,5-Trimethoxybenzene | Oakwood Chemical | 621-23-8 | MFCD00008385 | 168.192 | C9H12O3 | 98.000 | COc1cc(OC)cc(OC)c1 | 500g | 549157144
![eMolecules 425645-37-0 | N-[1-[(4-Methoxyphenyl)amino]-2-(4-methylphenyl)-2-oxoethyl]-2-furancarboxamide | Oakwood Chemicals | MFCD01457647 | 364.401 | C21H20N2O4 | 95.000 | COc1ccc(NC(NC(=O)c2ccco2)C(=O)c2ccc(C)cc2)cc1 | 10mg | 480151912](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502150110.JPG-250.jpg)
eMolecules 425645-37-0 | N-[1-[(4-Methoxyphenyl)amino]-2-(4-methylphenyl)-2-oxoethyl]-2-furancarboxamide | Oakwood Chemicals | MFCD01457647 | 364.401 | C21H20N2O4 | 95.000 | COc1ccc(NC(NC(=O)c2ccco2)C(=O)c2ccc(C)cc2)cc1 | 10mg | 480151912
N-[1-[(4-Methoxyphenyl)amino]-2-(4-methylphenyl)-2-oxoethyl]-2-furancarboxamide | Oakwood Chemicals | 425645-37-0 | MFCD01457647 | 364.401 | C21H20N2O4 | 95.000 | COc1ccc(NC(NC(=O)c2ccco2)C(=O)c2ccc(C)cc2)cc1 | 10mg | 480151912
Medchemexpress LLC N- 4-Methoxyphenyl m 500mg
N-(4-Methoxyphenyl)maleimide (N-(p-Methoxyphenyl)maleimide) is a compound that can copolymerize with Ethyl acrylate[1][2]
eMolecules 100960-68-7 | ChemScene | 4-Chloro-2-methoxybenzonitrile | 1g | 572194458 | CS-0115635 | MFCD09865166 | 167.59 | C8H6ClNO
Ambeed | 7-Methylpyrazolo[15-a]pyrimidine-3-carboxylic acid | 100mg | 600837410 | A318899 | 1016505-59-1 | MFCD09806068 | 177.163 | C8H7N3O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool