Methoxybenzoic acids and derivatives
eMolecules 1192813-64-1 | 2-Chloro-5-(difluoromethoxy)pyrimidine | Ambeed | MFCD18415615 | 180.540 | C5H3ClF2N2O | 95.000 | FC(F)Oc1cnc(Cl)nc1 | 5g | 570998306
2-Chloro-5-(difluoromethoxy)pyrimidine | Ambeed | 1192813-64-1 | MFCD18415615 | 180.540 | C5H3ClF2N2O | 95.000 | FC(F)Oc1cnc(Cl)nc1 | 5g | 570998306
eMolecules 725253-07-6 | (4-Chloro-phenyl)-(4-methoxy-phenylamino)-acetic acid | Oakwood Chemical | MFCD04116986 | 291.730 | C15H14ClNO3 | 0.000 | COc1ccc(NC(C(O)=O)c2ccc(Cl)cc2)cc1 | 1g | 537678756
(4-Chloro-phenyl)-(4-methoxy-phenylamino)-acetic acid | Oakwood Chemical | 725253-07-6 | MFCD04116986 | 291.730 | C15H14ClNO3 | 0.000 | COc1ccc(NC(C(O)=O)c2ccc(Cl)cc2)cc1 | 1g | 537678756
eMolecules 586-38-9 | 3-Methoxybenzoic acid | Ambeed | MFCD00002499 | 152.149 | C8H8O3 | 98 | COc1cccc(c1)C(O)=O | 25g | 490514643
3-Methoxybenzoic acid | Ambeed | 586-38-9 | MFCD00002499 | 152.149 | C8H8O3 | 98.000 | COc1cccc(c1)C(O)=O | 25g | 490514643
eMolecules 66644-80-2 | 2,3-Dimethoxy-5-sulfamoylbenzoic acid | Combi-Blocks | MFCD01317561 | 261.250 | C9H11NO6S | 98.000 | COc1cc(cc(C(O)=O)c1OC)S(N)(=O)=O | 5g | 117536374
2,3-Dimethoxy-5-sulfamoylbenzoic acid | Combi-Blocks | 66644-80-2 | MFCD01317561 | 261.250 | C9H11NO6S | 98.000 | COc1cc(cc(C(O)=O)c1OC)S(N)(=O)=O | 5g | 117536374
Matrix Scientific Methyl 4-(bromomethyl)-3-methoxybenzoate, 70264-94-7, MFCD00270115, 5g
Molecular Formula C10H11BrO3, Molecular Weight 259.11, Melting Point 87-89°
Accela Chembio Inc 3-methoxy-4-methylbenzoic Acid | 100g | 7151-68-0 | MFCD00002566 | 98% | Shelf Life: 1980 Days | Regular
3-methoxy-4-methylbenzoic Acid | 100g | 7151-68-0 | MFCD00002566 | 98% | Shelf Life: 1980 Days | Regular
Accela Chembio Inc Ethyl Vanillate | 100g | 617-05-0 | MFCD00017269 | 97+% | Shelf Life: 1260 Days | Regular
Ethyl Vanillate | 100g | 617-05-0 | MFCD00017269 | 97+% | Shelf Life: 1260 Days | Regular
Apexbio Technology LLC 1-Methoxy PMS(Synonyms: 1-Methoxyphenazine methosulfate, 1-Methoxy PMS, Methoxyphenazine methosulfate, MPMS), 200mg, CAS: 65162-13-2.
1-Methoxy PMS (CAS 65162-13-2) is a redox-active small molecule utilized as an electron transfer mediator in biochemical assays Acting at the interface between NAD(P)H and tetrazolium salts 1-Methoxy PMS facilitates the controlled generation of reactive oxygen species (ROS) thereby modulating oxidative stress conditions Due to its ability to regulate cellular redox balance it is widely employed in research exploring oxidative signaling pathways ROS-mediated cellular responses and related pathophysiological processes
Chem-Impex International, Inc. 4-Methoxy-2-methyl-benzoic acid methyl ester | 35598-05-1 | MFCD06203918 | 5G
4-Methoxy-2-methyl-benzoic acid methyl ester, 35598-05-1, MFCD06203918, 5G